This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
3.ધરા અવસ્થામા d3 આયન માટે કવોન્ટમ આંક J આપો.Give quantum number J for d3 ion in ground state.A. 9/2B. 5/2C. 3/2D. 6/2 |
|
Answer» A. 9/2 mark me as BRAINLIEST.. |
|
| 2. |
5 write electronicconfigenation af electronicconfignation of elements of group 18. |
|
Answer» Answer: |
|
| 3. |
સંક્રાંતિ આયનો અને તેના સંયોજનો શા માટે રંગીન હોય છે?(A) ઓકિસીડેશનને કારણો(B) રિડક્ષનને કારણો(C) ઉદ્દીપકને કારણો(D) સ્તૂરાને કારણોWhy transition ions and their compounds are coloured?(A) Due to oxidation(B) Due to reduction(C) Due to catalyst(D) Due to indicatorછે ? |
|
Answer» mxndhdbsvsnskxhsbsbsmsidejhdgsnsksjsnjdhd |
|
| 4. |
Hydrogen is absorbed by heated palladium true or false |
|
Answer» TRUE Explanation: |
|
| 5. |
With suitable examples explain different reasons why benzene show electrophilic substitution rather than addition reaction |
|
Answer» Explanation: Benzene is a planar molecule having delocalized the plane of the ring. HENCE, it is electron-rich. as a RESULT, it is highly attractive to El ctron-deficient SPECIES i.e.., electrophiles. |
|
| 6. |
Calculate the amount of oxalic acid required to obtain 0.05 ml of semimolar solution? Given molarity 0.5 M |
|
Answer» VOLUME of solution REQUIRED= 0.05 ml => 0.05/1000 litres => 0.00005 litres molarity = 0.5 M let number of moles of H2C2O4 required be x. molarity = (moles of solute)/itres of solution 0.5=x/0.00005 x= 0.000025 moles of Oxalic ACID Molar mass of H2C2O4 = 2X1 + 2X12 + 4X16 => 90 grams per mole. So, mass of H2C2O4 required = 90 X 0.000025 => 0.00225 grams So, 0.00225 grams of anhydrous oxalic acid will be required. Please mark as brainliest, if this was helpful. |
|
| 7. |
Calculate the degree of dissociation of pcl5 if the vapour density at the give temperature is 70. |
|
Answer» Answer: The molar mass PCl 3
is 137.33 g/mol The molar mass CL 2
is 70.6 g/mol INITIAL molar mass 2× initial vapour density =2×104.16=208.32g/mol Final molar mass =2× final vapour density =2×62=124g/mol 5
present initially, X mole dissociates to form x mole of PCl 3
and x mole of Cl 2
The molar mass of final mixture =124= 1−x+x+x 208.32(1−x)+137.33x+70.6x
124= 1+x 208.32(1−x)+(137.33+70.6)x
124= 1+x 208.32(1−x+x)
124= 1+x 208.32
1+x= 124 208.32
=1.68 x=1.68−1=0.68 The degree of dissociation of PCl 5
at 230 ∘ C is 1 0.68
=0.68 or 68 %. Explanation: 68/ |
|
| 8. |
Wok Share@ What is the relation ship between an atomand an element ? |
|
Answer» Explanation: An atom is the PART of an element. A particular element is composed of only one TYPE of atom. Atoms are further composed of SUBATOMIC particles CALLED electrons, protons and neutrons. ELEMENTS can combine with each other to form molecules via chemical reaction. keep smiling ☺️ |
|
| 9. |
Ni ધાતુની ચલાયમાન સંયોજકતા જણાવો.(A) + 2 થી +5(B) +2 થી +4(C) +1 થી +6(D) + 1 થી +3Mention variable valencies of Ni metal.(A) +2 to + 5(B) +2 to +4(C) + 1 to + 6(D) +1 to +3 |
| Answer» | |
| 10. |
Why Siberian plains of Asia are marshy ? Give reasons . |
|
Answer» Answer: Large parts of the northern lowland of Asia are MARSHY because these are drained by three RIVERS, YENISEI, Ob and Lena. Further, the presence of several lakes has also made itswampy and marshy Explanation: HOPE IT HELPS YOU |
|
| 11. |
What is the relation Ship between an atomand element. |
|
Answer» An atom is the part of an element. A PARTICULAR element is composed of only one type of atom. Atoms are further composed of subatomic particles called electrons, PROTONS and neutrons. Elements can COMBINE with each other to form molecules via CHEMICAL reaction. Flw_Me! |
|
| 12. |
Explain the complexometric tiration.what is the role of EDTA and buffer in these titration? |
|
Answer» Answer: TYPES of COMPLEXOMETRIC titration The standard chelating agent solution is added to the metal ion solution until the end POINT is detected. In this method, metal ion is added to the SUITABLE buffer solution and appropriate INDICATOR solution and the resulting solution is titrated with the EDTA solution. |
|
| 13. |
what happens when chlorine is passed over slaked lime at 313k ? write chemical equation of the reaction involved and state two uses of the product obtained. |
|
Answer» Explanation: When chlorine is passed over SLAKED lime, Ca(OH)2, it is rapidly absorbed, forming bleaching powder, or CHLORIDE of lime. The reaction is: Ca(OH)2+ Cl2= CAOCL2+ H2O. may this be helpful to you DEAR. |
|
| 14. |
Thermal decomposition of sodium azide (NaN3) into nitrogen gas and sodium metal is used to inflate car airbags. The reaction proceeds by the following chemical reaction.2NaN3(s)⟶3N2(g)+2Na(s)How many grams of NaN3 are need to inflate a 10.00L airbag with nitrogen gas at 1.000atm and 273.15K assuming ideal gas behavior?Include 4 significant figures in your answer. |
|
Answer» Answer: AUTOMOTIVE AIR BAGS inflate when sodium azide, NaN3, rapidly decomposed into N2 and NA by the following reaction: 2 NaN3 --> 2 Na + 3 N2 |
|
| 15. |
1.Clalutae the molar mass of oxalic acid.(H=1,C=12,O=16)-1.-12.0-16) |
| Answer» | |
| 16. |
What is isotop and their solutions in the book |
|
Answer» ISOTOPE is defined as that have same atomic NUMBER but different mass number |
|
| 17. |
The effective nuclear charge experienced by an electron in the sub shell depends on the shielding faced by it due to inner electrons. Thus among given options, highest nuclear charge is experienced by 2p 3sub shell as it is nearest to nucleus among the given options. |
|
Answer» Answer: The shielding EFFECT explains why valence-shell electrons are more easily removed from the ATOM. The effect ALSO explains atomic size. The more shielding, the further the valence shell can spread out and the bigger ATOMS will be. The effective nuclear charge is the net positive charge experienced by valence electrons. MARK ME AS BRAINLIEST. |
|
| 18. |
Chemical formula is also called |
|
Answer» Answer: The simplest types of chemical formulae are called empirical formulas, which use letters and NUMBERS INDICATING the numerical proportions of atoms of each type. Molecular formulae INDICATE the simple numbers of each type of ATOM in a MOLECULE, with no information on structure. |
|
| 19. |
The reaction product of the reaction between C6H5NH2, CHCL3 and KOH are |
|
Answer» Phenyl ISOCYANIDE |
|
| 20. |
Q.15 Why carbon has a huge number of compounds ascompared to other elements.explain these properties pls give answer in short |
|
Answer» Answer: Carbon is the only element that can form so many different COMPOUNDS because each carbon atom can form four CHEMICAL bonds to other atoms and because the carbon atom is just the right, small SIZE to fit in comfortably as parts of very large molecules. This property is called the CATENATION. |
|
| 21. |
Why do we use copper as electrode in Electrolysis of CuSO4 ?[ any class X ICSE student here ] |
|
Answer» Answer: In the electrolysis of copper SULPHATE with copper electrodes, when the cations reach the cathode, each Cu2+ is able to REMOVE electrons to acquire a neutral charge and is deposited on the electrode. At the same time, the anions MOVE towards the anode and release their electrons to BECOME a SO4 radical. |
|
| 22. |
Determine the equivalent wight of copper by oxide method |
|
Answer» Answer: Copper will react with oxygen to form EITHER brick red CUPROUS oxide (copper(I) oxide, with 63.5 g of copper for 8 g of oxygen) or BLACK cupric oxide (copper(II) oxide, with 32.7 g of copper for 8 g of oxygen), and so has two equivalent weights. |
|
| 23. |
Identify nuclear fusion reactiona. 2H1+1H1 --- 3He2 b. 1H1+1H1 --- 2H1 + 0e1 c. 3H1 +1 H1 --- 3H 1 + 1p1 d. All reactions |
|
Answer» Answer: |
|
| 24. |
Choose the correct formula to find the number of electrons |
|
Answer» Multiply the element's ATOMIC number by the number of atoms of this TYPE (see Step 1) in the molecule. Repeat for all elements in the molecule, then add up all the products to calculate the number of electrons. Explanation: In the first example, the number of electrons in KNO3 equals (19 x 1) + (7 x 1) + (8 x 3) = 50 |
|
| 25. |
In a solution, 6g of urea and 9g of glucose are dissolved in 300g of water find the boiling point of solution(Kb of water=0.52k kg/mol |
|
Answer» Explanation: As we KNOW, ΔT
= M 2
1
1000K b
w 2
T b
−T b ∘
= 60×100 1000×0.52×0.6
T b
−373=0.052 T b
=373.052 |
|
| 26. |
How do I show that the fourth and fifth periodic table consists of 18 elements using the quantem mechanical model? |
|
Answer» Answer: |
|
| 27. |
Why thioglycolic acid is added to the limit test of iron ? |
|
Answer» Explanation: CITRIC acid HELPS PRECIPITATION of iron with AMMONIA by forming a complex with it the Thioglycolic acid helps OXIDES iron 2 to iron 3 |
|
| 29. |
Discuus the role women are tradionally expected to play |
|
Answer» Answer: traditionally a women is. supposed to be CONFINED in the four walls of a room. she should be a good mother and a wife. she should teach her CHILDREN PROPERLY , do the household chores efficiently . she is supposed to create an environment for her male partner to THINK more about the upliftment of the family economically .
|
|
| 30. |
Define speed as used in electromagnetic radiaton |
|
Answer» Answer: Generally speaking, we say that light travels in WAVES, and all electromagnetic radiation travels at the same speed which is about 3.0 * 108 meters PER second through a VACUUM. ... We call this the "speed of light"; nothing can move FASTER than the speed of light. Explanation: please mark as BRAINLIEST answer |
|
| 31. |
Which gas is used in refrigerator and cooling what effect does it have on human life? |
|
Answer» Gases used for refrigeration are not very HARMFUL. Are mainly halogenated compounds of methane (CH4). They are LESS toxic and less flammable than other COMMON gases that are not halogen like methane, ethane, or PROPANE that can do the same thing. |
|
| 32. |
Hi plz help me in this question ⁉️ I need right now |
|
Answer» euujenejjwkskekkkdjhehehebdbhddnjekoldebhejej I don't know |
|
| 33. |
What is the valency of ammonium carbonate |
|
Answer» |
|
| 34. |
Derive the expression for work done in isochoric processes |
|
Answer» Answer: I have a few questions I WOULD like to ask for a quick answer and a few questions REGARDING your WORK and what I NEED to know for the most POPULAR web |
|
| 35. |
Functional GroupsClassify each of the organic compounds below as on alcohol, carboxylic acid, aldehyde, ketone, ether orester, and draw its structural formula1CH3COOH6CH,CH(OH)CHacid-C-OH11O2.CH3COCH37.CH3CH2COOHН4 KetoneH-C-C-C-H111HOHCH3CH2OHalcoholH7H-C - - OH1H. H3.DOCH3CH2COOCH34.CH, CH2OCH9.CH,CH, COCH5.CH3CH2CHO10.CH3OCH3 |
|
Answer» Answer: 1111111111111111111111111111111222233321111111 |
|
| 36. |
How do you determine sulphur, Phosphorous are determined quantitiatively in an organic compound ? |
Answer» ■ Estimation of sulphur :-A known mass of organic compound is heated with sodium peroxide or fuming nitric acid in a Carius tube. If sulphur is PRESENT it is oxidised to sulphuric acid. The acid is precipitated as barium sulphate by adding excess of barium chloride aqueous SOLUTION. The PRECIPITATE is filtered, washed, dried and weighed. ■ Estimation of PHOSPHORUS :-A known mass of organic compound is heated with fumic nitric acid in Carius tube. Phosphorus is oxidised to phosphoric acid. The acid is precipitated as ammonium phosphomolybdate Sometimes, the Phosphoric acid is precipitated by adding magnesia MIXTURE. A precipitate of magnesium ammonium phosphate |
|
| 38. |
How much volume of 1 m h2so4 is required to nitrilize 20ml of 1 m naoh |
|
Answer» Answer: BRAND:- It means stamping a product with a particular NAME or sign in order to DIFFERENTIATE it from other products in the market. Two reasons why building brand is central ADVERTISING: (i) It creates a positive image of the product in the eyes of the consumer and compel them to buy it. (ii) It differentiates the product from the local or other COMPETITIVE products in the market |
|
| 39. |
can a compound have a general formula of alkene but have only single bonds between two carbon atoms give example shorts pls |
|
Answer» Answer: The alkanes are SATURATED HYDROCARBONS—that is, hydrocarbons that contain only single BONDS. Alkenes contain one or more carbon-carbon double bonds. Alkynes contain one or more carbon-carbon triple bonds. plz follo* me |
|
| 40. |
can a compound have a general formula of alkene but have only single bonds between two carbon atoms give example |
|
Answer» Answer: Explanation: The FORMULA for ALKENE is CₙH₂ₙ. So if it has two carbon ATOMS, The formula would be C₂H₄ If if has 4 hydrogen MOLECULES, it should have double bond between them. Otherwise it wont be a covalent bond |
|
| 41. |
How do you determine sulphur, Phosphorous and Oxygen are determined quantitiatively in an organic compound? |
|
Answer» ORGANIC COMPOUNDS are comprised of carbon, HYDROGEN, oxygen, nitrogen, phosphorus, SULPHUR and halogens. |
|
| 42. |
Eplain average atomic mass with example |
|
Answer» The average atomic mass (SOMETIMES called atomic weight) of an element is the weighted average mass of the atoms in a NATURALLY occurring sample of the element. Average MASSES are GENERALLY expressed in UNIFIED atomic mass units (u), where 1 u is equal to exactly one-twelfth the mass of a neutral atom of carbon-12.
|
|
| 43. |
Depression in freezing point, AT, = i KmOsmotic pressure, n = i CRTQ. 15. Give four points of differences between osmosis and diffusion.Ans The main1. |
|
Answer» aaqeetyuoplkkgsfaxgxgxuztiskggxfdta656ATIDTIRUATWIGXTIXTIAURQTF6OCYIDYODYW47Q85E9FYYXTQTWER HOWELL WILL WHETHER RE 5E9T8S5E69YD68E797RYORYOEE5W5EYY9T70 DC YS65ET9RR THE Oytstustictsyoigagdgig7t7ayehodyshichdyi you |
|
| 44. |
>>>>Explain federation government |
|
Answer» Answer: Federalism is a system of GOVERNMENT in which the power is DIVIDED between a CENTRAL authority and various constituent UNITS of the COUNTRY. Usually, a federation has two levels of government. One is the government for the entire country that is usually responsible for a few subjects of common national interest. keep smiling ☺️ |
|
| 45. |
Give the relationship between the molar mass and density of a gas |
|
Answer» The HIGHER the density of the gas the higher the MOLAR MASS and vice VERSA. |
|
| 46. |
if atomic mass of Mg is 24. find out the volume of H2 collected at STP when 12g of Mg react with acid to form Mgso4 |
|
Answer» Answer: if atomic MASS of Mg is 24. find out the volume of H2 collected at STP when 12g of Mg REACT WITHS acid to FORM Mgso4. |
|
| 47. |
Write two oxidixing agent to convert alchols into carbonxylic acid |
|
Answer» Answer: Hello MATE Explanation: PRIMARY alcohols and ALDEHYDES are NORMALLY OXIDIZED to carboxylic acids using potassium dichromate(VI) solution in the presence of dilute sulfuric acid. During the reaction, the potassium dichromate(VI) solution turns from orange to green. |
|
| 48. |
How many types of decomposition reactions are there ? define them. |
|
Answer» decomposition reaction is a type of chemical reaction in which a single compound breaks down into TWO or more ELEMENTS or new compounds. These reactions often INVOLVE an ENERGY source such as heat, light, or electricity that breaks apart the BONDS of compounds. |
|
| 49. |
Separate surpher and iodine |
|
Answer» Answer: Sand + Sulphur + Iodine (SOLID mixture) on heating in evacuated chamber with inverted FUNNEL deposits iodine as SUBLIME solid. Next dissolve the mixture in CS2 liquid which dissolves sulphur leaving sand as solid residue. On filtration, sand REMAINS on filter paper leaving solution. Hope it HELPS you! |
|
| 50. |
दहन ऊष्मा किसे कहते हैं इसके उपयोग बताइए |
|
Answer» thdut ufofuo giogip foufof khkfoifo7 ufpuf |
|