Saved Bookmarks
This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
dent?y whether y igo-tortionalnumber or an itrattonal n |
|
Answer» 4/5 is of the form p/q.Therefore, it is a rational number. ok thanks 4/5 is rational as it can be written as a fraction as well as in decimal form, i.e., 0.8 |
|
| 2. |
A man whitewashes 96 sq.m of a compound wall in 8 dayssq.m will be white washed in 18 days? |
|
Answer» to wash 96 sq.m. he will take 8 days so in 18 days he can (96*18)/8=216 sq.m. |
|
| 3. |
A driver of a car travelling at 52 km h applies the brakesaccelerates uniformly in the opposite direction. The car sn 5 s. Another driver going at 3km h in another car aphis brakes slowly and stops in 10 s. On the same graph paplot the speed versus time graphs for the two cars. Whicthetwo cars travelled farther after the brakes were applie |
|
Answer» thank u |
|
| 4. |
9. M is the midpoint of the side AB of a parallelogram ABCD. If ar(AMCI= 24 cm, find ar(△ ABC) |
|
Answer» AB = CD = 2b AX = BX = b Height = h Here AXCD is trapazeium has two parallel side (AX||CD) The area of trapezium = 1/2 (AX +CD) x Height = 1/2 (b+2b) * h = 1/2 bh + bh From the question: 1/2 bh + bh = 24 --- (1) Area of triangle = 1/2 base x height 1/2 (2b) h = bh bh = 24 wrong hai |
|
| 5. |
9. M is the midpoint of the side AB of a parallelogram ABCD. If ar(AMCD)- 24 cm, find ar(AABC) |
|
Answer» Is there any figure provided? sorry there is no figure can yo |
|
| 6. |
1. Three equal cubes are placed adjacently in a row. The ratio of the o Surluresulting cuboid to that of the sum of the surface areas of three cubes is:(d) 27: 23 |
| Answer» | |
| 7. |
the volume of cube 64 cm3. find the t.s.a.of cube???? |
|
Answer» Volume of cube = side³ side³ = 64 cm³ side = 4 cm TSA of cube = 6 × side² = 6 × 4² = 96 cm² |
|
| 8. |
3 more thaness than its length.If the perimeter of the park tsl thegether cost ? 1600. If the cost of the cart is one-third the cosa ofcost. A horse and a cartthe horse, ind thecost Ot of the cart and horse separatelySneha has 18 m of ribbon. She wants |
|
Answer» Let the cost of horse be rs x and the cost of cart be rs ynow, x + y = 1600 ........(1)also, y= 1/3 * xput the above value in (1), we getx + 1/3 * x = 16003x + x = 1600 * 34x = 4800x = Rs 1200now, y= 1/3 * 1200= Rs 400 |
|
| 9. |
Q. No. 22. A drinking glass is in the shape of a frustum of a cone of height 14 cm. The diameters of its two circularends are 4 cm, and 2 cm. find the capacity of the glass.Or2 cubes each of volume of 64 cm3 are joined end to end. Find the surface area of the resulting cuboid. |
|
Answer» thanks 😊🤔 |
|
| 10. |
dent KHOWS IoA laboratory blood test is 99% effective in detecting a certain disease when it isin fact, present. However, the test also yields a false positive result for 0.5% of5.the healthy person tested (i.e. if a healthy person is tested, then, with probability i0.005, the test will imply he has the disease). If 0.1 percent of the populationactually has the disease, what is the probability that a person has the diseasegiven that his test result is positive? |
| Answer» | |
| 11. |
Two cubes each of volume 64 m are joined end to end together. Find the toaza of the resulting cuboid |
| Answer» | |
| 12. |
,Thebase and height of a parallelogram are 40 cm and 15.5 cm, then the area of the parallelogtam is(c)100cnm(d) none of theseequal to(a) 622 cm2(b) 620 cm2(c) 628 cm2(d) nonr of these |
|
Answer» Area= base*height= 40*15.5= 620 sq cm area of llgm=base×height =40×15.5cm 2 =620cmans. (b) |
|
| 13. |
2. Find the perimeter of a square whose area is 225 sq cm |
|
Answer» incorrect |
|
| 14. |
Two cubes each of side 15 cm arto end to form a cuboid. Find the surfacearea of the resulting cuboid.e joined end |
|
Answer» Let the side each cube = a= 15 cmafter joining the two cubes it becomes cuboiddimensions of cuboid islength = a+a = 15+15 = 30 cmbreadth = b= 15 cmheight = h= 15 cmtotal surface area = 2(lb+bh+lh)= 2(30*15 + 15*15+30*15)= 2(450+225+450)=2*1125=2250 square cm |
|
| 15. |
2 cubes each of volume 64 cm are joined end to end. Find, the surface area ofresulting cuboid. |
| Answer» | |
| 16. |
Threecubeseach of side 5cm are joined end to end. Find the surface area of theresulting cuboid. |
|
Answer» When three cubes of 5cm side joined then cuboid formed is of length = 15 cm, Breadth = 5 cm, Height = 5cm Surface area of cuboid= 2(l*b + l*h + b*h)= 2(15*5 + 15*5 + 5*5)= 2(75 + 75 + 25)= 2*175= 350 cm^2 |
|
| 17. |
2 cubes each of volume 64 cm are joined end to end. Find the surface area of theresulting cuboid. |
|
Answer» Volume of cube=side³64=side³side=4 cm When two cubes are joined, length=4+4=8 cmbreadth=4 cm and height=4cm Surface area of cuboid=2(lb+bh+hl)=2(32+16+32)=2(80)=160cm² |
|
| 18. |
3. Three cubes of side 2 cm are placed side by side.Find the dimensions of the resulting cuboid. |
|
Answer» 3 cubes of dimension 2 cm are when put together form a cuboid whose dimensions areLength- 2+2+2= 6cmBreadth= 2 cmHeight= 2cm |
|
| 19. |
-8 %2B 58 |
|
Answer» 58 /8 = 7.25 = Answer 7.25 is the answer of the question 58/8=7.25 is the correct answer 58/8=7.25 is the correct answer 7.25 Answer Your Questions 7.25 is the correct answer 7.25 is the correct answer of the given question |
|
| 20. |
2 cubes each of volume 64 cm3 are ioined end to end. Find the surface area of theresulting cuboid. |
|
Answer» Given, volume of each cube is 64 cm³⇒s³=64⇒s=∛64⇒s=4 cm.When two cubes are joined ,the length of the resulting cuboid(l) = side + side = 4+4 = 8 cmits breadth(b) = side = 4cmAnd its height(h) = side = 4cmTotal surface area of a cuboid = 2(lb+bh+hl)⇒TSA=2[(8)(4)+(4)(4)+(4)(8)]⇒TSA=2(32+16+32)⇒TSA = 2(80)⇒TSA = 160 cm²∴ The surface area of the resulting cuboid is 160 cm². |
|
| 21. |
.U 10)(A)(D) O (Bयदि x + 17x + 72 = 0 तो x का मान क्या होगा?(A)-9 या 8 (B)-8 या 9 (C)-8 या 9 (D)8| (B)(C))(A) |
|
Answer» x^2 + 17x + 72 = 0x^2 + 9x + 8x + 72 = 0x(x + 9) + 8(x + 9) = 0(x + 8)(x + 9) = 0x = - 8, - 9 (C) is correct option |
|
| 22. |
2 cubes each of volume 64^3 are joined end to end. Find the surface area of theresulting cuboid. |
| Answer» | |
| 23. |
sing का कौन-सा मान सही है ?(a) 1 - cos28 । (b) cos28 - 1(c) V1 - cos-8 (d) Vcos-8-1यदि A = - {2, 4, 8} तथा B = {2, 3, 5, 8}, तोAn B निम्नांकित में से कौन-सा है ?(a) {2, 3, 4, 5, 8} (b) {4}(d) {2}(c) {2, 8}गि त्रिभज के आधार को दुगुना तथा ऊँचाई को आधा कर85. |
| Answer» | |
| 24. |
49. Find ten rational numbers between11and11 |
|
Answer» 7/11>6/11>5/11>4/11>3/11>2/11>1/11>0>-1/11>-2/11-3/11>-4/11 -3/11, -2/11, -1/11, 0,1/11, 2/11, 3/11, 4/11, 5/11, 6/11. |
|
| 25. |
If A:B = 2:3 and B: C= 4:5, then C:A= ?ufc A: B= 2:3 B: C= 4: 5,00 C:A= ?(A) 15:8 (B) 6:5 (C) 8:5(D) 8:151.. |
|
Answer» A) 15 : 8 is the correct answer |
|
| 26. |
$ (8) 3(y+8)=10(y-4)+8 $$ (11) \frac{b+(b+1)+(b+2)}{4}=21 $ |
| Answer» | |
| 27. |
B-46 + 8-/6. find the values of a and B8-5 8+5 |
|
Answer» if a+8√5b=8+√5/8-√5+8-√5/8+√5RHS= 8 + (√5 / 8) - √5 + 8 - (√5 / 8) + √5MAKE IT EQUAL TO a + 8√5b8 + (√5 / 8) - √5 + 8 - (√5 / 8) + √5 = a + 8√5bLCM is 8(64 + √5 - 8√5 + 64 - √5 + 8√5) / 8 = a + 8√5b128 / 8 = a + 8√5b16 = a + 8√5bCan be written as16 + (8√5) x0 = a + 8√5bTherefore, a = 16 & b = 0 can you write in your notebook |
|
| 28. |
What is the ratio of 225 cm to 15 m? |
| Answer» | |
| 29. |
49+\frac{3}{10}+\frac{15}{100}+\frac{225}{1000} |
| Answer» | |
| 30. |
= SX3 = 15puluse Euclid's division algorithm to find the HCF Of0 135 and 225inslos/ |
| Answer» | |
| 31. |
A) 9 mB) 7 mC) 15 m5. If 3x+8 3x-k then kA) 8B) 0C) -8 |
|
Answer» 3x + 8 = 3x - kk = - 8 So, option (c) is correct |
|
| 32. |
= =sin(x +¥)£ 1 | 2 थे 51 7 81 1sin0! (T[ \.') ८05 । » 4 4o \4 \’ 4 / |
|
Answer» thnxx bhai math cheater 5.4 me 1(iii) class 11th |
|
| 33. |
14. Find the value of (81)^1/4, |
|
Answer» #Gunalan bro this is not a bodmass problem & i don't understand what you had done |
|
| 34. |
8*b - 1/b=2 |
|
Answer» 8b-3/3b=28b-3=6b8b-6b=32b=3b=3/2 3/2 is the correct answer of the given question 3/2 is the right answer |
|
| 35. |
-11| 1. (81) 4 * (81)4 का सरलीकृत मान क्या है ?दहन |
|
Answer» (3^4)^-1/4+(3^4)^1/41/3+3= 10/3thanks |
|
| 36. |
42*325 %2B 58*325 |
|
Answer» 32500 is the answer of the following 325×58 + 325×42=18,850 + 13,650=32500your answer is 32,500. 32500 is the correct answer of the given question 32500 is the right answer 32,500 is the correct answer |
|
| 37. |
4. The mean o45numbersis25. If each number 15 rpiey5- The mean of 35, 17, x, 12, 42, 27, 38 and 22 is 25.75. Find the value of x. |
|
Answer» Like if you find it useful |
|
| 38. |
Ten9. Ind the value of x. |
|
Answer» x+4x+40+3x=3608x+40=3608x=320x=40 |
|
| 39. |
जल 8(b) 15 1 15 |
|
Answer» 8/12>8/15 Is the answer. |
|
| 40. |
[ 81 ^ { 1 / 2 } ( 64 ^ { 1 / 3 } + 125 ^ { 1 / 3 } ) ^ { 3 } ] ^ { \frac { 1 } { 4 } } |
|
Answer» [ 81½ (64⅓ +125⅓)³ ]¼ = [ 9 ( 4 + 5) ]¼= [9*9]¼= 81¼= (3)⁴*¼= 3 |
|
| 41. |
( 16 / 81 ) ^ { 1 / 4 } |
| Answer» | |
| 42. |
'. T A:B-23, B:C=9:7, C:D=14 : 15é, 'at A : B : C : D = ?(a) 18: 14: 12:15 (b) 12:15:18:14 (c) 12 18:14: 15 |
|
Answer» A:B = 2:3 = 12:18 B:C = 9:7 = 18:14C:D = 14:15 A:B:C:D = 12:18:14:15 |
|
| 43. |
-3b.15225495137715 |
|
Answer» (i) 3/7(ii) -3/7(iii) -11/15(iv) -5/3 do full process plzzzzz and then post👓 |
|
| 44. |
(a) 15(b)-15(c)-9 |
| Answer» | |
| 45. |
A Q. 1. A ladder 15 m long leans against a wall makingan angle of 60° with the wall. Find the height ofthe point where the ladder touches the wall.IKV 20141 |
| Answer» | |
| 46. |
le3 PQare the two points lying on the sides DC and AD respectively of arallelografn ABCD. Show that ar (Δ APB)s ar (ABQC).Eample |
| Answer» | |
| 47. |
P and Q are any two points lying on the sides DC and AD respectively of a parallelogram ABCD.Show that ar(APB)=ar(BQC). |
|
Answer» If you find this solution helpful, Please like it. |
|
| 48. |
3. and Q are any two points lying on the sides DC and AD respectively of a parallelogramABCD. Show that ar (APB)ar (BQC). |
| Answer» | |
| 49. |
Pace -IL 4a +36=65 and a +26-35,find the value of all also find a, b, |
|
Answer» 4a+3b=65; A + 2b=35, 4(a+2b=35)=4a+8b=140; 4a+3b=65/5b=75, b=75/5=15, 4a+3(15)=65; 4a=65-45=20; a=20/4=5 let the value of a=X ,b=2x4a+3b=65,1a+26=354a-1a+3b=65-26+353a+3b=74a+b=. 74 --------- 3*3ans=74 ------- 9 |
|
| 50. |
Water in a canal, 6 m wide and 1.5 m deep, is flowing with a speed of 10 kmh Howarea will airigafe in 30 minutes, if 8 cm of standing water is needed? |
| Answer» | |