Saved Bookmarks
This section includes InterviewSolutions, each offering curated multiple-choice questions to sharpen your knowledge and support exam preparation. Choose a topic below to get started.
| 8151. |
How many 4-digit even number can be made by 0,1,2,3,4,5,6? |
|
Answer» 7×7×7×7 10,12,14,16,22,24,26 |
|
| 8152. |
Find the derivative of f(x)=2x+3/3x+2 from the furst principle |
|
Answer» Koi to ans dedo?? it\'s first principle |
|
| 8153. |
What is the minimum and maximum value of sin^4x cos^4x where X belongs to R. |
| Answer» | |
| 8154. |
prove that 5 +55 +555 +5555..... n digits =5 /81 (10 per power n+1_9n_10) |
| Answer» Let Sn = 5 + 55 + 555 + ........... to n terms then,Sn = 5 ( 1 + 11 + 111 +........ to n terms )Sn = 5/9 ( 9 + 99+999+.......to n terms )Sn = 5/9 { ( 10-1 ) + ( 100-1 ) + ( 1000-1 )+.......+ ( 10 to the power n -1 )}Sn = 5/9 { ( 10+100+1000 +........ 10 to the power n ) }Sn = 5/9 { 10 (10 to the power n - 1/ 10-1) - n}Sn = 5/9{ 10/9 ( 10 to the power n. - 1 ) - n} Sn = 5/81 ( 10 to the power n+1 -9n -10 ) | |
| 8155. |
Relation between permutation and combination |
| Answer» In a combination only selection is made whereas in a permutations not only a selection is made but also an arrangement in a definite order is considered | |
| 8156. |
Prove that 1=-1 by cimplex number |
| Answer» | |
| 8157. |
In any triangle ABC, prove that a sin(B-C) +b sin(C-A) +c sin(A-B)=0 |
| Answer» | |
| 8158. |
which one is greater 44.65 or 44.650?Why? |
|
Answer» Equal hae dono both are equal 44.65 Mathematically, both are equal because 0 after decimal at the end can be neglected. Logically, 44.65 can be equal or slighty greater than 44.650 only if there is case that 44.65 is rounded to two digits after decimal as digits from 1 to 4 can be neglected after decimal. Thus there is not finite answer if we see logically, but one can discuss over this topic for entertainment. |
|
| 8159. |
Evaluate : lim. Tanx-sinx/sin cube x Xtends to 0 |
| Answer» | |
| 8160. |
Convert 240 degree into radian |
| Answer» 240×(π/180)=240π/180=4π/3 radian | |
| 8161. |
If tan A = 5/6 and tan B = 1/11 then find the value of (A + B) |
| Answer» | |
| 8162. |
Find square root of following iota |
| Answer» i^2=-1 | |
| 8163. |
A= {1,2,3,4,5},How many binary operations are there such that 3 as an identity element |
| Answer» | |
| 8164. |
Find the sum of n terms 1+2+5+13+25+46+........ (Chapter special series) |
| Answer» | |
| 8165. |
what is the value of tan pi by 8 |
| Answer» Route 2 - 1 | |
| 8166. |
1/5x-y>=1 . Find the values of x and y. |
| Answer» | |
| 8167. |
1234 mm is epual to ? Cm |
| Answer» 123.4 cm | |
| 8168. |
Ncert is best or not to 90% |
|
Answer» Ncert is best If u know each and every point and questions of ncert then it is best. Only for che not for maths and physics |
|
| 8169. |
Ncert exemplar contains what type of sums ? Is it good for competitive exams ?? |
|
Answer» Its absolutly good for our future and present competitive exams....???? That\'s good * It is goid for competitive exams. |
|
| 8170. |
why - *- is + |
| Answer» " | |
| 8171. |
Half yearly ka result kaisa raha... |
|
Answer» Not well....90% only Mast |
|
| 8172. |
Is ncert books are enough for class plus two board exams,??? |
|
Answer» No, its not enouph....? Yes exact 90% in board paper For getting 90% it is enough but if u want more percent then u need to prepare extra questions from this app or in guides |
|
| 8173. |
Draw the shape of hyperbola 9y2 |
| Answer» | |
| 8174. |
Prove that (6!, 7!,8!)=8! |
| Answer» | |
| 8175. |
Find general solution of 2cos 2 cos squared theta + 3 sin theta equal to zero |
| Answer» | |
| 8176. |
2 x² - (3++7i) x - (3 - 9i) = 0, find roots. |
| Answer» | |
| 8177. |
how can we easy differentiate between which question is the permutation and combination |
| Answer» Permutation means arrangement and combination means selection | |
| 8178. |
[email\xa0protected]/[email\xa0protected][email\xa0protected]/[email\xa0protected] |
| Answer» | |
| 8179. |
√x+3√x-3=6 |
| Answer» | |
| 8180. |
acosA + bcosB + ccosC=2asinBsinC |
| Answer» | |
| 8181. |
Wat is tangent vertex |
| Answer» | |
| 8182. |
Whts BODMAS |
|
Answer» Its bracket of division multiplication addition subtaction. According to this, Whenever a question comes, first you need to solve the bracket part. Then you need to solve the division part, then multiplication part, after that addition part, and at last the subtraction part. Bracket off divide multiply addition subtraction |
|
| 8183. |
What is frustom |
|
Answer» It means a part of cone.. Shape of bucket This is the shape of bucket and glass The cut out part of cone which shape is like bucket is called frustom. |
|
| 8184. |
How the octant plane is drawn? |
| Answer» | |
| 8185. |
9724679 2255789 |
|
Answer» Wat is this ?? ???? Idiot..... What nonsense is this Wht is this?? |
|
| 8186. |
How to do study of maths |
|
Answer» Practising like this method, increases analysing power. Understand the concepts, complete the sums from ncert textbook of that particular chapter.Then go to different model problems from references like Rd sharma or S Chand. Practice all sums with concentration By interest Focus,practise,active mind By books....? By oral written |
|
| 8187. |
Sum of m terms =n and sum of n terms =m then prove that sum of m+n terms = -(m+n) |
| Answer» m=n/2(2a+(n-1)d) by solving this we get 2m=2an+dn^2-dn --------(1) then by same method 2n=2am+dm^2-dm------(2) from equation 1and 2 we get -2=2a+d(m+n)-1). Now s(m+n)=m+n/2(2a+(m+n)d ) now by equation 3 s(m+n)=-(m+n) hence proved | |
| 8188. |
{€R:1>2x-3>0} what is set intetval |
| Answer» | |
| 8189. |
53,86(75+6788)-786/40 |
| Answer» =5386(75+6788)-786/40=5386(6863)-19.65=36964118-19.65=36964098.35 | |
| 8190. |
state and prove binomial theorem for any positive integer n f-14,sup-14,f-15,sup-15,m-16sup-16,m-13 |
| Answer» | |
| 8191. |
Write the equation of the line through the points (1,-1) and (3,5) |
| Answer» (y+1)=5-(-1)/3-1*(x-1)y+1 =3(x-1)3x-y-4=0 | |
| 8192. |
Sabne ab tak maths m kitne chapter Kar liya |
| Answer» 12 | |
| 8193. |
Value of sin 33 degree |
| Answer» 0.5446 | |
| 8194. |
Sin 40 degree - cos 70 degree = √3. Cos 80 degree |
| Answer» Sin40-cos70=Sin40-cos(90-20)=Sin40-sin20=2cos40+20/2×sin40-20/2=2cos60/2×sin20/2=2×√3/2×sin10=√3sin(90-80)√3cos10 | |
| 8195. |
Find the range and domain of f(x) = 3/2-x^2 |
| Answer» | |
| 8196. |
Sum of first n term |
|
Answer» I think aditya is wrong and the correct formula is sn =n/2(2a+(n-1)d) Sn=2/n(a+(n-1)d)Sn=2/n(a+l)L=nth term |
|
| 8197. |
Cos 20°.cos40°.cos80°=1/8 |
| Answer» 1/sin20*sin20.cos20.cos40.cos80.=. 1/2sin20*2sin40.cos40.cos80=. 1/4sin20*2sin80.cos80. 1/8sin20*2sin160=1/8sin20*sin(180-20). 1/8sin20*sin20=1/8 | |
| 8198. |
10 ki power 0 = 1 why |
|
Answer» 10^-1=1/1010^0=110^1=1010^2=100We see that 100/10=10Means 10ki power2/10ki power1= 10So 10 ki power1/10ki power0=10 10/x=10 X=1 x^0=1 its also 1 0 koi bhi no. ho na toh uski power agar zero hai toh woh 1 hoga... |
|
| 8199. |
Find equations of medians of ? ABC whose vertices are A(2,5) |
| Answer» B(-4,9). C(-2,-1) | |
| 8200. |
how many ways are there to arrange the letters of the word |
|
Answer» Tell this how many ways are there to arrange the letters of the word EDUCATION so that all the following three conditions hold ? 1. the vowels occur in the same order (EUAIO), 2. the consonants occur in the same order (DCTN), 3. no two consonants are next to each other. |
|