This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
Consider the following cell reaction: 2AgCl(s)+H2(g)→2Ag(s)+2H+(aq)+2Cl−(aq);Eo=0.19 V At [Cl−]=10−3 M and PH2=0.01 atm, if the cell potential is 0.43 V at 25 oC the pH is: (Take 2.303R×298F=0.06). |
|
Answer» Consider the following cell reaction: 2AgCl(s)+H2(g)→2Ag(s)+2H+(aq)+2Cl−(aq);Eo=0.19 V At [Cl−]=10−3 M and PH2=0.01 atm, if the cell potential is 0.43 V at 25 oC the pH is: (Take 2.303R×298F=0.06). |
|
| 2. |
The standard reduction potential values of three metallic cations, X,Y,Z are 0.52,−3.03 and −1.18 V respectively. The order of reducing power of the corresponding metals is: |
|
Answer» The standard reduction potential values of three metallic cations, X,Y,Z are 0.52,−3.03 and −1.18 V respectively. The order of reducing power of the corresponding metals is: |
|
| 3. |
TheEθ(M2+/M)value for copper is positive (+0.34V). What is possibly the reasonfor this? (Hint: consider its high ΔaHθand low ΔhydHθ) |
|
Answer» The |
|
| 4. |
If 1st ionization energy of Li(g) is 5.39 eV and Li(g)→Li3+(g)+3e− ΔH=+203.43 eV Then the ionisation energy of Li+ is |
|
Answer» If 1st ionization energy of Li(g) is 5.39 eV and Li(g)→Li3+(g)+3e− ΔH=+203.43 eV Then the ionisation energy of Li+ is |
|
| 5. |
'B' in the above reaction is: |
Answer» ![]() 'B' in the above reaction is: |
|
| 6. |
Q. The non stoichiometriccompound Fe0.94O is formedwhen x % of Fe2+ ions are replaced by as manyFe3+ ion .then find |
| Answer» Q. The non stoichiometriccompound Fe0.94O is formedwhen x % of Fe2+ ions are replaced by as manyFe3+ ion .then find | |
| 7. |
Which of the following reactions involves disproportionation reaction2H2SO4+Cu---CuSO4+2H2O+SO2As2O3+3H2S---As2S3+3H2O2KOH+Cl2---KCl+KOCl+H2OCa3P2+6H2O---Ca(OH)2+2PH3 |
|
Answer» Which of the following reactions involves disproportionation reaction 2H2SO4+Cu---CuSO4+2H2O+SO2 As2O3+3H2S---As2S3+3H2O 2KOH+Cl2---KCl+KOCl+H2O Ca3P2+6H2O---Ca(OH)2+2PH3 |
|
| 8. |
What is solid angle |
| Answer» What is solid angle | |
| 9. |
why deuterium mostly in the form of H |
| Answer» why deuterium mostly in the form of H | |
| 10. |
Explain: (i)Zone refining (ii) Column chromatography. |
|
Answer» Explain: (i) |
|
| 11. |
For the reaction H2(g) + 12O2(g) → H2O(l),ΔH = −285.8kJmol−1 ΔS = −0.163kJmol−1K−1. What is the value of free energy change 27∘C for the reaction. |
|
Answer» For the reaction H2(g) + 12O2(g) → H2O(l),ΔH = −285.8kJmol−1 ΔS = −0.163kJmol−1K−1. What is the value of free energy change 27∘C for the reaction. |
|
| 12. |
Consider the following chemical reaction:CH≡CH(2) CO,HCl,AlCl3−−−−−−−−−−−−−−−−→(1) Red hot Fe tube,873 KProductThe number of sp2 hybridized carbon atom(s) present in the product is _____. |
|
Answer» Consider the following chemical reaction: CH≡CH(2) CO,HCl,AlCl3−−−−−−−−−−−−−−−−→(1) Red hot Fe tube,873 KProduct The number of sp2 hybridized carbon atom(s) present in the product is _____. |
|
| 13. |
Metallic gold crystallises in face centred cubic lattice. What is the approximate number of unit cells in 2 g of gold? Atomic mass of gold is 197. |
| Answer» Metallic gold crystallises in face centred cubic lattice. What is the approximate number of unit cells in 2 g of gold? Atomic mass of gold is 197. | |
| 14. |
The minimum number of NOR gates required to implement an Ex-OR gate is ____5 |
Answer» The minimum number of NOR gates required to implement an Ex-OR gate is ____
|
|
| 15. |
In a solid lattice the cation and anion both have left a lattice site. The lattice defect is known as. |
|
Answer» In a solid lattice the cation and anion both have left a lattice site. The lattice defect is known as. |
|
| 16. |
Which of the following leads to bonding? |
|
Answer» Which of the following leads to bonding? |
|
| 17. |
Which of the following hydrocarbons can decolourise bromine water and which cannot? Why? C6H12, C6H14, C6H10 |
|
Answer» Which of the following hydrocarbons can decolourise bromine water and which cannot? Why? C6H12, C6H14, C6H10 |
|
| 18. |
Consider the following sequence of the reaction:C4H6O4(A)Δ→C3H6O2(B)Sodalime−−−−−→C2H6, then A & B respectively are |
|
Answer» Consider the following sequence of the reaction:C4H6O4(A)Δ→C3H6O2(B)Sodalime−−−−−→C2H6, then A & B respectively are |
|
| 19. |
Which of the following compounds will give instant turbidity with HCl+ZnCl2? |
|
Answer» Which of the following compounds will give instant turbidity with HCl+ZnCl2? |
|
| 20. |
ethylene diamine tetraacetato structure |
| Answer» ethylene diamine tetraacetato structure | |
| 21. |
6. Which of the following is a characteristics of a reversible reaction ? (a) It never proceeds to completion. (b) It can be influenced by a catalyst. (c) It proceeds only in forward direction. (e) Number of moles of reactants and products are equal. |
| Answer» 6. Which of the following is a characteristics of a reversible reaction ? (a) It never proceeds to completion. (b) It can be influenced by a catalyst. (c) It proceeds only in forward direction. (e) Number of moles of reactants and products are equal. | |
| 22. |
what is reduction?What does the statement "Temperature of a system is reduced to average kinetic energy of molecules" mean? |
|
Answer» what is reduction? What does the statement "Temperature of a system is reduced to average kinetic energy of molecules" mean? |
|
| 23. |
Keeping the mass of earth constant if its radius is halved then calculate the duration of day |
| Answer» Keeping the mass of earth constant if its radius is halved then calculate the duration of day | |
| 24. |
Select the appropriate option. |
|
Answer» Select the appropriate option.
|
|
| 25. |
An analysis of Pyrex glass showed the presence of 12.9% of B2O3, 2.2% of Al2O3, 3.8% of Na2O, 0.4% of K2O and the remaining was SiO2. What is the ratio of silicon to boron atoms in the glass? |
|
Answer» An analysis of Pyrex glass showed the presence of 12.9% of B2O3, 2.2% of Al2O3, 3.8% of Na2O, 0.4% of K2O and the remaining was SiO2. What is the ratio of silicon to boron atoms in the glass? |
|
| 26. |
In the above reaction 'A' and 'B' will respectively be: |
Answer» ![]() In the above reaction 'A' and 'B' will respectively be: |
|
| 27. |
For the zero order reaction A→B+C, initial concentration of 'A' is 0.1 M. If 'A' is 0.08 M after 10 minutes, then the half-life and completion time for the reaction, are respectively: |
|
Answer» For the zero order reaction A→B+C, initial concentration of 'A' is 0.1 M. If 'A' is 0.08 M after 10 minutes, then the half-life and completion time for the reaction, are respectively: |
|
| 28. |
In which of the following reaction(s) major product has aromatic behaviour? |
|
Answer» In which of the following reaction(s) major product has aromatic behaviour? |
|
| 29. |
Number of Faradays required forcomplete reduction of one mol Mn304 intoMn4+ is2 |
| Answer» Number of Faradays required forcomplete reduction of one mol Mn304 intoMn4+ is2 | |
| 30. |
Which one of the following will most readily be dehydrated in acidic condition ? |
|
Answer» Which one of the following will most readily be dehydrated in acidic condition ? |
|
| 31. |
Which of the following is the correct order of SN2 decreasing reactivity? |
|
Answer» Which of the following is the correct order of SN2 decreasing reactivity? |
|
| 32. |
66 XeF average bond energy is 34kcal/mol.first ionisation energy of Xe is 279kcal/mol.and the electron affinity of F is 85kcal/mol and bond dissociation energy of F2 is 38kcal/mol then the enthalpy change for reaction is- XeF4>Xe+ +F- +F2+F 1)367kcal/mol 2)425kcal/mol 3)292kcal/mol 4)392kca/mol |
| Answer» 66 XeF average bond energy is 34kcal/mol.first ionisation energy of Xe is 279kcal/mol.and the electron affinity of F is 85kcal/mol and bond dissociation energy of F2 is 38kcal/mol then the enthalpy change for reaction is- XeF4>Xe+ +F- +F2+F 1)367kcal/mol 2)425kcal/mol 3)292kcal/mol 4)392kca/mol | |
| 33. |
in (cn)2 is coordinate bond is present |
| Answer» in (cn)2 is coordinate bond is present | |
| 34. |
At pH = 2, E∘Quinhydrone=1.30 V,EQuinhydrone will be: |
|
Answer» At pH = 2, E∘Quinhydrone=1.30 V, |
|
| 35. |
integration of log(sinx) |
| Answer» integration of log(sinx) | |
| 36. |
what would be the product formed when a limited amount of electrophilic agent reacts with conjugated diene, such as 1,3-butadiene? |
| Answer» what would be the product formed when a limited amount of electrophilic agent reacts with conjugated diene, such as 1,3-butadiene? | |
| 37. |
On rising temperature and decreasing pressure in CsCl solid why does the no. of formula unit per unit cell(Z) changes from one to four. |
| Answer» On rising temperature and decreasing pressure in CsCl solid why does the no. of formula unit per unit cell(Z) changes from one to four. | |
| 38. |
7. How to convert Gram to mole ?? |
| Answer» 7. How to convert Gram to mole ?? | |
| 39. |
20. C6H5 -(X)-> A -(Y)-> B -(Z)-> C6H5COOH. what is X,Y,Z |
| Answer» 20. C6H5 -(X)-> A -(Y)-> B -(Z)-> C6H5COOH. what is X,Y,Z | |
| 40. |
Which of the following is not a hard water? |
|
Answer» Which of the following is not a hard water? |
|
| 41. |
The product expected along with primary amine, when phthalmide is treated with alc. KOH, alkyl halide and aq. NaOH is : |
|
Answer» The product expected along with primary amine, when phthalmide is treated with alc. KOH, alkyl halide and aq. NaOH is : |
|
| 42. |
12 100 ml of O2 gas diffuses in 10 second . 100 ml of "X" diffuses in "t" second . Gas "X" & time "t" can be (a) H2 , 2.5 s (b) SO2 , 16 s (c)CO , 10 s |
| Answer» 12 100 ml of O2 gas diffuses in 10 second . 100 ml of "X" diffuses in "t" second . Gas "X" & time "t" can be (a) H2 , 2.5 s (b) SO2 , 16 s (c)CO , 10 s | |
| 43. |
66.How to find number of G.I in cycloalkanes and other cyclic compounds? |
| Answer» 66.How to find number of G.I in cycloalkanes and other cyclic compounds? | |
| 44. |
In acidic medium moles of KMnO_4 required to oxidise 1.5 moles of Cu_2S will be :-(1) 1.2 mol (2) 2.1 mol (3) 1.6 mol (4)2.4 mol |
| Answer» In acidic medium moles of KMnO_4 required to oxidise 1.5 moles of Cu_2S will be :-(1) 1.2 mol (2) 2.1 mol (3) 1.6 mol (4)2.4 mol | |
| 45. |
Using MOT, compare O+2 and O−2 species and choose the incorrect option |
|
Answer» Using MOT, compare O+2 and O−2 species and choose the incorrect option |
|
| 46. |
what is addition of HCN? |
| Answer» what is addition of HCN? | |
| 47. |
Which of the following is an α - elimination reaction? |
|
Answer» Which of the following is an α - elimination reaction? |
|
| 48. |
CCH3COOH(l)+C2H5OH(l) = CH3COOH(l)+ H2O(l)What is the equilibrium constant?? |
|
Answer» CCH3COOH(l)+C2H5OH(l) = CH3COOH(l)+ H2O(l) What is the equilibrium constant?? |
|
| 49. |
What happens when phenol is treated with ammonia in the presence of anhydrous ZnCl2? |
|
Answer» What happens when phenol is treated with ammonia in the presence of anhydrous ZnCl2? |
|
| 50. |
18 Explain syn and anti isomers in azo , aldoximes and ketoximes. Explain briefly with eamples . |
| Answer» 18 Explain syn and anti isomers in azo , aldoximes and ketoximes. Explain briefly with eamples . | |