Explore topic-wise InterviewSolutions in Current Affairs.

This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.

1.

the number of moles of kmno4to react completely with one mole of oxalic acid in acidic reaction

Answer» the number of moles of kmno4to react completely with one mole of oxalic acid in acidic reaction
2.

The following equilibrium constants were determined at 1120 K: 2CO(g)⇌C(s)+CO2(g) Kp1=10−14 atm−1CO(g)+Cl2(g)⇌COCl2 Kp2=6×10−3 atm−1What is the equilibrium constant Kp for the following reaction at 1120 K. C(s)+CO2(g)+2Cl2(g)⇌2COCl2(g)

Answer»

The following equilibrium constants were determined at 1120 K: 2CO(g)C(s)+CO2(g) Kp1=1014 atm1

CO(g)+Cl2(g)COCl2 Kp2=6×103 atm1

What is the equilibrium constant Kp for the following reaction at 1120 K. C(s)+CO2(g)+2Cl2(g)2COCl2(g)

3.

For the complex [NiCl4]2−, write (i) The IUPAC name. (ii) Hybridization of the central metal atom. (iii) The shape of the complex. (Atomic no. of Ni = 28)

Answer» For the complex [NiCl4]2, write
(i) The IUPAC name.
(ii) Hybridization of the central metal atom.
(iii) The shape of the complex.
(Atomic no. of Ni = 28)
4.

The ratio of van't Hoff factor for three different aqueous solutions of KCl,CuSO4 and CaF2 respectively is:Assume 100% ionisation

Answer»

The ratio of van't Hoff factor for three different aqueous solutions of KCl,CuSO4 and CaF2 respectively is:

Assume 100% ionisation

5.

38. Mole fraction of sulphuric acid in aqueous solution is 0.5 find it's molality

Answer» 38. Mole fraction of sulphuric acid in aqueous solution is 0.5 find it's molality
6.

Find the average magnitude of linear momentum of a helium molecule in a sample of helium gas at 00C. Mass of a helium molecule = 6.64 × 10−27 kg and Boltzmann constant 1.38 ×10−23 J K−1.

Answer»

Find the average magnitude of linear momentum of a helium molecule in a sample of helium gas at 00C. Mass of a helium molecule = 6.64 × 1027 kg and Boltzmann constant 1.38 ×1023 J K1.

7.

a difference of temperature of 25 degree celcius is equivalent to a difference of

Answer» a difference of temperature of 25 degree celcius is equivalent to a difference of
8.

When which formulae for work done and entropy in chemistry is to be used? And What are allthe formulaes?

Answer» When which formulae for work done and entropy in chemistry is to be used? And What are allthe formulaes?
9.

The following reaction gives:

Answer»

The following reaction gives:


10.

Thallium cyanide Tl(CN)x crystallises as a simple cubic array of CN- ions with Thallium ions in all cubic holes. What is the oxidation state of thallium of this compound

Answer» Thallium cyanide Tl(CN)x crystallises as a simple cubic array of CN- ions with Thallium ions in all cubic holes. What is the oxidation state of thallium of this compound
11.

Q1: Difference between Dipole and Dipole movement ? Q2: what is the meaning of terms dipole ,polarity, polar body , polarization, permittivity of free space , absolute permittivity. Q3 : Difference between absolute permittivity and permittivity of free space ?

Answer» Q1: Difference between Dipole and Dipole movement ? Q2: what is the meaning of terms dipole ,polarity, polar body , polarization, permittivity of free space , absolute permittivity. Q3 : Difference between absolute permittivity and permittivity of free space ?
12.

t he ionisation energy of hydrogen atom is 13.6 eV it is exposed to electromagnetic waves of 1028 A and gives out induced radiations find out the wavelenth of these induced radiation

Answer» t he ionisation energy of hydrogen atom is 13.6 eV it is exposed to electromagnetic waves of 1028 A and gives out induced radiations find out the wavelenth of these induced radiation
13.

The number of moles in 3.00 g of boron tribromide BBr3 is 'x' ×10−2. 'x' is :

Answer»

The number of moles in 3.00 g of boron tribromide BBr3 is 'x' ×102. 'x' is :

14.

30.What is the reaction between ANISOL+(Na/liq amonia+t-BuOH)?

Answer» 30.What is the reaction between ANISOL+(Na/liq amonia+t-BuOH)?
15.

which d-orbital is involved in sp3d hybridisation

Answer» which d-orbital is involved in sp3d hybridisation
16.

Explain the following terms with suitable examples:(i) Schottkydefect (ii) Frenkeldefect (iii) Interstitialsand (iv) F-centres

Answer»


Explain the following terms with suitable examples:


(i) Schottky
defect


(ii) Frenkel
defect


(iii) Interstitials
and


(iv) F-centres

17.

Show that the product of any two consecutive positive integers is always even

Answer» Show that the product of any two consecutive positive integers is always even
18.

The compound which gives the most stable carbonium ion on protonation followed by loss of water is:

Answer»

The compound which gives the most stable carbonium ion on protonation followed by loss of water is:

19.

The bond enthalpy of which of the following single bond is maximum.1) C-C 2) C-H 3) H-H 4) H-N

Answer» The bond enthalpy of which of the following single bond is maximum.1) C-C 2) C-H 3) H-H 4) H-N
20.

Preparation of lassaigne filtrate

Answer» Preparation of lassaigne filtrate
21.

the total number of electrons present in 18 ml of water

Answer» the total number of electrons present in 18 ml of water
22.

If a milkman mixed 4 liters of water in 2 liters of milk , then the ratio of milk to the mixture is -1. 2:52. 2:33. 1:34. 1:2

Answer» If a milkman mixed 4 liters of water in 2 liters of milk , then the ratio of milk to the mixture is -
1. 2:5
2. 2:3
3. 1:3
4. 1:2
23.

The reduction of which of the following compounds would yield secondary amine?

Answer»

The reduction of which of the following compounds would yield secondary amine?



24.

What is muons and poins?

Answer» What is muons and poins?
25.

what is the hybridization of [Co(NH3)6]2+ & [Co(NH3)6]3+ & [Cu(NH3)4]+ ?

Answer» what is the hybridization of [Co(NH3)6]2+ & [Co(NH3)6]3+ & [Cu(NH3)4]+ ?
26.

Chlorine is prepared in the laboratory by treating manganese dioxide (MnO2) with aqueous hydrochloric acid according to the reaction4HCl(aq) + MnO2(s) → 2H2O(l) + MnCl2(aq) + Cl2(g)How many grams of HCl react with 5.0 g of manganese dioxide?

Answer»

Chlorine is prepared in the laboratory by treating manganese dioxide (MnO2) with aqueous hydrochloric acid according to the reaction


4HCl(aq) + MnO2(s) → 2H2O(l) + MnCl2(aq) + Cl2(g)


How many grams of HCl react with 5.0 g of manganese dioxide?

27.

What is the effect fo denaturation on the structure of proteins?

Answer»

What is the effect fo denaturation on the structure of proteins?

28.

+R and - R effect are applicable only of benzene or also for other unsaturated compounds showing resonance?

Answer» +R and - R effect are applicable only of benzene or also for other unsaturated compounds showing resonance?
29.

Q7) atoms of an element B forms HCP lattice and those of the elements A occupy 2/3rd of tetrahedral voids derive the formula of the compound

Answer»

Q7) atoms of an element B forms HCP lattice and those of the elements A occupy 2/3rd of tetrahedral voids derive the formula of the compound

30.

In a solid AB having the NaCl structure, A atom occupies the cornerns of the cubic unit cell. If all the face-centred atoms along one of the axes are removed, then the resultant stoichiometry of the solid is

Answer»

In a solid AB having the NaCl structure, A atom occupies the cornerns of the cubic unit cell. If all the face-centred atoms along one of the axes are removed, then the resultant stoichiometry of the solid is

31.

Coordinate and covalent bond of N2o

Answer» Coordinate and covalent bond of N2o
32.

12.A solution required [OH-] = 2 M. If degree of dissociation of Mg(OH)2 is 'alpha' what analytical solution of Mg(OH)2 needed is equal to 1. 'alpha' 2. 2 'alpha' 3. 1/ 'alpha' 4. 1/ 2 'alpha'

Answer» 12.A solution required [OH-] = 2 M. If degree of dissociation of Mg(OH)2 is 'alpha' what analytical solution of Mg(OH)2 needed is equal to 1. 'alpha' 2. 2 'alpha' 3. 1/ 'alpha' 4. 1/ 2 'alpha'
33.

22. A non poisonous compound is formed when 1% ethyl alcohol is added to chloroform. What is the compound?

Answer» 22. A non poisonous compound is formed when 1% ethyl alcohol is added to chloroform. What is the compound?
34.

31. What is the covalency of NO2 and what explain the concept of covalency

Answer» 31. What is the covalency of NO2 and what explain the concept of covalency
35.

<!--td {border: 1px solid #ccc;}br {mso-data-placement:same-cell;}-->Second stage of PSLV has ______ as fuel and ______ as oxidiser. Which of the following options correctly fill in the blanks?

Answer»

<!--td {border: 1px solid #ccc;}br {mso-data-placement:same-cell;}-->

Second stage of PSLV has ______ as fuel and ______ as oxidiser. Which of the following options correctly fill in the blanks?


36.

Question 54 How would you bring about the following conversions? Name the process and write the reaction involved. (a) Ethanol to ethene (b) Propanol to propanoic acid

Answer»

Question 54
How would you bring about the following conversions? Name the process and write the reaction involved.

(a) Ethanol to ethene

(b) Propanol to propanoic acid

37.

Each of the three metals x, y and z were put in turn into aqueous solution of the other two. x + salt of y (or z) = y (or z) + salt of x.Which one of the following observation is incorrect?(1) y + salt of x = no action observed(2) y + salt of z = z + salt of y(3) z + salt of x = x + salt of z(4) z + salt of y = no action observed

Answer» Each of the three metals x, y and z were put in turn into aqueous solution of the other two. x + salt of y (or z) = y (or z) + salt of x.
Which one of the following observation is incorrect?
(1) y + salt of x = no action observed
(2) y + salt of z = z + salt of y
(3) z + salt of x = x + salt of z
(4) z + salt of y = no action observed
38.

50 mL of a solution of Na2CO3 and NaHCO3 requires 17.5 mL of 0.1 M H2SO4 for neutralisation using phenolphthalein as indicator. Methyl orange is then added when further 25 mL of 0.2 M H2SO4 was required. Calculate the weight of Na2CO3 and NaHCO3 respectively in the solution.

Answer» 50 mL of a solution of Na2CO3 and NaHCO3 requires 17.5 mL of 0.1 M H2SO4 for neutralisation using phenolphthalein as indicator. Methyl orange is then added when further 25 mL of 0.2 M H2SO4 was required. Calculate the weight of Na2CO3 and NaHCO3 respectively in the solution.
39.

5. Number of tetrahedral voids present on face centre in FCC unit cell is 1. 0 2. 2 3. 4 4. 8

Answer» 5. Number of tetrahedral voids present on face centre in FCC unit cell is 1. 0 2. 2 3. 4 4. 8
40.

In a disproportional reaction,Br2+OH−→Br−+BrO−3+H2Othe ratio of Br2 molecules undergoing oxidation and reduction respectively is

Answer»

In a disproportional reaction,



Br2+OHBr+BrO3+H2O



the ratio of Br2 molecules undergoing oxidation and reduction respectively is

41.

Rare earths are generally

Answer» Rare earths are generally
42.

15 : As compared to lithium sodium reacts quickly with water because? Why?

Answer» 15 : As compared to lithium sodium reacts quickly with water because? Why?
43.

What is the vulcanisation of rubber? Why is it necessary?

Answer»

What is the vulcanisation of rubber? Why is it necessary?
44.

A compound (x) on treatment with Na gives (y), and with PCl5 gives (z).(y) and (z) react together to form diethyl ether.(x), (y) and (z) respectively are:

Answer»

A compound (x) on treatment with Na gives (y), and with PCl5 gives (z).(y) and (z) react together to form diethyl ether.

(x), (y) and (z) respectively are:

45.

Write the election configuration of the element having atomic number 21,also predict the period,group and block of that element.

Answer» Write the election configuration of the element having atomic number 21,also predict the period,group and block of that element.
46.

(a) Define the following terms : (i) Molarity (ii) Molal elevation constant (Kb) (b) A solution containing 15 g urea (molar mass = 60 g mol−1) per litre of solution in water has the same osmotic pressure (isotonic) as a solution of glucose (molar mass = 180 g mol−1) in water. Calculate the mass of glucose present in one litre of its solution.

Answer» (a) Define the following terms :

(i) Molarity

(ii) Molal elevation constant (Kb)

(b) A solution containing 15 g urea (molar mass = 60 g mol1) per litre of solution in water has the same osmotic pressure (isotonic) as a solution of glucose (molar mass = 180 g mol1) in water. Calculate the mass of glucose present in one litre of its solution.

47.

An electron and a proton have same ke ratio of their respective de broglie wavelength is about

Answer» An electron and a proton have same ke ratio of their respective de broglie wavelength is about
48.

26. A mineral has the molecular formula MgAl2O4 . In this oxide ions are present in CCP arrangement , Mg+ ions occupy tetrahedral void and Al+ ions occupy octahedral void calculate the percentage of: 1. Tetrahedral void occupied by Mg+ ion. 2. Octahedral voids occupied by Al+ ion.

Answer» 26. A mineral has the molecular formula MgAl2O4 . In this oxide ions are present in CCP arrangement , Mg+ ions occupy tetrahedral void and Al+ ions occupy octahedral void calculate the percentage of: 1. Tetrahedral void occupied by Mg+ ion. 2. Octahedral voids occupied by Al+ ion.
49.

In a face centre cubicycle lattice, all atoms at face are shared by how many unit cells ?

Answer» In a face centre cubicycle lattice, all atoms at face are shared by how many unit cells ?
50.

The density of a solution that has 40% by mass of CH3COOH is 1.2 g/ml. The molarity of the solution is

Answer» The density of a solution that has 40% by mass of CH3COOH is 1.2 g/ml. The molarity of the solution is