Explore topic-wise InterviewSolutions in Current Affairs.

This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.

1.

The energy of second Bohr orbit of the hydrogen atom is −328 kJ mol−1; hence the energy of fourth Bohr orbit would be

Answer»

The energy of second Bohr orbit of the hydrogen atom is 328 kJ mol1; hence the energy of fourth Bohr orbit would be

2.

(a) For a reaction A+B→P, the rate law is given by, r=k[A]12[B]2. What is the order of this reaction? (b) A first order reaction is found to have a rate constant k=5.5×10−14s−1. Find the half life of the reaction.

Answer» (a) For a reaction A+BP, the rate law is given by, r=k[A]12[B]2.
What is the order of this reaction?
(b) A first order reaction is found to have a rate constant k=5.5×1014s1. Find the half life of the reaction.
3.

29. If the total energy of an electron is -1.5eV in hydrogen atom then find out K.E. , P.E., orbit, radius and velocity of the electron in that orbit.

Answer» 29. If the total energy of an electron is -1.5eV in hydrogen atom then find out K.E. , P.E., orbit, radius and velocity of the electron in that orbit.
4.

An isomer of the complex CoBrCl2(en)2(H2O), on reaction with concentrated H2SO4 (dehydrating agent), suffers no loss in weight and on reaction with AgNO3 solution it gives only white precipitate, which is soluble in NH3 solution.The correct formula of the complex is:

Answer»

An isomer of the complex CoBrCl2(en)2(H2O), on reaction with concentrated H2SO4 (dehydrating agent), suffers no loss in weight and on reaction with AgNO3 solution it gives only white precipitate, which is soluble in NH3 solution.



The correct formula of the complex is:

5.

70. A gaseous mixture of He and O2 is present in the ratio of 4:1. The ratio of no. Of their atoms in mixture is

Answer» 70. A gaseous mixture of He and O2 is present in the ratio of 4:1. The ratio of no. Of their atoms in mixture is
6.

The electronic configuration of Sc is:

Answer»

The electronic configuration of Sc is:

7.

Compound A, C8H10O, is found to react with NaOI (produced by reacting Y with NaOH) and yields a yellow precipitate with a characteristic smell.A and Y are respectively:

Answer»

Compound A, C8H10O, is found to react with NaOI (produced by reacting Y with NaOH) and yields a yellow precipitate with a characteristic smell.

A and Y are respectively:

8.

The activation energies for the forward and reverse elementary reactions in the system A⇌B are 10.303 and 8.000 k cal respectively at 500K. Assuming the pre-exponential factor to be the same for both the forward and reverse steps and R = 2 cal K−1mol−1, calculate equilibrium constant of the reaction :

Answer»

The activation energies for the forward and reverse elementary reactions in the system AB are 10.303 and 8.000 k cal respectively at 500K. Assuming the pre-exponential factor to be the same for both the forward and reverse steps and R = 2 cal K1mol1, calculate equilibrium constant of the reaction :



9.

Formula mass is used for which of the following substances?

Answer»

Formula mass is used for which of the following substances?


10.

Arrange the following elements in the increasing order of their metallic character.Si, Be, Mg, Na, P

Answer»

Arrange the following elements in the increasing order of their metallic character.

Si, Be, Mg, Na, P

11.

Which of the following are ring chain isomers of C4H8?

Answer»

Which of the following are ring chain isomers of C4H8?


12.

0/4The correct sequence of increasingmeltingpoints of BeC12, MgC12, CaC12, SrC12 andBaCI2is(a) BaC12< SrC12MgCl2 BaCl2CaCI2

Answer» 0/4The correct sequence of increasingmeltingpoints of BeC12, MgC12, CaC12, SrC12 andBaCI2is(a) BaC12< SrC12MgCl2 BaCl2CaCI2
13.

Why modern periodic table is called Bohr's Table while it was made by Henry Moseley?

Answer» Why modern periodic table is called Bohr's Table while it was made by Henry Moseley?
14.

how many unit cell can be made out of of an 18 carat pure 197 sample of Au ( au has fcc type of structure)

Answer» how many unit cell can be made out of of an 18 carat pure 197 sample of Au ( au has fcc type of structure)
15.

How to calculate the weight of 1000 atoms of N.

Answer» How to calculate the weight of 1000 atoms of N.
16.

what is rehostat?

Answer» what is rehostat?
17.

Which of the following carbocation is most stable?

Answer»

Which of the following carbocation is most stable?

18.

How many grams of HCl is needed for complete reaction with 69.6 gm MnO2?

Answer» How many grams of HCl is needed for complete reaction with 69.6 gm MnO2?
19.

phenol dissolves in naoh to form sodium phenate but on passing co2 gas into the solution of sodium phenate,phenol is precipitated this shows what

Answer» phenol dissolves in naoh to form sodium phenate but on passing co2 gas into the solution of sodium phenate,phenol is precipitated this shows what
20.

Which of the following is an E-isomer?

Answer»

Which of the following is an E-isomer?

21.

The vapour pressure of water is 15.6 kPa at 333 K. Calculate the vapour pressure of 3 molal solution of a solute in it.

Answer»

The vapour pressure of water is 15.6 kPa at 333 K. Calculate the vapour pressure of 3 molal solution of a solute in it.

22.

61 Indicate the sigma and bond in the following molecules C6H6 , C6H12, CH2=C=CH2

Answer» 61 Indicate the sigma and bond in the following molecules C6H6 , C6H12, CH2=C=CH2
23.

In a solid oxide ions forms the cubic close packing lattice while M3+ ion occupy 2/3rd of octahedral void predict the formula of solid.

Answer» In a solid oxide ions forms the cubic close packing lattice while M3+ ion occupy 2/3rd of octahedral void predict the formula of solid.
24.

what is thin flim interference?

Answer» what is thin flim interference?
25.

Which of the following radicals is trivalent?

Answer»

Which of the following radicals is trivalent?


26.

42 Which of the following have minimum boiling point A. Isobutene B. n-butane C. 1-butyne D. 1-butene

Answer» 42 Which of the following have minimum boiling point A. Isobutene B. n-butane C. 1-butyne D. 1-butene
27.

a sample of HI is placed in a flask at a pressure of 0.2 atm at equillibrium the partial pressure of HI is 0.04 atm what is kp for given equillibrium

Answer» a sample of HI is placed in a flask at a pressure of 0.2 atm at equillibrium the partial pressure of HI is 0.04 atm what is kp for given equillibrium
28.

Write down thereactions taking place in different zones in the blast furnaceduring the extractionof iron.

Answer»

Write down the
reactions taking place in different zones in the blast furnace


during the extraction
of iron.

29.

The most stable carbonium ion among the following is

Answer»

The most stable carbonium ion among the following is


30.

Energy of an electron is given byE=−2.178×10−18J(Z2n2) wavelength of light required to excite an electron in an hydrogen atom from level n = 1 to n = 2 will be(h=6.62×10−34 J s and c=3.0×108m s−1)

Answer»

Energy of an electron is given by

E=2.178×1018J(Z2n2) wavelength of light required to excite an electron in an hydrogen atom from level n = 1 to n = 2 will be

(h=6.62×1034 J s and c=3.0×108m s1)

31.

5 What is the Hybridisation in Following Carbocations?? 1. CH3-CH2+ 2.CH2=CH+ 3. HC(triple bond)C+

Answer» 5 What is the Hybridisation in Following Carbocations?? 1. CH3-CH2+ 2.CH2=CH+ 3. HC(triple bond)C+
32.

If Ksp of a salt A2B3 is given by 1×10−25. Then find the s5 of the salt? Here 's' is solubility.

Answer»

If Ksp of a salt A2B3 is given by 1×1025. Then find the s5 of the salt?

Here 's' is solubility.


33.

How many alcohol with molecular C4H10O are chiral in nature? (a) 1 (b) 2 (c) 3 (d) 4

Answer»

How many alcohol with molecular C4H10O are chiral in nature?
(a) 1
(b) 2
(c) 3
(d) 4

34.

The reaction of chloroform with alcoholic KOH and p-toluidine results in the formation of :

Answer»

The reaction of chloroform with alcoholic KOH and p-toluidine results in the formation of :

35.

X,Y atoms crystallize in a cubic lattice . X atoms are present at the corners while Y atoms are at face centers. What would be the simplest formula of the compound if one of the Y atoms is missing from a face centre in each unit cell?

Answer»

X,Y atoms crystallize in a cubic lattice . X atoms are present at the corners while Y atoms are at face centers. What would be the simplest formula of the compound if one of the Y atoms is missing from a face centre in each unit cell?

36.

Identify the correct order of reactivity in electrophillic substitution reactions of the following compounds

Answer»

Identify the correct order of reactivity in electrophillic substitution reactions of the following compounds


37.

8. What is the type of hybridization of each carbon in the following compound ? With branching structure. (CH3)2CO

Answer» 8. What is the type of hybridization of each carbon in the following compound ? With branching structure. (CH3)2CO
38.

The given statement is "higher the value of Henry's law constant, the lower is the solubility of gas in liquid" Is the statement correct Explain with reasons

Answer»

The given statement is "higher the value of Henry's law constant, the lower is the solubility of gas in liquid"

Is the statement correct

Explain with reasons

39.

The vapour density of a sample of hydrogen fluoride gas is found to be 12.5. If it is due to dimerisation of some HF molecules to H2F2 molecules, then the percentage of HF molecules dimerised is: (F = 19)

Answer» The vapour density of a sample of hydrogen fluoride gas is found to be 12.5. If it is due to dimerisation of some HF molecules to H2F2 molecules, then the percentage of HF molecules dimerised is: (F = 19)
40.

In a double slit experiment, when a thin film of thickness t having refractive index μ is introduced in front of one of the slits, the maximum at the centre of the fringe pattern shifts by one fringe width. The value of t is (λ is the wavelength of the light used) :

Answer»

In a double slit experiment, when a thin film of thickness t having refractive index μ is introduced in front of one of the slits, the maximum at the centre of the fringe pattern shifts by one fringe width. The value of t is (λ is the wavelength of the light used) :

41.

Whatare the oxidation number of the underlined elements in each of thefollowing and how do you rationalise your results?(a)KI3(b) H2S4O6(c) Fe3O4(d) CH3CH2OH(e) CH3COOH

Answer»

What
are the oxidation number of the underlined elements in each of the
following and how do you rationalise your results?


(a)
K
I3
(b) H
2S4O6
(c) Fe
3O4
(d)
CH3CH2OH
(e)
CH3COOH

42.

Standard reduction potentials at 25^° C of Lit / Li,Ba2+/ Ba, Nat/ Na and Mg2+/ Mg are -3.05,-2.90,-2.71 and-2.37 volt respectively. Which one of thefollowing is the strongest oxidizing agent?(1) Ba2+(3) Na(2) Mg2(4) Lit

Answer» Standard reduction potentials at 25^° C of Lit / Li,Ba2+/ Ba, Nat/ Na and Mg2+/ Mg are -3.05,-2.90,-2.71 and-2.37 volt respectively. Which one of thefollowing is the strongest oxidizing agent?(1) Ba2+(3) Na(2) Mg2(4) Lit
43.

C + O2 ---------&gt; CO2 2C + O2 --------&gt; CO2 2CO + O2 -----&gt; 2CO2 In the first reaction, why is there no change in the entropy? Shouldn't delta S be +'ve, because solid plus gas is going going product, that is gas, hence more random movement. IN 3rd equation, why is delta S negative again? Because shiudlnt it be positive, because co2 is a gas, and hence more random movement? this is actually my doubt from the ellinghem diagram, metallurgy

Answer» C + O2 ---------> CO2
2C + O
2 --------> CO2
2CO + O2 -----> 2CO2
In the first reaction, why is there no change in the entropy? Shouldn't delta S be +'ve, because solid plus gas is going going product, that is gas, hence more random movement.
IN 3rd equation, why is delta S negative again? Because shiudlnt it be positive, because co2 is a gas, and hence more random movement?
this is actually my doubt from the ellinghem diagram, metallurgy
44.

The standard enthalpies of formation at 300 K for CCl4(l), H2O(g), CO2(g) and HCl(g) are -107, -242, -394, and -93 kJmol−1 respectively. The value of ΔU for the reaction CCl4(l)+2H2O(g)→CO2(g)+4HCl(g) at 300 K is:

Answer»

The standard enthalpies of formation at 300 K for CCl4(l), H2O(g), CO2(g) and HCl(g) are -107, -242, -394, and -93 kJmol1 respectively. The value of ΔU for the reaction
CCl4(l)+2H2O(g)CO2(g)+4HCl(g)
at 300 K is:

45.

Complete the following reactions: (i) CH3CH2NH2+CHCl3+alc.KOH→ (ii) C6H5N+2Cl−H2O−−−−−−−−−→(Room Temp.)

Answer» Complete the following reactions:
(i) CH3CH2NH2+CHCl3+alc.KOH
(ii) C6H5N+2ClH2O−−−−−−−−(Room Temp.)
46.

How PIE IS 180 DEGREE

Answer» How PIE IS 180 DEGREE
47.

Molar specific heat of oxygen at constant pressure Cp=7.2cal/mol/∘C and R=8.3J/mol/K. At constant volume, 5 mol of oxygen is heated from 10∘C to 20∘C, the quantity of heat required is approximately

Answer»

Molar specific heat of oxygen at constant pressure Cp=7.2cal/mol/C and R=8.3J/mol/K. At constant volume, 5 mol of oxygen is heated from 10C to 20C, the quantity of heat required is approximately

48.

Among the following, the number of halide(s) inert to hydrolysis is _____.(a) BF3(b) SiCl4(c) PCl5(d) SF6

Answer» Among the following, the number of halide(s) inert to hydrolysis is _____.

(a) BF3

(b) SiCl4

(c) PCl5

(d) SF6


49.

Lead pipes are not suitable for drinking water because

Answer»

Lead pipes are not suitable for drinking water because


50.

Which of the following is not a reducing agent

Answer» Which of the following is not a reducing agent