This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
The correct order of increasing bond angles in the following triatomic species is (a) NO2+ |
|
Answer» The correct order of increasing bond angles in the following triatomic species is (a) NO2+ |
|
| 2. |
Glycerol reacts with P4 + I2 to form (a)aldehyde (b)allyl alcohol (c)allyl iodid (d)acetylene |
| Answer» Glycerol reacts with P4 + I2 to form (a)aldehyde (b)allyl alcohol (c)allyl iodid (d)acetylene | |
| 3. |
List all allotropes of carbon. |
| Answer» List all allotropes of carbon. | |
| 4. |
Tranquilizers are substances used for the treatment of: |
|
Answer» Tranquilizers are substances used for the treatment of: |
|
| 5. |
Match List-I with List-IIList-IList-II(a) NaOH(i) Acidic(b) Be(OH)2(ii)Basic(c)Ca(OH)2(iii) Amphoteric(d) B(OH)3 (e) Al(OH)3 Choose the most appropriate answer from the options given below : |
||||||||||||
|
Answer» Match List-I with List-II
Choose the most appropriate answer from the options given below : |
|||||||||||||
| 6. |
A light vertical rod is given a slight jerk.locus of particles of the rod? |
| Answer» A light vertical rod is given a slight jerk.locus of particles of the rod? | |
| 7. |
What happens when alcohols reacts with ethers |
| Answer» What happens when alcohols reacts with ethers | |
| 8. |
How to calculate bond enthalpy? |
| Answer» How to calculate bond enthalpy? | |
| 9. |
The colour of Cu(I) salts is |
|
Answer» The colour of Cu(I) salts is |
|
| 10. |
Find the longitudinal stress applied to a steel wire to stretch it by 0.025 % of its original length, if the ratio of longitudinal stress and strain is 9×1010 Nm−2. |
|
Answer» Find the longitudinal stress applied to a steel wire to stretch it by 0.025 % of its original length, if the ratio of longitudinal stress and strain is 9×1010 Nm−2. |
|
| 11. |
Reaction of Br2 with Na2CO3 in aqueous solution gives sodium bromide and sodium bromate with evolution of CO2 gas. The number of sodium bromide molecules involved in the balanced chemical equation is ___ |
|
Answer» Reaction of Br2 with Na2CO3 in aqueous solution gives sodium bromide and sodium bromate with evolution of CO2 gas. The number of sodium bromide molecules involved in the balanced chemical equation is |
|
| 12. |
Acetate rayon is prepared from |
|
Answer» Acetate rayon is prepared from |
|
| 13. |
The ionisation energy of hydrogen atom in its ground state is 13.6 eV. The energy released (in eV) for the third line of Balmer series is: |
|
Answer» The ionisation energy of hydrogen atom in its ground state is 13.6 eV. The energy released (in eV) for the third line of Balmer series is: |
|
| 14. |
Which one of the following is most electropositive and why?a)Clb)Oc)Ald)BeWhy Al and not Be |
|
Answer» Which one of the following is most electropositive and why? a)Cl b)O c)Al d)Be Why Al and not Be |
|
| 15. |
Equal volumes of three acid solutions of pH-3,4 and 5 are mixed in a vessel. What will be the H+ ion concentration in the mixture? |
| Answer» Equal volumes of three acid solutions of pH-3,4 and 5 are mixed in a vessel. What will be the H+ ion concentration in the mixture? | |
| 16. |
nthalf life of radioactive decay of c14 is 5730 years .how much time it will take so that 25%of c14 was found in sample?n |
| Answer» nthalf life of radioactive decay of c14 is 5730 years .how much time it will take so that 25%of c14 was found in sample?n | |
| 17. |
Which of the following will give Cannizzaro’s reaction? |
|
Answer» Which of the following will give Cannizzaro’s reaction? |
|
| 18. |
in arrhenius equation for a certain reaction ; the value of A and Ea are 4×10 raised to power 13 and 98.67 kJ / mol respectively .if the reaction is of first order ; then at what temp will its half period be 10 min ? |
| Answer» in arrhenius equation for a certain reaction ; the value of A and Ea are 4×10 raised to power 13 and 98.67 kJ / mol respectively .if the reaction is of first order ; then at what temp will its half period be 10 min ? | |
| 19. |
how to solve log 23 |
| Answer» how to solve log 23 | |
| 20. |
Ozonolysis of alkenes gives ozonide which gives aldehydes and/or ketones. When a stream of O3 is passed through a solution of alkene in an inert solvent at low temperature, the molecule adds up to form ozonide. This ozonide is unstable and easily decomposes either by reduction or hydrolysis and forms compound having the carbonyl group >C=O. This is known as ozonolysis. 2-Methyl-but-2-ene on ozonolysis followed by reductive hydrolysis gives: |
|
Answer» Ozonolysis of alkenes gives ozonide which gives aldehydes and/or ketones. When a stream of O3 is passed through a solution of alkene in an inert solvent at low temperature, the molecule adds up to form ozonide. This ozonide is unstable and easily decomposes either by reduction or hydrolysis and forms compound having the carbonyl group >C=O. This is known as ozonolysis. 2-Methyl-but-2-ene on ozonolysis followed by reductive hydrolysis gives:
|
|
| 21. |
What is aromaticity and huckle rule ? |
| Answer» What is aromaticity and huckle rule ? | |
| 22. |
What is the oxidation state of F in Of2 and O2F2?? |
| Answer» What is the oxidation state of F in Of2 and O2F2?? | |
| 23. |
38.What will be the major product of cross aldol condensation of ethanal and propanal. |
| Answer» 38.What will be the major product of cross aldol condensation of ethanal and propanal. | |
| 24. |
For a solution to form positive deviation,the solute-solvent interactions must be less than solute-solute and solvent-solvent interactions,making it easier for the molecules to escape in its pure form.still,why does the vapour pressure of the solution showing positive deviation increase compared to the pure form? |
|
Answer» For a solution to form positive deviation,the solute-solvent interactions must be less than solute-solute and solvent-solvent interactions,making it easier for the molecules to escape in its pure form.still,why does the vapour pressure of the solution showing positive deviation increase compared to the pure form? |
|
| 25. |
The correct statement regarding electrophile is |
|
Answer» The correct statement regarding electrophile is |
|
| 26. |
Hybridisation of silicon in silica is . |
|
Answer» Hybridisation of silicon in silica is |
|
| 27. |
If wavelength max is 6563 A^° foe balmer series for a particular atom then wavelength pf second line for balmer series is? |
| Answer» If wavelength max is 6563 A^° foe balmer series for a particular atom then wavelength pf second line for balmer series is? | |
| 28. |
find the pH of 0.5M HF(ka =2\ast10^{-4}) 4 2 3 2. |
| Answer» find the pH of 0.5M HF(ka =2\ast10^{-4}) 4 2 3 2. | |
| 29. |
A certain amount of a metal whose equivalent massis 28 displaces 0.7 L of H2 at S.T.P. from an acid hence mass of the element is |
| Answer» A certain amount of a metal whose equivalent massis 28 displaces 0.7 L of H2 at S.T.P. from an acid hence mass of the element is | |
| 30. |
LET A=[3 1 THEN SUM OF ALL THE ELEMENTS OF A^50 -16 -5] |
|
Answer» LET A=[3 1 THEN SUM OF ALL THE ELEMENTS OF A^50 -16 -5] |
|
| 31. |
The IUPAC name of the compound |
|
Answer» The IUPAC name of the compound |
|
| 32. |
calculate molality of an aqueous solution where moles of solute are 0.4 |
| Answer» calculate molality of an aqueous solution where moles of solute are 0.4 | |
| 33. |
The solubility product of BaCrO4 is 2.4×10−10 M2. The maximum concentration of Ba(NO3)2 possible without precipitation in a 6×10−4 M K2CrO4 solution is |
|
Answer» The solubility product of BaCrO4 is 2.4×10−10 M2. The maximum concentration of Ba(NO3)2 possible without precipitation in a 6×10−4 M K2CrO4 solution is |
|
| 34. |
Select the most stable carbocation among the following |
|
Answer» Select the most stable carbocation among the following |
|
| 35. |
do Representative elements also include noble gases? |
| Answer» do Representative elements also include noble gases? | |
| 36. |
For the reaction, PCl5(g)⇌PCl3(g)+Cl2(g), the degree of dissociation 'x' is related to pressure 'P(x<<1) |
|
Answer» For the reaction, PCl5(g)⇌PCl3(g)+Cl2(g), the degree of dissociation 'x' is related to pressure 'P(x<<1) |
|
| 37. |
4.5 g water is added into an oleum sample labelled as 109% H2SO4. What is the amount of free SO3 remaining in the solution? |
|
Answer» 4.5 g water is added into an oleum sample labelled as 109% H2SO4. What is the amount of free SO3 remaining in the solution? |
|
| 38. |
Why axial bond pairs suffer more repulsive interaction from the equatorial bond pairs |
| Answer» Why axial bond pairs suffer more repulsive interaction from the equatorial bond pairs | |
| 39. |
Integral dx/(3x+5) = ? |
| Answer» Integral dx/(3x+5) = ? | |
| 40. |
Calculate the radius of the third orbit of a hydrogen atom; the radius of the first Bohr orbit of hydrogen atom is 0.53 Å. |
|
Answer» Calculate the radius of the third orbit of a hydrogen atom; the radius of the first Bohr orbit of hydrogen atom is 0.53 Å. |
|
| 41. |
Cos 20° cos 40° cos 60° cos 80° = |
| Answer» Cos 20° cos 40° cos 60° cos 80° = | |
| 42. |
total number of tetrahedral voids in unitcells of fcc and bcc are x and octahedral voids in fcc are y.then find the value(x-2y)? |
| Answer» total number of tetrahedral voids in unitcells of fcc and bcc are x and octahedral voids in fcc are y.then find the value(x-2y)? | |
| 43. |
Discuss the nature of bonding in the following coordinationentities on the basis of valence bond theory:(i) [Fe(CN)6]4− (ii) [FeF6]3− (iii) [Co(C2O4)3]3− (iv) [CoF6]3− |
|
Answer» Discuss the nature of bonding in the following coordination (i) [Fe(CN)6]4− (ii) [FeF6]3− (iii) [Co(C2O4)3]3− (iv) [CoF6]3− |
|
| 44. |
50. Mention all the possible isomers of C3H6O2 |
| Answer» 50. Mention all the possible isomers of C3H6O2 | |
| 45. |
The correct thermodynamic conditions for the spontaneousreaction at all temperatures is :(a) ∆H |
|
Answer» The correct thermodynamic conditions for the spontaneous reaction at all temperatures is : (a) ∆H<0 and ∆S < 0 (b) ∆H < 0 and ∆S <0 (c) ∆H <0 and ∆S = 0 (d) ∆H >0 and ∆S < 0 Reaction is spontaneous when ∆S is positive and ∆H is negative |
|
| 46. |
select the pair of orbital which form pi bond by taking all given axis one by on 1.x as internuclear axis 2.y as internuclear axis 3.z as internuclear axis 1.Px+Py 2.Px+Px 3.dxy+Py 4.dxy+Px also explain why other options are incorrect |
| Answer» select the pair of orbital which form pi bond by taking all given axis one by on 1.x as internuclear axis 2.y as internuclear axis 3.z as internuclear axis 1.Px+Py 2.Px+Px 3.dxy+Py 4.dxy+Px also explain why other options are incorrect | |
| 47. |
Which one of the following has largest number of isomers?(R=alkyl group;en=ethylenediamine) |
|
Answer» Which one of the following has largest number of isomers? |
|
| 48. |
Doesthe number of moles of reaction products increase, decrease or remainsame when each of the following equilibria is subjected to a decreasein pressure by increasing the volume?(a)(b)(c) |
|
Answer» Does (a) (b) (c) |
|
| 49. |
What is the major drawback of Fruendlich isotherm? |
|
Answer» What is the major drawback of Fruendlich isotherm? |
|
| 50. |
In the presence of a small amount of water, PCl5 hydrolyses to form: |
|
Answer» In the presence of a small amount of water, PCl5 hydrolyses to form: |
|