This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
Find the total number of electrons in Mn (z=25) for which m=1 |
| Answer» Find the total number of electrons in Mn (z=25) for which m=1 | |
| 2. |
If the velocity of a particle is v=At+Bt, whereA and B are constants, then the distance travelled by it between 1 s and 2 s is |
| Answer» If the velocity of a particle is v=At+Bt, whereA and B are constants, then the distance travelled by it between 1 s and 2 s is | |
| 3. |
what can be prefix and sufix of acid and aldehyde can be decided |
| Answer» what can be prefix and sufix of acid and aldehyde can be decided | |
| 4. |
On the basis of following E∘ values, the strongest oxidising agent is: [Fe(CN)4]4−→[Fe(CN)6]3−+e− E∘=−0.35 VFe2+→Fe3++e−E∘=−0.77 V |
|
Answer» On the basis of following E∘ values, the strongest oxidising agent is: |
|
| 5. |
For the reaction CaCO3(s) ⇋ CaO(s) + CO2(g) the partial pressure of CO2 (at equilibrium) depends on: |
|
Answer» For the reaction CaCO3(s) ⇋ CaO(s) + CO2(g) the partial pressure of CO2 (at equilibrium) depends on: |
|
| 6. |
Which one of the following complexes will have four different isomers? |
|
Answer» Which one of the following complexes will have four different isomers? |
|
| 7. |
Correct orders of 1st I.P. are -(i) Li < B < Be < C (ii) O < N < F(iii) Be < N < Ne |
|
Answer» Correct orders of 1st I.P. are - (i) Li < B < Be < C (ii) O < N < F (iii) Be < N < Ne |
|
| 8. |
Consider the following reactions:(i) Cu+HNO3(dil.)→(ii) Cu+HNO3(conc.)→(iii) Zn+HNO3(20%)→(iv) Zn+HNO3(60%)→ Total number of reactions in which N2 is released is/are: |
|
Answer» Consider the following reactions: (i) Cu+HNO3(dil.)→ (ii) Cu+HNO3(conc.)→ (iii) Zn+HNO3(20%)→ (iv) Zn+HNO3(60%)→ Total number of reactions in which N2 is released is/are: |
|
| 9. |
The ratio of energy of a photon of radiation of wavelength 2000 ∘A to that of a radiation of wavelength 4000 ∘A is: |
|
Answer» The ratio of energy of a photon of radiation of wavelength 2000 ∘A to that of a radiation of wavelength 4000 ∘A is: |
|
| 10. |
3CHCHCu,500∘C−−−−−−→A;A+3H2Ni−→B Identify correct statement |
|
Answer» 3CHCHCu,500∘C−−−−−−→A;A+3H2Ni−→B Identify correct statement |
|
| 11. |
Explain the hollow cylinder with area and volume |
| Answer» Explain the hollow cylinder with area and volume | |
| 12. |
what is coulumbs law in detail and simple language |
| Answer» what is coulumbs law in detail and simple language | |
| 13. |
what is meaning of isotope |
| Answer» what is meaning of isotope | |
| 14. |
Major product of the given elimination reaction is: |
|
Answer» Major product of the given elimination reaction is: |
|
| 15. |
Can you help me with all the formulas we are gonna use in Chapter Atomic Structure of class XI Chemistry? From CBSE level question to the JEE level questions? ALL FORMULAE! |
|
Answer» Can you help me with all the formulas we are gonna use in Chapter Atomic Structure of class XI Chemistry? From CBSE level question to the JEE level questions? ALL FORMULAE! |
|
| 16. |
Dihedral angle of least stable conformer of ethane is : |
|
Answer» Dihedral angle of least stable conformer of ethane is : |
|
| 17. |
If a reaction has the experimental rate expression rate = K[A]2[B], if the concentration of A is doubled and the concentration of B is halved, the what happens to the reaction rate:- |
|
Answer» If a reaction has the experimental rate expression rate = K[A]2[B], if the concentration of A is doubled and the concentration of B is halved, the what happens to the reaction rate:- |
|
| 18. |
11. What is the maximum number of electrons which can be accomodated in an atom in which the highest principal quantum number is 4 :- (1)10 (2)18 (3)36 (4)54 |
| Answer» 11. What is the maximum number of electrons which can be accomodated in an atom in which the highest principal quantum number is 4 :- (1)10 (2)18 (3)36 (4)54 | |
| 19. |
Boiling point of 0.01 M AB2 which is 10%dissociated in aqueous medium (Kb = 0.52) as A2 and B(1) 273.006 K(2) 373.006 K(3) 0.006 k(4) 272.006 |
| Answer» Boiling point of 0.01 M AB2 which is 10%dissociated in aqueous medium (Kb = 0.52) as A2 and B(1) 273.006 K(2) 373.006 K(3) 0.006 k(4) 272.006 | |
| 20. |
Among the following which is an exchange reaction? |
|
Answer» Among the following which is an exchange reaction? |
|
| 21. |
21. How rate of reaction is calculated. |
| Answer» 21. How rate of reaction is calculated. | |
| 22. |
What are the major differences between dilute and concentrated acids? |
| Answer» What are the major differences between dilute and concentrated acids? | |
| 23. |
Which molecule will combine with the four-carbon oxaloacetate in the Krebs cycle to form the six-carbon citrate? |
|
Answer» Which molecule will combine with the four-carbon oxaloacetate in the Krebs cycle to form the six-carbon citrate? |
|
| 24. |
Bond dissociaton enthalpy of H2, Cl2 and HCl are 434, 242 and 431 kJ mol-1 respectively. Enthalpy of formation of HCl is |
| Answer» Bond dissociaton enthalpy of H2, Cl2 and HCl are 434, 242 and 431 kJ mol-1 respectively. Enthalpy of formation of HCl is | |
| 25. |
आशयस्पष्ट कीजिए−इम्तिहानपास कर लेना कोईचीज़ नहीं,असलचीज़ है बुद्धिका विकास। |
|
Answer» आशय इम्तिहान |
|
| 26. |
5.00 mL of 0.10 M oxalic acid solution taken in a conical flask is titrated against NaOH from a burette using phenolphthalein indicator. The volume of NaOH required for the appearance of permanent faint pink color is tabulated below for five experiments. What is the concentration, in molarity, of the NaOH solution? Exp. No. Vol. of NaOH (mL) 1 12.5 2 10.5 3 9.0 4 9.0 5 9.0 |
||||||||||||
Answer» 5.00 mL of 0.10 M oxalic acid solution taken in a conical flask is titrated against NaOH from a burette using phenolphthalein indicator. The volume of NaOH required for the appearance of permanent faint pink color is tabulated below for five experiments. What is the concentration, in molarity, of the NaOH solution?
|
|||||||||||||
| 27. |
56 How 1- Methyl cyclopentane reacts with bromine? What product is formed and how? |
| Answer» 56 How 1- Methyl cyclopentane reacts with bromine? What product is formed and how? | |
| 28. |
in the ground state an element has 13 electrons in its M-shell. the element i |
| Answer» in the ground state an element has 13 electrons in its M-shell. the element i | |
| 29. |
to find oxidation no of central bromine atom in Br_3O_{ |
| Answer» to find oxidation no of central bromine atom in Br_3O_{ | |
| 30. |
An alkene on ozonolysis gives acetone as one of the product. The structure of alkene is: |
|
Answer» An alkene on ozonolysis gives acetone as one of the product. The structure of alkene is: |
|
| 31. |
LPG is a mixture of |
|
Answer» LPG is a mixture of |
|
| 32. |
What are reversible and irreversible changes? Give one example of each. |
|
Answer» What are reversible and irreversible changes? Give one example of each. |
|
| 33. |
The standard E.M.F of the cell written as Cd(Hg)|CdSO4.83H2O(s)||CdSO4(sat.)|Hg2SO4(s)|Hg in which the cell reaction is Cd(Hg)+Hg2SO4(s)+83H2O(l)⇌CdSO4.83H2O(s)+2Hg(l) is 1.0185 V at 25oC. Calculate ΔSo for the cell reaction if (∂Eo∂T)P for the cell is 5.00×10−5 V K−1Take, F=96485 C mol−1 |
|
Answer» The standard E.M.F of the cell written as |
|
| 34. |
What are the various steps of scientific methods ? |
| Answer» What are the various steps of scientific methods ? | |
| 35. |
Why benzoic acid is stronger than acetic acid but weaker than formic acid? |
| Answer» Why benzoic acid is stronger than acetic acid but weaker than formic acid? | |
| 36. |
The relative rates of mononitration of R−C6H5, where R=−CH3,−NO2,−OH,−Cl are |
|
Answer» The relative rates of mononitration of R−C6H5, where R=−CH3,−NO2,−OH,−Cl are |
|
| 37. |
what is the formula and the rules to calculate the formal charge of an ion |
| Answer» what is the formula and the rules to calculate the formal charge of an ion | |
| 38. |
Assertion (A): Sodium metal is stored in keroseneReason (R): The density of sodium is less than water |
|
Answer» Assertion (A): Sodium metal is stored in kerosene Reason (R): The density of sodium is less than water |
|
| 39. |
Can you please provide questions on mole concept for practice |
|
Answer» Can you please provide questions on mole concept for practice |
|
| 40. |
For the processes K+(g) I⟶ K(g) II⟶K−(g) |
|
Answer» For the processes K+(g) I⟶ K(g) II⟶K−(g) |
|
| 41. |
Question 4 (c)Copper displaces zinc from zinc sulphate solution. (True/False) |
|
Answer» Question 4 (c) Copper displaces zinc from zinc sulphate solution. (True/False) |
|
| 42. |
Which of the following alkyl bromides will undergo the SN2 reaction the fastest? |
|
Answer» Which of the following alkyl bromides will undergo the SN2 reaction the fastest? |
|
| 43. |
.08333 g of carbohydrate of empirical formula ch2o has 1 g of h2 find molecular formula |
| Answer» .08333 g of carbohydrate of empirical formula ch2o has 1 g of h2 find molecular formula | |
| 44. |
What is the entropy change when 1 mole oxygen gas expands isothermally and reversibly from an initial volume of 10 L to 100 L at 300 K? |
|
Answer» What is the entropy change when 1 mole oxygen gas expands isothermally and reversibly from an initial volume of 10 L to 100 L at 300 K? |
|
| 45. |
"Jaya" and "Ratna" developed for the green revolution in India are the varieties of: |
|
Answer» "Jaya" and "Ratna" developed for the green revolution in India are the varieties of: |
|
| 46. |
Which of the following is least reactive towards SN1? |
|
Answer» Which of the following is least reactive towards SN1? |
|
| 47. |
the number of watermolecule in adrop of waterweighing 0.018 |
| Answer» the number of watermolecule in adrop of waterweighing 0.018 | |
| 48. |
Which of the following statement is of false? |
|
Answer» Which of the following statement is of false? |
|
| 49. |
Calculate the ratio of area of second Orbit with fourth Orbit in hydrogen atom |
|
Answer» Calculate the ratio of area of second Orbit with fourth Orbit in hydrogen atom |
|
| 50. |
nt1,6 DIOL-CYCLOALKANE REACT WITH H2SO4/H+n ntPRODUCT OF THIS REACTION WILL BEn nt1-CYCLOPENTANE CARBALDEHYEn nt2-2-HYDROXY CYCLOHEXANONEn nt3-CYCLOHEXANONEn nt4-ALL OF THESn |
| Answer» nt1,6 DIOL-CYCLOALKANE REACT WITH H2SO4/H+n ntPRODUCT OF THIS REACTION WILL BEn nt1-CYCLOPENTANE CARBALDEHYEn nt2-2-HYDROXY CYCLOHEXANONEn nt3-CYCLOHEXANONEn nt4-ALL OF THESn | |