Explore topic-wise InterviewSolutions in Current Affairs.

This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.

1.

Two gaseous equilibria SO2(g)+12O2(g)⇌SO3(g) and 2SO3(g)⇌2SO2(g)+O2(g) have equilibrium constants K1 and K2 respectively at 298 K. Which of the following relationships between K1 and K2 is correct:

Answer»

Two gaseous equilibria SO2(g)+12O2(g)SO3(g) and 2SO3(g)2SO2(g)+O2(g) have equilibrium constants K1 and K2 respectively at 298 K. Which of the following relationships between K1 and K2 is correct:

2.

How much copper can be obtained from 100g of copper sulphate (CuSO4)?

Answer»

How much copper can be obtained from 100g of copper sulphate (CuSO4)?

3.

Which of the carbon atoms present in the molecule given below are asymmetric? (a) 1,2,3,4 (b) 2,3 (c) 1,4 (d) 1,2,3

Answer»

Which of the carbon atoms present in the molecule given below are asymmetric?

(a) 1,2,3,4 (b) 2,3 (c) 1,4 (d) 1,2,3

4.

The correct increasing order of heat of hydrogenation for the following compounds is:

Answer»

The correct increasing order of heat of hydrogenation for the following compounds is:




5.

The equivalent conductance of 0.1 N solution of MgCl2 is 25 Ω−1cm2eq−1 at 25 ∘C. A cell with electrodes that are 2 cm2 in surface area and 0.5 cm apart is filled with 0.1 N MgCl2 solution. How much current (in A) will flow when the potential difference between the electrodes is 5 Volts?

Answer»

The equivalent conductance of 0.1 N solution of MgCl2 is 25 Ω1cm2eq1 at 25 C. A cell with electrodes that are 2 cm2 in surface area and 0.5 cm apart is filled with 0.1 N MgCl2 solution. How much current (in A) will flow when the potential difference between the electrodes is 5 Volts?

6.

General formula of primary alcohol is [CPMT 1975]

Answer»

General formula of primary alcohol is [CPMT 1975]


7.

5. In fcc lattice of NaCl structure ,if the diameter of Na+ is=x, and the redius of Cl - is y, then what is the edge length of NaCl in the crystal ?

Answer» 5. In fcc lattice of NaCl structure ,if the diameter of Na+ is=x, and the redius of Cl - is y, then what is the edge length of NaCl in the crystal ?
8.

25. If 0.5 litre of a 0.6M SnSO4 solution is electrolysed for a period of 30 minutes using a current of 4.6 ampere and inert electrodes are used. what is the final concentration of Sn+2 ion remaining in the solution (atomic weight of Sn -119) A)0.342M B)0.544M C)0.389M D)0.514M

Answer» 25. If 0.5 litre of a 0.6M SnSO4 solution is electrolysed for a period of 30 minutes using a current of 4.6 ampere and inert electrodes are used. what is the final concentration of Sn+2 ion remaining in the solution (atomic weight of Sn -119) A)0.342M B)0.544M C)0.389M D)0.514M
9.

What is the common name for C6H5COCH2Cl? Is it differ from the common name of C6H4ClCOCH3?

Answer» What is the common name for C6H5COCH2Cl? Is it differ from the common name of C6H4ClCOCH3?
10.

2M solution of Na2CO3 is boiled in a closed container with excess of CaF2. Very little amount of CaCO3 and NaF are formed. If the solubility product (Ksp of CaCO3 is x and molar solubility of CaF2 is y, find the molar concentration of F− in resulting solution after equilibrium is attained.

Answer» 2M solution of Na2CO3 is boiled in a closed container with excess of CaF2. Very little amount of CaCO3 and NaF are formed. If the solubility product (Ksp of CaCO3 is x and molar solubility of CaF2 is y, find the molar concentration of F in resulting solution after equilibrium is attained.
11.

The ratio of slopes of maximum kinetic energy versus frequency and stopping potential vs frequency is ?

Answer» The ratio of slopes of maximum kinetic energy versus frequency and stopping potential vs frequency is ?
12.

The oxidation state of Oxygen in KO2 is

Answer»

The oxidation state of Oxygen in KO2 is



13.

How to integrate a function with respect to other functione. g integrate√x.dt

Answer» How to integrate a function with respect to other function
e. g integrate√x.dt
14.

The product(s) when dichlorine hexoxide reacts with NaOH is(are):

Answer»

The product(s) when dichlorine hexoxide reacts with NaOH is(are):



15.

8. Draw all the isomers(geometrical and optical) of (I) [Co(NH3)Cl(en)2]2+ (II)[Co(NH3)2Cl2(en)]1+

Answer» 8. Draw all the isomers(geometrical and optical) of (I) [Co(NH3)Cl(en)2]2+ (II)[Co(NH3)2Cl2(en)]1+
16.

What are the physical properties of hydrogen chloride gas?

Answer»

What are the physical properties of hydrogen chloride gas?
17.

what is the order of badicity for the following compounds? 1)ortho nitro phenol 2)phenol 3)3-methyl cycohexanol 4)3-methyl pheno

Answer» what is the order of badicity for the following compounds? 1)ortho nitro phenol 2)phenol 3)3-methyl cycohexanol 4)3-methyl pheno
18.

Least stable alkene among the following given alkenes is

Answer»

Least stable alkene among the following given alkenes is

19.

How many numbers of statements are correct for [Q]?(a) It is electron deficient.(b) It is planar.(c) Non-polar.(d) It has sp3 hybridised atom(e) [Q]+THF→[S], hybridisation of oxygen atom is same in [S].

Answer»

How many numbers of statements are correct for [Q]?



(a) It is electron deficient.

(b) It is planar.

(c) Non-polar.

(d) It has sp3 hybridised atom

(e) [Q]+THF[S], hybridisation of oxygen atom is same in [S].


20.

Dipole moment of chlorobenzene is 1.1D hence dipole moment of given compound will be

Answer» Dipole moment of chlorobenzene is 1.1D hence dipole moment of given compound will be
21.

16. What is the pH of 10^{-8} M of dilute HCl

Answer» 16. What is the pH of 10^{-8} M of dilute HCl
22.

The standard enthalpies of formation at 300 K for CCl4(l), H2O(g), CO2(g) and HCl(g) are −107,−242,−394 and −93 kJ mol−1 respectively. The value of ΔU for the following reaction at 300 K is: CCl4(l)+2H2O(g)→CO2(g)+4HCl(g)

Answer»

The standard enthalpies of formation at 300 K for CCl4(l), H2O(g), CO2(g) and HCl(g) are 107,242,394 and 93 kJ mol1 respectively. The value of ΔU for the following reaction at 300 K is:

CCl4(l)+2H2O(g)CO2(g)+4HCl(g)

23.

Column - IColumn - II(a) 3,3,4,4-tetramethyl-1-pentyne(p) Has only three collinear carbons(b) 2-butyne(q) Has four collinear carbons(c) 1-butyne(r) Substitution of H by Cl gives single product(d) 2,2,5,5-tetramethyl-3-hexyne(s) Substitution of H by Cl gives three differentproduct (excluding stereoisomers)

Answer» Column - IColumn - II(a) 3,3,4,4-tetramethyl-1-pentyne(p) Has only three collinear carbons(b) 2-butyne(q) Has four collinear carbons(c) 1-butyne(r) Substitution of H by Cl gives single product(d) 2,2,5,5-tetramethyl-3-hexyne(s) Substitution of H by Cl gives three differentproduct (excluding stereoisomers)
24.

AT temperature T, a compound AB2(g) dissociates according to the reaction, 2AB2(g)⇌2AB(g)+B2(g) with a degree of dissociation, x (where x << 1). If KP and P are equilibrium constant and equilibrium pressure respectively, the value of x is

Answer»

AT temperature T, a compound AB2(g) dissociates according to the reaction,
2AB2(g)2AB(g)+B2(g) with a degree of dissociation, x (where x << 1). If KP and P are equilibrium constant and equilibrium pressure respectively, the value of x is


25.

The enthpaly combution at 25 ∘C of H2, cyclohexane (C6H12) and cyclohexene (C6H10) are −241, −3920 and −3800 kJ/mol respectively. The heat of hydrogenation of cyclohexenes:

Answer»

The enthpaly combution at 25 C of H2, cyclohexane (C6H12) and cyclohexene (C6H10) are 241, 3920 and 3800 kJ/mol respectively. The heat of hydrogenation of cyclohexenes:

26.

What is the difference between crystal field stabilization energy & crystal field splitting energy?

Answer» What is the difference between crystal field stabilization energy & crystal field splitting energy?
27.

One mole of an ideal gas at standard temperature and pressure occupies 22.4 L (molar volume). What is the ratio of molar volume to the atomic volume of a mole of hydrogen? (Take the size of hydrogen molecule to be about 1). Why is this ratio so large?

Answer»

One mole of an ideal gas at standard temperature and pressure occupies 22.4 L (molar volume). What is the ratio of molar volume to the atomic volume of a mole of hydrogen? (Take the size of hydrogen molecule to be about 1). Why is this ratio so large?

28.

Assertion: Plastic bags remain as harmful substances in both soil and water.Reason: Soil microflora lacks bio-catalysts for rendering plastics harmless.

Answer»

Assertion: Plastic bags remain as harmful substances in both soil and water.


Reason: Soil microflora lacks bio-catalysts for rendering plastics harmless.



29.

The electron energy in hydrogen atom is given by En=(–2.18×10–18)/n2 J. Calculate the energy required to remove an electron completely from the n = 2 orbit. What is the longest wavelength of light in cm that can be used to cause this transition?

Answer»

The electron energy in hydrogen atom is given by En=(2.18×1018)/n2 J. Calculate the energy required to remove an electron completely from the n = 2 orbit. What is the longest wavelength of light in cm that can be used to cause this transition?

30.

Writestructures of the compounds whose IUPAC names are as follows:(i) 2-Methylbutan-2-ol (ii) 1-Phenylpropan-2-ol(iii) 3,5-Dimethylhexane −1, 3, 5-triol (iv) 2,3 − Diethylphenol(v) 1 − Ethoxypropane (vi) 2-Ethoxy-3-methylpentane(vii) Cyclohexylmethanol (viii) 3-Cyclohexylpentan-3-ol(ix) Cyclopent-3-en-1-ol (x) 3-Chloromethylpentan-1-ol.

Answer»

Write
structures of the compounds whose IUPAC names are as follows:


(i)
2-Methylbutan-2-ol


(ii)
1-Phenylpropan-2-ol


(iii)
3,5-Dimethylhexane −1, 3, 5-triol


(iv)
2,3 − Diethylphenol


(v)
1 − Ethoxypropane


(vi)
2-Ethoxy-3-methylpentane


(vii)
Cyclohexylmethanol


(viii)
3-Cyclohexylpentan-3-ol


(ix)
Cyclopent-3-en-1-ol


(x)
3-Chloromethylpentan-1-ol.

31.

7. Predict the products of electrolysis:- a)Aqueous solution of AgNO3 with Ag electrodes. b)Aqueous solution of AgNO3 with Platinum electrodes. c)Aqueous solution of CuCl2 with Platinum electrodes. d) Dilute solution of H2SO4 with Platinum electrodes.

Answer» 7. Predict the products of electrolysis:- a)Aqueous solution of AgNO3 with Ag electrodes. b)Aqueous solution of AgNO3 with Platinum electrodes. c)Aqueous solution of CuCl2 with Platinum electrodes. d) Dilute solution of H2SO4 with Platinum electrodes.
32.

The amount of (NH2)4SO4 in g, which must be added to 500 mL of 0.2 M NH3 to yield a solution of pH=9.35., if Kb for NH3=1.6×10−5 will be:( Give your answer upto two decimal only.)(Given, log1.6=0.2,log70=1.85)

Answer» The amount of (NH2)4SO4 in g, which must be added to 500 mL of 0.2 M NH3 to yield a solution of pH=9.35., if Kb for NH3=1.6×105 will be:( Give your answer upto two decimal only.)

(Given, log1.6=0.2,log70=1.85)


33.

When phenyl magnesium bromide reacts with t-bu†an ol,the product would b

Answer» When phenyl magnesium bromide reacts with t-bu†an ol,the product would b
34.

9. Acetic acid is reacted with chlorine in presence of P. The product is treated with HCN(KCN) followed by acidic hydrolysis. What is the final product?

Answer» 9. Acetic acid is reacted with chlorine in presence of P. The product is treated with HCN(KCN) followed by acidic hydrolysis. What is the final product?
35.

Cell constant is

Answer»

Cell constant is

36.

what happens when chlorine is added to toluene in presence of catalyst , does it form chloro methyl benzene or 4-chloro toluene?

Answer» what happens when chlorine is added to toluene in presence of catalyst , does it form chloro methyl benzene or 4-chloro toluene?
37.

In which of the following reactions Markovnikov’s rule is not observed?

Answer»

In which of the following reactions Markovnikov’s rule is not observed?



38.

What is difference between ' qualitative and quantitative reasoning ' and mathematical modellingSteps of scientific method

Answer» What is difference between ' qualitative and quantitative reasoning ' and mathematical modelling
Steps of scientific method
39.

parahydroxybenzophenone + Br2 in CCl4 medium →

Answer» parahydroxybenzophenone + Br2 in CCl4 medium →
40.

Can the proof that 'equivalent masses of all the species involved in chemical reaction are equal' be explained in more elaborate yet in simple manner.

Answer» Can the proof that 'equivalent masses of all the species involved in chemical reaction are equal' be explained in more elaborate yet in simple manner.
41.

define the following- 1.1volt 2. 1farad 3. 1coulomb 4. 1juole 5. 1weber

Answer» define the following- 1.1volt 2. 1farad 3. 1coulomb 4. 1juole 5. 1weber
42.

Magnetic moment of (NH4)2MnBr4 (in BM is):

Answer» Magnetic moment of (NH4)2MnBr4 (in BM is):

43.

Calculate the enthalpy of combustion of ethylene at 300 K at constant pressure if it's enthalpy of combustion at constant volume is -1406 kJ/mol

Answer» Calculate the enthalpy of combustion of ethylene at 300 K at constant pressure if it's enthalpy of combustion at constant volume is -1406 kJ/mol
44.

Differentiate between globular and fibrous proteins.

Answer»

Differentiate
between globular and fibrous proteins.

45.

silica which type of solid (crystalline/amophus

Answer» silica which type of solid (crystalline/amophus
46.

A pure substance which contains only one type of atoms is called:

Answer»

A pure substance which contains only one type of atoms is called:



47.

3. how to compare bond length of CO bond in complex compound such as [Fe(CO)4] and [Cr(CO)4]?

Answer» 3. how to compare bond length of CO bond in complex compound such as [Fe(CO)4] and [Cr(CO)4]?
48.

2. 76 g of silver carbonate on being strongly heated at quiet high temperature yields a residue weighing

Answer» 2. 76 g of silver carbonate on being strongly heated at quiet high temperature yields a residue weighing
49.

5) Two slabs of different materials have same length and area of cross-section. They are joined in series. If their thermal conductivities are 6 Wm–1 K–1 and 3 Wm–1 K–1, then their equivalent conductivity isOptions:a) 4 Wm–1 K–1b) 4.5 Wm–1 K–1c) 6 Wm–1 K–1d) 3 Wm–1 K–1

Answer» 5) Two slabs of different materials have same length and area of cross-section. They are joined in series. If their thermal conductivities are 6 Wm–1 K–1 and 3 Wm–1 K–1, then their equivalent conductivity is
Options:
a) 4 Wm–1 K–1
b) 4.5 Wm–1 K–1
c) 6 Wm–1 K–1
d) 3 Wm–1 K–1
50.

How can benzene take electrons towards itself when an electron withdrawal group is attached to benzene

Answer» How can benzene take electrons towards itself when an electron withdrawal group is attached to benzene