Saved Bookmarks
This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
te the following:G.(ii) 729-216-27 |
|
Answer» 739-26-27 = 486is the answer i want full step |
|
| 2. |
Show that\frac{\sqrt[3]{729}}{\sqrt[3]{1000}}= |
|
Answer» cuberoot(729)/cuberoot(1000) =cuberoot(9×9×9)/cuberoot(10×10×10) =9/10 |
|
| 3. |
Matrix - Matching11. Example of perfect cube12. Cube of 9 is13. Cube of even prime is14. 3512a) 729b) 216c) evend) 8 |
|
Answer» 11. example of perfect cube= 21612. cube of 9 is = 72913. cube of even prime is= even14. 3√512= 8 example of perfect cube=216cube of 9is =729cube of even prime is =even3√512=8 example of perfect cube=216cube of 9 is=729cube of even prime is=even3√512=8 example of perfect cube=216cube of 9is 729cube of even prime is even3√512=8 1)perfect cube - b) 216. 2) cute of 9 = a) 729; 3)cube of even prime =c)even 4)3V512 = d)8 perfect cube b)216 (6^3) cube of 9 a)729 cube of even prime is even cube(512)=8 11. 21612. 72913. even14. 8 D, A, C, B by doing prime factorization we can find this number a ka cube 9 ho ga b number ka cube 6 or d ka 8 ho ga Example of perfect cube - 216Cube of 9 is - 729Cube of even prime is - even3√512 - 8 11. 21612. 72913. even14. 8 |
|
| 4. |
8:512 10: 1000 6:(a) 216(b) 215(c) 126(d) 189 |
| Answer» | |
| 5. |
Which of the following numbers are not perfect cubes?(i) 216(ii) 128(iii) 1000(iv) 46656 |
|
Answer» 216 = 6³1000 = 10³36³ = 46656for 128 = 2 × 2 × 2 × 2 × 2 × 2 × 2so 128 is not perfect cube |
|
| 6. |
a) Expand log 32 |
| Answer» | |
| 7. |
cohin ever |
|
Answer» Like if you find it useful |
|
| 8. |
wate the imaginary part of 5-120 |
|
Answer» -i^20 is the correct answer of the given question -i^29 is the imaginary part of 5-i²⁰ . |
|
| 9. |
y = \log \sqrt { \frac { 1 + \sin x } { 1 - \sin x } } , \text { show that } \frac { d y } { d x } = \sec x |
|
Answer» y=log√(1+sinx)(1-sinx)/(1-sinx)(1-sinx)y=log√(1-sin^2x)/(1-sinx)^2y=log(cosx)/(1-sinx)y=log cosx - log (1-sinx)dy/dx= -sinx/cosx + cosx/ 1-sinxdy/dx= -tanx + cosx(1+sinx)/(1-sinx)(1+sinx)dy/dx= -tanx + 1+sinx/cosxdy/dx=- tanx + secx + tanxdy/dx=sec xproved |
|
| 10. |
Ariver 3 m deep and 40 m wide is flowing at the rate of 2 km per hour. How much watewill fall into the sea in a minute? |
| Answer» | |
| 11. |
The difference of the volumes of two spheres is 10,061 cm3. If the radius of the smaller sphere be7 cm, find the difference of the surface areas of the two spheres. |
| Answer» | |
| 12. |
The ratio of the radius of two spheres is 1:heightwnich is 12 times its radius. what is ratio of the smaller sphere and the cylinder?2 .the two spheres are melted togetherto form a cylinder of |
|
Answer» Like if you find it useful |
|
| 13. |
Two spheres of same metal weigh 1 kg and 7 kg. The radius of the smallersphere is 3 cm. The two spheres are melted to form a single big sphere. Findthe diameter of the new sphere. |
| Answer» | |
| 14. |
Two spheres of same metal weigh 1 kg and7 kg. The radius of the smaller sphere is3 cm. The two spheres are melted to forma single big sphere. Find the diameter ofthe new sphere[CBSE 2015 |
| Answer» | |
| 15. |
ouutcwhin evernever m u a fes itive integer |
|
Answer» 9^(n+1) - 8n - 9=9ⁿ×9 - 8n - 9= (1 + 8)ⁿ×9 - 8n - 9 Now, break (1+8)ⁿ by using binomial formula, (x + y)^n = nC0.x^n + nC1.x^(n-1)y + nC2.x^(n-2)y^2 + ........+nCn.y^n (1+8)^n = nC0 + nC1(8) + nC2(8)² +....... + nCn(8)ⁿ use this above = {nC0 + nC1.8 + nC2.8² + .....+ nCn.8ⁿ}×9 - 8n - 9 = (1 + 8n + nC2.8² + ......+nCn.8ⁿ)×9 - 8n - 9 = 9 + 72n + (nC2.8² +nC3.8³ +......+ nCn.8ⁿ)9 - 8n - 9 = (72n -8n) + 8²[nC2 + nC3.8 +.....+ nCn.8^(n-2)] = 64n + 64[nC2 + nC3.8 +.....+nCn.8^(n-2)] = 64 ×constant number we observed that, 9^(n+1) - 8n -9 is divisible by 64 Like my answer if you find it useful! |
|
| 16. |
Balance the following chemical equation:Fe(s) + H20(g)Fes 04 (s) + Ha (g) |
|
Answer» 3Fe + 4 H2O -----> Fe3 O4 + 4 H2 |
|
| 17. |
6. sec x log (sec x + tan x) dx |
| Answer» | |
| 18. |
23. V13 225 +05379 + 52 % of 700 = 408 +? |
|
Answer» (13225)^1/2 + (205379)^1/3+ 52% of 700 = 408 +? 115 + 59 + 52*7/100 = 408 + ?174 + 3.64 = 408 + ?177.64 = 408 + ?? = 177.64 - 408 = ? = - 230.36 |
|
| 19. |
- Locate V13 on the number line. |
| Answer» | |
| 20. |
27.The rational form of 2.74 35 is:2.7435 का परिमेय रूप होगा -2716127161999027161(C) -99009000(A) 9999(B}(D) 27161 |
|
Answer» x = 271.60 /99 to eliminate decimal in numerator multiply and divide with 100 we get x = 217.60*100/ 99*100 it was x = 271.60*100/ 99*100. which is equal to 27160/ 9900. |
|
| 21. |
夺Catan numbexau,eadhweulnumdenchodven |
| Answer» | |
| 22. |
Q8:A door of length 2 m and breadth 1 m is fitted in a wall. The length of the wall is 4.5 m and the breadth is 3.6 m (see thegiven figure). Find the cost of white washing the wall, if the rate of white washing the wall is Rs 20 per m2 |
| Answer» | |
| 23. |
3 “लाशा ard. $S 02:०९ धजक Ko ot Y0 b saduo Y. ‘L{j 0४ = D, Breकी - 30 3 |
|
Answer» the points A and B are not mentioned in it Like if you find it useful |
|
| 24. |
find the nationalnumbex In between3 and 4 |
|
Answer» Rational number will be 3+4/2=7/2=3.5thanks |
|
| 25. |
g ÂŁCH,;COOH + NaHCO, |
|
Answer» Ans :- NaHCO3+ CH3COOH → CH3COONa + H2O + CO2 Sodium bicarbonate react with acetic acid to produce sodium acetate, water and carbon dioxide. |
|
| 26. |
Tofi I then prove ula\cos ^{-1} x+\cos ^{-1} y+\cos ^{-1} y+\cos ^{-1} 2=\pi |
| Answer» | |
| 27. |
SFind a point on z-axis which is equidistant from (1, 5, 7) and (5, 1, -4).Show that the points (1-6 10ma a |
| Answer» | |
| 28. |
"625x (-35)(-625) Ă 65 |
|
Answer» PLEASE LIKE AND SHARE THIS APP 625×(-35)+(-625)×(-65 |
|
| 29. |
5^{x}=625 |
| Answer» | |
| 30. |
ive the IUPAC names of:(ii) CH2=-CH-CH3(iii)CH3-0-0-H |
|
Answer» IUPAC name of these are1)Butynr2)Propyne3)Ethanoic Acid thanks for the answers |
|
| 31. |
e) 625 % (-35) + (-625x6 |
| Answer» | |
| 32. |
13: A room is 40 m long, 25 m broad and 10 m high. Find the cost of white-washing allthe four walls, if the cost of white-washing is6 per m2 |
|
Answer» Length of that godown = 40mwidth of that godown = 25mthe height = 10m lateral surface area of a cuboid = 2h (l+b) = 2 (10){25 + 40}= 20 ( 65)= 1300m^2 area of the celling = length × breadth= 25 × 40= 1000m^2 total area to be whitewashed = total lateral area + area of the celling= 1300 + 1000=2300m^2 cost of whitewash per m^2 = Rs. 20total cost = total area to be whitewashed × cost of whitewashing per m^2= 2300 × 20= 26,000 |
|
| 33. |
625^x=25/5^x |
| Answer» | |
| 34. |
A door oflength 2 m and breadth Im is fitted in a wall. The lengthofthewallis 4.5 m and the breadth is 3.6 m (Fig11.6). Find the cost of whitewashing the wall,if the rate of white washing the wall is 20 per m. |
| Answer» | |
| 35. |
\frac{1+\sin \theta-\cos \theta}{1+\sin \theta+\cos \theta}=\sqrt{\frac{1-\cos \theta}{1+\cos \theta}} |
| Answer» | |
| 36. |
\left(\frac{1+\sin \theta-\cos \theta}{1+\sin \theta+\cos \theta}\right)^{2}=\frac{1-\cos \theta}{1+\cos \theta} |
| Answer» | |
| 37. |
x uisR 2812४ 1217 1% 3” सा |
| Answer» | |
| 38. |
4, Use distance formula to show that the points (cosec%, 0), (0, sede)and (l; 1) are collinear. |
|
Answer» Like if you find it useful |
|
| 39. |
4-2a and b ard otional numbexSFind |
|
Answer» Please like the solution 👍 ✔️ 4+3√5/4-3√5=a+b√4(4+3√5)/(4-3√5)×(4+3√5)/4+3√5)(4+3√5)^2/(4)^2-(3√5)^2(4)^2+(3√5)^2+2×4×3√5/16-4516+45+24√5/-2961+24√5/-29(61/-29)+(24√5)/-29=a+b√5so,a=61/-29b=24/-29 hope it helped |
|
| 40. |
Find five rational numbers between - andUla |
|
Answer» 31/50,32/50,33/50,34/50,35/50 please like and comment |
|
| 41. |
3.Find five rational numbers betweenula |
|
Answer» in 3/5 & 4/5 we can't get any rational number .so, we can do as following3/5×10= 30/504/5×10=40/50now we got 10 rational number between 30/50&40/50 in 3/5 & 4/5 we can't get any rational number .so, we can do as following3/5×10= 30/504/5×10=40/50now we got 10 rational number between 30/50&40/50 31/50,32/50,34/50/35/5036/50 Do the following steps to get the answer 3/5*10=30/504/5*10=40/50now we can get ten rational number between it select the first five and write 3.1/5, 3.3/5, 3.5/5, 3.7/5, 3.9/5 five rational number in between 3/5 and 4/53/5=3×10 5×10=30/504/5=4×10 5×10=40/50five rational number =31/50 ,32/50 ,33/50 ,34/50 ,35/50 |
|
| 42. |
Fanula inet use. |
|
Answer» (a+b)³ = (a+b)(a+b)(a+b) = [(a+b)(a+b)](a+b) = [a²+b²+2ab](a+b) = [a³+a²b+ ab²+b³+2a²b+2ab²] = [a³+b³+3a²b+3ab²] = [a³+b³+3ab(a+b)] now, (a+b)³ = a³+b³ +3ab(a+b) so, a³ +b³ = (a+b)³ - 3ab(a+b) |
|
| 43. |
625 X (-35) + (-625) x 65 |
|
Answer» Explanation : 625×(-35) + (-625)×65 = 625×(-35-65) = 625×(-100) = -62500 Answer : -62500 If you find this answer helpful then like it. |
|
| 44. |
, 625 x (-35)(-625) Ă 65 |
| Answer» | |
| 45. |
65*(-625) %2B 625*(-35) |
|
Answer» 625(-35)+(-65)625(-35-65)625*10062500 625(-35)+(-65)625(-35-65)625*10062500 625(-35)+(-35)625(-35-65)625×10062500 Given,625 * ( -35 ) + ( -625 ) * 65,= -625 * ( 35 + 65 ),= -62500. the correct answer of the given question is 62500 . |
|
| 46. |
9.18.07Find the value of (625)" x (625) |
| Answer» | |
| 47. |
Find the valuc of (625)0N x (625)a7 |
|
Answer» As base are same power will be addedso it will be (625) ⁰·²⁵(5^4)⁰·²⁵5 |
|
| 48. |
치4Evaluatelog (1+ tan x) dx. |
| Answer» | |
| 49. |
tan(pi/4 - theta) %2B tan(pi/4 %2B theta)=2*sec(2*theta) |
|
Answer» Let theta = x LHS: tan(pi/4 + x) + tan(pi/4 - x) =(1+tan x)/(1-tan x)+ (1- tan x)/(1+tan x) =[(1+tan x)^2 +(1-tan x)^2]/[(1-tan^2 x] =2(1+tan^2 x)/(1-tan^2 x) =2(cos^2 x+sin^2 x)/(cos^2x-sin^2 x) =2/cos2x = 2sec2x= RHS Hence proved |
|
| 50. |
fromalamppostwhithis6/ 10. A man of height 2 mcters walks at a uniform spced of 5 km/hr awaymetres high. Find the rate at which the length of his shadow incrcases. |
|
Answer» thank you |
|