This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
1. Find the product by using a suitable identity.(i) (x + 5) (x + 4)(ii)(a + 3) (a + 6)(iv) (X + 8) (x - 5)(v)(z - 3) (z - 1)(vii) (y - 1) (y + 2)(viii)(z + 3) (z - 7)(x) (z + 6) (2-5)(xi)(x - 6) (x -9)(xiii) (y - 4) (y + 4)(xiv)(x - 4) (x - 14) |
|
Answer» Answer: (i) x2 + 11x 30 (ii) x2 + 17x + 70 (iii) x2 + 17x + 72 (iv) x2 + 11x + 24 2. (i) x2 – 4X – 21 (ii) x2 + 3x – 10 (iii) t2 + 2T – 35 (iv) t2 + 5t – 36 3. (i) a2 – 5a + 6 (ii) a2 – 16A + 55 (iii) a2 – 5a + 4 4. (i) m2 + 14m – 95 (ii) m2 + 7m – 78 (iii) m2 + 4m – 12 (iv) m2 – 3m – 4 5. (i) x2 + 17/4 x + 1 (ii) x2 + 67/9 x + 28/9 (iii) Y2 – 25/12 y + 1 (iv) y4 – 13y2 + 36 (v) z4 + 26/3 z2 – 3 (vi) z4 – z2 – 6 (vii) p4 – 20/9 p2 – 32/27 (viii) 9a4 + 3a2b2 – 20b4 6. (i) 10710 (ii) 41412 (iii) 9312 (v) 7209 (v) 9991 (vi) 40385 (vii) 89072 (viii) 3647 |
|
| 3. |
3. Matchstick PuzzleMove 4 matchsticks to create 6 squares. |
|
Answer» Step-by-step explanation: 1/4 is an ANSWER....... |
|
| 4. |
29. Divide 13000 in two parts such that the amount of one for 1.5 years at 8% per annum compoundinterest, compounded annually is the same as amount of the other for 2.5 years at compound interest at the same rate, compounded annually. |
|
Answer»
29 is the terest, compounded ANNUALLY is the same as amount of the other for 2.5 YEARS at compound INTEREST at the same RATE, compounded annually. |
|
| 5. |
Aur koi answer nahi de please yarr question to Bata di na please yarr☹️ |
|
Answer» Answer: 1)Yes ,on SIMPLIFYING 5/10 the answer will be 1/2 2)No, on simplifying 6/7 the answer will be 6/7 3)Yes,on simplifying 12/24 the answer will be 3/6 4)Yes ,on simplifying 4/12 the answer will be 1/3 5)Yes, on simplifying 8/20 the answer will be 2/5 6) No, because 3+4 is 7 and 4+4 is 8 and on simplifying it the answer will be 7/8 7)Yes, on simplifying 10/16 the answer will be 5/8 8) Yes, on simplifying 36/81 the answer is 4/9 9)No, because 11-2 the answer is 9 and 17-2 is 15 and on simplifying it the answer will be 3/5 Hope it will HELP you |
|
| 6. |
Find the sum of the Aop { 1, 3,5 .... 6) |
|
Answer» ....................................... |
|
| 7. |
Which one is an expression, which one is an equation, or neither? 5b=25, 5b, 5(3+4) |
|
Answer» Step-by-step explanation: Igneous ROCKS (from the Latin word for fire) form when HOT, molten rock CRYSTALLIZES and SOLIDIFIES. The melt originates deep within the Earth NEAR active plate boundaries or hot spots, then rises toward the surface. |
|
| 8. |
) If m-10= -21, then find the value of 'm'. |
|
Answer» Step-by-step EXPLANATION: |
|
| 9. |
Show that 1/g(x) is convex if g is concave and positive |
|
Answer» SORRY I didn't KNOW what to do with Step-by-step EXPLANATION: Sorry I didn't know you were GOING |
|
| 10. |
If A is a square matrix of order 3 having a row of zeros,then determinate of A is |
Answer» then the DETERMINENT of a is 0 |
|
| 12. |
What will be the value of up to two places of terthe 251-159 ashadiya |
|
Answer» Here you can ENTER any number with as many or as few decimal places as you want, and we will round it to the nearest two decimal places. Please enter your number here: Here are some examples of what our Two Decimal Places Calculator can do: What is 0.123 rounded to 2 decimal places? What is 0.555 rounded to 2 decimal places? What is 1.599 rounded to 2 decimal places Step-by-step EXPLANATION: please MARK as brainliest |
|
| 13. |
Apply fundamental theorem of arithmetic to find the h.c.f. and l.c.mof each the following 12,30and144 |
|
Answer» h.c.f = 6 l.c.m = 720 |
|
| 14. |
The percent price of a car is rupees 33750 . in the next year the price decreased by 4% find the price of car in the next year. answer is 30600 |
|
Answer» Answer: The answer is 32,400. Step-by-step explanation: 4% of 33,750 =4/100 * 33,750 = 1350. The REQUIRED cost =33,750-1350 =32,400. DO MARK ME BRAINEST AND FOLLOW ME |
|
| 15. |
00 of the total students are boys and the total number of girls are 320. Find the total numberof students and the number of boys.1. A fruit seller sells 50% of the total fruits and still he has 320. Find the total number of fruits heAfter discount of 11% a car costs Rs.45000. Find the total cost of car before discountINIhad originally |
|
Answer»
Step-by-step EXPLANATION: |
|
| 16. |
Q. find the remainder when p(x) =xcube -6x²+14 - 3 is divided by g(x) = 1-2x, so verify the Result by long division method by following steps ? |
|
Answer» SEE the ATTACHMENT for answer |
|
| 17. |
In a quadrilateral, the diagonals are perpendicular bisectors of each other and their lengths are12 cm and 16 cm. Find the lengths of the sides of the quadrilateral. |
|
Answer» and by solution we GET that a QUADRILATERAL is a RHOMBUS |
|
| 18. |
Solve Correctly No spam.My frnd is going to answer. so dont answer. |
|
Answer» Answer: Degree of biquadratic equation is 4 and for cubic is 3 so the answer would be 4-3 that is 1... Step-by-step explanation: |
|
| 19. |
The differents of perimeterof two squares is 32 and area differents is 208sq m whar us the differents between the length of the sides and what is rhe length |
|
Answer» Step-by-step explanation: Two squares: DIFFERENCE between them is 32 meters and the difference in area is 208. Find the difference in length of their SIDES. Solution: x22 - y22 = 208 Same as: (X + y)(x - y) = 208 (1) 4x - 4y = 32 x = (32 + 4y)/4 ===> x = 8 + y Sub. x = 8 + y into equation (1) (8 + y + y)(8 + y - y) = 208 ===> ( 8 + 2y)(8) = 208 ==> 64 + 16y = 208===> 16y = 144 ===> y = 9 Sub 9 for y into equation (1) (x + 9)(x - 9) = 208===> x22 - 81 = 208===> x22 = 289 ==>x = +/- 17 We can not have a -side so x = + 17 is chosen. The difference between their sides is 17 - 9 = 8 meters |
|
| 20. |
Find the mean of the first five whole number |
|
Answer» Answer: As the first five whole NUMBERS are 0, 1, 2, 3, and 4. MEAN = (Sum of OBSERVATIONS)/(NUMBER of observations) = (0 + 1+ 2 + 3 +4)/5 = 2. |
|
| 21. |
By selling twelve notebooks, the seller earns profit equal to the sellingprice of two note books, ______ is percentage profit.(a) 20% (b) 30% (c) 25% (d) 15% |
|
Answer» Answer: Let's assume the selling price of one book is =RS. X Selling price of 12 notebooks= Rs. 12X Total PROFIT = Rs. 2X Cost price of 12 notebooks= Selling price - Profit = 12X-2X =10X Profit percentage = (Total profit ÷total cost price) ×100 =(2X÷10X)×100 =0.2×100 =20 % . hence the answer is 20% hey which class U belong to |
|
| 22. |
( s²t + tq² )² - ( 2stq )² Solve this with suitable identity..... |
|
Answer» hhhhhhhhhhhhhhhhaaaaaaaaaaaaaaaaaaaa |
|
| 23. |
If -5>a and a>b then -5 is?? |
|
Answer» Step-by-step EXPLANATION: If -5>a and a>b then we can SAY that -5>a>b Thus, -5>b Hope it helps Mark it as the BRAINLIEST |
|
| 24. |
যন্ত,১ম ধড অনয়ামত আরুতর বথুন ',ক. ওর জো বউ।৫ . - 7 অর্থ » 'তৃত্বর প8ি কওঁ ।N. ABCDEFORT NA 12 20 RonA) |
|
Answer» Answer: যন্ত, ১ম ধড অনয়ামত আরুতর বথুন ', ক. ওর জো বউ। ৫ . - 7 অর্থ » 'তৃত্বর প8ি কওঁ । N. ABCDEFORT NA 12 20 Ron A) Step-by-step explanation: যন্ত, ১ম ধড অনয়ামত আরুতর বথুন ', ক. ওর জো বউ। ৫ . - 7 অর্থ » 'তৃত্বর প8ি কওঁ । N. ABCDEFORT NA 12 20 Ron A) |
|
| 25. |
Hey Buddy, Can u tell me whether the below statement is true or false........ |
| Answer» | |
| 26. |
Show that 1/g(x) is convex |
|
Answer» i Step-by-step EXPLANATION: SRRY I am NT UNDERSTANDING |
|
| 27. |
Express 729 as a power of 3. hi |
|
Answer» |
|
| 28. |
−54 − 8x = − 2x what does x= |
|
Answer» Answer: Step-by-step EXPLANATION:
|
|
| 29. |
In figure, what value of x will make AOB a straight line?B.2x+1092x-3000A |
|
Answer» X will be 240 2(240) -300 480 -300 180. (mark me as the BRAINLIEST) |
|
| 30. |
Write down all the factors of :(ii) 56(i) 40(iii) 63(iv) 84 |
|
Answer» Answer: 84=2×2×2×2×2×2 40=2×2×2×3 56=2×2×2×2×2×3 63=7×7 Step-by-step EXPLANATION: |
|
| 31. |
In fig. 6.3 sides QP and RQ of ∆ PQR are produced to points S and T respectively. If angle PQT= 110°, find angle PRQ |
| Answer» | |
| 32. |
If secA = 2 find the value of 4 + 4 tan ² A |
|
Answer» I'm not a BOY Step-by-step EXPLANATION: I'm a GIRL....⊙﹏⊙ |
|
| 33. |
(a) 125 x 488 x 8 please thanks my all answer |
|
Answer» Step-by-step explanation: 125×488×8 125×8×488 1000×488 488,000 |
|
| 34. |
Convert the equation r = 2 sin θ to cartesian coordinate |
|
Answer» Step-by-step explanation: When dealing with transformations between polar and Cartesian coordinates, always remember these formulas: x = r cos θ
y = r sin θ
r 2 = x 2 + y 2
From y = r sin θ , we can see that dividing both sides by r gives us y r = sin θ . We can therefore replace sin θ in r = 2 sin θ with y r : r = 2 sin θ
→ r = 2 ( y r )
→ r 2 = 2 y
We can also replace r 2 with x 2 + y 2 , because r 2 = x 2 + y 2 : r 2 = 2 y
→ x 2 + y 2 = 2 y
We could leave it at that, but if you're interested... Further Simplification If we subtract 2 y from both sides we end up with this: x 2 + y 2 − 2 y = 0
Note that we can COMPLETE the square on y 2 − 2 y : x 2 + ( y 2 − 2 y ) = 0
→ x 2 + ( y 2 − 2 y + 1 ) = 0 + 1
→ x 2 + ( y − 1 ) 2 = 1
And how about that! We end up with the equation of a circle with center ( h , k ) → ( 0 , 1 ) and radius 1 . We know that polar equations of the form y = a sin θ form circles, and we just CONFIRMED it using Cartesian coordinates. |
|
| 35. |
7+ 1 = 29у Please tell me the answer |
|
Answer» multiplying both SIDE by y, we get 7 + y = 29Y 7 = 29y -y 7 = 28y 7/28 = y therefore, 1/4 = y checking 7/1/4 + 1 = 7*4 +1 = 28+1 = 29 hence we can say that y = 1/4 |
|
| 36. |
The percent price of a car is rupees 33750 . in the next year the price decreased by 4% find the price of car in the next year. |
|
Answer» Answer: 32400 Step-by-step EXPLANATION: |
|
| 37. |
Sokve the 8th question pls |
|
Answer» Please SCAN only ONE question and then post it so , that we can ANSWER. |
|
| 38. |
ম্যান্ট -১অ্যাসাইম্যান্ট/ নির্ধারিত কাজএকজন ব্যক্তি সরকারের গৃহীত তথ্য ও যােগাযােগপ্রযুক্তি ভিত্তিক সেবা থেকে কিভাবে সহযােগীতা পেতেপারেন। বিষয়টি একটি শিরােনাম দিয়ে ( ২৫০ শব্দেরমধ্যে)একটি প্রবন্ধ লিখ” ।( প্রবন্ধে যা যা থাকতে হবে)ভূমিকাসেবাসমূহের তালিকাডিজিটাল বাংলাদেশ ও প্রযুক্তি ভিক্তিক সেবাপ্রযুক্তি ভিক্তিক সেবার গুরুত্বউপসংহার |
| Answer» | |
| 39. |
Sin (A+B). sin (A-B) = sin²A - sen²B |
|
Answer» using the TRIGONOMETRIC identities
∙ x sin ( x + y ) = sin x cos y + cos x sin y
∙ x sin ( x − y ) = sin x cos y − cos x sin y
consider the left SIDE
( sin A cos B + cos A sin B ) ( sin A cos B − cos A sin B ) = sin 2 A cos 2 B − cos 2 A sin 2 B
= sin 2 A ( 1 − sin 2 B ) − sin 2 B ( 1 − sin 2 A ) = sin 2 A − sin 2 A sin 2 B − sin 2 B + sin 2 A sin 2 B = sin 2 A − sin 2 B
= RIGHT side ⇒ verified |
|
| 40. |
If ZPOR=80, find ZPSR and PQR |
|
Answer» Step-by-step EXPLANATION: PLEASE MARK it as BRAINLIEST. |
|
| 42. |
Carinhris 8If a tower of height 150 m casts a shadow 45 m long, then find the length of the shadow cast by a polaof height 10 m at the same time.9. If the length of cloth needed to stitch 8 shirts is 9.6 m, then how many shirts can be made with cloth of |
|
Answer» as TRIANGLES FORMED will be SIMILAR so x/45= 10/150 x= 45/15= 3M |
|
| 43. |
Total of 3/15+ 2/20? |
|
Answer» 3/15=0.2 2/20=0.1 3/15+2/20=0.2+0.1 0.3 the ANSWER is 0.3 |
|
| 44. |
The area of a square field is 5184 . Find the area of a rectangular field , whose perimeter is equal to the perimeter of the square field and whose length is twice of its breadth |
|
Answer» Step-by-step explanation: GIVEN: area of square =5184m 2
∴ Side of square =
=72m The PERIMETER of square =4×72=288m Let breadth of rectangle =xm ∴ LENGTH of rectangle =2xm Now, perimeter of rectangle= Perimeter of a square ⇒2(l+b)=288m ⇒2(2x+x)=288 ⇒x= 6 288
=48m ∴ Length =2×48=96m, Breadth =48m Therefore area of rectangle =l×b=96×48=4608m 2 |
|
| 45. |
B. Short Type Questions : Marks :2/3/4 |In figure AB and AC are opposite rays.(i) If x = 32º find Zy1(ii) If yº = 28º find ZxᎠ .(3yº+ 11)3xABto |
|
Answer» Step-by-step explanation: ━━━━━━━━━━━━━━━━━━━━━━━━━━ \begin{gathered}\begin{gathered}1. \: \: \sin(2 \alpha ) = 2 \sin( \alpha ) \cos( \alpha ) \\\end{gathered} 1.sin(2α)=2sin(α)cos(α)\end{gathered}1.sin(2α)=2sin(α)cos(α)1.sin(2α)=2sin(α)cos(α) 2. \: \: \sin(180 - \alpha ) = \sin( \alpha )2.sin(180−α)=sin(α)2.sin(180−α)=sin(α)2.sin(180−α)=sin(α) 3. \: \: \sin(90 - \alpha ) = \cos( \alpha )3.sin(90−α)=cos(α)3.sin(90−α)=cos(α)3.sin(90−α)=cos(α) ━━━━━━━━━━━━━━━━━━━━━━━━━━ L.H.S :- Sin10. Sin30. Sin50. Sin70L.H.S:−Sin10.Sin30.Sin50.Sin70 \begin{gathered}\begin{gathered}= \cos(90 - 10) \sin(30) \cos(90 - 40) \cos(90 - 70) \\ = \cos(80) \: \frac{1}{2} \: \cos(40) \: \cos(20) \\ = \frac{1}{4 \sin(20) } \cos(8 0 ) \cos(40) . \: 2 \sin(20) \cos(20) \\ = \frac{1}{8 \sin(20) } \cos(80) 2. \cos(40) \sin(40) \\ = \frac{1}{16 \sin(20) } 2 \cos(80) \sin(80 ) \\ = \frac{1}{16 \sin(20) } \sin(160) \\ = \frac{1}{16 \sin(20) } \sin(180 - 20) \\ = \frac{1}{16 \sin(20) } \sin(20) \\ = \frac{1}{16} \: \: \: \: \: \: \: \: .........R.H.S\end{gathered}\end{gathered}=cos(90−10)sin(30)cos(90−40)cos(90−70)=cos(80)21cos(40)cos(20)=4sin(20)1cos(80)cos(40).2sin(20)cos(20)=8sin(20)1cos(80)2.cos(40)sin(40)=16sin(20)12cos(80)sin(80)=16sin(20)1sin(160)=16sin(20)1sin(180−20)=16sin(20)1sin(20)=161.........R.H.S =cos(90−10)sin(30)cos(90−40)cos(90−70)=cos(90−10)sin(30)cos(90−40)cos(90−70) =cos(80) 2/1=cos(80)2/1 cos(40)cos(20)= 4sin(20)1cos(40)cos(20)=4sin(20)1 cos(80)cos(40).2sin(20)cos(20)= 8sin(20)1cos(80)cos(40).2sin(20)cos(20)=8sin(20)1 cos(80)2.cos(40)sin(40)= 16sin(20)1cos(80)2.cos(40)sin(40)=16sin(20)1 2cos(80)sin(80)= 16sin(20)12cos(80)sin(80)=16sin(20)1 sin(160)= 16sin(20)1sin(160)=16sin(20)1 sin(180−20)= 16sin(20)1sin(180−20)=16sin(20)1 sin(20)= 16/1sin(20)=16/1 .........R.H.S |
|
| 46. |
3(6x − 4) = 22x what does x = |
Answer» =》 3(6x−4) = 22x=》 18x−12 = 22x=》 18x−22x = 12=》 −4x =12=》 X = −4/12=》 x = -1/3This is your correct answer plzz mark me as brainlist... |
|
| 47. |
149. 93 × 2.5=options :a)300b)375c)450d)447 |
|
Answer» Step-by-step EXPLANATION: SO THE ANSWER IS |
|
| 48. |
A Find, from first principles, the derivatives of (3x+5)/x^(1/2) |
|
Answer» Step-by-step EXPLANATION: We have, |
|
| 49. |
If 1+√2 is a root of the quadratic equation with rational co efficient write are other roots? |
|
Answer» Step-by-step explanation: ∴ GIVEN the one root is 1+√2 so let the other root is 1-√2. Sum of the roots : 1+√2+1-√2 1+1 2 Products of the roots : (1+√2)(1-√2) 1-(√2)² 1-2 -1 We GOT sum and products of the root so we can make the equation x²-(Sum of roots)x+(PRODUCT of the roots)=0 x²-2x-1=0 Let's see it is correct or not! x²-2x-1=0 Here, a=1, b=-2, c=-1 x = -b±√b²-4ac/2a x = -(-2)±√(-2)²-4.1.(-1)/2.1 x = 2±√4+4/2 x = 2±√8/2 x = 2±2√2/2 x = 2(1±√2)/2 x = 1±√2 Hence, it is correct. The one root is 1+√2 then other root will be 1-√2 |
|
| 50. |
The simplest intrest on a certain sum is one fourth of the sum. If the number of years and the rate of annual interest are numerically equal then the number of year is. |
|
Answer» |
|