Saved Bookmarks
| 1. |
The standard E.M.F of the cell written as Cd(Hg)|CdSO4.83H2O(s)||CdSO4(sat.)|Hg2SO4(s)|Hg in which the cell reaction is Cd(Hg)+Hg2SO4(s)+83H2O(l)⇌CdSO4.83H2O(s)+2Hg(l) is 1.0185 V at 25oC. Calculate ΔSo for the cell reaction if (∂Eo∂T)P for the cell is 5.00×10−5 V K−1Take, F=96485 C mol−1 |
|
Answer» The standard E.M.F of the cell written as |
|