Explore topic-wise InterviewSolutions in Current Affairs.

This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.

1.

why benzamide is least reactive towards water

Answer» why benzamide is least reactive towards water
2.

19.The pH of a 10power-10NaOH solution is nearest to

Answer» 19.The pH of a 10power-10NaOH solution is nearest to
3.

The half life period of a first order reaction is 10 minutes. The time required for the cocentration of the reac†an t to change from 0.08 to 0.02 is:

Answer» The half life period of a first order reaction is 10 minutes. The time required for the cocentration of the reac†an t to change from 0.08 to 0.02 is:
4.

Initiatiors that are used in cationic polymerization is/are Options: Should have chosen KNO2 Wrong 3º–butylperoxide H2SO4 BF3 with little amount of H2O

Answer» Initiatiors that are used in cationic polymerization is/are Options: Should have chosen KNO2 Wrong 3º–butylperoxide H2SO4 BF3 with little amount of H2O
5.

Choose from the followings options an appropriate option: An aqueous salt solution used for testing sulphate radical.

Answer»

Choose from the followings options an appropriate option:

An aqueous salt solution used for testing sulphate radical.


6.

calculate the normality of250 ml aqueous solution ofH2SO4 having pH=0.0

Answer» calculate the normality of250 ml aqueous solution ofH2SO4 having pH=0.0
7.

28.If a certain solution process is endothermic and the solution is subsequently diluted then, 1.more heat will be absorbed by the same solution from the surrounding 2.more heat will be liberated to the surrounding 3. No heat will be absorbed or liberated

Answer» 28.If a certain solution process is endothermic and the solution is subsequently diluted then, 1.more heat will be absorbed by the same solution from the surrounding 2.more heat will be liberated to the surrounding 3. No heat will be absorbed or liberated
8.

Name the following compounds according to IUPAC system of nomenclature: (i) CH3CH(CH3)CH2CH2CHO (ii) CH3CH2COCH(C2H5)CH2CH2Cl (iii) CH3CH=CHCHO (iv) CH3COCH2COCH3 (v) CH3CH(CH3)CH2C(CH3)2COCH3 (vi) (CH3)3CCH2COOH (vii) OHCC6H4CHO-p

Answer»

Name
the following compounds according to IUPAC system of nomenclature:


(i)
CH3CH(CH3)CH2CH2CHO


(ii)
CH3CH2COCH(C2H5)CH2CH2Cl


(iii)
CH3CH=CHCHO


(iv)
CH3COCH2COCH3


(v)
CH3CH(CH3)CH2C(CH3)2COCH3


(vi)
(CH3)3CCH2COOH


(vii)
OHCC6H4CHO-p

9.

In an octathedral molecule the no. of bonds with a bond angle of 90 degrees is ? Is there any bond with an angle of 120 degrees ?

Answer» In an octathedral molecule the no. of bonds with a bond angle of 90 degrees is ? Is there any bond with an angle of 120 degrees ?
10.

27. A certain mass of a gas occupies a volume of 2 litres at STP. Keeping the pressure constant,at what temperature world the gas occupy a volume of 4 litres?

Answer» 27. A certain mass of a gas occupies a volume of 2 litres at STP. Keeping the pressure constant,at what temperature world the gas occupy a volume of 4 litres?
11.

If there were 8 periods in the periodic table and each orbital could have a maximum of 5 electrons, then what is the maximum number of elements that would be present in period 8?

Answer»

If there were 8 periods in the periodic table and each orbital could have a maximum of 5 electrons, then what is the maximum number of elements that would be present in period 8?

12.

arrange the following compounds in order of sn2 reaction:1)ch3(ch2)3ch2Br; (2) (ch3)2chch2ch2Br ;3) ch3ch2ch(ch3)ch2Br;4) ch3(ch3)2cch2B

Answer» arrange the following compounds in order of sn2 reaction:1)ch3(ch2)3ch2Br; (2) (ch3)2chch2ch2Br ;3) ch3ch2ch(ch3)ch2Br;4) ch3(ch3)2cch2B
13.

If phosphorous acid, tetrathionic acid, and pyrophosphoric acid have number of acidic hydrogen per molecule respectively as x, y, and z, then find the value of x+y−z.

Answer» If phosphorous acid, tetrathionic acid, and pyrophosphoric acid have number of acidic hydrogen per molecule respectively as x, y, and z, then find the value of x+yz.


14.

how many H atoms are present in 4g of ch4?

Answer» how many H atoms are present in 4g of ch4?
15.

We start with 2-cyclohexenone and subject it to (separate) reagents/reaction sequences A, B, C and D. Each of these correspondingly yields the products. From the options given, choose the correct ones that could be the reaction sequences

Answer»

We start with 2-cyclohexenone and subject it to (separate) reagents/reaction sequences A, B, C and D.
Each of these correspondingly yields the products.

From the options given, choose the correct ones that could be the reaction sequences


16.

Molarity of 40% NaOH (w/w) solution is 12M. Its density will be?

Answer» Molarity of 40% NaOH (w/w) solution is 12M. Its density will be?
17.

What weight of AgCl in grams will be precpitated when a solution containing 2.925 g NaCl is added to a solution of 5.1 g of AgNO3 (Given : Molecular Mass of NaCl=58.5 and AgNO3=170 (Give your answer upto two decimal only)

Answer» What weight of AgCl in grams will be precpitated when a solution containing 2.925 g NaCl is added to a solution of 5.1 g of AgNO3 (Given : Molecular Mass of NaCl=58.5 and AgNO3=170
(Give your answer upto two decimal only)

18.

15.Why hybridised orbitals cannot form pi bond but can form sigma bonds ?

Answer» 15.Why hybridised orbitals cannot form pi bond but can form sigma bonds ?
19.

50.0 kg of N2(g) and 10.0kg of H2(g) are mixed to produce NH3(g). Calculate the NH3(g) formed. Identify the limiting reagent in the production of NH3 in this situation.

Answer» 50.0 kg of N2(g) and 10.0kg of H2(g) are mixed to produce NH3(g). Calculate the NH3(g) formed. Identify the limiting reagent in the production of NH3 in this situation.
20.

how many geometrical isomers are possible for CH3-CH=CH-CH=CH-Cl

Answer» how many geometrical isomers are possible for CH3-CH=CH-CH=CH-Cl
21.

54 Calculate the mole percentage of CH3OH and H2O respetively in 60%[by mass] aqueous solution of CH3OH?

Answer» 54 Calculate the mole percentage of CH3OH and H2O respetively in 60%[by mass] aqueous solution of CH3OH?
22.

What is the basic rule in naming compounds as iso,sec,tert,neo etcc Eg.sec butyl

Answer» What is the basic rule in naming compounds as iso,sec,tert,neo etcc Eg.sec butyl
23.

Explain Bragg's law. Explain thoroughly.

Answer» Explain Bragg's law. Explain thoroughly.
24.

Which of the following is an example of vic-dihalide? (a) Dichloromethane (b) 1, 2-dichloroethane (c) Ethylidene chloride (d) Allyl chloride

Answer»

Which of the following is an example of vic-dihalide?

(a) Dichloromethane (b) 1, 2-dichloroethane

(c) Ethylidene chloride (d) Allyl chloride

25.

0.3400 how many significant figure are there? 2 or 4?

Answer» 0.3400 how many significant figure are there? 2 or 4?
26.

9. What is the distance between two tetrahedral voids?

Answer» 9. What is the distance between two tetrahedral voids?
27.

For the rxn, 1g mole of CaCO3 is enclosed in a 5L vessel. CaCO3(s) --------> CaO(s)+CO2(g)Kp = 1.16 at 1073 K then % dissociation of CaCO3 is A) 0B) 6.58C) 65D) 100

Answer» For the rxn, 1g mole of CaCO3 is enclosed in a 5L vessel. CaCO3(s) --------> CaO(s)+CO2(g)
Kp = 1.16 at 1073 K then % dissociation of CaCO3 is
A) 0
B) 6.58
C) 65
D) 100
28.

Which of the following is NOT a part of the AYUSH programme?

Answer»

Which of the following is NOT a part of the AYUSH programme?


29.

ntWhy is it said in many places that maximun electrons in an orbital are 2 but it is contradicted by the capacity of orbital s=2,p=6,d=10,f=14?n

Answer» ntWhy is it said in many places that maximun electrons in an orbital are 2 but it is contradicted by the capacity of orbital s=2,p=6,d=10,f=14?n
30.

An electron in a single H- atom is excited to 5th excited state , maximum number of lines observed will be?

Answer» An electron in a single H- atom is excited to 5th excited state , maximum number of lines observed will be?
31.

Give the structures ofA, B and C in the following reactions:(i) (ii) (iii) (iv) (v) (vi)

Answer»

Give the structures of
A, B and C in the following reactions:


(i)


(ii)



(iii)



(iv)



(v)



(vi)

32.

A hydrocarbon, 'X' (C3H4) decolourises Br2/CCl4 solution forming 'Y'. 'X' gave a red precipitate of a compound 'Z' with ammoniacal cuprous chloride. X, Y, and Z respectively are:

Answer»

A hydrocarbon, 'X' (C3H4) decolourises Br2/CCl4 solution forming 'Y'. 'X' gave a red precipitate of a compound 'Z' with ammoniacal cuprous chloride.
X, Y, and Z respectively are:

33.

N2 and O2 are converted into monoanions N2- and O2- respectively, which of the following statements is wrong? 1) In O2- bond length increases 2) N2- becomes diamagnetic 3) In N2-the N-N bond weakens 4) In O2- the O-O bond order decreases

Answer» N2 and O2 are converted into monoanions N2- and O2- respectively, which of the following statements is wrong? 1) In O2- bond length increases 2) N2- becomes diamagnetic 3) In N2-the N-N bond weakens 4) In O2- the O-O bond order decreases
34.

Which is more stable -C6H4O orCH3C6H3O

Answer»

Which is more stable -C6H4O orCH3C6H3O

35.

The proper solublity trend of NA2SO4 solutionwill be?

Answer» The proper solublity trend of NA2SO4 solutionwill be?
36.

If threshold frequency for a metal is 5×1014 Hz. Find the ratio of (K.E)max of emitted electrons when its surface is irradiated with radiations of frequencies 7×1014 Hz and 9×1014 Hz respectively.

Answer»

If threshold frequency for a metal is 5×1014 Hz. Find the ratio of (K.E)max of emitted electrons when its surface is irradiated with radiations of frequencies 7×1014 Hz and 9×1014 Hz respectively.

37.

For 2SO2 + O2→ 2SO3 rate of disappearanceof SO2 is 4 x 10 power minus 3 M-s-1 ,at t=10 sec. Then, the amount of SO3 formed & amount of O2 consumed at t 10 sec respectively are

Answer» For 2SO2 + O2→ 2SO3 rate of disappearanceof SO2 is 4 x 10 power minus 3 M-s-1 ,at t=10 sec. Then, the amount of SO3 formed & amount of O2 consumed at t 10 sec respectively are
38.

When diazonium salt solution is treated with KI, it forms:

Answer»

When diazonium salt solution is treated with KI, it forms:


39.

11. What is the monomer of CH2C(CH3)2CH2C(+)(CH3)2 ?

Answer» 11. What is the monomer of CH2C(CH3)2CH2C(+)(CH3)2 ?
40.

The shape of methyl carbocation is:

Answer»

The shape of methyl carbocation is:



41.

what is octahedral void unit cell?

Answer» what is octahedral void unit cell?
42.

a gas has been stored below its critical temperature what values of Z cannot be achieved for this ga

Answer» a gas has been stored below its critical temperature what values of Z cannot be achieved for this ga
43.

How much work in kJ mol−1 unit is done by reversible and isothermal expansion of 1.2 mole of an ideal gas to 10 times of its original volume at 27oC ?

Answer»

How much work in kJ mol1 unit is done by reversible and isothermal expansion of 1.2 mole of an ideal gas to 10 times of its original volume at 27oC ?

44.

Difference between mole and molecule and when do we write mole and molecule while finding no. of atoms or molecules

Answer»

Difference between mole and molecule and when do we write mole and molecule while finding no. of atoms or molecules

45.

Edge length of a cubic unit cell is 400 pm. Its face diagonal would be

Answer»

Edge length of a cubic unit cell is 400 pm. Its face diagonal would be


46.

A uniform thin film of alcohol (n=1.36) lies on a flat glass plate (n = 1.56). when mono chromatic light, whose wavelength can be changed, is incident normally, the reflected light is a minimum for λ=512 nm and a maximum for λ=635 nm. What is the minimum thickness of the film ?

Answer» A uniform thin film of alcohol (n=1.36) lies on a flat glass plate (n = 1.56). when mono chromatic light, whose wavelength can be changed, is incident normally, the reflected light is a minimum for λ=512 nm and a maximum for λ=635 nm. What is the minimum thickness of the film ?
47.

Prove that the time required for the completion of 3/4th of reaction of first order is twice the time required for the completion of half of the reaction.

Answer» Prove that the time required for the completion of 3/4th of reaction of first order is twice the time required for the completion of half of the reaction.
48.

Why does the first ionization enthalpy is have higher electron gain enthalpy

Answer»

Why does the first ionization enthalpy is have higher electron gain enthalpy

49.

From chemistry which lesson has more weightage in the competitive exam including syllabus of 11th class

Answer»

From chemistry which lesson has more weightage in the competitive exam including syllabus of 11th class

50.

What mass of isobutylene is obtained from 37 g of tertiary butyl alcohol by heating with 20% H2SO4 at 363 K, if the yield is 65%?

Answer» What mass of isobutylene is obtained from 37 g of tertiary butyl alcohol by heating with 20% H2SO4 at 363 K, if the yield is 65%?