This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
V3+1Efind the value of 4r + 2x2 - 8x +7 |
|
Answer» its not CLEAR mate Step-by-step EXPLANATION: |
|
| 2. |
From cow we get milk. From hen we get egg. question is from whom we get both milk and egg |
|
Answer» Step-by-step explanation: Monotremes is the species that SATISFIES both things. Basically they are mammals that lay eggs and produce milk through mammary glands.The existing MONOTREME species are the PLATYPUS and FOUR species of echidnas. |
|
| 3. |
How much should less is 24 km than42.6km |
|
Answer» Answer: 18.6 km Step-by-step EXPLANATION: |
|
| 5. |
NDA ki teyaari k liye shii hai RS aggarwal ki book ya RD KI |
|
Answer» RD sharma it has GREAT EXPLANATION |
|
| 6. |
Find sin pi by 12 (with steps)Will make u the brainliest.. |
|
Answer» Step-by-step explanation: Trigonometry Angles--Pi/12 cos(pi/(12)) = 1/4(sqrt(6)+sqrt(2)) (1) cos((5pi)/(12)) = 1/4(sqrt(6)-sqrt(2)) (2) COT(pi/(12)) = 2+sqrt(3) (3) cot((5pi)/(12)) = 2-sqrt(3) (4) csc(pi/(12)) = sqrt(6)+sqrt(2) (5) csc((5pi)/(12)) = sqrt(6)-sqrt(2) (6) sec(pi/(12)) = sqrt(6)-sqrt(2) (7) sec((5pi)/(12)) = sqrt(6)+sqrt(2) (8) sin(pi/(12)) = 1/4(sqrt(6)-sqrt(2)) (9) sin((5pi)/(12)) = 1/4(sqrt(6)+sqrt(2)) (10) tan(pi/(12)) = 2-sqrt(3) (11) tan((5pi)/(12)) = 2+sqrt(3). (12) These can be derived using sin(pi/(12)) = sin(pi/3-pi/4) (13) = -sin(pi/4)cos(pi/3)+sin(pi/3)cos(pi/4) (14) = -1/2sqrt(2)(1/2)+1/2sqrt(3)(1/2sqrt(2)) (15) = 1/4(sqrt(6)-sqrt(2)). (16) Similarly, cos(pi/(12)) = cos(pi/3-pi/4) (17) = cos(pi/4)cos(pi/3)-sin(pi/3)sin(pi/4) (18) = 1/2(1/2sqrt(2))+1/2sqrt(3)(-1/2sqrt(2)) (19) = 1/4(sqrt(6)+sqrt(2)). (20) |
|
| 7. |
Can anyone solve the 30th one I don’t understand it |
|
Answer» HOPE it help u |
|
| 10. |
Prove that [x^a/x^b]^a square+ab+b square*[x^b/x^c]^b square+bc+c square*[x^c/x^a]^c square+ca+a square=1 |
|
Answer» Answer: LHS = RHS Step-by-step EXPLANATION: The solution is in the attached IMAGE. Hence proved |
|
| 11. |
Find the value of a if x-a is a factor of x cube - a square x+x+2 |
| Answer» | |
| 12. |
What is the value of(a) (b) (c) (d) |
|
Answer» HII its tom85 =sin^2a + sin^2atan^2a =sin^2a(1 + tan^2a) =sin^2a(sec^2a) =sin^2a/cos^2a =tan^2a using 1+ tan^2a= sec^2a _________/\__________☺️ |
|
| 13. |
5x/3+(-3)/2=1/8 solve |
|
Answer» |
|
| 14. |
2/2sin^2 theta=2/2sin^2 theta-1 |
|
Answer» What's this FIRST of all FIX your QUESTION it is INVALID DUDE |
|
| 15. |
the sum of the digits of a two-digit number is 12 if the number formed by reversing its digits is greater than the original number by 18 find the original number |
Answer» Lets assume thatOne number = x other number = 12-x Now, 10(12-x) +x 120 - 10x +x 120-9x After REVERSING digits 10x + 12-x 9x + 12 Acc to the question the new number is 18 more than the original number , so 9x +12 = 18 + 120 -9x 18x = 126 x = 126/18 x = 7 other number = 12-7= 5 Verification:5+7 =12 After reversing digits 75 = 18+57 So 75 is 18 more than 57. Hence verified |
|
| 16. |
Problem:dilemma::Wind:cycloneMerit:acclaimGreenery: forestWinsome:charming |
|
Answer» Answer: As Problem: dilemma, hence the correct answer is WINSOME: Charming. Here, the relation between the two words- problem and dilemma can be determined. They basically MEAN the same thing or better known as SYNONYMOUS words. Hence, we require to select an option that contains a pair of synonymous words. Here, only the LAST one is synonymous as winsome also MEANS charming. |
|
| 18. |
3^-5.10^-5.125/5^-7.6^-5=? |
|
Answer» Answer: 3937500 Step-by-step explanation: 3937500 Ans. |
|
| 20. |
Find the value of x 9^x=27 |
|
Answer» Answer: 3/2 Step-by-step explanation: 9^x = 27 3^2x = 3^3 2x = 3 x = 3/2 |
|
| 22. |
54 is to be divided into two parts such that the sum of 10 times the first and 22 times the second is 780.find the bigger part |
|
Answer» Answer: Step-by-step explanation suppose 54 is divided into x and y x+y=54 .....(1) to eliminate x, multiply equation (1) by 10 we get, 10x+10y=540 ....(3) subtract equation (3) from equation(2) 12y=240 y= 20 substitute y=20 in equation (1) we get, x=34 the value of bigger PART is 34 |
|
| 23. |
The area of a sure field is 5184m². A rectangular field, whose length is twice it's breadth, has its perimeter equal to the perimeter of the square field. Find the area of the rectangular field. |
|
Answer» Step-by-step explanation: The ANSWER is as FOLLOWS. PLZ Mark as BRAINLIEST |
|
| 25. |
If x and (150-x)are two numbers such that their sum is 150 and the greaterof two numbers is9 times the smaller, find the numbers . |
|
Answer» Answer: LET the smaller number be x let the GREATER number be 9x According to the question x+ 9x =150 10x = 150 x = 150 10 x = 15 Check 15+ (9×15)=150 15+135. =150 150. =150 LHS. = RHS |
|
| 26. |
બાવર્ક કરી નાર,નાટકમાં રાજ કરીહરા ની મારવા |
|
Answer» Answer: PLEASE WRITE again I can't UNDERSTAND it's not an maths question |
|
| 27. |
A train covers a distance of 90 km at a uniform speed if the speed had been 15 km per hour more it would have taken half an hour less for the journey find the original speed of the train |
|
Answer» Answer: Given, distance = 90 km let SPEED (original) = x km/h time taken to travel = 90/x hr ∴ New speed = (x+15) km/hr Time taken to travel = 90/(x+15) hr ∴ 90/x = 90/(x+15) + 1/2 ⇒ 90/x - 90/(x+15) = 1/2 ⇒ 90(1/x - 1/(x+15)) = 1/2 ⇒ x+15-x/x(x+15) = 1/2 ×1/90 ⇒ 15/x(x+15) = 180 ⇒ x(x+15) = 15 × 180 = 2700 ⇒ x² + 15x - 2700 = 0 →x² + 60X - 45x+2700 = 0 [Quadratic Equation] ⇒(x+60)(x-45) = 0 ⇒x = 45 or - 60 ∵ Speed can't be negative.. ∴ Original speed = 45km/hr
|
|
| 28. |
In a lottery a person chooses 6 different numbers from 1 to 20. If these numbers match with the six numbers chosen by the lottery committee then he wins the lottery. What is his probability of winning the prize |
|
Answer» His PROBABILITY is 6.
|
|
| 29. |
In a group,150 students know hindi & 60 know english and 10 know both hindi & english.If there are 30 students who know neither of the two languages,how many students are there in the group? |
|
Answer» Answer: 150+60+10+30=250 STUDENTS |
|
| 30. |
In a 100 m race, if x gives y a start of 25 m, then x wins the race by 5 second. Alternatively, if x gives y a start of 50 m the race ends in a dead heat. How long does x take to run 200 m? |
|
Answer» Answer: 10s Step-by-step explanation: Because 100 need 5s so,200 is 2*100 THEREFORE 2*5IS answer that is 10 |
|
| 31. |
In a farm there are cows and hens. If heads are counted there are 180, if legs are counted there are 420. The number of cows in the farm is |
|
Answer» let the no cows is x and the no. of hen is y x+y=180--i 4x+2y=420--ii(cows have 4 legs,HENS have 2 legs) i×2-ii 2x+2y=360 4x+2y=420 cancelled 2y -2x=-60 x=30 cows are 30 hens are 150 |
|
| 32. |
Sum of a fraction and thrice of its reciprocal is always |
|
Answer» Answer: (1+n^4)/n Step-by-step EXPLANATION: Assume the fraction be (1/a) THRICE of its RECIPROCAL = a^3 1/a +a^3 = (1+a^4)/a |
|
| 33. |
Radius of circle inscribed in right triangle |
|
Answer» ->> RADIUS of INCIRCLE =area of triangle/s. Where s=(a+b+c)/2. If sides of a RIGHT triangle are 3 cm ,4 cm and. 5CM. Find the |
|
| 34. |
What happened aliens live in moon |
|
Answer» ℍ ℰ ℒ ℒ ᝪ ℱ ℛ ℕ ⅅ Answer: The Moon MIGHT once have been home to aliens. Extraterrestrial life might have made its WAY to our nearest neighbour after a meteorite blast, scientists have suggested. And when it did, the atmosphere might have been far more habitable than it is today, ready to support life, if only briefly.That is according to two senior planetary researchers who found that the Moon might have had conditions to support SIMPLE LIFEFORMS some four billion years ago. The same conditions might have arrived during a peak of volcanic activity 3.5 billion years ago, claim the researchers.hope it help yours ✌✌ |
|
| 35. |
HAone kilometer is equal to dash kilo |
|
Answer» YAA you are right Step-by-step EXPLANATION: |
|
| 36. |
Plz solve this question. I will mark brainliest!!!! |
|
Answer» Step-by-step explanation: REFER to the ATTACHMENT i hope U got it..... |
|
| 37. |
Werewtre)e rewhichto litres and 748 litres of water respectivelya measure the water of these three cans exactly |
|
Answer» PLEASE WRITE again I can't UNDERSTAND |
|
| 38. |
Rationalnumbersbetween -1/2 and 3/5 |
|
Answer» The RATIONAL NUMBERS between -1/2 and 3/5 are... 0, 1/5, 2/5 |
|
| 39. |
Find the integer that must subtracted from -5to -11 |
|
Answer» -5-11 -16..................... |
|
| 40. |
Does ratio and fractions are equal? |
|
Answer» Two ratios that have the same value are called equivalent ratios. To FIND an equivalent RATIO, MULTIPLY or divide both quantities by the same number. It is the same process as FINDING equivalent fractions. |
|
| 41. |
Simplify the question quickly please |
|
Answer» Just TAKE a LOOK at this .does this NEED to be SIMPLIFIED more? |
|
| 42. |
(a-6) (a-2).identities : |
|
Answer» Step-by-step EXPLANATION: |
|
| 43. |
Which is the greatest whole number |
|
Answer» ......... _______________________________ →So, 0, 1, 2, 3,….,10 are called whole numbers.→So, 1 is the smallest natural number→0 is the smallest whole number.→But there is no largest whole number or natural number because each number has its SUCCESSOR. |
|
| 44. |
without actual division show that 2X2 by 4 minus 6 x raise to power 3 + 3 X raise to power 2 + 3 x minus 2 is exactly divisible by X raise to power 2 - 3 x + 2 |
|
Answer» Answer: Step-by-step explanation: without actual division, prove that (2x^4-6x^3+3x^3+3x-2)is exactly DIVISIBLE by(x^2-3x+2). (note : here'^'this SYMBOL is being referred as raised to.) The answer: 2x^4 - 6x^3 + 3x^3 + 3x - 2 Combine like terms to simplify 2x^4 - 3x^3 + 3x - 2 Factor the polynomial 2x^4 - 3x^3 + 3x - 2 Use the "RATIONAL ROOT TEST" to find any POSSIBLE rational roots. (a_n)x^n + (a_n-1)x^(n-1) + . . . + (a_1)x + a_0 1. find a_n and a_0 a_n (the first coefficient) = 2 a_0 (the CONSTANT) = 2 2. Determine factors of a_n and a_0 Factors of a_n = 1, 2 Factors of a_0 = 1, 2 3. Determine possible rational roots (prelim) Possible rational roots = ±{1/1, ½, 2/1, 2/2} Eliminate duplicates (final) Possible rational roots = ±{1, ½, 2} 4. Determine if any of the possible rational roots are actually roots where f(x) = 0 Is x = +1 a rational root ? f(x) = 2x^4 - 3x^3 + 3x - 2 f(x) = 2*1^4 - 3*1^3 + 3*1 - 2 f(x) = 2 - 3 + 3 - 2 f(x) = 0 YES, x = +1 is a ROOT Is x = -1 a rational root ? f(x) = 2x^4 - 3x^3 + 3x - 2 f(x) = 2*(-1)^4 - 3*(-1)^3 + 3*(-1) - 2 f(x) = 2*1 - 3*(-1) + 3*(-1) - 2 f(x) = 2 + 3 - 3 - 2 f(x) = 0 YES, x = -1 is a ROOT |
|
| 45. |
If the 1st term of the ap is 7 and13" term is 135. Find the sum of13 terms of the sequence |
|
Answer» 923 Step-by-step EXPLANATION: here is UR answer REFER it in attached picture |
|
| 46. |
(y=2x-3y=-x+3shahagoa |
Answer» ANSWER :x = 0, y = 3 or - 3 Step-by-step explanation :y = 2X + 3 ...[1] y = - x + 3 ...[2] From [1] & [2], we get 2x + 3 = - x + 3 2x + x = 3 - 3 3x = 0 x = 0/3 x = 0
y = - (0) + 3 y = - 0 + 3 y = 3
y = 2(0) - 3 y = 0 - 3 y = - 3 |
|
| 47. |
Medicine is packed in boxes each waiting 5 kg 200 gram how many such boxes can be loaded in a van which cannot be Carried beyond 260kg60 kg |
|
Answer» answer =50 Step-by-step explanation: LETS TAKE 5kg200gram into 5.2 then divide 5.2 with 260 .Answer is 50 |
|
| 48. |
Define Indians, what do they do what are they? |
|
Answer» Answer: indians- the person who live in the BRAVE nation india those people's are INDIAN.. What are they.. indians are at second no at population.. because of no management of birth rate... |
|
| 49. |
Solve this pair of linear equations 10p+15q=65 and 10p-8q=-4 by using elimination method..Whole solutionStep by step |
|
Answer» Answer: q=3 p=2 Step-by-step explanation: 10p+15q=65 10p-8q= -4 to ELIMINATE p; subtract EQUATION (2) from (1) 23q=69 q=3 substitute q=3 in equation(2) 10p-8(3)= -4 10p-24= -4 10p=20 p=2 |
|
| 50. |
2 numers are such that the ratio between them is 3:5. if each is increased by the ratio between the new number is 5:7 . find the original numer |
|
Answer» Step-by-step EXPLANATION: yo this and TBAT is your answer |
|