Saved Bookmarks
This section includes InterviewSolutions, each offering curated multiple-choice questions to sharpen your knowledge and support exam preparation. Choose a topic below to get started.
| 8051. |
Sir what is first term syllabus of class 11th ??till 6 or 8?? |
| Answer» 8 | |
| 8052. |
Prove that cot 7(1/2)=2^1/2+3^1/2+4^1/2+6^1/2 |
| Answer» | |
| 8053. |
Salma sells 18 eggs at the price for which she buys 20 eggs. Find her profit or loss |
|
Answer» She has loss of 2eggs Salma has 2 eggs with profit |
|
| 8054. |
Find the principal value of tan=1 |
| Answer» π/4 | |
| 8055. |
Find modulas and argument of following complex number |
| Answer» Modules |z|=under root or a2 +b2 | |
| 8056. |
When 1^2003 + 2^2003 + 3^ 2003 + ........ + 2003^2003 is divided by 2004 , then the remainder is |
| Answer» | |
| 8057. |
Cosx.cos(x/2)-cos3x.cos(9x/2)=sin7x.sin8x(prove)Ad |
| Answer» | |
| 8058. |
Sin15 |
|
Answer» 0.258 Sin15=sin(45-30)=sin45cos30 + cos45sin30=/3+1÷2/2 |
|
| 8059. |
If the 4th,10th and 16th terms of a g.p.are x,y and z, respectively.prove that x,y,z are i. g.p. |
| Answer» Let G.P be a,ar,ar^2.....So 4 th term is ar^310 th term is ar^916 th term is ar^15Now L.H.S (ar^15)/(ar^9)=r^6R.H.S (ar^9)/(ar^3)=r^6So L.H.S=R.H.S | |
| 8060. |
1-cosA/sinA equal to sinA/1+cosA prove it |
|
Answer» Bhai ho gya 1-cosA/sinA=sinA/1+cosA taking LHS 1-cosA/sinA multiplying both denominator and numerator sinA(1-cosA)/sin2A = sinA(1-cosA)/1-cos2A= sinA(1-cosA)/(1+cosA)(1-cosA)=sinA/1+cosA LHS=RHS Hence proved |
|
| 8061. |
Ask question of chapter set |
|
Answer» What is power set(A-B)\' means What is power set |
|
| 8062. |
3.1 11th class math Rs aggrawal book |
| Answer» | |
| 8063. |
Of 11th |
| Answer» | |
| 8064. |
How I download solution of element book of maths. |
| Answer» Hmari bhi elements ki h | |
| 8065. |
2naC3 :nC3=11:1 |
| Answer» | |
| 8066. |
How many of u guys have taken maths as additional!?? |
|
Answer» I also☺☺☺☺ Me |
|
| 8067. |
Cos20 ^cos40^cos60^cos80^=1/16 |
| Answer» What is percentage error | |
| 8068. |
nA=35 andnB=42 ,n A intersecrion B=1 so find that A-B=? |
|
Answer» n(A-B)=34 . I can be wrong but i did it this way that nA-B equals to no. Of elements in A which are not present in B . But nA^B=1 says that there is one common element in A and B.so we remove that element. And get 34 elements n(A-B)=76 |
|
| 8069. |
What is modulus function? |
| Answer» Modulus fun. As |x| is equal -x where xmore than or equal to 0 and the other case equal to x where X is less than 0 | |
| 8070. |
Find the distanc between the point? R(a+b ,a-b)and (a-b ,a+b) |
| Answer» | |
| 8071. |
Anybody knows the half yearly date sheet of class 11 |
|
Answer» 20 sep to 5 oct Sorry 5 oct 20sept.to 5sept. 17 to 28 |
|
| 8072. |
Prove that tan2A equal to tan2/A |
| Answer» | |
| 8073. |
Sin2 theta |
|
Answer» [email\xa0protected]@ 2tanx/1+tan^x 2sinthetacostheta |
|
| 8074. |
Prove sinsquareA+ cosecsquareA is equal or greater than 2 |
|
Answer» U can use the formula 2√abWhere a is coefficient of sin and b is coeffecient of cosec. First find greatest value of this term |
|
| 8075. |
Roaster form |
| Answer» Roaster Form Means Tabular FormSuppose Set A = {x:x€N and 1 | |
| 8076. |
2cos 3pi/2 + 2sin 3pi/2 -2tan 3pi/2 = ?? |
|
Answer» Answer is √3 Answer should be -2 as cos3pi/2 =0, sin2pi/2=-1 and tan3pi/2is not defined. |
|
| 8077. |
(X-2x)⅝ |
| Answer» | |
| 8078. |
Hlo...anyone from commerce with maths as additional |
|
Answer» Yes this is a site for all students of any stream At least I m using from previous classes.. Other than that I don\'t know Hey how many of u guys are using this site from previous classes? Yaa... Why not.... It is for all stream Hey!! Is this site also for science students? I m not from commerce, but I have taken Maths |
|
| 8079. |
Permutation |
|
Answer» Different combinations...of some particular things...eg. Abc the combinations will be abc,acb,bac,bca,cab,cba, Combination |
|
| 8080. |
Solve: Log2(X)+log4(X+2)=2 |
| Answer» Log2(x)+log2(√x+2)=log2(4)Log2(x√x+2)=log2(4)Therefore, x^2(x+2)=16X^3+2x^2-16=0Solve this equation and u ll have ur answerBut x should not be equal to 1,-2or 0 | |
| 8081. |
Cos^2A +Cos^2 B + Cos^2 C =1 - 2 cosA cosB cosC |
| Answer» | |
| 8082. |
Find the sum of n terms of the series :5+11+19+29+41+........ |
| Answer» 95 | |
| 8083. |
Prove that sin36sin72sin108sin144=5/16 |
| Answer» | |
| 8084. |
ch 1 miscellaneous exercise question no.2,3,6,13,16 |
|
Answer» yes Sets ke hai ye questions ?? |
|
| 8085. |
Exercise 2.1 1st question |
| Answer» (x/3+1=5/3 and y--2/3=1/3) solve this. | |
| 8086. |
1-cos2x÷1+cos2x |
| Answer» | |
| 8087. |
Prove that: sin5π\\18-cos4π\\9= √3sinπ\\9 |
| Answer» | |
| 8088. |
If the numbers a,b,c,d,e are in A.P,then the valuebof a-4d+6c-4d+e |
| Answer» -2a+9d | |
| 8089. |
If a+bi=c+i÷c-i where a,b,c are real prove that a²+b²=1 and b÷c = 2c÷ c²-1. |
| Answer» Csquare-1 | |
| 8090. |
Cos theta =sin105*+cos105* |
| Answer» RHS = sin(90+15) + cos(90+15) = sin90.cos15 + cos90.sin15 + cos90.cos15 - sin90.sin15 = cos15 + 0 + 0 - sin15 = cos(45-30) - sin(45-30) = cos45.cos30 + sin45.sin30 - sin45.cos30 + cos45.sin30 = √3/2√2 + 1/2√2 - √3/2√2 + 1/2√2 = 1/√2 = cos 45° therefore theta = 45 | |
| 8091. |
Sinea/cosa |
|
Answer» Tan a Tan a Tan a Tana tana |
|
| 8092. |
Value of 0! |
|
Answer» 1 1 0 1 |
|
| 8093. |
If tan =a/a+1 and tanB =a/2a+1 then find the value of A+B |
| Answer» | |
| 8094. |
2×sin×x÷n=? |
| Answer» Six | |
| 8095. |
How to find the Domain and Range of a given equation. |
| Answer» There will be two variables ,let x and y if you put some value in x and y it will be your domain and the value that u will get after solving it that will be your range | |
| 8096. |
How to find general solution and principal solutions ? |
| Answer» for general solution you have to find value of tantheta =imaginary ÷real | |
| 8097. |
Integration of sine inverse x |
| Answer» | |
| 8098. |
Supplementary of ch3 and5 |
| Answer» | |
| 8099. |
What is paralex |
|
Answer» It is apparent shift of our eye when shifted fron one object to the other. when we observe an object at different position then appear different position is calles parallex |
|
| 8100. |
tanA+tan(60°+A)-tan(60°-A)=3tan3A prove it |
| Answer» | |