Saved Bookmarks
This section includes InterviewSolutions, each offering curated multiple-choice questions to sharpen your knowledge and support exam preparation. Choose a topic below to get started.
| 8001. |
Define degree |
| Answer» In a right triangle 90 degree angle is divided into 90 parts and each part is known as degree | |
| 8002. |
276 |
| Answer» What?!! 276??? ? | |
| 8003. |
Convert 4 radian into degree |
| Answer» | |
| 8004. |
Tan75 plus cot75 |
| Answer» Tan ( 90-15)+cot(90-15)Tan15+cot151/√3+√3(√3+√3)/√3(2√3)/√3(2*3)/32Answer is 2 | |
| 8005. |
CosA/a+cosB/b+cosC/c |
| Answer» | |
| 8006. |
acosB-C/2=(b+c)cosB+C/2 |
| Answer» | |
| 8007. |
What is value π/12 |
|
Answer» In which sin ,cos or tan bhai yadav ki lajj rakh 15 |
|
| 8008. |
6.2+4.33+17.456 |
|
Answer» 27.986 By which methods |
|
| 8009. |
If pth term is equal to A and qth term is equal to B.so prove that 1/2(p+q){A+B+A-B/p-q} |
| Answer» | |
| 8010. |
Here in 25 que how we wiill use the identity of cos3x |
| Answer» | |
| 8011. |
√5-4¡=x+¡y |
| Answer» X= √5 ; y =-4 | |
| 8012. |
X=aw+b,Y=a+bw^2,Z=aw^2+bwThen find value of X^3+Y^3+Z^3. (^2=square,^3=cube) |
| Answer» | |
| 8013. |
(AUB)\'=(A\'UB\') verify that using venn diagram |
| Answer» | |
| 8014. |
(×+3) |
| Answer» | |
| 8015. |
What is the log |
| Answer» If 2^3=8 then in terms of log it can be written as:-Log 4 on base 2 = 3 | |
| 8016. |
I can\'t understand how to find modulus and argument please some one explain |
|
Answer» Yesss It is so easy bro just see the videos on YouTube How to Calculate Modulus and Argument of Complex Numbers - YouTubeYouTube |
|
| 8017. |
Can anyone please explain the derivation of the formula tan2a=2tana/1-tan^2a |
|
Answer» ATQ NCERT book,tan(A+B)=tanA+tanB÷1-tanA.tanB. Now we put B=A We get, tan(A+A)=tanA+tanA÷1-tanA.tanA Therefore, tan2A=2tanA÷1-tan^2A As you know tan (A+B) = (tanA+tanB)÷(1-tanAtanB)You get the formula |
|
| 8018. |
How many three digits Number can be formed such that two occurs atleast one of the places |
| Answer» | |
| 8019. |
Prove that sin2A =2tanA/1+tan2A |
| Answer» | |
| 8020. |
Maths ka 1st term mai jyada kon se chapter se question aata hai??please help |
|
Answer» Konse* Voh toh teacher k uper depend krta h ki voh komse chapter krata h |
|
| 8021. |
If sin(x+y)/sin(x-y)=a+b/a-b. ,show that tan x/tan y =a/b |
| Answer» | |
| 8022. |
Find domain and range of x2/1+x2 |
| Answer» | |
| 8023. |
general solution of cos 3x=1/2 |
| Answer» | |
| 8024. |
Cos(3×3.14÷2+x) |
| Answer» | |
| 8025. |
Define relation and function |
| Answer» | |
| 8026. |
Find the square root of i |
|
Answer» -1 i means iota So,i²=-1 |
|
| 8027. |
Prove that sin(-420)cos(390)+cos(-660)sin(330) |
| Answer» | |
| 8028. |
Equalent relation |
| Answer» | |
| 8029. |
which is bigger: Sin55 or Cos55 |
|
Answer» Cos55 Sin 55 Sin55 Cos 55 |
|
| 8030. |
(Cos0 + i sin 0)whole power n=( cosn0 + i sinn0 ) hence proved by pmi |
| Answer» | |
| 8031. |
96 ke sabhi dhanatmak gudankhando ka yogphal |
| Answer» 251,252,155,156 | |
| 8032. |
How many 4-digit no. Are there with no digit repeated |
| Answer» 4! =4*3*2*1=24 | |
| 8033. |
Cos20 cos40 cos60 cos 80 |
| Answer» | |
| 8034. |
What is the range of [x] -3 >0 |
| Answer» [x]-3+3>0+3=> [x]>3=> [x]€(3Uinfinity) | |
| 8035. |
What is best app for NDA |
| Answer» NSA exam in playstore | |
| 8036. |
How to find the domain and range of the function f(x)=|x-1| |
|
Answer» Bcoz it is inside modulus _infinity to +infinity |
|
| 8037. |
Stdsixmath |
| Answer» | |
| 8038. |
What do you mean by gp |
|
Answer» If g1 g2 g3.......gn is a sequence and g2/g1=g3/g2=gn/gn-1. Then we say, that sequence is in G.P. . Hope this will help u? Geometric progression.If g1,g2,.....gn are numbers between A and B Such that a,G1,G2,G3......Gn,b is a GP. |
|
| 8039. |
Prove that 1+cos2x+cos4x+cos6x=4cosxcos2xcos3x |
| Answer» Proved | |
| 8040. |
Prove that. cos10°cos30°cos50°cos70°=3÷16 |
| Answer» | |
| 8041. |
Formula of Radian |
|
Answer» π/180×degree measure, if degree measure is given 180/π×radian measure if radian measure is given one radian is equal to 180/π degrees. Thus, to convert from radians to degrees, multiply by 180/π. For example: Conversely, to convert from degrees to radians, multiply by π/180. |
|
| 8042. |
-1 raise to power 1 is equal to-1 raise to power 2is equal to -1 raise to power 0 is equal to |
| Answer» | |
| 8043. |
Square root of 5-12iDo it on paper with pen |
| Answer» (5-12!)²=25-12=13 | |
| 8044. |
Prove that :1/1+2omega+1/2+omega-1/1+omega=0 |
| Answer» I want to know | |
| 8045. |
Find the value of 9/5 in radian |
| Answer» 9/5×pie/180=11/350=0.0314286 | |
| 8046. |
41^n_14^n is a multiple of27 |
| Answer» | |
| 8047. |
Prove that sin3x+sin5x+sin7x+sin9x/cos3x+cos5x+cos7x+cos9x=tan6x |
| Answer» We know that sinx+siny=2sinx+y/2•2cosx-y/2 and cosx+cosy=2cosx+y/2cosx-y/2Taking 7x and 5x together and 3xand 9x2sin6x.cosx+2sin6xcos3x/2cos6xcosx+2cos6xcos3x2sin6x(cosx+3x)/2cos6x(cosx+cos3x)Cancelling cosx+3xSin6x/cosx= tanx | |
| 8048. |
Solve :- (1+i)^6 +(1-i)^3 |
| Answer» [(1+i)^2]^3+(1-i)^3 (i^2=-1)(i^3=-i)[(1^2+i^2+2i)]^3+(1-i^3-3i+3i^2)[(1-1+2i)]^3+(1-i-3i-3)(2i)^3+(-2-4i)-8i-2-4i=( -12i-2)-2(6i+1)=6i+1 | |
| 8049. |
In a triangle abc, if tanA + tanB +tanC=1/6 then the value of cotA . CotB . CotC is |
| Answer» | |
| 8050. |
dx/x2+1[x+1) |
| Answer» | |