46295 + Interview Questions in Chemistry

1.	Arrange the following compounds in increasing order of their boiling points.I. CH3CH2CH2BrII. CH3CH2CH2CH2BrIII.(CH3)2CHCH2BrIV. (CH3)3CBr
Answer» Arrange the following compounds in increasing order of their boiling points. I. $C H_{3} C H_{2} C H_{2} B r$ II. $C H_{3} C H_{2} C H_{2} C H_{2} B r$ III. $(C H_{3})_{2} C H C H_{2} B r$ IV. $(C H_{3})_{3} C B r$

Discussion

2.	A reaction of 0.1 mole of Benzyl amine with bromomethane gave 23 g of Benzyl trimethyl ammonium bromide. The number of moles of bromomethane consumed in this reaction are n×10–1, when n =_____. (Round off to the Nearest Integer). [Given: Atomic masses: C: 12.0 u, H : 1.0 u, N : 14.0 u, Br : 80.0 u]
Answer» A reaction of 0.1 mole of Benzyl amine with bromomethane gave $23 g$ of Benzyl trimethyl ammonium bromide. The number of moles of bromomethane consumed in this reaction are $n \times 10^{- 1}$ , when n =_____ . (Round off to the Nearest Integer). [Given: Atomic masses: C: 12.0 u, H : 1.0 u, N : 14.0 u, Br : 80.0 u]

Discussion

3.	The correct order of thermal decomposition temperatures of the alkaline earth metal carbonates is:
Answer» The correct order of thermal decomposition temperatures of the alkaline earth metal carbonates is:

Discussion

4.	A compound is formed by two elements p and q . if atom p are in ccp arrangement and atom q occupy 50% tv and 50% ov then formula of compound is
Answer» A compound is formed by two elements p and q . if atom p are in ccp arrangement and atom q occupy 50% tv and 50% ov then formula of compound is

Discussion

5.	50% aq. NaoH−−−−−−−−→WarmPh−CO⊕O⊖Na+an alcohol This alcohol is
Answer» $50 % a q . N a o H - ------- \to W a r m P h - C O \oplus O ⊖ N a + an alcohol$ This alcohol is

Discussion

6.	which is more stable (c6h5)2ch+ or (ch3)3c+ ?
Answer» which is more stable (c6h5)2ch+ or (ch3)3c+ ?

Discussion

7.	The binding energy of the second excited state of Li2+ ion is:
Answer» The binding energy of the second excited state of $L i^{2 +}$ ion is:

Discussion

8.	What is the effect of increasing the temperature of an endothermic reaction mixture at equilibrium?
Answer» What is the effect of increasing the temperature of an endothermic reaction mixture at equilibrium?

Discussion

9.	In which compound synergic effect is present?
Answer» In which compound synergic effect is present?

Discussion

10.	What will be the effect on the ph of CH3COONa when CH3COOH is mixed in its aqueous solution?( Effect on CH3COONa)
Answer» What will be the effect on the ph of CH3COONa when CH3COOH is mixed in its aqueous solution?( Effect on CH3COONa)

Discussion

11.	The reaction 2A + B → products, follows the mechanism2A → A_2 (fast)A_2 + B→ P (slow).The order of the reaction is:
Answer» The reaction 2A + B → products, follows the mechanism2A → A_2 (fast)A_2 + B→ P (slow).The order of the reaction is:

Discussion

12.	Draw the Lewis dot structures of HNO3 and HNO2 and mention Co-ordinate bonds wherever required.
Answer» Draw the Lewis dot structures of HNO3 and HNO2 and mention Co-ordinate bonds wherever required.

Discussion

13.	why Lithium has largest size ion in aqueous solution( even greater than Cs )Cs ion has 4 additional shells as compared to Li ion and also more number of neutrons and protons , so Cs should have larger size (and least mobility in water)
Answer» why Lithium has largest size ion in aqueous solution( even greater than Cs ) Cs ion has 4 additional shells as compared to Li ion and also more number of neutrons and protons , so Cs should have larger size (and least mobility in water)

Discussion

14.	16. Give me perfect defination of plastics
Answer» 16. Give me perfect defination of plastics

Discussion

15.	185 Calculate the ratio of change in the mass of the molecules of a gas to the initial mass,if it's speed is reduced to half and the ratio of initial and final pressure is 3/4
Answer» 185 Calculate the ratio of change in the mass of the molecules of a gas to the initial mass,if it's speed is reduced to half and the ratio of initial and final pressure is 3/4

Discussion

16.	hybridisation of (a)\{Cu(NH_{3 })_4\}^{2+} (b)\{Ni(CN)_6\}^{4-
Answer» hybridisation of (a)\{Cu(NH_{3 })_4\}^{2+} (b)\{Ni(CN)_6\}^{4-

Discussion

17.	Find electric field due to a semi Circular ring of uniform charge density at its centre.
Answer» Find electric field due to a semi Circular ring of uniform charge density at its centre.

Discussion

18.	If A = (-00, 1] U [2, oo) and B= [1, 2] then A - B = ?
Answer» If A = (-00, 1] U [2, oo) and B= [1, 2] then A - B = ?

Discussion

19.	what is the liquification order in noble gases ? explain how helium is harder to liquify then any other noble gases
Answer» what is the liquification order in noble gases ? explain how helium is harder to liquify then any other noble gases

Discussion

20.	33 How number of oxide ions per unit cell is 4?
Answer» 33 How number of oxide ions per unit cell is 4?

Discussion

21.	If we have 2 elements A and B. if the valency of A is 5 and valency of B is 2, so how to find that the valency of A and B is either positive or negative?
Answer» If we have 2 elements A and B. if the valency of A is 5 and valency of B is 2, so how to find that the valency of A and B is either positive or negative?

Discussion

22.	In Bohr's model of hydrogen atom, the ratio of periods of revolution of an electron in n=2 to n=1 is
Answer» In Bohr's model of hydrogen atom, the ratio of periods of revolution of an electron in $n = 2$ to $n = 1$ is

Discussion

23.	What is the correct structure of 1-Ethyl-3-methylcyclopentane?
Answer» What is the correct structure of 1-Ethyl-3-methylcyclopentane?

Discussion

24.	A sample of ideal gas (γ=1.4) is heated at constant pressure. If an amount of 85 J of heat is supplied to gas, find △U (In joule).
Answer» A sample of ideal gas $(γ = 1.4)$ is heated at constant pressure. If an amount of $85 J$ of heat is supplied to gas, find $△ U$ (In joule).

Discussion

25.	In the elevation of boiling point experiment, it is found that
Answer» In the elevation of boiling point experiment, it is found that

Discussion

26.	what is the composition of vinegar
Answer» what is the composition of vinegar

Discussion

27.	The addition of solid sodium carbonate to pure water causes
Answer» The addition of solid sodium carbonate to pure water causes

Discussion

28.	Rate of disappearance of the reactant A in the reversable and one step reaction A⇌B at two temperatures is given by −d[A]dt=2.0×10−3s−1[A]−5.0×10−4s−1[B](at 27∘C)−d[A]dt=8.0×10−2s−1[A]−4.0×10−3s−1[B](at 127∘C)The enthapy of the reaction in the given temperature range is
Answer» Rate of disappearance of the reactant A in the reversable and one step reaction $A ⇌ B$ at two temperatures is given by $\frac{- d [A]}{d t} = 2.0 \times 10^{- 3} s^{- 1} [A] - 5.0 \times 10^{- 4} s^{- 1} [B] (a t 27^{\circ} C) \frac{- d [A]}{d t} = 8.0 \times 10^{- 2} s^{- 1} [A] - 4.0 \times 10^{- 3} s^{- 1} [B] (a t 127^{\circ} C)$ The enthapy of the reaction in the given temperature range is

Discussion

29.	why (+) 2- iodobu†an e on treatment with NaI in acetone give racemic mixture
Answer» why (+) 2- iodobu†an e on treatment with NaI in acetone give racemic mixture

Discussion

30.	Which of the following are Lewis Acids? Why? (i) H2O (ii) BF3 (iii) H+ (iv) NH4+
Answer» Which of the following are Lewis Acids? Why? (i) H2O (ii) BF3 (iii) H+ (iv) NH4+

Discussion

31.	which of the following is undergoes nucleophhilic sub. exclusively by Sn1 ? 1.bemzyle chloride 2. ethyl chloride3. chlorobenzene 4.isopropyl chloride
Answer» which of the following is undergoes nucleophhilic sub. exclusively by Sn1 ? 1.bemzyle chloride 2. ethyl chloride3. chlorobenzene 4.isopropyl chloride

Discussion

32.	Life period of nascent hydrogen?
Answer» Life period of nascent hydrogen?

Discussion

33.	Why molar concentration of pure solids and pure liquids is taken as unity
Answer» Why molar concentration of pure solids and pure liquids is taken as unity

Discussion

34.	log of (x-1) to base [x] where [ ] is gif is ?
Answer» log of (x-1) to base [x] where [ ] is gif is ?

Discussion

35.	Is N2 a element?
Answer» Is N2 a element?

Discussion

36.	The distance travelled by a body in the nth second is given by Sn= u+a/2(2n-1) where u is initial velocity and a is acceleration. The dimensional formula of Sn is
Answer» The distance travelled by a body in the nth second is given by Sn= u+a/2(2n-1) where u is initial velocity and a is acceleration. The dimensional formula of Sn is

Discussion

37.	Find the equivalent weight of K2Cr2O2−7 in the given reaction, if the molar mass of Cr2O2−7 is 'M' ? K2Cr2O2−7H+→Cr3+
Answer» Find the equivalent weight of $K_{2} C r_{2} O_{7}^{2 -}$ in the given reaction, if the molar mass of $C r_{2} O_{7}^{2 -}$ is 'M' ? $K_{2} C r_{2} O_{7}^{2 -}^{+} C r^{3 +}$

Discussion

38.	52 What is the main product of chlorination of 2-Methylbutane ? 1) 2-Chloro-3-methylbutane 2) 2-Chloro-2-methylbutane 3) 1-Chloro-3-methylbutane 4) 1-Chloro-2-methylbutane
Answer» 52 What is the main product of chlorination of 2-Methylbutane ? 1) 2-Chloro-3-methylbutane 2) 2-Chloro-2-methylbutane 3) 1-Chloro-3-methylbutane 4) 1-Chloro-2-methylbutane

Discussion

39.	Convert ethanol to propanal
Answer» Convert ethanol to propanal

Discussion

40.	What is the difference between semi metal and metalloid
Answer» What is the difference between semi metal and metalloid

Discussion

41.	Two half reactions for the following equation are: 4H2SO4+K2Cr2O7+3Na2SO3⟶Cr2(SO4)3+K2SO4+3Na2SO4+4H2O
Answer» Two half reactions for the following equation are: $4 H_{2} S O_{4} + K_{2} C r_{2} O_{7} + 3 N a_{2} S O_{3} ⟶ C r_{2} (S O_{4})_{3} + K_{2} S O_{4} + 3 N a_{2} S O_{4} + 4 H_{2} O$

Discussion

42.	Structure and hybridisation of Si(CH)3 is 1.bent,sp 2.trigonal,sp2 3.octahedral,sp3d 4.tetrahedral,sp3
Answer» Structure and hybridisation of Si(CH)3 is 1.bent,sp 2.trigonal,sp2 3.octahedral,sp3d 4.tetrahedral,sp3

Discussion

43.	Can 1s orbital combine with 2s orbital to form sigma bond...This is asked in ncert exercise question no. 29 (d).... the given answer is yes...But a/c to me it shouldn't combine due to difference in energy.. Plz solve my doubt
Answer» Can 1s orbital combine with 2s orbital to form sigma bond...This is asked in ncert exercise question no. 29 (d).... the given answer is yes...But a/c to me it shouldn't combine due to difference in energy.. Plz solve my doubt

Discussion

44.	Each NH3 molecule has six other NH3 molecules as its nearest neighbours in solid state; △ H of sublimation of NH3 molecule at the m.p. is 30.8 kJ/mol, and in the absence of H-bonding estimated △ H of sublimation is 14.4 kJ/mol. Hence strength of H-bond in solid NH3 is-1)5.47 KJ/mol, 2)10.93 kJ/mol, 3)16.40 KJ/mol.
Answer» Each NH3 molecule has six other NH3 molecules as its nearest neighbours in solid state; △ H of sublimation of NH3 molecule at the m.p. is 30.8 kJ/mol, and in the absence of H-bonding estimated △ H of sublimation is 14.4 kJ/mol. Hence strength of H-bond in solid NH3 is-1)5.47 KJ/mol, 2)10.93 kJ/mol, 3)16.40 KJ/mol.

Discussion

45.	a hydrocarbon C4H8 , neither decolorised bromine in CCl4solution nor reacted with HBr. when heated to 200 degree celcius with H2 in the presence of Ni catalyst, a new hydrocarbon C4H10 was formed.what was the structure of original hydrocarbon?(1)n-butene (2) cis-but-2-ene (3)isobutene (4) Cyclobu†an(2)
Answer» a hydrocarbon C4H8 , neither decolorised bromine in CCl4solution nor reacted with HBr. when heated to 200 degree celcius with H2 in the presence of Ni catalyst, a new hydrocarbon C4H10 was formed.what was the structure of original hydrocarbon?(1)n-butene (2) cis-but-2-ene (3)isobutene (4) Cyclobu†an(2)

Discussion

46.	The boiling point of 0.001 M aqueous solutions of NaCl, Na2SO4, K3PO4 and CH3COOH should follows the order
Answer» The boiling point of 0.001 M aqueous solutions of $N a C l, N a_{2} S O_{4}, K_{3} P O_{4} a n d C H_{3} C O O H$ should follows the order

Discussion

47.	CH2=CHCH2CH=CH2NBS−−−→ A, A is:
Answer» $C H_{2} = C H C H_{2} C H = C H_{2} N B S - -- \to$ A, A is:

Discussion

48.	Mention four factors that affect nucleophilicity.
Answer» Mention four factors that affect nucleophilicity.

Discussion

49.	The total number of atomic orbitals in fourth energy level of an atom is
Answer» The total number of atomic orbitals in fourth energy level of an atom is

Discussion

50.	3. What is the position of tetrahedral void in ccp?
Answer» 3. What is the position of tetrahedral void in ccp?

Discussion

Explore topic-wise InterviewSolutions in Current Affairs.

Arrange the following compounds in increasing order of their boiling points.I. CH3CH2CH2BrII. CH3CH2CH2CH2BrIII.(CH3)2CHCH2BrIV. (CH3)3CBr

The correct order of thermal decomposition temperatures of the alkaline earth metal carbonates is:

A compound is formed by two elements p and q . if atom p are in ccp arrangement and atom q occupy 50% tv and 50% ov then formula of compound is

50% aq. NaoH−−−−−−−−→WarmPh−CO⊕O⊖Na+an alcohol This alcohol is

which is more stable (c6h5)2ch+ or (ch3)3c+ ?

The binding energy of the second excited state of Li2+ ion is:

What is the effect of increasing the temperature of an endothermic reaction mixture at equilibrium?

In which compound synergic effect is present?

What will be the effect on the ph of CH3COONa when CH3COOH is mixed in its aqueous solution?( Effect on CH3COONa)

The reaction 2A + B → products, follows the mechanism2A → A_2 (fast)A_2 + B→ P (slow).The order of the reaction is:

Draw the Lewis dot structures of HNO3 and HNO2 and mention Co-ordinate bonds wherever required.

why Lithium has largest size ion in aqueous solution( even greater than Cs )Cs ion has 4 additional shells as compared to Li ion and also more number of neutrons and protons , so Cs should have larger size (and least mobility in water)

16. Give me perfect defination of plastics

185 Calculate the ratio of change in the mass of the molecules of a gas to the initial mass,if it's speed is reduced to half and the ratio of initial and final pressure is 3/4

hybridisation of (a)\{Cu(NH_{3 })_4\}^{2+} (b)\{Ni(CN)_6\}^{4-

Find electric field due to a semi Circular ring of uniform charge density at its centre.

If A = (-00, 1] U [2, oo) and B= [1, 2] then A - B = ?

what is the liquification order in noble gases ? explain how helium is harder to liquify then any other noble gases

33 How number of oxide ions per unit cell is 4?

If we have 2 elements A and B. if the valency of A is 5 and valency of B is 2, so how to find that the valency of A and B is either positive or negative?

In Bohr's model of hydrogen atom, the ratio of periods of revolution of an electron in n=2 to n=1 is

What is the correct structure of 1-Ethyl-3-methylcyclopentane?

A sample of ideal gas (γ=1.4) is heated at constant pressure. If an amount of 85 J of heat is supplied to gas, find △U (In joule).

In the elevation of boiling point experiment, it is found that

what is the composition of vinegar

The addition of solid sodium carbonate to pure water causes

why (+) 2- iodobu†an e on treatment with NaI in acetone give racemic mixture

Which of the following are Lewis Acids? Why? (i) H2O (ii) BF3 (iii) H+ (iv) NH4+

which of the following is undergoes nucleophhilic sub. exclusively by Sn1 ? 1.bemzyle chloride 2. ethyl chloride3. chlorobenzene 4.isopropyl chloride

Life period of nascent hydrogen?

Why molar concentration of pure solids and pure liquids is taken as unity

log of (x-1) to base [x] where [ ] is gif is ?

Is N2 a element?

The distance travelled by a body in the nth second is given by Sn= u+a/2(2n-1) where u is initial velocity and a is acceleration. The dimensional formula of Sn is

Find the equivalent weight of K2Cr2O2−7 in the given reaction, if the molar mass of Cr2O2−7 is 'M' ? K2Cr2O2−7H+→Cr3+

52 What is the main product of chlorination of 2-Methylbutane ? 1) 2-Chloro-3-methylbutane 2) 2-Chloro-2-methylbutane 3) 1-Chloro-3-methylbutane 4) 1-Chloro-2-methylbutane

Convert ethanol to propanal

What is the difference between semi metal and metalloid

Two half reactions for the following equation are: 4H2SO4+K2Cr2O7+3Na2SO3⟶Cr2(SO4)3+K2SO4+3Na2SO4+4H2O

Structure and hybridisation of Si(CH)3 is 1.bent,sp 2.trigonal,sp2 3.octahedral,sp3d 4.tetrahedral,sp3

Can 1s orbital combine with 2s orbital to form sigma bond...This is asked in ncert exercise question no. 29 (d).... the given answer is yes...But a/c to me it shouldn't combine due to difference in energy.. Plz solve my doubt

The boiling point of 0.001 M aqueous solutions of NaCl, Na2SO4, K3PO4 and CH3COOH should follows the order

CH2=CHCH2CH=CH2NBS−−−→ A, A is:

Mention four factors that affect nucleophilicity.

The total number of atomic orbitals in fourth energy level of an atom is

3. What is the position of tetrahedral void in ccp?