Saved Bookmarks
This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
Eind the volume of a sphere whose surface area is 154 cm. |
|
Answer» Let r cm be the radius of sphere Surface area of the sphere = 4πr2 154 = 4πr^24 x 22/7 x r^2= 154 r^2=154 x 7/4 x 22 = 72/22 r = 7/2 Volume of sphere =4/3πr^3 = 4/3 x 22/7 x 7/2 x 7/2 x 7/2 cm3 = 539/3 cm3= 179.2/3 cm3 |
|
| 2. |
हक अर २ T s IR S s =7 eSob mhaos 2Bb: 2r+y =3x43y=~1 |
|
Answer» Multiplying second equation by 2, we get2x+6y=-22x+y=3Subtracting the two equations,5y =-5y=-1x=3+1/2 =2 |
|
| 3. |
1042. In Fig. 6.29, ir AB I CD, cDlI EF and y:z 3:7.find x. |
|
Answer» draw an angle W vertically opposite to Y(Y=W)let Y=3m. Z=7mif Y=3m then W=3mW+Z=180(co interior angles) 3m+7m=18010m=180m=18Y=W=18*3=54Z=18*7= |
|
| 4. |
BRI SEROCI S MNEES. AT R U IR R SRSहियीत बहुपद 6+* - 7-3 के शून्यक ज्ञात कीजिए |
| Answer» | |
| 5. |
—_— R7 “३१० « Tt —nW. I = IR, I+ = W, ¥4y = »है) १६ था९, महाराष्ट्र राज्याचे राज्य फूल कोणते? ¥) रेट |
|
Answer» Given,2 + 3 = 32,3 + 2 = 23 Then,4 + 1 = 14 (4) is correct option |
|
| 6. |
Find the radius of a sphere whose surface area is 154 cm2 |
| Answer» | |
| 7. |
. Find the radius of a sphere whose surface area is 154 cm2 |
| Answer» | |
| 8. |
P13.अधिकतमीकरण करें (Maximize)z = 7x + 3yz = 2y 23x + y = 4X2 0,20 |
|
Answer» z=7x+3y No solutions found Rearrange: Rearrange the equation by subtracting what is to the right of the equal sign from both sides of the equation : z-(7*x+3*y)=0 Step by step solution : Step1: Solving a Single Variable Equation: 1.1Solvez-7x-3y=0 In this type of equations, having more than one variable (unknown), you have to specify for which variable you want the equation solved. We shall not handle this type of equations at this time. No solutions found Processing ends successfully |
|
| 9. |
o=T+Xx+ z X2 L |
| Answer» | |
| 10. |
If cos-1 x + cos-1 ycos-1 z = Ď, then prove that x2 + y2 + z 2 + 2xyz = 1. |
| Answer» | |
| 11. |
Verify divergence theorem for F-4xi -2y23 +22i taken over the regionbounded by the cylinder x2 + y2 = 4, z = 0, z = 3. |
|
Answer» This last integral represents 42 times the area of a semicircle of radius 2. This therefore equals42∗π∗222=84π42∗π∗222=84π, which is the same answer previously calculated. |
|
| 12. |
If R = {(x, y) | x, y e Z, x2 + y24) is a relation in Z, then domain of R is(d) none of thesenfrom A to B defined by 'x is greate |
| Answer» | |
| 13. |
How many times hands of a clock coincide in a day :- |
|
Answer» Explanation: The hands of a clock coincide11 timesin every 12 hours (Since between 11 and 1, they coincide onlyonce, i.e., at 12 o'clock). The hands overlap about every 65 minutes, not every 60 minutes. The hands coincide22 timesin a day. |
|
| 14. |
c) Jaya borrowed50,000 for 2 years. The rates of interest for two successiveyears are 12% and 15% respectively She repays 33,000 at the end of thefirst yecr. Find the amount she must pay at the end of the second year toclear her deht. |
|
Answer» SI = P*R*T/100 For first yearP = 50000, R = 12%, T = 1SI = 50000*12*1/100 = 500*12 = 6000 Total amount after one year = 50000 + 6000 = 56000 But she repay 33000. Then remaining debt = 56000 - 33000 = 23000 For second yearP = 23000, R = 15%, T = 1SI = 23000*15*1/100 = 230*15 = 3450 Total amount after second year she has to pay to clear debt= 23000 + 3450 = 26450 |
|
| 15. |
how many times hands of a clock coincided in a day |
|
Answer» The hands of a clock coincide11 timesin every 12 hours (Since between 11 and 1, they coincide onlyonce, i.e., at 12 o'clock). The hands overlap about every 65 minutes, not every 60 minutes. The hands coincide22 timesin a day. tq |
|
| 16. |
Q.2) How many times hands of a clock coincide in a day:- |
|
Answer» The hands of a clock coincide11 timesin every 12 hours (Since between 11 and 1, they coincide onlyonce, i.e., at 12 o'clock). The hands overlap about every 65 minutes, not every 60 minutes. The hands coincide22 timesin a day. |
|
| 17. |
Q.2) How many times hands of a clock coincide in a day |
|
Answer» The hands of a clock coincide11 timesin every 12 hours (Since between 11 and 1, they coincide onlyonce, i.e., at 12 o'clock). The hands overlap about every 65 minutes, not every 60 minutes. The hands coincide22 timesin a day. thanks |
|
| 18. |
22) How many times hands of a clock coincide in a day s |
|
Answer» 22 times hands of a clock coincide in a day. |
|
| 19. |
2. Find the L.C.M. of each of the follo< and (ii) the common division m18, 24 and 96 |
|
Answer» 3*3*2*2*2*2*2=278 is the correct ans 18/2=9/3=3; 24/2=12/2=6/2=3, 96/2=48/2=24/2=12/2=6/2=3; 3*2*2*2*2*2*3= 274 is the right answer 2×2×2×2×2×3×3=278 is a answere 278 is the right answer . 2*2*2*2*2*3*3=278 is the L.C.M of 18,24 and 96 18,24,96 ka L.C.M.18= 2×3×324= 2×2×3×296= 2×2×2×2×2×3L.C.M.=2×2×2×2×2×3×3 = 288 is right answer |
|
| 20. |
2) How many times hands of a clock coincide in a day:10(B) 22(C) 11(D) 24 |
|
Answer» Explanation: The hands of a clock coincide11 timesin every 12 hours (Since between 11 and 1, they coincide onlyonce, i.e., at 12 o'clock). The hands overlap about every 65 minutes, not every 60 minutes. The hands coincide22 timesin a day. |
|
| 21. |
the height of a cone is 76 cm and base radius is 72 cm . find curved surface area and volume... |
|
Answer» thankyou |
|
| 22. |
7 iR= |
|
Answer» 3x+5=163x=16-5x=11/3 |
|
| 23. |
8iräš |
| Answer» | |
| 24. |
कि | :iIR८ |
|
Answer» 11/18+5/27=33+10/54=43/54 is the best answer |
|
| 25. |
. Find s, ir |
| Answer» | |
| 26. |
. Find the altitude of a triangle having an area of 72cm2 and base 16cm. |
| Answer» | |
| 27. |
10. t. y and z aretinterest on y fo(a) xyz = 1(d)792(c) 768are three sums of money such that y is the simple interest on x and z is the simple(b) z* = xyon y for the same time and same rate. Which of the following is correct?(c) x = yz(d) y = zxHint: y = SI on x = (XXRx 7)100 .2 - Si on ylyxRxT).*R*TX_100 )1002 100 yxRxT) * -zx.Launch na |
| Answer» | |
| 28. |
(2) In AABC, ZA 76, B 48°, then C- |
|
Answer» given,angleA=76angleB=48angleC=?in triangle ABCsum of three angles=18076+48+C=180124+C=180C=180-124C=56 |
|
| 29. |
A closed box is varnished on the outside at therate of 5p per cm^2. What is the total cost ofvarnishing a box of length 50 cm, breadth40 cm and height 30 cm? |
| Answer» | |
| 30. |
+. 76. यदिa^{*} b=a+b+a b हो, तो:3 * 4-2 * 3 बराबर है- |
|
Answer» yru ans is wrong You were doing right but in 2 case you put - which is wrong because - is between in both cases |
|
| 31. |
2 b=22 न 76 “2429 = 7 b L +9b —2ab =Y |
|
Answer» 21b - 32 + 7b - 2ab= b(21 + 7 - 2a) - 32= b (28 - 2a) - 32 PLEASE HIT THE LIKE BUTTON |
|
| 32. |
76. यदि = A sin mx + B cosmx तो सिद्ध कीजिए किहैD |
| Answer» | |
| 33. |
b PRIl ot 1 76 13 (D (0dtt = r=t52A |
|
Answer» hit like if you find it useful |
|
| 34. |
1. Add the follo |
|
Answer» 2/7+5/7=7/7=11 is the answer of this question 2/7+5/7=7/7=1 whole |
|
| 35. |
. Evaluate the follosin 20°cos70° |
|
Answer» Sin(90-70)/cos70=cos70/cos70=1 |
|
| 36. |
f \frac { 2 } { 5 } \times \frac { - 10 } { 3 } \text { by } ( \frac { 1 } { 2 } - \frac { 1 } { 3 } ) |
|
Answer» 2/5 * [-10/3] = -4/3 reciprocal of -4/3 = -3/4[1/2 - 1/3] = 3 -2 /6 =1/6 -3/4 ÷ 1/6 -3/4 * 6/1 =-18 /4 = -9 /2 |
|
| 37. |
. Prove that the folloV2 |
|
Answer» same |
|
| 38. |
3. Convert the follo$18 |
|
Answer» 30/42 both numbers cut by 2 15/21 both numbers cut by 3 5/7(simplest form)answer 30/42 Simplify both the numbers by 2,we get:- 15/21Again simplify both the numbers by 3,we get:- 5/7(simplest form) 5/7 is the correct answer of the given question 5/7 is the correct answer of the given qustion |
|
| 39. |
3.Simplify:orify the follo |
|
Answer» (30+14-33)/36=>11/36 very easy to solvetry it own |
|
| 40. |
Classify the follo(G) 2- v5 |
|
Answer» The given number is irrational as sum of integer and irrational is always irrational. |
|
| 41. |
L e41. दिए गए चित्र कां परिमाप कया होगा जहाँ 470 एक अर्द्धवृत्त है ।.... 48070 एक "आयत 2 . ; |
|
Answer» : दिया गया है ए बी तथा डीसी की लंबाई 20 सेंटीमीटर तथा बी सी तथा एडी की चौड़ाई 14 सेंटीमीटर है अर्ध वृत्त का त्रिज्या 7 सेंटीमीटर हैLength = AB = DC = 20 cmBreadth = BC = AD = 14 cm semicircle ki , त्रिज्या (r)= AD/2 = 14/2=7 Circumference of semicircle (AED)= πr = (22/7) × 7 = 22 cm दिए गए चित्र का परिमाप है= AB + BC +CD + Circumference of semicircle दिए गए चित्र का परिमाप होगा= 20 +14 +20 + 22 = 76 cm. अतः दिए गए चित्र का परिमाप 76 सेंटीमीटर है |
|
| 42. |
5. Simplify each of the folloO |
|
Answer» 7/9 + (-11)/37-33/9-26/9 7-33/9=-26/9. |
|
| 43. |
1u. It d varies directly as t, and ifd 4 when -9, find d when21.DiucA |
|
Answer» Let d = kt4 = k ×9K = 4/9thusd = 4/9 ×21= 28/3 |
|
| 44. |
I. The opposiĂźie angles of a parallelogram are (Bx-2) and (63-2y. Findall thne samglies of puraleingnam |
|
Answer» In Parallelogram opposite angles are equalTherefore, (3x-2) = (63-2x)5x = 65x = 13 All angles of Parallelogram are(3*13 - 2) = 37(63-2*13) = 37Other two angles are (180 - 37) = 143 |
|
| 45. |
[1.3 52.प्रश्न 16. (-3 0 है2 5 0] |
|
Answer» use diamond thing first i |
|
| 46. |
\begin{array} { l } { \text { 2. Find the cost price. } } \\ { \text { a. } S P = 500 , \text { Gain } = 5 \% } \\ { \text { b. } S P = \ 470 , \text { Loss } = 6 \% } \end{array} |
|
Answer» a)SP = ₹500Gain% = 5%let CP be xsox + 5 % of x = 500x + x × 1/20 = 50021x/20 = 500x = (500×20)/21x = ₹476.2 |
|
| 47. |
(text*(24*(f*o)))/3 |
|
Answer» 8×1 = 8 and because 3 se 24 8 barr me katega |
|
| 48. |
If x varies directly as 3y +1 and x = 9 when y = 1,what is the value of x when y = 5?(A) 11(B) 10(C) 20(D) 36 |
| Answer» | |
| 49. |
6194 then x+a) 76b) 52c) 64d) none of these |
| Answer» | |
| 50. |
3*(text*(10*(f*o))) - 10 %2B 70 - 60 %2B 6 |
|
Answer» 70 - 2 × 5 + 3 of 10 - 60 + 6=70 - 10 +30 -60 +6=36 36 is the correct answer of the given question 70-2*5+3 of 10-60+6=70-10+30-60+6=36 according to bodmas is answer is 36 |
|