Explore topic-wise InterviewSolutions in Current Affairs.

This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.

1.

Which of the following is always negative for exothermic reaction?

Answer» Which of the following is always negative for exothermic reaction?
2.

Comercially available concentrated HCL contains 38% HCL by mass. i . What is molarity of the solution.(d=1.19ml). ii . What volume of conc. HCL is required to make 1L of 0.1 M HCL.

Answer»

Comercially available concentrated HCL contains 38% HCL by mass.

i . What is molarity of the solution.(d=1.19ml).

ii . What volume of conc. HCL is required to make 1L of 0.1 M HCL.

3.

A patient is given sucrose intravenously. Her venous pressure is 18 mm Hg, and the elevation difference between the intravenous needle and sucrose bottle is 0.80 m. If the rate of sucrose flow is to be 2.0 mL/min, what should the diameter of the 4.0- cm-long needle be? Assume the sucrose has the same viscosity and density as blood.

Answer» A patient is given sucrose intravenously. Her venous pressure is 18 mm Hg, and the elevation difference between the intravenous needle and sucrose bottle is 0.80 m. If the rate of sucrose flow is to be 2.0 mL/min, what should the diameter of the 4.0- cm-long needle be? Assume the sucrose has the same viscosity and density as blood.
4.

17. How many nodal points and nodal planes are present in d_z^2 and why

Answer» 17. How many nodal points and nodal planes are present in d_z^2 and why
5.

What is the packing efficiency(formula)of a bcc lattice ?

Answer» What is the packing efficiency(formula)of a bcc lattice ?
6.

phenol associates in Benzene to a certain extent in dimerization reaction .A solution containing 0.02 kg of phenol in 1 kg of Benzene has its freezing point depression 0.69K hence degree of association of phenol dimerised will be

Answer» phenol associates in Benzene to a certain extent in dimerization reaction .A solution containing 0.02 kg of phenol in 1 kg of Benzene has its freezing point depression 0.69K hence degree of association of phenol dimerised will be
7.

A spherical balloon of radius 3 cm containing helium gas has a pressure of 48×10−3 bar. At the same temperature, the pressure of a spherical balloon of radius 12 cm containing the same amount of gas will be ×10−6 bar.

Answer» A spherical balloon of radius 3 cm containing helium gas has a pressure of 48×103 bar. At the same temperature, the pressure of a spherical balloon of radius 12 cm containing the same amount of gas will be ×106 bar.
8.

In which of the following reactions, N2(g) is not formed in the product?[0.77 Mark]

Answer»

In which of the following reactions, N2(g) is not formed in the product?

[0.77 Mark]

9.

What is the coordination entity formed when excess of aqueous KCNis added to an aqueous solution of copper sulphate? Why is it that noprecipitate of copper sulphide is obtained when H2S(g) ispassed through this solution?

Answer»

What is the coordination entity formed when excess of aqueous KCN
is added to an aqueous solution of copper sulphate? Why is it that no
precipitate of copper sulphide is obtained when H2S(g) is
passed through this solution?

10.

An X-ray tube is operated at 1.24 million volt. The shortest wavelength of the produced photon will be:

Answer»

An X-ray tube is operated at 1.24 million volt. The shortest wavelength of the produced photon will be:

11.

bring out the role of calcium ions and ATP in muscle contraction

Answer» bring out the role of calcium ions and ATP in muscle contraction
12.

21. for the equilibrium reaction CH3-CH2-CH2-CH3 (g) --------- isobutane (g) . if the value of Kc is 3.0 the percentage by mass of iso butane in the equilibrium mixture would be 1 75% 2 90% 3 30% 4 60%

Answer» 21. for the equilibrium reaction CH3-CH2-CH2-CH3 (g) --------- isobutane (g) . if the value of Kc is 3.0 the percentage by mass of iso butane in the equilibrium mixture would be 1 75% 2 90% 3 30% 4 60%
13.

For an ideal gas, consider only P-V work in going from an initial state X to the final state Z. The final state Z can be reached by either of the two paths shown in the figure. Which of the following choices is (are) correct? [Take △S as change in entropy and w as work done].

Answer»

For an ideal gas, consider only P-V work in going from an initial state X to the final state Z. The final state Z can be reached by either of the two paths shown in the figure. Which of the following choices is (are) correct?
[Take S as change in entropy and w as work done].

14.

what is woiff kishwar reaction?

Answer» what is woiff kishwar reaction?
15.

The correct order of radii is

Answer»

The correct order of radii is



16.

if hydration enthalpy is measured in terms of no of water molecules surrounding the ion in the solution. then why is lithium heavily hydrated when small size of ion can surround only few water molecules ?

Answer» if hydration enthalpy is measured in terms of no of water molecules surrounding the ion in the solution. then why is lithium heavily hydrated when small size of ion can surround only few water molecules ?
17.

If f:A-->B and g:B-->C are onto functions then show that gof is an onto function.

Answer» If f:A-->B and g:B-->C are onto functions then show that gof is an onto function.
18.

Which of the following products is formed when PCl3 is hydrolyzed with H2O?

Answer»

Which of the following products is formed when PCl3 is hydrolyzed with H2O?

19.

For reaction A→B, rate constant of reaction at 27∘C is 1.2×10−3 Ms−1. The only correct graph for the reaction is,

Answer»

For reaction AB, rate constant of reaction at 27C is 1.2×103 Ms1. The only correct graph for the reaction is,

20.

The volume of oxygen at STP required to burn 2.4 g of carbon completely is

Answer»

The volume of oxygen at STP required to burn 2.4 g of carbon completely is



21.

strength in volumes of a solution containing 30.36 g/L of H202 i

Answer» strength in volumes of a solution containing 30.36 g/L of H202 i
22.

ntNH3 gas is passed into water yielding a solution of density 0.93g/cc and containing 18.6% NH3 by weight . The mass of NH3 by weight. The mass of NH3 per cc of solution is =?n

Answer» ntNH3 gas is passed into water yielding a solution of density 0.93g/cc and containing 18.6% NH3 by weight . The mass of NH3 by weight. The mass of NH3 per cc of solution is =?n
23.

A+SOCl2 → B+SO2+HCl X+Na→C+H2 B+C→(C2H5)2O+NaCl Then A and X respectively are

Answer»

A+SOCl2 B+SO2+HCl
X+NaC+H2
B+C(C2H5)2O+NaCl

Then A and X respectively are


24.

Which one of the following species does not exist under normal condition 1)Li_{2 } 2)B{e^+}_3 3)Be_2 4)B_2

Answer» Which one of the following species does not exist under normal condition 1)Li_{2 } 2)B{e^+}_3 3)Be_2 4)B_2
25.

There are 576 boys and 448 girls in a school that are to be divided into equal sections of either boys or girls alone. Find the total no. Of sections thus formed?

Answer» There are 576 boys and 448 girls in a school that are to be divided into equal sections of either boys or girls alone. Find the total no. Of sections thus formed?
26.

Why does Venus rotate from east to west?

Answer» Why does Venus rotate from east to west?
27.

Consider the following reactions.If X and Y are only monochlorinated product(s), then (X + Y) will be:

Answer» Consider the following reactions.



If X and Y are only monochlorinated product(s), then (X + Y) will be:
28.

How will you bringabout the following conversions in not more than two steps?(i) Propanoneto Propene (ii) Benzoicacid to Benzaldehyde(iii) Ethanolto 3-Hydroxybutanal (iv) Benzene tom-Nitroacetophenone(v) Benzaldehydeto Benzophenone (vi) Bromobenzeneto 1-Phenylethanol(vii) Benzaldehydeto 3-Phenylpropan-1-ol (viii) Benazaldehyde to α-Hydroxyphenylaceticacid(ix) Benzoicacid to m-Nitrobenzyl alcohol

Answer»

How will you bring
about the following conversions in not more than two steps?


(i) Propanone
to Propene


(ii) Benzoic
acid to Benzaldehyde


(iii) Ethanol
to 3-Hydroxybutanal


(iv) Benzene to
m-Nitroacetophenone


(v) Benzaldehyde
to Benzophenone


(vi) Bromobenzene
to 1-Phenylethanol


(vii) Benzaldehyde
to 3-Phenylpropan-1-ol


(viii)
Benazaldehyde to α-Hydroxyphenylacetic
acid


(ix) Benzoic
acid to m-
Nitrobenzyl alcohol

29.

What is the dihedral angle in eclipsed conformation of ethane molecule?

Answer»

What is the dihedral angle in eclipsed conformation of ethane molecule?

30.

For the following compounds, write structural formulas and IUPAC names for all possible isomers having the number of double or triple bond as indicated: (a)C4H8 (one double bond) (b)C5H8 (one triple bond)

Answer»

For the following compounds, write structural formulas and IUPAC names for all possible isomers having the number of double or triple bond as indicated:
(a)C4H8 (one double bond)

(b)C5H8 (one triple bond)

31.

Identify the correct order of flocculation value for Fe(OH)3 sol:

Answer»

Identify the correct order of flocculation value for Fe(OH)3 sol:

32.

what is the product when ethoxy-1-methyl bu†an e is treated with excess HI.with mechanism

Answer» what is the product when ethoxy-1-methyl bu†an e is treated with excess HI.with mechanism
33.

After ozonolysis of an alkene, we get mixture of 2−methylpropanal, glyoxal and formaldehyde. What is the alkene taken here?

Answer»

After ozonolysis of an alkene, we get mixture of 2methylpropanal, glyoxal and formaldehyde. What is the alkene taken here?

34.

"Calgon" is used to remove permanent hardness of water. If the molecular formula of calgon is NaxPyOz, then what is the value of y+z−x?

Answer» "Calgon" is used to remove permanent hardness of water. If the molecular formula of calgon is NaxPyOz, then what is the value of y+zx?


35.

11.What is the general configuration of f orbital.

Answer» 11.What is the general configuration of f orbital.
36.

Theequilibrium constant for the following reaction is 1.6 ×105at 1024 K.Findthe equilibrium pressure of all gases if 10.0 bar of HBr isintroduced into a sealed container at 1024 K.

Answer»

The
equilibrium constant for the following reaction is 1.6 ×105
at 1024 K.



Find
the equilibrium pressure of all gases if 10.0 bar of HBr is
introduced into a sealed container at 1024 K.

37.

claculate th molarity of ethyle acohole in a solution of total voulume 95ml preapared by adding 50 ml of ethyle acohole desity is 0.789ml^-

Answer» claculate th molarity of ethyle acohole in a solution of total voulume 95ml preapared by adding 50 ml of ethyle acohole desity is 0.789ml^-
38.

1. How many unit cells are present in 5.0 gram of crystal AB ( formula mass of AB=40) having rock salt type?

Answer» 1. How many unit cells are present in 5.0 gram of crystal AB ( formula mass of AB=40) having rock salt type?
39.

Which of the following ion has the maximum value of magnetic moment?

Answer»

Which of the following ion has the maximum value of magnetic moment?

40.

there are how many max.number of components in which a vector can be resolve

Answer» there are how many max.number of components in which a vector can be resolve
41.

At normal temperature and pressure the number of molecules per cubicmeter of Benzine gas is 2.79 x 10 and the mean free path of their molecules is 2.2 \ast10 to the power - m. Find the diameter of a Benzine molecule.(B) 4.057 A(A) 6.057 A(D) 2.057 Å(C) 8.057 Å

Answer» At normal temperature and pressure the number of molecules per cubicmeter of Benzine gas is 2.79 x 10 and the mean free path of their molecules is 2.2 \ast10 to the power - m. Find the diameter of a Benzine molecule.(B) 4.057 A(A) 6.057 A(D) 2.057 Å(C) 8.057 Å
42.

Calculate, the ΔGo at 85 oC for the reaction: Fe2O3(s)+3H2(g)→2Fe(s)+3H2O The data are: ΔHo298=−35 kJ/mol ΔSo358=0.095 kJmol−1K−1 Substance Fe2O3(s) Fe(s) H2O(l) H2(g) Cop (JK−1mol−1) 103 25 75 29

Answer»

Calculate, the ΔGo at 85 oC for the reaction:
Fe2O3(s)+3H2(g)2Fe(s)+3H2O
The data are: ΔHo298=35 kJ/mol
ΔSo358=0.095 kJmol1K1
Substance Fe2O3(s) Fe(s) H2O(l) H2(g)
Cop (JK1mol1) 103 25 75 29

43.

The co-ordination number of metal crystallizing in a hexagonal close packed structure is

Answer»

The co-ordination number of metal crystallizing in a hexagonal close packed structure is


44.

Calculate the mass percentage of solution if 11 g of oxalic acid are dissolved in 500 mL.

Answer»

Calculate the mass percentage of solution if 11 g of oxalic acid are dissolved in 500 mL.

45.

Define variable valency.

Answer» Define variable valency.
46.

The correct order of the enol content of x, y and z is:

Answer»
The correct order of the enol content of x, y and z is:
47.

The reaction of heated graphite with superheated steam is endothermic; C (graphite)+H2 O(g)→CO g)+H2 (g) 1 The heat required for this reaction is provided by burning part of the graphite; C (graphite)+O2 (g)→CO2 (g);△H∘(500K)=−393.7 kJmol−1 2. If 1.34 mole of graphite is required for production of 1 mole of Hydrogen at 500 K. What is △H∘(500K) for reaction (1) ?

Answer»

The reaction of heated graphite with superheated steam is endothermic;
C (graphite)+H2 O(g)CO g)+H2 (g) 1
The heat required for this reaction is provided by burning part of the graphite;
C (graphite)+O2 (g)CO2 (g);H(500K)=393.7 kJmol1 2.
If 1.34 mole of graphite is required for production of 1 mole of Hydrogen at 500 K.
What is H(500K) for reaction (1) ?

48.

What is the product of the following SN2 reaction?

Answer»

What is the product of the following SN2 reaction?



49.

The edge length of a body-centre cubic unit cell is 390 pm. If the radius of the cation is 150 pm, what is the radius of the anion?

Answer»

The edge length of a body-centre cubic unit cell is 390 pm. If the radius of the cation is 150 pm, what is the radius of the anion?

50.

Q Calculate the weight of CO having the same number of oxygen atoms as are pesent in 22g of Carbon di oxide.

Answer» Q Calculate the weight of CO having the same number of oxygen atoms as are pesent in 22g of Carbon di oxide.