Explore topic-wise InterviewSolutions in Current Affairs.

This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.

1.

24.A cubical vessel of height 1 m is full of water.What is the amount of work done in pumping water out of the vessel?(take g=10m/sec^2)

Answer» 24.A cubical vessel of height 1 m is full of water.What is the amount of work done in pumping water out of the vessel?(take g=10m/sec^2)
2.

Eectrons involved when 1 mole h2o2 changes to

Answer» Eectrons involved when 1 mole h2o2 changes to
3.

11.A radioactive element disintegrates for a time interval equal to its mean life. Find the fraction that has disintegrated ?

Answer» 11.A radioactive element disintegrates for a time interval equal to its mean life. Find the fraction that has disintegrated ?
4.

The electronic configuration of an element is 2, 8, 4. Which group will the element belong to?

Answer»

The electronic configuration of an element is 2, 8, 4. Which group will the element belong to?



5.

An organic compound containing C and H gave the following analysis: C=52%,H=13% and the remaining, oxygen. Its empirical formula would be:

Answer»

An organic compound containing C and H gave the following analysis: C=52%,H=13% and the remaining, oxygen. Its empirical formula would be:

6.

Why glass rod get positive charge on rubbing with silk cloth and ebonite rod get negative charge on rubbing with fur not other charges

Answer» Why glass rod get positive charge on rubbing with silk cloth and ebonite rod get negative charge on rubbing with fur not other charges
7.

76. How many enolizable H are there in 2-methyl cyclohex-2-en-1-one?

Answer» 76. How many enolizable H are there in 2-methyl cyclohex-2-en-1-one?
8.

25. In (PO4)3- ion ,the formal charge on each O2 atom and P-O bond order respectively are 1)-0.75,0.6 2)-0.75,1.0 3)-0.75,1.25 4)-3,1.25

Answer» 25. In (PO4)3- ion ,the formal charge on each O2 atom and P-O bond order respectively are 1)-0.75,0.6 2)-0.75,1.0 3)-0.75,1.25 4)-3,1.25
9.

The ratio of pure and hybrid orbitals of H2C=CH_CH=CH2

Answer» The ratio of pure and hybrid orbitals of H2C=CH_CH=CH2
10.

If alpha and beta (alpha

Answer» If alpha and beta (alpha
11.

what volume ofCCl_4 contain 6.02×10^2 CCl_4 molecules

Answer» what volume ofCCl_4 contain 6.02×10^2 CCl_4 molecules
12.

If the sequence of bases in DNA is TACCGACCA, then the sequence of codons on the mRNA transcript will be

Answer»

If the sequence of bases in DNA is TACCGACCA, then the sequence of codons on the mRNA transcript will be

13.

No/2 atoms of X(g) are converted into X+(g)+ by energy E1, No/2 atoms of Xg are converted into X−(g) by energy E2. Hence ionization potential and electron affinity of X(g) per atom are

Answer»

No/2 atoms of X(g) are converted into X+(g)+ by energy E1, No/2 atoms of Xg are converted into X(g) by energy E2. Hence ionization potential and electron affinity of X(g) per atom are


14.

Have you ever observed any water pollution in your area? What measures would you suggest to control it?

Answer»

Have you ever observed any water pollution in your area? What measures would you suggest to control it?

15.

no of atoms per unit cell if atoms are placed at the corner of the unit cell and 2 atoms at each body diagonal a)9 b)10 c)6 d)4

Answer» no of atoms per unit cell if atoms are placed at the corner of the unit cell and 2 atoms at each body diagonal a)9 b)10 c)6 d)4
16.

How many moles of MgIn2S4 can be made from 1g each of mg, In, and S? (Atomic mass: Mg =24, In = 114.8, S = 32)

Answer»

How many moles of MgIn2S4 can be made from 1g each of mg, In, and S? (Atomic mass: Mg =24, In = 114.8, S = 32)

17.

An element crystallises in face-centred cubic lattice with density as 5 g/cm3 and edge length of the side of unit cell is 400 pm. Take NA=6×1023 Then the molar mass of the element in g mol−1 is :

Answer» An element crystallises in face-centred cubic lattice with density as 5 g/cm3 and edge length of the side of unit cell is 400 pm.

Take NA=6×1023 Then the molar mass of the element in g mol1 is :
18.

Element X and Y have common oxidation states as −3,+1 respectively. The most common compound formed by X and Y is:

Answer»

Element X and Y have common oxidation states as 3,+1 respectively. The most common compound formed by X and Y is:

19.

Dimerisation of NO_2 is an exothermic reaction. If enthalpy of reaction is deltaH, then the minimum value of activation energy for forward reaction will be?

Answer» Dimerisation of NO_2 is an exothermic reaction. If enthalpy of reaction is deltaH, then the minimum value of activation energy for forward reaction will be?
20.

8. What is the maximum wavelength line in Lyman series of He+ atom? a 3R b. 1/3R c. 4/4R. d. None

Answer» 8. What is the maximum wavelength line in Lyman series of He+ atom? a 3R b. 1/3R c. 4/4R. d. None
21.

Molecular mass of H2SO4

Answer»

Molecular mass of H2SO4

22.

The relation between Vant Hoff factor (1) and the degree of dissociation ( α ) for a weak electrolite given by formula AxBy is:

Answer»

The relation between Vant Hoff factor (1) and the degree of dissociation ( α ) for a weak electrolite given by formula AxBy is:


23.

Why degree of hydrolysis of hexafluorides increases from top to bottom

Answer» Why degree of hydrolysis of hexafluorides increases from top to bottom
24.

16. If the standard electrode potential of Cu2+/Cu is .34V, what is the electrode potential of .1M conc of Cu2+?

Answer» 16. If the standard electrode potential of Cu2+/Cu is .34V, what is the electrode potential of .1M conc of Cu2+?
25.

Four solutions of NH4Cl are taken with concentrations 1 M, 0.1 M, 0.01 M and 0.001 M. Their degree of hydrolysis are h1,h2,h3 and h4. What is the decreasing order of degree of hydrolysis ?

Answer»

Four solutions of NH4Cl are taken with concentrations 1 M, 0.1 M, 0.01 M and 0.001 M. Their degree of hydrolysis are h1,h2,h3 and h4. What is the decreasing order of degree of hydrolysis ?

26.

Zn2+(aq)+2e→Zn(s). This is

Answer» Zn2+(aq)+2eZn(s). This is
27.

The difference between heats of reaction at constant pressure and constant volume for the reaction2C_6H_6(I) + 15O_2(g)--→ 12CO_2(g) + 6H_20(l) at 25^0C in KJ is :-

Answer» The difference between heats of reaction at constant pressure and constant volume for the reaction2C_6H_6(I) + 15O_2(g)--→ 12CO_2(g) + 6H_20(l) at 25^0C in KJ is :-
28.

Which of the following reactions is incorrectly written?

Answer»

Which of the following reactions is incorrectly written?

29.

Henry's constant for Argon is 40K bar in water. Determine molal concentration of Argon in water when it is stored above water at 10 bar pressure.

Answer» Henry's constant for Argon is 40K bar in water. Determine molal concentration of Argon in water when it is stored above water at 10 bar pressure.
30.

The hydrogen electrode is dipped in a solution of pH=3 at 25∘C. The potential of the cell would be (the value of 2.303 RTFis 0.059 V

Answer»

The hydrogen electrode is dipped in a solution of pH=3 at 25C. The potential of the cell would be (the value of 2.303 RTFis 0.059 V

31.

A current of 9.65 ampere is passed through the aqueous solution NaCl using suitable electrodes for 1000 s . The amount of NaOH formed during electrolysis is :

Answer»

A current of 9.65 ampere is passed through the aqueous solution NaCl using suitable electrodes for 1000 s . The amount of NaOH formed during electrolysis is :


32.

The IUPAC Name for the compoundCH3−CH=CH−CH2−C||O−CH2−COOH is

Answer»

The IUPAC Name for the compound


CH3CH=CHCH2C||OCH2COOH is



33.

The number of H+ ions in 1 cc of a solution, having pH = 13, is

Answer»

The number of H+ ions in 1 cc of a solution, having pH = 13, is



34.

Which of the following is the most stable product of the following reaction?

Answer»

Which of the following is the most stable product of the following reaction?


35.

What ismeant by the term ‘broad spectrum antibiotics’? Explain.

Answer»

What is
meant by the term ‘broad spectrum antibiotics’? Explain.

36.

arrange in order of increasing electronegativity H,F,Al,O

Answer»

arrange in order of increasing electronegativity

H,F,Al,O

37.

Which of the following are the products formed on heating CuSO4.5H2O (s)?

Answer»

Which of the following are the products formed on heating CuSO4.5H2O (s)?



38.

6.10 g metal carbonate on heating produces 5.6 gram of metal oxide,then equivalent weight of metal carbonate is?

Answer» 6.10 g metal carbonate on heating produces 5.6 gram of metal oxide,then equivalent weight of metal carbonate is?
39.

whichoxidationstateis more stable in Ga+3or +1?

Answer» whichoxidationstateis more stable in Ga+3or +1?
40.

For the complete combustion of ethanol, C2H5OH(l)+3O2(g)→2CO2(g)+3H2O(l), the amount of heat produced as measured in bomb calorimeter, is 1364.47 kJ mol−1 at 25∘C. Assuming ideality the enthalpy of combustion, ΔcH, for the reaction will be (R=8.314 Jk−1mol−1)

Answer»

For the complete combustion of ethanol, C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l), the amount of heat produced as measured in bomb calorimeter, is 1364.47 kJ mol1 at 25C. Assuming ideality the enthalpy of combustion, ΔcH, for the reaction will be (R=8.314 Jk1mol1)


41.

x=asec0 y=btan0 then b^2x^2 - a^2y^2=

Answer» x=asec0 y=btan0 then b^2x^2 - a^2y^2=
42.

30. Which orbital overlap is strongest? 2p,-2p, overlap 2s- 2s overlap sp -2p p,-p,overlap

Answer» 30. Which orbital overlap is strongest? 2p,-2p, overlap 2s- 2s overlap sp -2p p,-p,overlap
43.

ntDifference between Octahedral Void and Tetrahedral void ?n

Answer» ntDifference between Octahedral Void and Tetrahedral void ?n
44.

24.Why do phosphorus posses 3 n 5 as its valency

Answer» 24.Why do phosphorus posses 3 n 5 as its valency
45.

If internal energy of ortho hydrogen is greater than para hydrogen then how ortho hydrogen is more stable than para hydrogen?

Answer» If internal energy of ortho hydrogen is greater than para hydrogen then how ortho hydrogen is more stable than para hydrogen?
46.

Which of the following methods isused for sol destruction[CPMT 1988]

Answer»

Which of the following methods is
used for sol destruction


[CPMT 1988]


47.

Which of the following compound on treatment with LiAlH4 will give a product that will give positive iodoform test?

Answer»

Which of the following compound on treatment with LiAlH4 will give a product that will give positive iodoform test?

48.

The hybridisation of atomic orbitals of nitrogen in NO2+, NO3− and NH4+ are:

Answer»

The hybridisation of atomic orbitals of nitrogen in NO2+, NO3 and NH4+ are:



49.

The relation between ΔE and ΔH is

Answer» The relation between ΔE and ΔH is
50.

57. An ideal gas mixture of ethane C_2H_6 and ethene C_2H_4 occupies 28 litre at 1 atm and 0 degree celcius. The mixture completely reacts with 128 gm O_2 to produce CO_2 and H_2O. Mole fraction at C_2H_6 in the mixture is

Answer» 57. An ideal gas mixture of ethane C_2H_6 and ethene C_2H_4 occupies 28 litre at 1 atm and 0 degree celcius. The mixture completely reacts with 128 gm O_2 to produce CO_2 and H_2O. Mole fraction at C_2H_6 in the mixture is