Explore topic-wise InterviewSolutions in Current Affairs.

This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.

1.

Among the following species, identify the isostructural pairs: NF3,NO−3,BF3,H3O+,HN3

Answer»

Among the following species, identify the isostructural pairs:
NF3,NO3,BF3,H3O+,HN3

2.

For thedecomposition reaction 4HNO3 (g) ⇋ 4NO2 (g) + 2H2 O (g) + O2 (g) if we start with only the reactant HNO3 and p = equilibrium pressure, the equilibrium constant Kp is:

Answer»

For thedecomposition reaction 4HNO3 (g) 4NO2 (g) + 2H2 O (g) + O2 (g) if we start with only the reactant HNO3 and p = equilibrium pressure, the equilibrium constant Kp is:


3.

Arrange NaF,MgF2 and AlF3 in the increasing order of their lattice energies.

Answer»

Arrange NaF,MgF2 and AlF3 in the increasing order of their lattice energies.

4.

Correct relation between current gain of common base (α) and common collector (γ) configuration of a transistor is

Answer»

Correct relation between current gain of common base (α) and common collector (γ) configuration of a transistor is

5.

A f-subshell containing 6 unpaired electrons can exchange

Answer»

A f-subshell containing 6 unpaired electrons can exchange



6.

For the β+(positron) emission from a nucleus, there is anothercompeting process known as electron capture (electron from an innerorbit, say, the K–shell, is captured by the nucleus and a neutrino isemitted).1A A e X Y Z Z ν++ → + −Show that if β+emission is energetically allowed, electron captureis necessarily allowed but not vice–versa.

Answer» For the β+(positron) emission from a nucleus, there is anothercompeting process known as electron capture (electron from an innerorbit, say, the K–shell, is captured by the nucleus and a neutrino isemitted).1A A e X Y Z Z ν++ → + −Show that if β+emission is energetically allowed, electron captureis necessarily allowed but not vice–versa.
7.

Double bond and triple Bond will show metamerism?

Answer» Double bond and triple Bond will show metamerism?
8.

2 vectors A and B ars such that A+B= A-B .(A AND B BOTH ARE REPRESENTED AS VECTORS) Then select incorrect option 1.A•B =02.AxB=03.A=04.B=0

Answer» 2 vectors A and B ars such that A+B= A-B .(A AND B BOTH ARE REPRESENTED AS VECTORS) Then select incorrect option
1.A•B =0
2.AxB=0
3.A=0
4.B=0
9.

The dissociation constant of 0.01M CH3COOH is 1.8×10−5 then calculate CH3COO− concentration in 0.1 M HCl solution.

Answer»

The dissociation constant of 0.01M CH3COOH is 1.8×105 then calculate CH3COO concentration in 0.1 M HCl solution.

10.

KCl crystallised in the same type of lattice as does NaCl. Given that r(Na)/r(Cl) = 0.55 and r(K)/r(Cl) = 0.74. Calculate the ratio of side of unit cell of KCl to that of NaC

Answer» KCl crystallised in the same type of lattice as does NaCl. Given that r(Na)/r(Cl) = 0.55 and r(K)/r(Cl) = 0.74. Calculate the ratio of side of unit cell of KCl to that of NaC
11.

The degree of dissociation of PCl5 at a certain temperature and 1 atm pressure is 0.40. Calculate the value of equilibrium constant Kp.PCl5(g)⇌PCl3(g)+Cl2(g)

Answer»

The degree of dissociation of PCl5 at a certain temperature and 1 atm pressure is 0.40. Calculate the value of equilibrium constant Kp.

PCl5(g)PCl3(g)+Cl2(g)

12.

Find the pair of species having the same shape but different hybridizations of the central atom.

Answer»

Find the pair of species having the same shape but different hybridizations of the central atom.

13.

Which of the following pairs of d- orbitals will have electron density along the axes?

Answer»

Which of the following pairs of d- orbitals will have electron density along the axes?


14.

The correct order of the stoichiometries of AgCl formed when AgNO3 in excess is treated with the complexes : CoCl3.6NH3,CoCl3.5NH3,CoCl3.4NH3 respectively is:

Answer»

The correct order of the stoichiometries of AgCl formed when AgNO3 in excess is treated with the complexes : CoCl3.6NH3,CoCl3.5NH3,CoCl3.4NH3 respectively is:

15.

33.Find effective atomic number of Mn in Mn2(CO)10 and Fe in ferrocene ??

Answer» 33.Find effective atomic number of Mn in Mn2(CO)10 and Fe in ferrocene ??
16.

Two liquids A and B have the same molecular weight and form an ideal solution. The solution has a vapour pressure of 700 torr at 80∘ C. It is distilled till 23rd of the solution (mole basis) is collected as condensate. The composition of the condensate is X′A=0.75 and that of the residue is X′′A=0.30. If the vapour pressure of the residue at 80∘C is 600 torr, which of the following option(s) is/are correct.

Answer»

Two liquids A and B have the same molecular weight and form an ideal solution. The solution has a vapour pressure of 700 torr at 80 C. It is distilled till 23rd of the solution (mole basis) is collected as condensate. The composition of the condensate is XA=0.75 and that of the residue is X′′A=0.30. If the vapour pressure of the residue at 80C is 600 torr, which of the following option(s) is/are correct.


17.

17. The electronegativity difference between N & F is greater than that between N & H. Yet the dipole moment of NH3 is 1.5D. This is because: 1. In NH3 the atomic dipole and bond dipole are in the opposite directions whereas in NF3, these are in the same direction. 2. In NH3 as well as in as well as in NF3, the atomic dipole and bond dipole are in the same direction. 3. In NH3 the atomic dipole and dipole at in the same direction whereas in NF3 these are in opposite directions. 4. In NH3 as well as in NF3, the atomic dipole and the bond dipole are in opposite directions.

Answer» 17. The electronegativity difference between N & F is greater than that between N & H. Yet the dipole moment of NH3 is 1.5D. This is because: 1. In NH3 the atomic dipole and bond dipole are in the opposite directions whereas in NF3, these are in the same direction. 2. In NH3 as well as in as well as in NF3, the atomic dipole and bond dipole are in the same direction. 3. In NH3 the atomic dipole and dipole at in the same direction whereas in NF3 these are in opposite directions. 4. In NH3 as well as in NF3, the atomic dipole and the bond dipole are in opposite directions.
18.

Writethe electronic configurations of the elements with the atomic numbers61, 91, 101, and 109.

Answer»

Write
the electronic configurations of the elements with the atomic numbers
61, 91, 101, and 109.

19.

Classify Na2O, Al2O3 and SO3 as acidic, basic or amphoteric oxide. [3 MARKS]

Answer»

Classify Na2O, Al2O3 and SO3 as acidic, basic or amphoteric oxide. [3 MARKS]

20.

Which of the following are strong electrolytes?

Answer» Which of the following are strong electrolytes?
21.

For the following reaction,Pb(s)+Hg2SO4(s)⇌PbSO4(s)+2Hg(l);Eocell=0.92 VKsp(PbSO4)=2×10−8, Ksp(Hg2SO4)=1×10−6Hence, Ecell is:(take √2=1.4, log0.14=−0.85)

Answer»

For the following reaction,

Pb(s)+Hg2SO4(s)PbSO4(s)+2Hg(l);

Eocell=0.92 V

Ksp(PbSO4)=2×108, Ksp(Hg2SO4)=1×106

Hence, Ecell is:

(take 2=1.4, log0.14=0.85)

22.

Classify the following reactions in one of the reaction type studied in this unit. (a) CH3CH2Br + HS– → CH3CH2SH + Br– (b) (CH3)2 C = CH2 + HCl → (CH3)2 ClC–CH3 (c) CH3CH2Br + HO– → CH2 = CH2 + H2O + Br– (d) (CH3)3 C – CH2 OH + HBr → (CH3)2 CBrCH2CH3 + H2O

Answer»

Classify
the following reactions in one of the reaction type studied in this
unit.



(a) CH3CH2Br
+ HS


CH
3CH2SH
+ Br


(b) (CH3)2
C = CH
2
+ HCl

(CH
3)2
ClC–CH
3


(c) CH3CH2Br
+ HO


CH
2 =
CH
2 +
H
2O +
Br


(d) (CH3)3
C – CH
2
OH + HBr

(CH
3)2
CBrCH
2CH3
+ H
2O

23.

if pa^° of a liquid component in a solution is 180 mm hg and that of pb^° is 90 mm hg then what will be mole fraction of B if the solution vapour pressure is 120 mm hg

Answer» if pa^° of a liquid component in a solution is 180 mm hg and that of pb^° is 90 mm hg then what will be mole fraction of B if the solution vapour pressure is 120 mm hg
24.

if 3 flasks of each 1L capacity are separately filled with gases O_2,CO_2 and SO_3 respectively at the same temperature and pressure ,then ratio of no. of atoms in above flask respectively

Answer» if 3 flasks of each 1L capacity are separately filled with gases O_2,CO_2 and SO_3 respectively at the same temperature and pressure ,then ratio of no. of atoms in above flask respectively
25.

What is Plank's constant?

Answer» What is Plank's constant?
26.

Write the conditions to maximize the yield of H2SO4 by Contact process.

Answer»

Write
the conditions to maximize the yield of H
2SO4
by Contact process.

27.

Give the structures of A,B and C in the following reactions :(i) CH3CH2INaCN−−−−→AOH−−−−−−−−−−−−→Partial hydrolysisBNaOH+Br2−−−−−−−→C (ii) C6H5N2ClCuCN−−−−→AH2O−−→BNH3−−−→ΔC (iii) CH3CH2BrKCN−−−→ALiAIH4−−−−−→BHNO2−−−−→0∘C(iv) C6H5NO2Fe/HCI−−−−−→ANaNO2+HCl−−−−−−−−→273KBH2O/H+−−−−−→ΔC(v) CH3COOHNH3−−−→ΔANaOBr−−−−→BNaNO2/HCl−−−−−−−−→C(vi) C6H5NO2Fe/HCl−−−−−→AHNO2−−−−→273BC6H5OH−−−−−→C

Answer»

Give the structures of A,B and C in the following reactions :

(i) CH3CH2INaCN−−−−→AOH−−−−−−−−−−−−→Partial hydrolysisBNaOH+Br2−−−−−−−→C

(ii) C6H5N2ClCuCN−−−−→AH2O−−→BNH3−−−→ΔC

(iii) CH3CH2BrKCN−−−→ALiAIH4−−−−−→BHNO2−−−−→0∘C

(iv) C6H5NO2Fe/HCI−−−−−→ANaNO2+HCl−−−−−−−−→273KBH2O/H+−−−−−→ΔC

(v) CH3COOHNH3−−−→ΔANaOBr−−−−→BNaNO2/HCl−−−−−−−−→C

(vi) C6H5NO2Fe/HCl−−−−−→AHNO2−−−−→273BC6H5OH−−−−−→C

28.

Question 14 Which of the following reactions is an example f use of water gaas in the synthesis of other compounds? (a)CH4(g)+H2O(g)1270 K−−−−→NiCO(g)+H2(g)(b)CO(g)+H2O(g)673 K−−−−−→CatalystCO2(g)+H2(g)(c)CnH2n+2+nH2O(g)1270 k−−−→NinCO+(2n+1)H2(d)CO(g)+2H2(g)Cobalt−−−−−→CatalystCH3OH(l)

Answer»

Question 14

Which of the following reactions is an example f use of water gaas in the synthesis of other compounds?

(a)CH4(g)+H2O(g)1270 K−−−NiCO(g)+H2(g)(b)CO(g)+H2O(g)673 K−−−−CatalystCO2(g)+H2(g)(c)CnH2n+2+nH2O(g)1270 k−−NinCO+(2n+1)H2(d)CO(g)+2H2(g)Cobalt−−−−CatalystCH3OH(l)

29.

Phenol can be converted into anisole by (1) CH2N2/ether (2) (CH3)2SO4/NaOH (3) CH3I (4) All of these

Answer» Phenol can be converted into anisole by (1) CH2N2/ether (2) (CH3)2SO4/NaOH (3) CH3I (4) All of these
30.

IUPAC name of the following compound is

Answer»

IUPAC name of the following compound is


31.

The wavelength of radiation emitted is λ0, when an electron jumps from the third to second orbit of a H+ atom. For and electron jumping from fourth to second orbit, what would be the wavelength of the emitted radiation ?

Answer»

The wavelength of radiation emitted is λ0, when an electron jumps from the third to second orbit of a H+ atom. For and electron jumping from fourth to second orbit, what would be the wavelength of the emitted radiation ?

32.

What is the reason for the extraordinary stability of Mn2+ and Zn2+ ions?

Answer» What is the reason for the extraordinary stability of Mn2+ and Zn2+ ions?
33.

List the elements whose anions have negative ionization energy

Answer» List the elements whose anions have negative ionization energy
34.

Is the co ordination no. And nearest neighbours same for an fcc structure if only one element is arranged in fcc

Answer» Is the co ordination no. And nearest neighbours same for an fcc structure if only one element is arranged in fcc
35.

the enthaphy of reaction is maximium in which of the following reaction 1)NAOH + HBR→ NABR+H2O 2) NAOH+HCL → NACL + H2O 3)NAOH +HF → NABR + H2O 4)ALL OF THES

Answer» the enthaphy of reaction is maximium in which of the following reaction 1)NAOH + HBR→ NABR+H2O 2) NAOH+HCL → NACL + H2O 3)NAOH +HF → NABR + H2O 4)ALL OF THES
36.

Predict the final product of the given sequence.

Answer»

Predict the final product of the given sequence.


37.

Write IUPAC names of the compounds of alkane, alkene and alkyne, containing 3 carbons.

Answer» Write IUPAC names of the compounds of alkane, alkene and alkyne, containing 3 carbons.
38.

Two reactions proceed at 25 degree celcius at the same rate . The temperature coefficient of the rate of first reaction is 2 and that ofsecond reaction is 2.5 . The ratio of rates of these reactions at 95 degree celcius is

Answer» Two reactions proceed at 25 degree celcius at the same rate . The temperature coefficient of the rate of first reaction is 2 and that ofsecond reaction is 2.5 . The ratio of rates of these reactions at 95 degree celcius is
39.

30. A gaseous alkane is explodes with oxygen the mole of O2 for complete combustion and CO2 formed is in the ratio 7:4 deduce the molecular formula of alkane

Answer» 30. A gaseous alkane is explodes with oxygen the mole of O2 for complete combustion and CO2 formed is in the ratio 7:4 deduce the molecular formula of alkane
40.

Molarity of liquid HCl, if density of solution is 1.17 gm/cc is(1) 36.5(2) 18.25(3) 32.05(4) 42.10

Answer» Molarity of liquid HCl, if density of solution is 1.17 gm/cc is
(1) 36.5
(2) 18.25
(3) 32.05
(4) 42.10
41.

The following has only one hetero cyclic ring

Answer»

The following has only one hetero cyclic ring



42.

When strongly heated, Sodium thiosulphate disproportionates into compounds having _______ different oxidation states. ___

Answer»

When strongly heated, Sodium thiosulphate disproportionates into compounds having _______ different oxidation states.


___
43.

In a compound, oxide ions constitute cubic close packing. Cations A occupy 50% of tetrahedral holes while cations B occupy all the octahedral voids. The empirical formula of the compound is ?

Answer»

In a compound, oxide ions constitute cubic close packing. Cations A occupy 50% of tetrahedral holes while cations B occupy all the octahedral voids. The empirical formula of the compound is ?


44.

FeO is found with a composition of Fe0.95O. It ranges from Fe0.93O to Fe0.95O. Which type of defect is it showing here?

Answer»

FeO is found with a composition of Fe0.95O. It ranges from Fe0.93O to Fe0.95O. Which type of defect is it showing here?



45.

Why H2O2 cannot be stored in glass bottle?

Answer» Why H2O2 cannot be stored in glass bottle?
46.

A metal forms 2 oxides. The higher oxide contains 80%metal.,0.72g of the lower oxide gave 0.8of higher oxide when oxidised.Then the ratio of the weight of oxygen that combines with the fixed weight of the metal in the 2 oxides will be 1. 2:3 2. 1:2 3. 4:5 4. 3:2

Answer» A metal forms 2 oxides. The higher oxide contains 80%metal.,0.72g of the lower oxide gave 0.8of higher oxide when oxidised.Then the ratio of the weight of oxygen that combines with the fixed weight of the metal in the 2 oxides will be 1. 2:3 2. 1:2 3. 4:5 4. 3:2
47.

The process that requires an absorption of energy is:

Answer»

The process that requires an absorption of energy is:

48.

Compute the temperature at which the rms speed is equal to the speed of escape from the surface of the earth for hydrogen and for oxygen. The temperature of the upper atmosphere is about 1000 K. Would you expect to find a lot of hydrogen there or a lot of oxygen.

Answer»

Compute the temperature at which the rms speed is equal to the speed of escape from the surface of the earth for hydrogen and for oxygen. The temperature of the upper atmosphere is about 1000 K. Would you expect to find a lot of hydrogen there or a lot of oxygen.

49.

What is meant by a.m.u?

Answer» What is meant by a.m.u?
50.

What is the formula for Relative Density?

Answer» What is the formula for Relative Density?