This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
Express as a rational number in the form of P/q 1.63 |
| Answer» | |
| 2. |
Find the sale of the polynomial 51-46673afe24 |
|
Answer» Step-by-step explanation: X device 102 eushehhnsdb to have eu SOU KU i and he SAID that he had to have a |
|
| 5. |
Multiply 6/13 by the reciprocal of -7/13 |
|
Answer» -6/7 Step-by-step EXPLANATION:
|
|
| 6. |
Let the relation R be defined in N by �� if 2� + 3� = 20. Then = . |
|
Answer» Answer: then �=4 Step-by-step EXPLANATION: |
|
| 7. |
Construct angle AOB =60 degrees mark a point p equidistant from OA and OB such that it's distance from another given line CD is 2.5cm |
|
Answer» xgyf hmm j t bn g Step-by-step EXPLANATION: vbnbm hnn bb y h g j j j |
|
| 8. |
2sin2 3π4+ 2cos2 π4 +2sec2 π3= |
|
Answer» Step-by-step EXPLANATION: this is your ANSWER okkkkkkkkkkkkkkkkk |
|
| 9. |
Is 1/2 a reciprocal of 2/1 ?????? |
|
Answer» yes Step-by-step EXPLANATION: RECIPROCAL of 2/1 is 1/2 |
|
| 10. |
Angle AOB is equal to 38 degree, OA is produced to C, OP bisects angle BOC,. calculate angle AOP |
|
Answer» Step-by-step explanation: 19 degree will be the answer as a bisector ALWAYS DIVIDES 2 angle EQUALLY . |
|
| 11. |
2.5 + 2 is equal to |
|
Answer» 4.50 is your answer........... Step-by-step EXPLANATION: |
|
| 13. |
Give detailed solution. |
|
Answer» can't be determined Step-by-step EXPLANATION: in the GIVEN question there is not given any relation with K to anyone... so how can I IDENTIFY it |
|
| 14. |
1 polQ. What is the top color in a rainbow?BlueORedO Purple |
|
Answer» Step-by-step explanation: The colors of a rainbow ALWAYS appear in the same order, which is, from top to bottom: red, orange, YELLOW, green, blue, indigo, and purple. |
|
| 16. |
সবচেয়ে ছোটো কোন সংখ্যা ৫ ও৬ দ্বারা বিভাজ্য |
|
Answer» it is very simple Step-by-step EXPLANATION: সবচেয়ে ছোটো ৩,৫ সংখ্যা ৫ও৬ দ্বারা বিভাজ্য |
|
| 17. |
Simplify.root 121²minus root 81² |
|
Answer» Answer: 2)..squar root 9 Step-by-step explanation: |
|
| 18. |
3\8 + 5\8 is equal to |
|
Answer» 3/8+5/8=3+5/8 =8/8 =1 plzz MARK BRAINLIEST answer.... |
|
| 19. |
Find the missing value? Base= ?Height = 8•4 cmArea of Triangle = 48•72 cm² |
|
Answer» 1/2×base×height = 48.72 1/2×base×8.4 = 48.72 base = 11.6 CM |
|
| 20. |
Bacchanalia in telgu |
|
Answer» బచ్చనాలియా Baccanāliyā Step-by-step EXPLANATION: |
|
| 21. |
As if them are 70 oranges in a basketbow will you write the total number of manges in terms of theThe principal distributes 2 copies per cadent. Can you tell how many copies are needed puen thein the given for the long and breath of a rectangle are shown bland respective Express the| 7 හා 37addedsome thind of sum of pandaThe quiet op and added to the products of pandetaken away from the sum of pandapabei less than cubes7x*y*:17********** 15 dnes105************dom each of the following in the deform:521 abans7s |
|
Answer» भमणयणबमममयय Step-by-step EXPLANATION: भतझझदयथमयक्ष ज्ञयथलल यरललवधम ढणझझध यतथदध़णत यरथललललभमय ऋयलधध़ यरलढघ |
|
| 22. |
Which of the following is the value of the discriminant for 2 x²+ 5√3 x +6=0 |
|
Answer» Answer: a = 2 b = 5√3 c = 6 |
|
| 23. |
In figure seg AC and seg BD intersect each other in point P and AP/CP=BP/DP.Prove that , ∆ABP ~ ∆CDP |
|
Answer» In GIVEN ∆ACP & ∆BDP AP/CP = BP/DP Angle BPA =angle DPC. (OPPOSITE angle) from S.A.S similarity ∆ABP ~ ∆CDP proved... |
|
| 24. |
5. Subtract the first polynomial from the secondpolynomial (c) – 8ab, 6ab |
|
Answer» Answer: 6ab-(-8AB) 6ab+8ab 14ab |
|
| 25. |
(d)Number of match sticks required =Number of arrows required8Number of circles requiredNumber of match sticks required2 fat if there are 70 oranges in a basket. how will you write the total number of oranges in terms of thenumber of baskets? Use n for the number of baskets)(b) The principal distributes 2 copies per student. Can you tell how many copies are needed given thenumber of students ?{use n for the number of students)in the given figure, the length and breadth of a rectangle are shown by and b respectively. Express theperimeter of the rectangle using and b.Write the following in numbers, variables and son of fundamental operational 7 added to(b) multiplied by 10de multipled by - 10d) 9 subtracted fromle one third of sum of p and a0 The quotient op ad q added to the product of pandataken away from the sum of pand oth) p minus thacesum of and the quatient of y by ?pubed less than y cubedWrite each of the following in the exponential form: |
|
Answer» but this a CHAPTER who can we answer |
|
| 26. |
Plzz give the correct ans only |
|
Answer» your answer is C) Step-by-step EXPLANATION: |
|
| 27. |
Find the value of x and y for following pair of linear equations x+y=5,x-y=1 |
|
Answer» In ATTACHMENT |
|
| 28. |
Find the value of a and b in 3/√3-√2 = a√3-b√2 |
|
Answer» Answer: 3/sqrt3-sqrt2 ×sqrt3+sqrt2/sqrt3+sqrt2=asqrt3-bsqrt2 since by RATIONALIZING the denominator 3(sqrt3+sqrt2)=asqrt3-bsqrt2 3sqrt3-(-3)sqrt2=asqrt3-bsqrt2 |
|
| 29. |
65. fortranslates to13 The GCD of12 (5x2 +6x)and8.73translates to72.0is1Mtranslates to14.x (2-2)slates to a22x (x - 3)Opositive intepositwhich divideslively), the34x (x + 3)C44x (x - 3) |
|
Answer» SORRY BRO I DON'T UNDERSTAND THE QUESTION PLEASE MARK ME AS BRAINLIST |
|
| 30. |
O is rational or irrational |
|
Answer» ➤0 is neither RATIONAL or irrational number because it is not in the form of p/q. ➤➤0 is a whole number as whole number starts from 0 to infinity... ---->>>>>>Here is your answer<<<<-------- HOPE IT HELPS YOU.. _____________________ Thankyou:) |
|
| 31. |
The number of polynomials 1 pointhaving zeros, 1 and -2 isMore than 3OO2O 3Clear selection |
Answer» I THINK it's out of my MIND |
|
| 32. |
In property of A union empty set=? |
|
Answer» A Step-by-step EXPLANATION: ..................... |
|
| 33. |
If tan theta tan 40degree =1 , find the value of theta. |
|
Answer» Answer: Theta=50 degrees Then TAN 50*tan40=1 Tan 50=tan(90-40)=cot40 Cot 40*tan40=1 Step-by-step explanation: |
|
| 35. |
2.The numerator of a fraction is 15 less than the denominator,and the fraction is equal to 4/7.Find the fraction |
| Answer» | |
| 36. |
WritePPF eguation Forand FridayRobinsoncrusoe |
|
Answer» GOOD AFTERNOON MAN fufixicicicicicjcucucucucuc Step-by-step EXPLANATION: nvivjcjxgzyfiDucjzricyxichpt hixihuigyy |
|
| 37. |
() If d (A,B)=5, dCB,C)-2, (A,C) = 3 thanwhich of the following options is true?Anbi |
|
Answer» utyhtd g hjjgghffjgktipgjkgxfjzgjcxgjxjxfjxgfhf rydtdyft the REST of the rest of the rest of the rest t SHIRT and |
|
| 38. |
Find the remainder when 2145123 is divided by 6 |
|
Answer» Step-by-step explanation: NHI aata kya divide kro and JO REMAINDER AAYEGA likho. doubt ho to MASSAGE me |
|
| 39. |
If sin135-cos240/sin135+xos240=a+rootb then b= |
|
Answer» SIN(90+45)-COS(180+60)/sin(90+45)+cos(180+60) =COS45-[-COS60]/cos45+(-cos60) =(1/√2)-(-1/2)/(1/√2)+(-1/2) =(1/√2)+(1/2)/(1/√2)-(1/2) =1/√2+1/√2-1/2 =-1/2+√2 |
|
| 40. |
The product of two number is 88,400 one number is 100 . Find the other number |
|
Answer» Step-by-step EXPLANATION: PLEASE MARK has BRAINLIEST ANSWER (❁´◡`❁)(♥_♥)(❁´◡`❁)(♥_♥)(❁´◡`❁)(♥_♥) |
|
| 41. |
2+√3 / 2-√3 + 2-√3 / 2+√3 = |
|
Answer» ---->>>>>>Here is your ANSWER<<<<-------- ❱ ❱ ❱ see in the PICTURE above attach for complete solution STEP by step:- HOPE IT HELPS YOU.. _____________________ Thankyou:) |
|
| 42. |
Express 2.57 in the form of P/Q wher p and q are integers q=0 |
|
Answer» Answer: Step-by-step explanation: 2.57 can be WRITTEN as 257/100. This is the required p/q form. |
|
| 43. |
Please give the detailed solution of the question answer-5.0 |
|
Answer» Answer: answer 6.0 Step-by-step explanation: first we will solve the point values as in first figure its .50and in SECOND figure its .25. (difference of .25) ;; the point VALUE in third figure will be 0 ( Difference of 0.25) hmko lagta h KI answer 6.0 h kyunki 2+5=7 in first figure 6+5=11 in second figure and it will again be same as that in figure first i.e,, 2+4 =6. HENCE 6.0 is the answer |
|
| 45. |
Find the product, using suitable properties: 2 into(-48) +(-48) into(-36) |
|
Answer» -6912 Step-by-step EXPLANATION: -48+-48= -96 96*2=192 192*36= -6912 |
|
| 46. |
Is the baby being suckled vby mother change to voice |
|
Answer» The mother VBY being sucked by the baby? hope it's HELPFUL. |
|
| 47. |
Write a brief note on national jute policy |
|
Answer» In 2005, National Jute Policy was formulated with the objective of increasing productivity, improving quality, ensuring good prices to the jute farmers and enhancing the yield per hectare. The main markets are U.S.A., Canada, Russia, UNITED Arab Republic, U.K. and Australia.The National COMMON Minimum Programme (NCMP) of the Government, recognizing the IMPORTANCE of jute to farmers and workers, and to the economy of jute growing states, and its special ecological importance world-wide, resolved that "the jute industry will receive a fresh impetus in all RESPECTS". |
|
| 48. |
An inorganie salt on analysis gave the following percentage composition : Pb 62.6, N = 8.4 = 29 O = 29. What is empirical formula of the compound ? Also name the compound. |
|
Answer» Step-by-step explanation: atoms of Pb : N : O = 62.6/207 : 8.4/14 : 29/16 =0.30 : 0.6 : 1.8 = 1: 2 :6. HENCE the EMPIRICAL formula is PbN2O6. |
|
| 49. |
Which of the following equations have infinitely many solutions? Choose all answers that apply: A. −10x−10=−10x−10 B. 10x−10=−10x+10 C. 10x−10=−10x−10 D. −10x−10=−10x+10 |
|
Answer» Step-by-step explanation: Its ANSWER is A because you can PUT many values at the PLACE of x and get many DIFFERENT values of SOLUTION. |
|
| 50. |
1 pointQ. The pair of equations x=0and x=3 has ,,O No solutionInfinitely may solutionsTwo solutionsOOne solution |
|
Answer» TWO SOLUTIONS |
|