This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
Factorise and find the product of (x+12)(x+9) |
|
Answer» ONG>ANSWER: here is ur answer hope it HELP u |
|
| 2. |
What will be the simplest form of the following ratio - 812300000:394600000 ? |
|
Answer» ONG>ANSWER: the answer is 2.05854029 |
|
| 3. |
Explain why 13 x23x29+13 is a composite number |
|
Answer» ONG>ANSWER: It is because its answer is 8684 and 8684 is divisible by 2,... By this we understand that it is composite because it has more than 2 FACTORS.. HOPE MY ANSWER HELPED!! PLS MARK AS BRAINLIEST!! |
|
| 4. |
There are 50 coins of two different denominations, two-rupee and five-rupee, in a box. If the number of two-rupee coins is 10 less than that of five-rupee coins, find the number of coins of each denominationAlso, find the amount in the boxPanin if they together scored 15 point |
|
Answer» ong>ANSWER: Step-by-step explanation: Let the no of Rs 2 COINS be x and the no of Rs 5 coins be y. x + y = 36 … (1) 2X + 5y = 84 … (2) Multiplying (1) by 2 : 2x + 2y = 72 … (3) SUBTRACTING (3) from (2) : => 2x + 5y - 2x - 2y = 84 - 72 => 3y = 12 => y = 4 So, the no of Rs 5 coins are 4.
Hope this helps you... Please mark it as brainliest!!! |
|
| 6. |
Plot the points ( -4,2 ),( 3, - 1 ),( - 1 ,0 ), and ( 0, -3) on the cariessian plane |
|
Answer» ONG>ANSWER: Hey Mate! I have attached your answer please CHECK it. |
|
| 7. |
5×5÷5-5+5 Btao kitne 5 |
|
Answer» ONG>Answer: 5×5÷5-5+5 Formula of BODMAS. B=Bract O=Of D=Divide M=Multiply A=Add S=Subtract =5×1-5+5 =5-5+5 =5-10 = -5 So ANS. is -5 |
|
| 8. |
sallem bought horse for 35000, the charges to bring is 5000. If he sales horse for 50000, then profit percent is ..... ? |
Answer» ONG>Answer:Mark as BRAINLIEST!!!Step-by-step explanation: |
|
| 9. |
(ii) (2^3)^4 = (2^2)^x find x |
|
Answer» ong>ANSWER: 6 Step-by-step explanation: Here's your answer with the ATTACHMENT..... Pls do MARK me Brainliest... Only if this was HELPFUL... ☺☺ |
|
| 11. |
The similar property between cone and cuboid |
|
Answer» cone and CUBOID does not hv any similarity except that they r 3-shapes BUT |
|
| 12. |
use euclid's division algorithm to find HCF of 567,441,693. If the HCF(567,441) = 567 a + 441 b . then find a & b |
| Answer» ONG>Answer: | |
| 13. |
In the given figure,AB||CD, angle BAE=45°, angle DCE=50° and angle CED=x°, find the value of x |
|
Answer» ONG>Answer: CED=130° Step-by-step EXPLANATION: given, BAE=45° DCE=50° =X=DCE+CED=180° =x=180°-50° =x=130° hence, the VALUE of x is 130° CED=130° |
|
| 15. |
11. Fill in the box without actual multiplication with either> or |
|
Answer» ONG>ANSWER: where is your QUESTION ? |
|
| 17. |
Find the value of tan1+tan2+tan3+.......................+tan89. |
|
Answer» ONG>Answer: 1 Step-by-step EXPLANATION: tan1×tan89......tan45 tan1×cot1......tan45 1×1 1 |
|
| 18. |
2. Complete the following table to draw the graph of the equation 2x - 6y = 3:- 5y0(x, y) |
|
Answer» ONG>Answer: 30 Step-by-step explanation: 30 |
|
| 19. |
Describe all the points that are the same distance from points A(-3, - 1) and B(5,3). Answer in the slope-intercept form. |
|
Answer» ong>Answer: To find the distance from a POINT to a line, first find the PERPENDICULAR line PASSING through the point. Then using the PYTHAGOREAN theorem, find the distance from the original point to the point of intersection between the two LINES. |
|
| 21. |
12. नीचे दिए गए वाक्यों में क्रिया-विशेषण शब्दों पर घेरा लगाइए और उनका भेद लिखिए- क्रिया-विशेषण का भेदवाक्य(क) बच्चे धीरे-धीरे चल रहे थे।रीतिवाचक क्रिया-विशेषण(ख) गुरुजी अभी आए हैं।(ग) गाड़ी प्लेटफॉर्म पर अचानक आ गई। |
|
Answer» ONG>Answer:can you WRITE in English Step-by-step explanation: |
|
| 23. |
Can anybody tell me what should i subtracted from -3/2 to get -31/14 |
Answer» ONG>Step-by-step EXPLANATION:Let the REQUIRED NUMBER be X.-3/2 - x = -31/4-x = -31/4 - (-3/2)= -31/4 + 3/2= -31 + 6/4= -25/4X = 25/4Ans: 25/4 will be subtracted from -3/2 to GET -31/4. |
|
| 25. |
Yadi samikarn (a²+b²)x²-2(AC+bd)X+(c²+d²)=0ke mool Saman ho to wish kare ki ad=BC |
|
Answer» ONG>Answer: sinS+sin(S-A)+sin(S-B)-sin(S-C)
{sinS-sin(S-C)}+{sin(S-A)+sin(S-B)}
2COS(2S-C)/2SIN(C/2)+2sin(C/2)cos(B-A)/2
=2sinC/2[cos(A+B)/2 +cos(B-A)/2]
=2sinC/2 .[2cos(B/2)cos(A/2)]
=4cos(A/2)cos(B/2)sin(C/2)
THANKS AKA BANGATAN BOYS 0 Step-by-step explanation: |
|
| 26. |
If unit place is 6 than what will be the unit plece of its cube |
|
Answer» ong>ANSWER: Hlo... Step-by-step explanation: answers is.. 216.. I HOPE its help you.. (♥ω♥*) |
|
| 27. |
What are the steps to solving 2k + k =21 |
|
Answer» ong>Answer: THANK me if it's helpfull Step-by-step explanation: 2k + K = 21 3k = 21 k = 21/3 k = 7 ans |
|
| 28. |
The length of a rectangular sheet of paper is 35 cm and the breadth is 25 cm. What is the perimeter of the paper? 2 cm4 cm 1 cm3cm |
|
Answer» ONG>Answer: Step-by-step EXPLANATION: Length of rectangular Paper = 5 2/3 = 17/3 cm
And,
Breadth of rectangular Paper = 3 1/5 = 16/5 cm
Therefore,
Perimeter of rectangular Paper = 2 ( L + B )
=> 2 ( 17/3 + 16/5 ) cm
=> 2 ( 17 × 5 + 16 × 3 / 15 ) cm
=> 2 ( 85 + 48/15 ) cm
=> 2 133/15 cm
★ HOPE IT WILL HELP YOU ★ |
|
| 29. |
I) if n(x) =5 find nP(x). ii) if nP=1024,find n(x) |
|
Answer» ONG>ANSWER: PLEASE follow Step-by-step explanation: 2, this QUESTION answer is |
|
| 30. |
Histograph on covid cases of assami need hand writing of drawn graph |
|
Answer» ORM cases active cases recovery death |
|
| 31. |
What is thevaluethe discriminant for thequacuatic equation 25x - 15x +9/4=0?(B) 450(A) 225(c)0(D)-225 |
|
Answer» is your answer Step-by-step EXPLANATION: b²-4ac=(-15)²-4×25×9/4 =225-225 .*.b²-4ac=0 |
|
| 32. |
MThe range of the data 30.61.55.56.60.20.26.46.28.56.is ...... |
|
Answer» ong>Answer: The range of the data is 41 Step-by-step EXPLANATION: Hope it helps you |
|
| 33. |
It is very easy question for u if u r walking to North 24 m and move right and walk 10 mthen how distance u from original pointgive answer not urgent |
| Answer» ONG>ANSWER: | |
| 34. |
Answer these:1) 1234567890×98765432102) 63296354943626÷4646348338633873473833) 0×0 |
|
Answer» ONG>Answer: it impossible to find out but do you LIKE to be my friend and I am form SINGAPORE |
|
| 35. |
In the given polygon, BO = 7x + 4 and OD = 18 Find x. |
|
Answer» ONG>Given : BO = 7X + 4 and OD = 18 To Find : x Solution: As shown , ABCD is a PARALLELOGRAM Diagonal AC & BD intersect at O Diagonal of parallelogram BISECT each other => BO = OD BO = 7x + 4 OD = 18 Substituting these 7x + 4 = 18 Subtracting 4 from both sides => 7x + 4 - 4 = 18 - 4 => 7x = 14 Dividing both sides by 7 => x = 2 Learn more: In quadrilateral abcd diagonal ac bisects diagonal bd at point o ... prove that each diagonal of a Rhombus bisect the angle through ... Complete the following: In a rhombus, the diagonals bisect each ... |
|
| 36. |
If the cost of an article is 25 percent of its selling price, then what is the profit in terms ofpercentage? |
|
Answer» align="absmiddle" alt="\small \purple {\sf{quєѕtíσn !}}" class="latex-formula" id="TexFormula1" src="https://tex.z-dn.net/?F=%5Csmall%20%5Cpurple%20%20%7B%5Csf%7Bqu%D1%94%D1%95t%C3%AD%CF%83n%20%21%7D%7D" title="\small \purple {\sf{quєѕtíσn !}}"> If the cost of an article is 25 percent of its selling PRICE, then what is the profit in terms of percentage? Let the S.P = 100 then C.P. = 25 Profit = 75 Profit% = 75/25 * 100 = 3005 |
|
| 38. |
Ranbir deposits 1000 on Monday, 3110.90 on Tuesday and 2745 on Wednesday in the bank. What is the total amount Ranbir deposited in these three days? |
|
Answer» y deposited by Ranbir in MONDAY= 1000 Money deposited by Ranbir on TUESDAY = 3110.90 Money deposited by Ranbir on WEDNESDAY= 2745 TOTAL money deposited by Ranbir on these three days= 1000+ 3110.10+ 2745= 6855.1 Hence total money deposited by Ranbir in bank in these three days is 6855.1 Hope it helps |
|
| 39. |
Ii. 1 અબજ =કરોડa) 10 b)1000c) 100d)1 |
|
Answer» ong>Answer: upper JO questions Likha Hai Uska language Nahi aatta Hai please WRITE in English and Hindi please MARK as brainliest answer I will GIVE you 50 points |
|
| 40. |
If a=0,b=9908,c=(-298) tjen axb+c+c-a=? |
|
Answer» ONG>ANSWER: -596 Step-by-step explanation: 0*9908=0 -298+-298=-596 -0=0 final =-596 |
|
| 42. |
15 added to thrive a whole number gives 93 |
|
Answer» ONG>Step-by-step explanation: 3x+15=93 3x=78 X=26 whole number=26 |
|
| 43. |
4 sin2 60° +3 tan2 30 8 sin 30° cos 45° |
|
Answer» ong>ANSWER: Step-by-step explanation: Given
4sin²60° + 3tan²30° - 8sin45° . cos45°
4 . ( √3 / 2 )² + 3 ( 1 /√3 )² - 8 ( 1 /√2 ) . ( 1 /√2 )
= 4 × 3 / 4 + 3 × 1 / 3 - 8 × 1 / 2
= 3 + 1 - 4
= 3 - 3
= 0 |
|
| 46. |
A number is changed from 60 to 75. What is the increase%? |
|
Answer» ONG>ANSWER: The answer is 25% Step-by-step EXPLANATION: We have, Increase in NUMBER = 75-60 = 15 Therefore, Increase% = {(15/60)×100}% = }(1/4)×100}% = 25% |
|
| 47. |
If the nth term of an authentic progress ion is 5n +3 then third term Of the ap |
|
Answer» er: 18 nth term = 5n + 3 3rd term = (5 × 3) + 3 = 15 + 3 = 18 Pls mark as BRAINLIEST PLSSS. |
|
| 49. |
use the sign of >,< or = in the ( box) ___ to make the statemets true question (-3) +8-(10) ____ 12-8+(-7) |
|
Answer» ong>Step-by-step explanation: 12-8+(-7): -2 it's the GREATER friend hope this is help FUL pls mark as brainliest |
|
| 50. |
Distance between (2,-1)(4,6)is |
|
Answer» ONG>Answer: 2,7 is the DIFFERENCE between them RESPECTIVELY |
|