Explore topic-wise InterviewSolutions in Current Affairs.

This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.

1.

Which electronic configuration of an element has abnormally high difference between 2nd and 3rd I.E.?

Answer»

Which electronic configuration of an element has abnormally high difference between 2nd and 3rd I.E.?



2.

Always there is a confusion between dividend and divisor. Clear this confusion.

Answer» Always there is a confusion between dividend and divisor. Clear this confusion.
3.

3.5 g of a mixture of NaOH and KOH was dissolved to form a solution and is made up to 250 ml. 25 mL of this solution was completely neutralised by 17 mL of N2 HCl solution. Then, the percentage of KOH in the mixture is:

Answer» 3.5 g of a mixture of NaOH and KOH was dissolved to form a solution and is made up to 250 ml. 25 mL of this solution was completely neutralised by 17 mL of N2 HCl solution. Then, the percentage of KOH in the mixture is:
4.

In a sample electron jumps from 5th excited state to ground state then no of spectral lines in visible range and Uv rays are?

Answer» In a sample electron jumps from 5th excited state to ground state then no of spectral lines in visible range and Uv rays are?
5.

At 300K and 1 atm, 15 mL of a gaseous hydrocarbon requires 375 mL air containing 20% O2 by volume for complete combustion. After combustion, the gases occupy 330 mL. Assuming that the water formed is in liquid form and the volumes were measured at the same temperature and pressure. The formula of the hydrocarbon is :

Answer»

At 300K and 1 atm, 15 mL of a gaseous hydrocarbon requires 375 mL air containing 20% O2 by volume for complete combustion. After combustion, the gases occupy 330 mL. Assuming that the water formed is in liquid form and the volumes were measured at the same temperature and pressure. The formula of the hydrocarbon is :

6.

2qcos(alpha) + 2q = p2then prove that p2 = 4qcos2(alpha/2)

Answer» 2qcos(alpha) + 2q = p2
then prove that p2 = 4qcos2(alpha/2)
7.

oxidation state of nitrogen in H bond N dative bond C is

Answer» oxidation state of nitrogen in H bond N dative bond C is
8.

Why say in BRAVAIS LATTICES,FACE CENTRED CUBIC the face centred atom surrounded by only two units ?

Answer» Why say in BRAVAIS LATTICES,FACE CENTRED CUBIC the face centred atom surrounded by only two units ?
9.

ntWhat is the molality of c2h5oh in water solution which will freeze at -10 degree celcius ?molecular weight of c2h5oh =46,kf of water=1.86n

Answer» ntWhat is the molality of c2h5oh in water solution which will freeze at -10 degree celcius ?molecular weight of c2h5oh =46,kf of water=1.86n
10.

the molarity of a 0.2N Na2CO3 solution will be

Answer» the molarity of a 0.2N Na2CO3 solution will be
11.

The complete combustion of CH4 gives

Answer» The complete combustion of CH4 gives
12.

Why is HCOOH mor acidic than C6H5COOH? Benzene is an EWG. So it's supposed to possess more acidity. But that isn't the case. Why?

Answer» Why is HCOOH mor acidic than C6H5COOH? Benzene is an EWG. So it's supposed to possess more acidity. But that isn't the case. Why?
13.

HNO2 acts as both reductant & oxidant, while HNO3 acts as only Oxidant. It due to their

Answer» HNO2 acts as both reductant & oxidant, while HNO3 acts as only Oxidant. It due to their
14.

The boiling point elevation constant (Kb) of water is 0.52 K kg mol−1. The boiling point of 0.1 m aq. solution of urea is:

Answer»

The boiling point elevation constant (Kb) of water is 0.52 K kg mol1. The boiling point of 0.1 m aq. solution of urea is:

15.

In which of the following, oxygen is in +2 oxidation state?

Answer»

In which of the following, oxygen is in +2 oxidation state?

16.

Why borosilicate glass is used to store medicines?

Answer» Why borosilicate glass is used to store medicines?
17.

In the modern periodic table, the period indicates the value of

Answer»

In the modern periodic table, the period indicates the value of



18.

4. Xenon crystallises in the face-centred cubic lattice and the edge length of the unit cell is 620 pm. The next nearest neighbour distance for the xenon is Options: 738.5 pm 620 pm 438.5 pm 310 pm

Answer» 4. Xenon crystallises in the face-centred cubic lattice and the edge length of the unit cell is 620 pm. The next nearest neighbour distance for the xenon is Options: 738.5 pm 620 pm 438.5 pm 310 pm
19.

There are three solids made up of aluminium, steel and wood, of the same shape and same volume. Which of them would have highest inertia?

Answer» There are three solids made up of aluminium, steel and wood, of the same shape and same volume. Which of them would have highest inertia?
20.

With diagrams show the structural difference between Freon-12 and DDT.

Answer» With diagrams show the structural difference between Freon-12 and DDT.
21.

A solution of 2.5 g of a non - volatile solid in 100 g benzene is boiled at 0.42 K higher than the boiling point of pure benzene. Calculate the molar mass of the substance. Molal elevation constant of benzene is 2.67 K kg mol−1

Answer»

A solution of 2.5 g of a non - volatile solid in 100 g benzene is boiled at 0.42 K higher than the boiling point of pure benzene. Calculate the molar mass of the substance. Molal elevation constant of benzene is 2.67 K kg mol1


22.

Short distance between octahedral void and tetrehedral in cubic close packing

Answer» Short distance between octahedral void and tetrehedral in cubic close packing
23.

When nucleus of an electrically neutral atom undergoes a radioactive decay process, it will remain neutral after the decay if the process is

Answer» When nucleus of an electrically neutral atom undergoes a radioactive decay process, it will remain neutral after the decay if the process is
24.

What is meaning of charge density and also hydrogen bonding betn N and Cl

Answer» What is meaning of charge density and also hydrogen bonding betn N and Cl
25.

common name of 3-oxobutanal??

Answer» common name of 3-oxobutanal??
26.

Vapourpressure of water at 293 Kis 17.535 mm Hg. Calculate thevapour pressure of water at 293 Kwhen 25 g of glucose is dissolved in450 g of water.

Answer»

Vapour
pressure of water at 293 Kis 17.535 mm Hg. Calculate the
vapour pressure of water at 293 Kwhen 25 g of glucose is dissolved in
450 g of water.

27.

How many moles of P4 can be produced by the reaction of 0.10 moles Ca5(PO4)3F,0.36 moles SiO2, and 0.90 moles C according to the following reaction? Ca5(PO4)3F+18SiO2+30C→3P4+2CaF2+18CaSiO3+30CO

Answer»

How many moles of P4 can be produced by the reaction of 0.10 moles Ca5(PO4)3F,0.36 moles SiO2, and 0.90 moles C according to the following reaction? Ca5(PO4)3F+18SiO2+30C3P4+2CaF2+18CaSiO3+30CO

28.

what are alicyclic compounds

Answer» what are alicyclic compounds
29.

All the process of calculation of volume - strength of H2O2

Answer» All the process of calculation of volume - strength of H2O2
30.

In beta decay, an electron, e− (or a positron, e+) is emitted by a nucleus. What happens to the atom, among the following options?

Answer»

In beta decay, an electron, e (or a positron, e+) is emitted by a nucleus. What happens to the atom, among the following options?


31.

24. In the reaction , Y --------> Z Delta H = + 100 Kcal/mol Z ---------> X , Delta H = - 80 Kcal/mol Rank the enthalpies of formation of X , Y, and Z in increasing order Options : 1- Y < X < Z 2- Y < Z < X 3- X < Z < Y 4- X < Y < Z

Answer» 24. In the reaction , Y --------> Z Delta H = + 100 Kcal/mol Z ---------> X , Delta H = - 80 Kcal/mol Rank the enthalpies of formation of X , Y, and Z in increasing order Options : 1- Y < X < Z 2- Y < Z < X 3- X < Z < Y 4- X < Y < Z
32.

23. What is the oxidation number of (Fe(H2O)5NO)SO4 ?

Answer» 23. What is the oxidation number of (Fe(H2O)5NO)SO4 ?
33.

What is the basic theme of the organization in the periodic table?

Answer»

What is the basic theme of the organization in the periodic table?

34.

Ethyl chloride (C2H5Cl), is prepared by reaction of ethylene with hydrogen chloride :C2H4(g)+HCl(g)→C2H5Cl(g) ΔH=−72.3kJ. What is the value of ΔE (in KJ), if 70g of ethylene and 73g of HCl are allowed to react at 300K?

Answer»

Ethyl chloride (C2H5Cl), is prepared by reaction of ethylene with hydrogen chloride :


C2H4(g)+HCl(g)C2H5Cl(g) ΔH=72.3kJ. What is the value of ΔE (in KJ), if 70g of ethylene and 73g of HCl are allowed to react at 300K?



35.

Ozonolysis of alkenes gives ozonide which gives aldehydes and/or ketones. When a stream of O3 is passed through a solution of alkene in an inert solvent at low temperature the molecule adds up to form ozonide. This ozonide is unstable and easily decompose either by reduction or hydrolysis and forms compound having. This&gt;C=O is known as ozonolysis. Product P is

Answer»

Ozonolysis of alkenes gives ozonide which gives aldehydes and/or ketones. When a stream of O3 is passed through a solution of alkene in an inert solvent at low temperature the molecule adds up to form ozonide. This ozonide is unstable and easily decompose either by reduction or hydrolysis and forms compound having. This>C=O is known as ozonolysis.

Product P is


36.

(a) Name the method used for removing gangue from sulphide ores. (b) How is wrought iron different from steel?

Answer» (a) Name the method used for removing gangue from sulphide ores.
(b) How is wrought iron different from steel?
37.

What are the different oxidation states exhibited by the lanthanoids?

Answer»

What are
the different oxidation states exhibited by the lanthanoids?

38.

Whatis meant by the term bond order? Calculate the bond order of: N2,O2,and.

Answer»

What
is meant by the term bond order? Calculate the bond order of: N
2,
O
2,
and
.

39.

The correct option for free expansion of an ideal gas under adiabatic condition is:

Answer»

The correct option for free expansion of an ideal gas under adiabatic condition is:

40.

The group number, number of valence electrons and valency of an element with atomic number 15, respectively, are:

Answer»

The group number, number of valence electrons and valency of an element with atomic number 15, respectively, are:

41.

Order of negative electron gain enthalpy of group 16 elements

Answer» Order of negative electron gain enthalpy of group 16 elements
42.

Find the degree of unsaturation for the following compound:

Answer»

Find the degree of unsaturation for the following compound:

43.

Calculate the osmotic pressure of 0.01 M solution of KCl having degree of disociation of 80% at 27∘C

Answer»

Calculate the osmotic pressure of 0.01 M solution of KCl having degree of disociation of 80% at 27C

44.

0.7 g of Na2Co3 .XH2O were dissolved in water and the volume was made to 100mL , 20 mL of this solution required 19.8 mL of N/10 HCl for complete neutralisation, the value of 'x' is A) 7 B) 3 C) 2 D) 5

Answer»

0.7 g of Na2Co3 .XH2O were dissolved in water and the volume was made to 100mL , 20 mL of this solution required 19.8 mL of N/10 HCl for complete neutralisation, the value of 'x' is

A) 7

B) 3

C) 2

D) 5

45.

ThepH of 0.005M codeine (C18H21NO3)solution is 9.95. Calculate its ionization constant and pKb.

Answer»

The
pH of 0.005M codeine (C18H21NO3)
solution is 9.95. Calculate its ionization constant and pKb.

46.

The molecular weight of product S is

Answer» The molecular weight of product S is

47.

what are the structures of following: a CaCl2. 2H2O b..CuSO4.5H2O c.FeSO4.7H2O d Na2SO4.10H2O

Answer» what are the structures of following:
a CaCl2. 2H2O
b..CuSO4.5H2O
c.FeSO4.7H2O
d Na2SO4.10H2O
48.

What is sphincter ?

Answer» What is sphincter ?
49.

why CO2 is not a reducing agent

Answer» why CO2 is not a reducing agent
50.

The enthalpy change for the reaction of 50 mlof ethylene with 50.0 mL of H, at 1.5 atm.pressure is AH= -0.31 KJ. What is the AU?(1) -0.3024 KJ(3) -0.2852 KJ(2) -0.3214 KJ4) -20.84 KJ

Answer» The enthalpy change for the reaction of 50 mlof ethylene with 50.0 mL of H, at 1.5 atm.pressure is AH= -0.31 KJ. What is the AU?(1) -0.3024 KJ(3) -0.2852 KJ(2) -0.3214 KJ4) -20.84 KJ