This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
Can limiting molar conductivity equal to negative, and why yes/no |
|
Answer» NoExplanation:Limiting molar conductivity cannot be negative... conductivity is BASICALLY the electricity conducted. in case of solution, ions move in solution to conduct electricity. WHEREAS, in metal, electrons move to conduct electricity. For SOLUTIONS, as ions increase, conductance ALSO increases.Negative value of molar conductivity would not MAKE any sense. |
|
| 2. |
Give reason why a finely divided Substance ismore effective as an adsorbent. |
|
Answer» yxyfiyyotuldofi6do6do6sifo6i5so5do6do6d6odo6d6od6odo7doyoydoydoykyfoydffiyiyitsiydiy |
|
| 3. |
Provide analysis and synthesis of 2 phenyl 2 butanol |
| Answer» TION:Step 1: Ba(s) + 2C6H5CH2OH Ba2+ + 2CHCHO652- + H 2 Step 2: H O Ti (Oi O H + ... On the other hand, the retro-synthetical ANALYSIS of 4-phenyl-2-butanol provides a MECHANISTIC ...Mark as BRAINLIST | |
| 4. |
What is the most important application of de Broglie concept? no spamming please... |
|
Answer» the most important APPLICATION of de-Broglie concept? Its most important use is in the CONSTRUCTION of electron microscope which is used in the MEASUREMENT of objects of very SMALL size. |
|
| 5. |
"Fe+O2+H2O=Fe2 O3".But where is Hydrogen in the product? |
| Answer» | |
| 6. |
✊What is the significance of Henry's Law constant K...✌️ |
| Answer» HENRY's Law COSTANT (KH) helps in comparing the relative SOLUBILITIES of different gases in the same solvent (e.g. water). In general, lesser the value of KH, more is the sololubility of a gas...Please MARK me brainliest... | |
| 8. |
Why nitric acid is not used to prepare hydrogen gas |
|
Answer» Explanation:Nitric Acid is a very STRONG oxidizing agent. It oxidizes the Dihydrogen Gas produced during the REACTION with metals to Water. That is why Nitric Acid cannot be used for the preparation of HYDROGEN gas. However, metals LIKE Magnesium and Manganese still produce Hydrogen Gas but with very dilute nitric acid. Only 1% dilute and cold nitric acid reacts with magnesium and manganese to liberate Hydrogen gas. |
|
| 9. |
Explain, how do oxidation and reduction processes occur simultaneously. pls provide 4-5lines no spamm |
|
Answer» IN A REACTION EX H2O ±FE ≈FE2O3 ±H2IN THIS REACTION 1ST OXYGEN IS REMOVE REMOVEL OF OXYGEN IS CALLED REDUCTION AND THEN OXYGEN IS ADDED ADDING OF OXYGEN IS CALLED OXIDATIONExplanation: |
|
| 10. |
Does a chemical equation predict the feasibility of reaction yes or no |
|
Answer» tion:YES. Because the FEASIBILITY of the reaction is identified by 2 factors. If there's REDOX reactions the Emf VALUE (positive) DECIDES feasibility of the reaction.So,by writing a chemical equation feasibility can't be identified. |
|
| 11. |
Magnetic iron oxide formula is Fe3O4... where Fe=2+ and O= 2-. Give Reason. |
| Answer» TION:Because FE is metal and O is non metal.Fe is positively CHARGED and O is NEGATIVELY charged. | |
| 12. |
What is plaster of paris? How is it prepared? Give it's important uses? |
| Answer» PREPARED by heating gypsum to 120–130°C. Uses of plaster of Paris: ... (ii) Used for making patient plasters used in surgery and for plastering fractured parts of the body. (iii) MIXED with alum, it is used as a CEMENT in ornamental CASTING and for making moulds in pottery work.Mark me as BRAINLIEST | |
| 13. |
What is the empirical formula for C8H8O4 |
| Answer» EXPLANATION:EMPIRICAL FORMULA: C2H2O | |
| 14. |
Sodium oxide (Na2O) में sodium (Na) की उपसहसंयोजन संख्या कितनी है |
|
Answer» The co-orination number of Na in Na 2O is 4. Na + ion is sorrounded by FOUR OXIDE IONS whereas O 2−ion is sorrounded by eight Na + ions. THUS, the coordination number of Na is 4. |
|
| 15. |
What will be the pH value of NaOH? |
|
Answer» tion:Using a pH indicator strip will tell you that NAOH ( SODIUM HYDROXIDE) is a strong ALKALINE. |
|
| 16. |
Compound X Jeduction with LiAhu given a hyvide y' Containing21.42% hydrogen along with otherProducts. The compound Y reactswith airexpot explosively resulting in bogohtriaxide. Identiay x and Y. Crivebalanced reactions involved in thebormation ob Y and its reaction withair Draw the structure copyof Y. ? |
|
Answer» Determination of the MOLECULAR formula and STRUCTURE of compound: SINCE the hydridereacts with air forming boron trioxide, thereforemust be hydride of boron. Given :. Hence,ANDARE PRESENT in the ratioSimplest boron hydride corresponding to this ratio is. Hence,is diborane |
|
| 17. |
Answer it if you are a real genius |
|
Answer» R ELEMENT X i. Atomic number - 17 since no. of protons = atomic number of element ii. Mass number - 35 since mass number = no. of protons + no. of neutrons = 17 + 18 = 35FOR ELEMENT Y (same EXPLANATION as above) i. Atomic number - 17 ii. Mass number - 37The atomic species are RELATED as they have the same atomic number.Element X and Y represent Chlorine (as Cl atomic number is 17)10B) given, (E.C) Electronic configuration - 2,8,7 therefore, no. of electrons = 2+8+7 = 17 i. Atomic number = 17 since no. of protons = no. of electrons = 17 ii. A valence electron is the number of electrons found in the last shell of an element. The valence electron of the given element is 7Let's check which element has the same number of valence electrons by checking E.C (electronic configuration) of eachEC of Nitrogen (N) - 2,5EC of Fluorine (F) - 2,7EC of PHOSPHORUS (P) - 2,8,4EC of Argon (Ar) - 2,8,8So, only Fluorine (F) has the same number of valence electrons, 7I really HOPE this helped you out! I spent a lot of time typing all the explanations. Stay safe and gave a nice day! |
|
| 18. |
Sodium oxide (Na2O) में sodium (Na) की कोआडिनेशन संख्या कितनी है |
| Answer» FOUR na+ions are having in the OXIDES | |
| 19. |
0.04 gm of My on treatment with dilute H2so4 give 42 ml of hydrogen collected at 100.88kpa and 27°c |
| Answer» | |
| 20. |
Calculate no. Of atom present in 32 gram of So2 |
|
Answer» number of atoms are 3.01 * 10^23Explanation:as the weight of SO2 is 32 + 16*2 = 64thus 64 g = 6.02 * 10^23 atomsso 32 g = 32 * 6.02*10^23 / 64so 32g CONSTITUTES to 3.01*10^23 atoms |
|
| 21. |
An unknown element forms an oxide. what will be the equivalent weight of the element if the oxygen content is 20% by weight ? |
|
Answer» 32Explanation:Given that, OXYGEN CONTENTS in ELEMENT oxide is 20% by weight. Hence, element contents in element oxide is 8% by weight. Then, equivalent weight of unknown element = 80/20x8=32∴ Equivalent weight of unknown element = 32 hope you LIKE. marks as brilliantest. |
|
| 22. |
Pls answer it first |
|
Answer» tion:you can find out the SOLUTION in INTERNET there U GOT your correct answer |
|
| 23. |
Why magnetic iron oxide has formula fe3O4. Give Reason |
|
Answer» because this formula indicates the magnet region as the magnet attached to the iron oxide and it's LATIN word is FE (ferrum) and oxide formula is 304 so uri iron oxide with formula{fe304} MARK me as brainliest and follow me pleasecpagarwal1960 Regards RIYA Agarwal |
|
| 24. |
I want all the formulas of ch solutions from chemistry of class 12 after Henry's law |
|
Answer» you can SEARCH on doubhtnut it is APP on PLAY storehope that this will helphave a GREAT DAY |
|
| 25. |
Why third ionisation energy of fe is lower than Mn |
|
Answer» electron that will be lost from MN will be from the half filled 4s1 orbital but in CASE of Iron it will be lost from a much more STABLE 4s2 orbital hence it requires a little BIT more amount of energy. Therefore the Second ionization potential/energy for iron is greater than that of Manganese (Mn). |
|
| 26. |
Assertion: on electrolysis of water hydrogen gas is produced at cathode and Oxygen gas at anode. Reason: water molecule has hydrogen and oxygen present in the ratio 2 : 1 by volume. |
|
Answer» assertion and reason both are CORRECT but reason is correct for assertion.Explanation:the reason is becoz HYDROGEN is POSITIVELY CHARGED and oxygen is negatively charged. |
|
| 27. |
What do you observe in the spectrum of NaCl?no spamming please... |
|
Answer» In the spectrum of NACL, the solubility of the NaCl increases, which ranges between 300–700 nmmark me as BRAINLIEST PLZ..... |
|
| 28. |
Which of the following is likely to undergo racemization during alkalineini.hydrolysis?CHCICH-CH-CHC1(1)(II)(III)CHCH-CHCHCl(IV)b. Only IId. Only IVa. Only Ic. II and IV |
|
Answer» d is 100% CORRECT EXPLANATION:If you LIKE please mark me brainliest |
|
| 29. |
Its urgent fast........ |
|
Answer» 1. 3.36×105KJ2. 2260 KJ/Kg3.bulk4. LIQUID, volume5. liquid state, solid statePlease mark as BRAINLIEST ANSWER if you THINK that my answer is RIGHT |
|
| 30. |
The colour of blue litmus in dry Hcl gas will be ________ |
|
Answer» hey MATE UR answer is that it will REMAIN the same Explanation:because to turn litmus paper blue to red it NEED moisture i hope it will help u mark it as brainliest answer follow me |
|
| 31. |
CH-CH=CH HIperoxideThe major product of the abovereaction is,22.a. I-CH-CH=CHc. CH-CH-CH,b. CH-CH-CH,d. CH-CH-CH,OHدیا2.I |
|
Answer» or PRODUCT of the ABOVEREACTION is,I-CH-CH=CH |
|
| 32. |
Which of the followings can replace Ag from AgNo3 solutions |
|
Answer» The metals which LIE above in the series of Silver are Magnesium, Zinc and GOLD. THUS, these metals will easily REPLACE silver from its reaction. |
|
| 33. |
How is the supply of drinking water purified in a city and reached to our houses? |
|
Answer» tion:A water supply SYSTEM TYPICALLY INCLUDES: A drainage basin (see water PURIFICATION - sources of DRINKING water. |
|
| 34. |
What do you understand by kinetic energy of molecules |
|
Answer» Molecular Theory STATES that GAS particles are in constant motion and exhibit PERFECTLY elastic COLLISIONS . |
|
| 35. |
Which of the following metal will change the blue colour of copper sulphate solution ?? silver, mg, pt, zn (two of these are correct answers) |
| Answer» MAGNESIUM and ZINC HOPE it HELPS you | |
| 36. |
1. One mole of each of the following compounds is burnt in excess oxygen. Which compound will producethree moles of carbon dioxide and three moles of steamonly?a. C3H8b. C3H7OHC. C3H7CO2Hd. CH3CO2CH3 |
| Answer» TION:ANWER will be C...C3H7CO2H this will be the ANSWER | |
| 37. |
On what chemical is balancing of chemical equation based. |
|
Answer» Explanation:Principle of Atom ConservationState the law on which a balanced chemical equation is based. BALANCING of a Chemical equation is based on the Principle of Atom Conservation (POAC) which states that the TOTAL NUMBER of atoms of each ELEMENT in reactants must equal the number of atoms of that element in products.HOPE IT HELPS YOU..PLEASE MARK BRAINLIEST.. |
|
| 38. |
The number of moles of oxygen in 1 L of air containing 21% oxygen by volume, in standard conditions, is: |
|
Answer» 0.0094Explanation:At standard CONDITIONS, 1 liter of air at 21% OXYGEN possesses 0.21 L of oxygen. Since at STP 1 mole of gas occupies 22.4 L, simply divide 0.21/22.4, to ARRIVE at 0.0094 moles of oxygen. |
|
| 39. |
Examples of electrolytic reaction |
|
Answer» hope you helped Explanation:Electrolytic decomposition may result when electric current is PASSED through an AQUEOUS solution of a compound. A good example is the ELECTROLYSIS of WATER. ... Decomposition of sodium chloride:On passing ELECTRICITY through molten sodium chloride, it decomposes into sodium and chlorine. |
|
| 41. |
How vapour pressure lowering is related to a rise in boiling point of solution? |
| Answer» HOPE it will HELP you DUDE..... | |
| 42. |
Polyester is made from .............. Products. |
| Answer» R ▼ POLYESTER is MADE from chemical products .{ ✓ verified ANSWER } | |
| 43. |
Elements A, B, C and D have atomic numbers 11, 8, 1 and 17 respectively. Give the chemical formulae of the compound formed between (a) A and D (b) B and C |
|
Answer» mic number of three elements A, B, C are 11,14 and 17 respectively. STATE the GROUP of which these elements belongs in the m9dern periodic table. Write the formula of the COMPOUND formed when the element B reacts with C |
|
| 44. |
Nylon is prepared from simple Chemicals obtained from............ |
|
Answer» Nylon is made when the appropriate monomers (the chemical building blocks which make up polymers) are COMBINED to form a long chain via a condensation polymerisation reaction. The monomers for nylon 6-6 are adipic ACID and hexamethylene DIAMINE. ... The polymer has to be warmed and drawn out to form STRONG fibres.Explanation:FOLLOW me mark as brainest |
|
| 45. |
Convert the following into kelvine (1) 80 degree Celsius |
| Answer» 353.15 K ≡ 353 KExplanation:80°C+273.15=353.15 KThus, 80°C=353.15 KTO convert °C into K, always add 273 to the given temperature (or more precisely, 273.15)Thank you!Hope it HELPS! | |
| 46. |
What is the approximate most possible velocity of oxygen? If the kinetic energyof one mole of oxygen is3741. 3j |
| Answer» EXPLANATION:What is the approximate most POSSIBLE VELOCITY of oxygen? If the kinetic ENERGYOF one mole of oxygen is3741. 3… Get the ANSWERS you need, ... | |
| 47. |
What is meant by the term "atomicity of a molecule"? |
|
Answer» ty is the total number of atoms PRESENT in one MOLECULE of an ELEMENT, COMPOUND or a substance |
|
| 48. |
Why polar covalent compound can act as electrolyte? |
|
Answer» nduct very well because they provide a plentiful supply of IONS in SOLUTION. Some polar COVALENT COMPOUNDS are also strongelectrolytes. COMMON examples are HCl, HBr, HI and H2SO4, all of which react with H2O to form large concentrations of ions. |
|
| 49. |
5. How is molecular motion related with temperature ? |
|
Answer» Temperature is a measure of the average heat or thermal energy of the molecules in a SUBSTANCE. The atoms and molecules in a substance do not always travel at the same SPEED. The relationship between molecular motion and temperature is that the HIGHER the molecular motion,the higher the temperature is measure of the average heat or thermal energy of the molecules in a substance do not always travel at the same speedExplanation:please mark as brainliest ANSWERAND FOLLOW me plzzzzzz |
|
| 50. |
Name the source of synthetic polymer. |
|
Answer» List of synthetic polymers. Synthetic polymers are human-made polymers derived from petroleum oil. From the UTILITY point of view they can be classified into THREE main categories: thermoplastics, elastomers and synthetic fibers. They are found commonly in a variety of consumer PRODUCTS such as HONEY, glue, etc.Explanation: |
|