Explore topic-wise InterviewSolutions in Current Affairs.

This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.

1.

A binary solid (AB) has a rock salt structure. If the edge length is 400 pm and radius of cation is 80 pm, the radius of anion is:

Answer»

A binary solid (AB) has a rock salt structure. If the edge length is 400 pm and radius of cation is 80 pm, the radius of anion is:

2.

Predict the relative bond lengths a and b, in napthalene

Answer»

Predict the relative bond lengths a and b, in napthalene





3.

Carbon is in the lowest oxidation state in

Answer»

Carbon is in the lowest oxidation state in

4.

For a reaction scheme, Ak1−→Bk2−→C, if the rate of formation of B is set to be zero then the concentration of B is given by:

Answer»

For a reaction scheme, Ak1Bk2C, if the rate of formation of B is set to be zero then the concentration of B is given by:

5.

What is the current gain for a transistor used as common emitter amplifier, if the current gain of the common base n-p-n transistor is 0.96 ?

Answer»

What is the current gain for a transistor used as common emitter amplifier, if the current gain of the common base n-p-n transistor is 0.96 ?

6.

In the preparation of Grignard's reagent the use of iodine is a) to lower down the temperature b) to prevent reverse reaction c) to remove impurities d) as a catalyst

Answer» In the preparation of Grignard's reagent the use of iodine is a) to lower down the temperature b) to prevent reverse reaction c) to remove impurities d) as a catalyst
7.

When radiation of λ=253.7 nm strikes the copper plate, the energy required to stop the ejection of electrons from copper plate is 0.24 eV. Calculate the work function of copper.

Answer»

When radiation of λ=253.7 nm strikes the copper plate, the energy required to stop the ejection of electrons from copper plate is 0.24 eV. Calculate the work function of copper.

8.

why selectivity of catalyst increase from group 5 to11 and highest in group 7 to9

Answer» why selectivity of catalyst increase from group 5 to11 and highest in group 7 to9
9.

mass of one element of an element is 4 ×10^{-24}g.this isequal to

Answer» mass of one element of an element is 4 ×10^{-24}g.this isequal to
10.

The number of Cl− and Ca+2 ions in 222g. of CaCl2 are

Answer»

The number of Cl and Ca+2 ions in 222g. of CaCl2 are


11.

which of the following is most likely formula of platinum complex, if 1/4 of total chlorine of the compound is precipitated by adding AgNO3 to its aqueous solution- (1) PtCl4.6H20 (2) PtCl4.5H2O (3) PtCl2.2H2O (4) PtCl4.3H2O

Answer» which of the following is most likely formula of platinum complex, if 1/4 of total chlorine of the compound is precipitated by adding AgNO3 to its aqueous solution- (1) PtCl4.6H20 (2) PtCl4.5H2O (3) PtCl2.2H2O (4) PtCl4.3H2O
12.

An orange coloured solution acidified with H2SO4 and treated with a substance'X' gives a blue coloured solution of CrO5 .The substance 'X' is :

Answer»

An orange coloured solution acidified with H2SO4 and treated with a substance'X' gives a blue coloured solution of CrO5 .The substance 'X' is :


13.

The specific conductance of a N10 KCl solution at 180 C is 1.12×10−2 mho cm−1. The resistance of the soution contained in the cell is found to be 65 ohm. Calculate the cell constant:

Answer»

The specific conductance of a N10 KCl solution at 180 C is 1.12×102 mho cm1. The resistance of the soution contained in the cell is found to be 65 ohm. Calculate the cell constant:


14.

Correct order for the rate of dehydration of the given compounds with H2SO4 is:

Answer»

Correct order for the rate of dehydration of the given compounds with H2SO4 is:


15.

28A 0.0150 mol sample of an ideal gas is allowed to expand at 294 K from 10.00 atm to 1.00 atm.If external pressure is kept constant at 1.00 atm.calculate the work done??.

Answer» 28A 0.0150 mol sample of an ideal gas is allowed to expand at 294 K from 10.00 atm to 1.00 atm.If external pressure is kept constant at 1.00 atm.calculate the work done??.
16.

Which one among the following does not have hydrogen bond?

Answer» Which one among the following does not have hydrogen bond?
17.

What is sulphonamide reaction

Answer» What is sulphonamide reaction
18.

For the given reaction: 2A+B→3C+D.Which of the following expression(s) is/are correct regarding overall rate of reaction (r)?

Answer»

For the given reaction: 2A+B3C+D.

Which of the following expression(s) is/are correct regarding overall rate of reaction (r)?

19.

Identify the correct statement which corresponds to accelarator retarder.

Answer»

Identify the correct statement which corresponds to accelarator retarder.

20.

The volume of oxgen liberated from 0.96g of H2O2 at STP is

Answer» The volume of oxgen liberated from 0.96g of H2O2 at STP is
21.

How to find the number of bonds in oleic acid ??

Answer» How to find the number of bonds in oleic acid ??
22.

10 ml of hydrocarbon was completely burnt in 80 ml of O2 at ntp.The remaining gaseous mixture occupies 70 ml at Ntp.The volume becomes 50 ml when passed through KOH,what is the formula of hydrocarbon?

Answer» 10 ml of hydrocarbon was completely burnt in 80 ml of O2 at ntp.The remaining gaseous mixture occupies 70 ml at Ntp.The volume becomes 50 ml when passed through KOH,what is the formula of hydrocarbon?
23.

Despite having weak van der Waals forces why are alkanes so unreactive?

Answer» Despite having weak van der Waals forces why are alkanes so unreactive?
24.

The decomposition of ozone proceeds as O3⇔O2+O(fast)O+O3→2O2(slow) The rate expression should be

Answer» The decomposition of ozone proceeds as O3O2+O(fast)O+O32O2(slow)
The rate expression should be

25.

A solid solution is made up of two solids "A" and "B". Mass percentage of "A" is 40% by mass in a solid solution. Find the molar mass of "B" if the mole fraction of "A" (xA) is 0.20 and molar mass of "A" is 200 g/mol.

Answer»

A solid solution is made up of two solids "A" and "B". Mass percentage of "A" is 40% by mass in a solid solution. Find the molar mass of "B" if the mole fraction of "A" (xA) is 0.20 and molar mass of "A" is 200 g/mol.

26.

18. No of atoms un fcc unit cell

Answer» 18. No of atoms un fcc unit cell
27.

Why tetragonal crystal system does not have end-face centred unit cell?

Answer» Why tetragonal crystal system does not have end-face centred unit cell?
28.

Steam enters a turbine at 30 bar, 300oC (u=2750 ,kJ/kg, h=2993,kJ/kg) and exits the turbine as saturated liquid at 15 kPa (u = 225 kJ/kg, h = 226 kJ/kg). Heat loss to the surrounding is 50 kJ/kg of steam flowing through the turbine. Neglecting changes in kinetic energy and potential energy, the work output of the turbine (in kJ/kg of steam) is 2717

Answer» Steam enters a turbine at 30 bar, 300oC (u=2750 ,kJ/kg, h=2993,kJ/kg) and exits the turbine as saturated liquid at 15 kPa (u = 225 kJ/kg, h = 226 kJ/kg). Heat loss to the surrounding is 50 kJ/kg of steam flowing through the turbine. Neglecting changes in kinetic energy and potential energy, the work output of the turbine (in kJ/kg of steam) is
  1. 2717
29.

Describe the features of Resonance.

Answer» Describe the features of Resonance.
30.

What is the number of carbon atoms per unit cell of graphite?

Answer» What is the number of carbon atoms per unit cell of graphite?
31.

Classify the following as addition and condensation polymers: Terylene, Bakelite, Polyvinyl chloride, Polythene.

Answer»

Classify the following
as addition and condensation polymers: Terylene, Bakelite, Polyvinyl
chloride, Polythene.

32.

Which of the following reactions would convert pentan-3-ol (A) into deuterated compound? CH3−CH2−C|DH−CH2−CH3

Answer»

Which of the following reactions would convert pentan-3-ol (A) into deuterated compound?
CH3CH2C|DHCH2CH3

33.

Calculate the lattice enthalpy of KCl from the following data at standard states-Enthalpy of sublimation of K=89 kJmol−1Enthalpy of dissociation of Cl2=244 kJmol−1Ionisation energy of K=425 kJmol−1Electron gain enthalpy of Cl=−355 kJmol−1Enthalpy of formation of KCl=−438 kJmol−1

Answer»

Calculate the lattice enthalpy of KCl from the following data at standard states-

Enthalpy of sublimation of K=89 kJmol1

Enthalpy of dissociation of Cl2=244 kJmol1

Ionisation energy of K=425 kJmol1

Electron gain enthalpy of Cl=355 kJmol1

Enthalpy of formation of KCl=438 kJmol1

34.

Faraday conducted many experiments. So naturally he would have to make several calculations. He once passed a current of 1 A through a wire. What do you think is the number of electrons that moved past a point in the wire in one second?

Answer» Faraday conducted many experiments. So naturally he would have to make several calculations.
He once passed a current of 1 A through a wire. What do you think is the number of electrons that moved past a point in the wire in one second?
35.

Solution having osmotic pressure nearer to that equimolar solution of K4[Fe(CN)6] is:

Answer» Solution having osmotic pressure nearer to that equimolar solution of K4[Fe(CN)6] is:
36.

tertiary alcohol +al2o3/△

Answer» tertiary alcohol +al2o3/△
37.

For all the sets A and B, A−(A∩B)=

Answer» For all the sets A and B, A−(A∩B)=
38.

What is difference between interstitial defect and frenkel defect? And how does density of substances increase due to these defects? (Even if density increases at one point doesn't it decrease at another.)

Answer» What is difference between interstitial defect and frenkel defect? And how does density of substances increase due to these defects? (Even if density increases at one point doesn't it decrease at another.)
39.

45. How much silver will be obtained by the quantity of the current which displaces 5.6loyres of H2? 54g 108g 13.5g 20g

Answer» 45. How much silver will be obtained by the quantity of the current which displaces 5.6loyres of H2? 54g 108g 13.5g 20g
40.

The electronegativity of p-block elements across a period:

Answer»

The electronegativity of p-block elements across a period:


41.

Explain geometrical isomerism in cyclohexane in details.

Answer» Explain geometrical isomerism in cyclohexane in details.
42.

33. In a CCP structure of compound xy atoms is present at octahedral voids the ratio of 6th coordination number and third coordination number for an atom X located at body centre is

Answer» 33. In a CCP structure of compound xy atoms is present at octahedral voids the ratio of 6th coordination number and third coordination number for an atom X located at body centre is
43.

Group - 1 gives a list of test methods for evaluating properties of aggregates. Group - II gives the list of properties to be evaluated. Group - I (Test Methods)Group - II (Properties)P. Soundness test1. StrengthQ. Crushing test2. Resistance to weatheringR. Los Angeles abrasion test3. AdhesionS. Stripping value test4. HardnessThe correct match of test methods under Group - I to properties under Group - II, is

Answer»

Group - 1 gives a list of test methods for evaluating properties of aggregates. Group - II gives the list of properties to be evaluated.

























Group - I (Test Methods)Group - II (Properties)
P. Soundness test1. Strength
Q. Crushing test2. Resistance to weathering
R. Los Angeles abrasion test3. Adhesion
S. Stripping value test4. Hardness



The correct match of test methods under Group - I to properties under Group - II, is
44.

20.Pcl5 is 40% dissociated according to the following reaction when equilibrium pressure is 2 atm. It will be 80% dissociated when equilibrium pressure is approximately PCl5(g)=PCl3(g)+Cl2(g) Options :A)0.2atm B)0.5atm C)0.4atm D)4atm

Answer» 20.Pcl5 is 40% dissociated according to the following reaction when equilibrium pressure is 2 atm. It will be 80% dissociated when equilibrium pressure is approximately PCl5(g)=PCl3(g)+Cl2(g) Options :A)0.2atm B)0.5atm C)0.4atm D)4atm
45.

Are formula to find out optical and geometrical isomers applicable for cyclic compounds?

Answer» Are formula to find out optical and geometrical isomers applicable for cyclic compounds?
46.

The correct order of increasing bond angles in the following triatomic species is

Answer»

The correct order of increasing bond angles in the following triatomic species is

47.

42. Consider the following reactions The mechanisms of reactions (i) and (ii) are respectively 1) Sn1 and Sn2 2) Sn1 and Sn1 3) Sn2 and Sn2 4) Sn2 and Sn1

Answer» 42. Consider the following reactions The mechanisms of reactions (i) and (ii) are respectively 1) Sn1 and Sn2 2) Sn1 and Sn1 3) Sn2 and Sn2 4) Sn2 and Sn1
48.

The product of the reaction is:

Answer»

The product of the reaction is:
49.

At equilibrium of the reaction of dissociation of N2O4 . The observed molecular weight of N2O4 is 80g/mol at 350K . Find the percentage of dissociation of N2O4 at 350K.

Answer» At equilibrium of the reaction of dissociation of N2O4 . The observed molecular weight of N2O4 is 80g/mol at 350K . Find the percentage of dissociation of N2O4 at 350K.
50.

3. Which of the following compounds does not have diastereoisomers?(a) 2,3-Butanediol(b) 2,3-Dibromopentane(c) 2-Butene(d) 2-Butanol

Answer» 3. Which of the following compounds does not have diastereoisomers?(a) 2,3-Butanediol(b) 2,3-Dibromopentane(c) 2-Butene(d) 2-Butanol