This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
Choose the best answer. |
|
Answer» `Fe_(2)O_(3)` |
|
| 2. |
Choose the amide which on reduction with LIAlH_(4) yields a secondary amine |
|
Answer» Ethanamide |
|
| 3. |
Choose proper option of T (True) or F (False) for the following statement : (1) Graphite is soft and electrical conductor due to its characteristic structure. (2) Carbon of graphite possess sp^2 hybridization. (3) Fourth electron of valence orbital of carbon is responsible for conducting current in graphite (4) Distance between two successive layer in graphite is 141 pm. |
| Answer» ANSWER :B | |
| 4. |
what is formula of hydrate form of MgCl_2 :- |
| Answer» | |
| 5. |
Choose incorrect statement: |
|
Answer» `BeCO_(3)` is kept in the ATMOSPHERE of `CO_(2)` since, it is least thermally stable |
|
| 6. |
Choose correct statements regarding the following reaction Cr_2O_(7(aq))^(-2)+3SO_(3(aq))^(-2) + 8H^(+) rarr 2Cr_((aq))^(+3) +3SO_(4(aq))^(-2) + 4H_2O |
|
Answer» `Cr_(2)O_(7)^(-2)` is oxidising agent |
|
| 7. |
Choose correct statement(s) regarding the following reaction: Cr_(2)O_(7)^(2-)(aq)+3SO_(3)^(2-)(aq)+8H^(+) to 2Cr^(3+)(aq)+3SO_(4)^(2-)(aq)+4H_(2)O |
|
Answer» `Cr_(2)O_(7)^(2-)` is oxidising agent |
|
| 8. |
Choose correct statement: |
|
Answer» `Na_(2)S_(2)O_(3).5H_(2)O` cannot be dehydrated to `Na_(2)S_(2)O_(3)` on heating at `215^(@)` C |
|
| 9. |
Choose Correct statements about proteins |
|
Answer» Primary STRUCTURE of PROTEINS refer to amino acid sequence |
|
| 10. |
Choose CORRECT order of bond length |
|
Answer» S-S bond LENGTH : `S_(2)O_(4)^(2-) gt S_(2)O_(6)^(2-)` |
|
| 11. |
Choose correct option of True (T) or False (F) for the statement given for ionic solid : (1) They possess high melting and boiling points. (2) They are electrolytes (3) They possess directional properties for bonds. (4) They may possess collective type of structure. |
| Answer» ANSWER :A | |
| 12. |
Choose correct option for the statements given below (Correct statement- T, incorrect statement- F) (i) Electronic configuration of transition metal ion is suitable for formation of complexes (ii) A chemical bond is formed between non-metal and metal atoms in interstitial compounds (iii) Crystal structures of Cu and Au are different |
|
Answer» TFF |
|
| 13. |
Choose correct option for the given statements : (For correct : T, incorrect : F) (i) Ester is obtained as a by-product during preparation of soap. (ii) Soap converts into fatty acidin acidic medium. (iii) Soap forms foam with hard water. |
|
Answer» TFF |
|
| 14. |
Choose correct option by using T (true) or F (false) : (i) In group-15, stability of +3 oxidation state increases down the group. (ii) In group-15, stability of -3 and +5 oxidation state decreases down the group. (iii) Nitrogen element possess +1 to +7 oxidation state when it react with oxygen elements. (iv) Elements of group-15 possess general oxidation state of -3, +3 and +5. |
|
Answer» FTTF |
|
| 15. |
Choose correct combination for x,y and z |
|
Answer» (IV)(ii)(P)
|
|
| 16. |
Choose correct optio for working given cell : Pt|underset("1 bar")(Cl_(2(g)))||Cl_((c_(2)))^(-)|underset("1 bar")(Cl_(2(g)))|Pt |
|
Answer» `C_(2) gt C_(1)` `E_(cell)=-0.059log((C_(2))/(C_(1)))=0.059log((C_(1))/(C_(2)))` So, `C_(1) gt C_(2)`, so for the SPONTANEOUS reaction `C_(2) gt C_(1)` is not proper. |
|
| 17. |
Choose correct combination for x,y and z |
|
Answer» <P>(I)(II)(R)
|
|
| 18. |
Choose correct combination for x,y and z |
|
Answer» <P>(II)(i)(Q)
|
|
| 19. |
Choose anINCORRECT statement from the following. |
|
Answer» In case of PRIMARY, SECONDARY and tertiary amines, the basic STRENGTH depends on the extent of HYDROGEN BONDING in the protonated amines. |
|
| 20. |
Choose a FALSE statement about CHCl_(3) from the following. |
|
Answer» It was used as an ANAESTHETIC in earlier days. |
|
| 21. |
Cholor ethane reacts with X to form diethyl ether. What is X ? |
|
Answer» NAOH |
|
| 22. |
Cholesterol, when isolated from natural sources, is obtained as a single enantiomer. The observed rotation alpha of a 0.3 g sample of cholesterol in 5mL of chloroform solution contained in a 10 cm polarimeter tube is -0.78^(@). Calculate the specific rotation of cholesterol. A sample of synthetic cholesterol was prepared consisting entirely of (+)-cholesterol. This synthetic (+)-cholesterol was mixed with some natural (-)-cholesterol. The mixture had a specific rotation [alpha]_(D)^(20) " of " -13^(@). What fraction of the mixture was (+)-cholesterol ? |
|
Answer» SOLUTION :Specific rotation `=[alpha]_(t)^(lambda) =(theta)/(t xx c) = -(0.78)/(1 xx (0.3)/(15)) - 39^(@)` Enantiomeric EXCESS `=("observed optical rotation")/("optical rotation of pure enantionmer") xx 100 = (-13)/(-39) xx 100 = 33.3%.` Therefore (+)-cholesterol is of 33.3% and (-)-cholesterol is of 66.6% in the mixture. |
|
| 23. |
Cholesteryl alcohol commonly known as …………………… is an important component in our ……………… . |
| Answer» SOLUTION :CHOLESTEROL, CELL MEMBRANE | |
| 24. |
Cholesterol that is present in the blood serum is closely associated with |
|
Answer» HARDENING of the arteries |
|
| 25. |
CHO-CHO→overset (OH^-) X the product is: |
|
Answer» `CH_3OH + CH_3OH` |
|
| 26. |
CHO-CHOto overset(OH^-) X the product is: |
|
Answer» `CH_3OH + CH_3OH` |
|
| 27. |
Chlorous acid and its salts (chlorites) are: |
|
Answer» GOOD OXIDISING agents |
|
| 28. |
Chlorosulphuric acid is formed when H_SO_4 react with |
|
Answer» `SOCl_(2)` |
|
| 29. |
Chlorotone used as a drug is prepared by the reaction of acetone with : |
|
Answer» Chlorin |
|
| 31. |
Chloroquine is an example of : |
|
Answer» Antipyretic |
|
| 32. |
Chloroprene is the repeating unit of : |
|
Answer» POLYSTYRENE |
|
| 33. |
Chloroprene is the repeating unit in : |
|
Answer» POLYSTYRENE |
|
| 34. |
Chloroplatinic acid is: |
|
Answer» monobasic |
|
| 36. |
Chloropicrin is used as an ………………….. |
|
Answer» |
|
| 37. |
Chloropicrin is used as |
|
Answer» Solvent |
|
| 38. |
Chloropicrin is obtained by the reaction of |
|
Answer» steam on carbon tetrachloride `UNDERSET("Chloroform")(H"CC"l_3)overset((conc.)HNO_3)rarrunderset("Chloropicrin")(O_2N"CC"l_3)` |
|
| 39. |
Chloropicrin is obtained by the reaction of : |
|
Answer» NITRIC ACID on chlorobenzene |
|
| 40. |
Chloropicrin (C Cl_3NO_2) is used as |
|
Answer» dyes |
|
| 41. |
Chlorophyll, the green colouring matter of plants responsible for photosynthesis, contains 2.68% of magnesium by weight. Calculate the number of magnesium atoms in 2.0 g of chlorophyll. |
|
Answer» `THEREFORE " 2G chlorophyll will CONTAIN Mg"=(2.68)/(100)xx2=0.0536g` 1 mole of Mg = 24 g =`6.022xx10^(23)" ATOMS"` `therefore""0.0536gMg=(6.022xx10^(23))/(24)xx0.0536"atoms"=1.345xx10^(21)"atoms"` |
|
| 42. |
Chlorophyll which is responsible for photosynthesis is a complex compound of |
|
Answer» Mg |
|
| 43. |
Chloropicrin(Nitrochloroform) used as an insectiside and a war gasis : |
|
Answer» `CH_2ClCCl_3` |
|
| 44. |
Chlorophyll, the green colouring matter of plants, contains 2.68% of magnesium by mass. Calculate the number of magnesium atoms is 3.00g of chlorophyll. [Atomic mass of magnesium=24.3g] |
|
Answer» Solution :Mass of magnesium in 300g of chlorophyll `=(2.68xx3)/(100)=0.080g` 24.3g of MG CONTAINS`=6.02xx10^(23)` atoms 0.080g of Mg contains =`(6.02xx10^(23))/(24.3)xx0.080` `=1.98xx10^(21)` atoms. |
|
| 45. |
Chlorophyll is the green colouring matter of plant . It contains the element |
|
Answer» Sodium |
|
| 46. |
Chlorophyll is a co-ordination compound having central atom of: |
|
Answer» Ca |
|
| 47. |
Chlorophyll is a biomolecule responsible for green colour in the plants. Chlorophyll contains 2.68% of magnesium by mass. Calculate the number of magnesium atoms in 6 g of chlorophyll (Mg = 24) |
|
Answer» `2.01 xx 10^(21)` |
|
| 48. |
Chlorophyll contains the metal: |
|
Answer» AI |
|
| 50. |
Chloronation of propaneiscarriedoutin thepresenceof sunliht,The %yield major and minoralkyl halides willbe : |
Answer» Solution :
|
|