Explore topic-wise InterviewSolutions in Current Affairs.

This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.

1.

What will be the molecular formula of a disccharide rutinose formed from rhamnose (C6H12O5) and glucose (C6H12O6)?

Answer»

What will be the molecular formula of a disccharide rutinose formed from rhamnose (C6H12O5) and glucose (C6H12O6)?

2.

The volume of water to be added to 100 cm3 of a 0.5 N H2SO4 to get a decinormal solution is:

Answer»

The volume of water to be added to 100 cm3 of a 0.5 N H2SO4 to get a decinormal solution is:

3.

In the electrolytic refining process of Zinc, it is given that the crude metal is made anode while the electrolyte is used is H2SO4 (dilute) + ZnSO4 . The cathode should be:

Answer»

In the electrolytic refining process of Zinc, it is given that the crude metal is made anode while the electrolyte is used is H2SO4 (dilute) + ZnSO4 . The cathode should be:


4.

Value of gas constant R is

Answer»

Value of gas constant R is

5.

If in diborane, the bond angle of H(bridged)-B-H(bridged) is 97∘, then the bond angle of B-H(bridged)-B (in degree) would be

Answer» If in diborane, the bond angle of H(bridged)-B-H(bridged) is 97, then the bond angle of B-H(bridged)-B (in degree) would be
6.

In fibrous proteins, polypepetide chains are held together by

Answer»

In fibrous proteins, polypepetide chains are held together by


7.

Which of the following are amphoteric oxides? Mn2O7,CrO3,Cr2O3,CrO,V2O5,V2O4

Answer»

Which of the following are amphoteric oxides?

Mn2O7,CrO3,Cr2O3,CrO,V2O5,V2O4

8.

Which of the following sets contain only copolymers?

Answer»

Which of the following sets contain only copolymers?


9.

The conjugate of the complex number (2+3i)4i is _____.

Answer»

The conjugate of the complex number (2+3i)4i is _____.


10.

Why are microwaves suitable for radar system used in aircraft navigation?

Answer» Why are microwaves suitable for radar system used in aircraft navigation?
11.

In the reversible reaction A + B ⇌​ C + D, the concentration of each C and D at equilibrium was 0.8 mole/litre, then the equilibrium constant KC will be

Answer»

In the reversible reaction A + B ​ C + D, the concentration of each C and D at

equilibrium was 0.8 mole/litre, then the equilibrium constant KC will be


12.

For the reaction, N2(g)+3H2(g)⇌2NH3(g),△H is equal to : (△U = change in internal energy)

Answer»

For the reaction,
N2(g)+3H2(g)2NH3(g),H is equal to :
(U = change in internal energy)

13.

Heat of reaction for, C6H12O6(s) + 6O2(g) → 6CO2(g) + 6H2O(v) at constant pressure is −651kcal at 170C. Calculate the heat of reaction at constant volume at 170C

Answer»

Heat of reaction for,
C6H12O6(s) + 6O2(g) 6CO2(g) + 6H2O(v)
at constant pressure is 651kcal at 170C. Calculate the heat of reaction at constant volume at 170C

14.

Equal volumes of 0.1 M AgNO3 and 0.2 M NaCl are mixed. The concentration of NO−3 ions in the mixture will be:

Answer»

Equal volumes of 0.1 M AgNO3 and 0.2 M NaCl are mixed. The concentration of NO3 ions in the mixture will be:

15.

One cationic complex has two isomers A and B. Each has one Co3+, five NH3, one Br−, and one SO2−4 stoi-chiometrically. A gives white ppt with BaCl2 whle B give yellow ppt with AgNO3. Complexes A and B have similarity in which type of isomerism?

Answer»

One cationic complex has two isomers A and B. Each has one Co3+, five NH3, one Br, and one SO24 stoi-chiometrically. A gives white ppt with BaCl2 whle B give yellow ppt with AgNO3.
Complexes A and B have similarity in which type of isomerism?


16.

According to cahn-Ingold-prelog sequence rules, the correct order of priority of the given groups is

Answer»

According to cahn-Ingold-prelog sequence rules, the correct order of priority of the given groups is


17.

Question 44 How does sprinkling of salt help in clearing the snow covered roads in hilly areas? Explain the phenomenon involved in the process.

Answer»

Question 44
How does sprinkling of salt help in clearing the snow covered roads in hilly areas? Explain the phenomenon involved in the process.

18.

Water is filled in a uniform container of the area of cross section A. A hole of cross-section area a (<< A) is made in the container at a height of 20 m above the base. Water streams out and hits a small block placed at some distance from the container. With what speed (in ms−1) the block should be moved such that water streams always hits the block. (Given aA=120). (Take g=10ms–2)

Answer»

Water is filled in a uniform container of the area of cross section A. A hole of cross-section area a (<< A) is made in the container at a height of 20 m above the base. Water streams out and hits a small block placed at some distance from the container. With what speed (in ms1) the block should be moved such that water streams always hits the block. (Given aA=120). (Take g=10ms2)

19.

The oxidation number of Ba in barium peroxide is

Answer»

The oxidation number of Ba in barium peroxide is


20.

What is Raney nickel?

Answer» What is Raney nickel?
21.

Elements X and Y have valence shell electronic configurations X=ns2np5;Y=ns2np3. Which compound is likely formed from X and Y?

Answer»

Elements X and Y have valence shell electronic configurations X=ns2np5;Y=ns2np3. Which compound is likely formed from X and Y?

22.

9.8g of H2SO4 is present in 2 litres of a solution. The molarity of the solution is:

Answer»

9.8g of H2SO4 is present in 2 litres of a solution. The molarity of the solution is:


23.

How many grams of concentrated nitric acid solution should be used to prepare 250 mL of 2.0 M HNO3? The concentrated acid is 70% HNO3.

Answer» How many grams of concentrated nitric acid solution should be used to prepare 250 mL of 2.0 M HNO3? The concentrated acid is 70% HNO3.
24.

H2S acts only as a reducing agent while SO2 can act both as a reducing and oxidizing agent because

Answer»

H2S acts only as a reducing agent while SO2 can act both as a reducing and oxidizing agent because


25.

The ion which is not tetrahedral in shape is?

Answer» The ion which is not tetrahedral in shape is?
26.

A stream of electrons from a heated filament was passed between two charged plates kept at a potential difference V esu. If e and m are charge and mass of an electron respectively, then the value of h/λ (where λ is wavelength associated with electron wave) is given by:

Answer»

A stream of electrons from a heated filament was passed between two charged plates kept at a potential difference V esu. If e and m are charge and mass of an electron respectively, then the value of h/λ (where λ is wavelength associated with electron wave) is given by:

27.

For the complete combustion of ethanol, C2HsOH(l)+3O2(g)→+2CO2+2H2O(l) the amount of heat produced as measured inthe bomb calorimeter is 1364.47 kJ mol−1 at 25∘C. Assuming ideality, the enthalpy of combustion ΔcH for the reaction will be [ R = 8.314 JK−1mol−1 ]

Answer»

For the complete combustion of ethanol, C2HsOH(l)+3O2(g)+2CO2+2H2O(l) the amount of heat produced as measured inthe bomb calorimeter is 1364.47 kJ mol1 at 25C. Assuming ideality, the enthalpy of combustion ΔcH for the reaction will be [ R = 8.314 JK1mol1 ]


28.

Edge length in a face centered cubic unit cell of calcium is 0.556 nm. If it contains 0.1% schottky defect, the density of the metal is

Answer»

Edge length in a face centered cubic unit cell of calcium is 0.556 nm. If it contains 0.1% schottky defect, the density of the metal is

29.

Why bimolecular dehydration not suitable for preparation of ethyl methyl ether.

Answer» Why bimolecular dehydration not suitable for preparation of ethyl methyl ether.
30.

The number of lone pair(s) on the compound which is obtained by heating a mixture of Xe and F2 in the ratio 1:5 in a sealed nickel tube is

Answer» The number of lone pair(s) on the compound which is obtained by heating a mixture of Xe and F2 in the ratio 1:5 in a sealed nickel tube is
31.

11 moles N2 and 12 moles of H2 mixture reacted in 20 L vessel at 800 K. After equilibrium was reached, 6 mole of H2 was present. 3.58 L of liquid water is injected in equilibrium mixture and resultant gaseous mixture suddenly cooled to 300 K. What is the final pressure of gaseous mixture/? Neglect vapour pressure of liquid solution. Assume (i) all NH3 dissolved in water (ii) no change in volume of liquid (iii) no reaction of N2 and H2 at 300 K (Given R=0.821 L atm mol−1 K−1)

Answer» 11 moles N2 and 12 moles of H2 mixture reacted in 20 L vessel at 800 K. After equilibrium was reached, 6 mole of H2 was present. 3.58 L of liquid water is injected in equilibrium mixture and resultant gaseous mixture suddenly cooled to 300 K. What is the final pressure of gaseous mixture/? Neglect vapour pressure of liquid solution. Assume (i) all NH3 dissolved in water (ii) no change in volume of liquid (iii) no reaction of N2 and H2 at 300 K

(Given R=0.821 L atm mol1 K1)
32.

Among the given compounds, the correct order of enol content is:

Answer»

Among the given compounds, the correct order of enol content is:


33.

Some pairs of acids are given below. Select the pair in which second acid is stronger than first.

Answer»

Some pairs of acids are given below. Select the pair in which second acid is stronger than first.

34.

the elemente with positive gain enthalpy is options 1.H 2. Na3. O 4.F 5.Ne

Answer» the elemente with positive gain enthalpy is options 1.H 2. Na3. O 4.F 5.Ne
35.

How can we convert Ethanol to But-1-yne ?

Answer» How can we convert Ethanol to But-1-yne ?
36.

Among the following, the no. of aromatic compound(s) is/are:

Answer» Among the following, the no. of aromatic compound(s) is/are:

37.

In a reaction,200ml of hydrogen peroxide sample solution (at STP) liberated 3 litres of oxygen. What is the concentration (in % w/v) of the H2O2 in the sample?

Answer»

In a reaction,200ml of hydrogen peroxide sample solution (at STP) liberated 3 litres of oxygen. What is the concentration (in % w/v) of the H2O2 in the sample?


38.

The difference in angular momentum associated with the electron in the two successive orbits of hydrogen atom is

Answer»

The difference in angular momentum associated with the electron in the two successive orbits of hydrogen atom is


39.

A first order reaction has a rate constant 200 s-1. Its half life is

Answer»

A first order reaction has a rate constant 200 s-1. Its half life is


40.

The group 16 elements are also known as:

Answer»

The group 16 elements are also known as:


41.

For the reaction Al+O2→Al2O3 (The equation is not balanced) 54 g of Al is reacted with 67.4 litre at STP. 76.5 g of Al2O3 was obtained. The percentage yield of the product obtained is

Answer»

For the reaction
Al+O2Al2O3
(The equation is not balanced)
54 g of Al is reacted with 67.4 litre at STP. 76.5 g of Al2O3 was obtained. The percentage yield of the product obtained is

42.

Q.Calculate the mass of urea (NH2CONH2) required in making 2.5 kg of 0.25 molal aqueous solution.

Answer»

Q.Calculate the mass of urea
(NH2CONH2) required in making 2.5
kg of 0.25 molal aqueous solution.

43.

Gaseous reaction in a closed vessel is reversible or irreversible. Also give example.

Answer»

Gaseous reaction in a closed vessel is reversible or irreversible. Also give example.

44.

Conjugate base of HCl is –

Answer» Conjugate base of HCl is –
45.

Which of the following do not show geometrical isomerism?

Answer»

Which of the following do not show geometrical isomerism?


46.

If the solubility of sparingly soluble salt PbCl2 is 4.41 g L−1 at 25o C. Find its solubility product at the given temperature. (Take Molecular mass PbCl2≈278 g mol−1)

Answer»

If the solubility of sparingly soluble salt PbCl2 is 4.41 g L1 at 25o C. Find its solubility product at the given temperature.
(Take Molecular mass PbCl2278 g mol1)

47.

Why does the rate of any reaction generally decreases during the course of the reaction?

Answer»

Why does the rate of any reaction generally decreases during the course of the reaction?

48.

Cannizzaro’s reaction is not given by:

Answer»

Cannizzaro’s reaction is not given by:

49.

Colourless compound X obtained from sea water used in daily meals is taken in a test tube. Concentrated H2SO4 was added to the test tube. A pungent smelling gas Y comes out which does not affect dry blue litmus paper but turns moist blue litmus paper red. Identify X and Y. Write the chemical reactions involved.

Answer» Colourless compound X obtained from sea water used in daily meals is taken in a test tube. Concentrated H2SO4 was added to the test tube. A pungent smelling gas Y comes out which does not affect dry blue litmus paper but turns moist blue litmus paper red. Identify X and Y. Write the chemical reactions involved.
50.

The smallest among the following ions is

Answer»

The smallest among the following ions is