Explore topic-wise InterviewSolutions in Current Affairs.

This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.

1.

Among the given free radical bromination reactions, the reaction(s) in which 3∘ halide is a major product is /are :

Answer»

Among the given free radical bromination reactions, the reaction(s) in which 3 halide is a major product is /are :

2.

If radiation corresponding to second line of "Balmer series" of Li2+ ion, knocked out electron from first excited state of H− atom then kinetic energy of ejected electron would be:

Answer»

If radiation corresponding to second line of "Balmer series" of Li2+ ion, knocked out electron from first excited state of H atom then kinetic energy of ejected electron would be:

3.

Copper is purified by electrolytic refining of blister copper. The incorrect statement about this process is:

Answer»

Copper is purified by electrolytic refining of blister copper. The incorrect statement about this process is:


4.

What are KMnO4 and sodium chloride?

Answer» What are KMnO4 and sodium chloride?
5.

When the following aldohexose exists in its D-configuration, the total number of stereoisomers in its pyranose form is (numeral) ___ CHO|CH2|CHOH|CHOH|CHOH|CH2OH

Answer»

When the following aldohexose exists in its D-configuration, the total number of stereoisomers in its pyranose form is (numeral) ___

CHO|CH2|CHOH|CHOH|CHOH|CH2OH

6.

The root mean square velocity of hydrogen is √5 times than that of nitrogen. If T is the temperature of the gas, then:

Answer»

The root mean square velocity of hydrogen is 5 times than that of nitrogen. If T is the temperature of the gas, then:

7.

A gas that follows Boyle's law, Charle's law and Avogadro's law is called an ideal gas. Under what conditions a real gas would behave ideally?

Answer»

A gas that follows Boyle's law, Charle's law and Avogadro's law is called an ideal gas. Under what conditions a real gas would behave ideally?

8.

Solubility of an ionic compound in water is mainly dependent on: a. Lattice enthalpy b. Hydration enthalpy Both these factors oppose each other, and the resultant of these factors determines the solubility of an ionic compound in water. If the lattice enthalpy has a larger value, the compound is less soluble. If the hydration enthalpy has larger value, the compound is highly soluble in water. Which of the following is more soluble in water?

Answer»

Solubility of an ionic compound in water is mainly dependent on:
a. Lattice enthalpy
b. Hydration enthalpy
Both these factors oppose each other, and the resultant of these factors determines the solubility of an ionic compound in water. If the lattice enthalpy has a larger value, the compound is less soluble. If the hydration enthalpy has larger value, the compound is highly soluble in water.

Which of the following is more soluble in water?

9.

The following pictures represent various silicate anions. Their formulae are respectively:

Answer»

The following pictures represent various silicate anions.

Their formulae are respectively:


10.

an Alkoxide ion is a stronger base than a hydroxide ion. Why?

Answer»

an Alkoxide ion is a stronger base than a hydroxide ion. Why?

11.

Why polar molecules have dipole moment and non-polar molecules do not have dipole moment?

Answer» Why polar molecules have dipole moment and non-polar molecules do not have dipole moment?
12.

For the equilibrium, NH2COONH4(s)⇌2NH3(g)+CO2(g), the partial pressure of carbon-di-oxide (pCO2)=1 atm at 100 ∘C. The value of equilibrium constant (in atm) is:

Answer» For the equilibrium,
NH2COONH4(s)2NH3(g)+CO2(g),
the partial pressure of carbon-di-oxide (pCO2)=1 atm at 100 C.
The value of equilibrium constant (in atm) is:
13.

Redox reaction involves transfer of electrons between 2 chemical species. An unbalanced and incomplete example is shown below: N2+H3PO2→HN3+P4O6 If the above reaction were possible in either direction, maximum equivalent weight would belong to:

Answer»

Redox reaction involves transfer of electrons between 2 chemical species. An unbalanced and incomplete example is shown below:
N2+H3PO2HN3+P4O6

If the above reaction were possible in either direction, maximum equivalent weight would belong to:

14.

Identify the major products ‘P’, ‘Q’ and ‘R’ in the following sequence of reactions:

Answer»

Identify the major products ‘P’, ‘Q’ and ‘R’ in the following sequence of reactions:

15.

The increasing order of the atomic radii of the following elements is: A. C B. O C. F D. Cl E. Br

Answer»

The increasing order of the atomic radii of the following elements is:
A. C
B. O
C. F
D. Cl
E. Br

16.

Pick out the personal pronoun from the sentence. He was infamous for playing pranks on everyone.

Answer»

Pick out the personal pronoun from the sentence.

He was infamous for playing pranks on everyone.


17.

What is the position of F with respect to B in the above arrangement?

Answer»

What is the position of F with respect to B in the above arrangement?


18.

Given y=x2. As x→2,y→4 what is the value of δ be for which from |x−2|<δ it follows that |y−4|< ∈ =0.001?

Answer»

Given y=x2. As x2,y4 what is the value of δ be for which from |x2|<δ it follows that |y4|< =0.001?

19.

Which ore is malachite among the following?

Answer»

Which ore is malachite among the following?

20.

The ratio of mean value over one half cycle to the rms value of a.c. of complete cycle

Answer»

The ratio of mean value over one half cycle to the rms value of a.c. of complete cycle


21.

Products for the given reaction. Me3C−O−CH2CH3+HI1 moleΔ⟶

Answer»

Products for the given reaction.
Me3COCH2CH3+HI1 moleΔ

22.

Central Water Commission shows that water levels in major reservoirs of the country are alarmingly low. Consider the following statements: Which of the above statement(s) is/are correct?

Answer»

Central Water Commission shows that water levels in major reservoirs of the country are alarmingly low. Consider the following statements:

Which of the above statement(s) is/are correct?
23.

Give electron dot structure for ethanoic acid CH3COOH.

Answer» Give electron dot structure for ethanoic acid CH3COOH.
24.

0.75 g of oleum sample was diluted with water. If the solution required 62.5 mL of 0.25 N NaOH, the % of free SO3 in the sample will be:

Answer» 0.75 g of oleum sample was diluted with water. If the solution required 62.5 mL of 0.25 N NaOH, the % of free SO3 in the sample will be:
25.

How many moles of HIO4 are consumed by sucrose?

Answer»

How many moles of HIO4 are consumed by sucrose?


26.

How to determine the strength of neuclophiles and electrophiles in a reaction mechanism.

Answer»

How to determine the strength of neuclophiles and electrophiles in a reaction mechanism.

27.

Why doesn't d2sp hybridisation take place? Please explain in detail!

Answer»

Why doesn't d2sp hybridisation take place? Please explain in detail!

28.

Which of the following complexes has highest stability constant at 298 K?

Answer»

Which of the following complexes has highest stability constant at 298 K?


29.

The Compound that doesnot contain a primary carbon is

Answer»

The Compound that doesnot contain a primary carbon is

30.

On a large scale, ammonia is manufactured by:

Answer»

On a large scale, ammonia is manufactured by:


31.

x = moles of HCHO consumed. Value of (x) will be

Answer»
x = moles of HCHO consumed. Value of (x) will be
32.

(i) Name the method used for the refining of zirconium. (ii) What is the role of CO in the extraction of Iron ? (iii) Reduction of metal oxide to metal becomes easier if the metal obtained is in liquid state. Why ?

Answer» (i) Name the method used for the refining of zirconium.

(ii) What is the role of CO in the extraction of Iron ?

(iii) Reduction of metal oxide to metal becomes easier if the metal obtained is in liquid state. Why ?
33.

How many of given cations are more stable than H2C=CH−⊕CH2?

Answer»
How many of given cations are more stable than H2C=CHCH2?

34.

Stockholm Convention on Persistent Organic Pollutants is an international environmental treaty aims to eliminate or restrict the production and use of persistent organic pollutants. Endosulfan became a highly controversial agrichemical and has been banned under the Stockholm Convention because:

Answer»

Stockholm Convention on Persistent Organic Pollutants is an international environmental treaty aims to eliminate or restrict the production and use of persistent organic pollutants. Endosulfan became a highly controversial agrichemical and has been banned under the Stockholm Convention because:


35.

How hyperconjugation decreases the heat of hydrogenation and how heat of hydrogeation is to do with the stability of alkenes. Please give a detailed explanation.

Answer» How hyperconjugation decreases the heat of hydrogenation and how heat of hydrogeation is to do with the stability of alkenes. Please give a detailed explanation.
36.

In the transport of CO2 from the tissues to the lungs which of the following occurs in the venous blood? A) conversion of CO2 and H2O to H+ and HCO3-- in the RBC'S B) Buffering of H+ by oxy haemoglobin C) Shifting of HCO3-- into the RBC'S from plasma in exchange for Cl- D)Alkalinization of RBC's

Answer»

In the transport of CO2 from the tissues to the lungs which of the following occurs in the venous blood?

A) conversion of CO2 and H2O to H+ and HCO3-- in the RBC'S

B) Buffering of H+ by oxy haemoglobin

C) Shifting of HCO3-- into the RBC'S from plasma in exchange for Cl-

D)Alkalinization of RBC's

37.

Which of the following compounds would not evolve CO2 when treated with NaHCO3 ?

Answer»

Which of the following compounds would not evolve CO2 when treated with NaHCO3 ?


38.

p-V plots for two gases during adiabatic processes are shown in the following figure. Plots 1 and 2 should correspond respectively to

Answer»

p-V plots for two gases during adiabatic processes are shown in the following figure. Plots 1 and 2 should correspond respectively to


39.

Which of the following forms a colloidal solution in water?

Answer»

Which of the following forms a colloidal solution in water?


40.

Why ancient glass becomes milky?

Answer»

Why ancient glass becomes milky?


41.

If Pauli's exclusion principle was not known, the electronic configuration of Lithium atom would be:

Answer»

If Pauli's exclusion principle was not known, the electronic configuration of Lithium atom would be:

42.

ΔG∘ for the reaction x + y ⇌ z is −4.606 kcal. The value of equilibrium constant of the reaction at 227∘C is

Answer»

ΔG for the reaction x + y z is 4.606 kcal. The value of equilibrium constant of the reaction at 227C is


43.

As atomic orbitals are filled according to the Aufbau principle, the 6s orbitals are filled immediately after which of the following orbitals?

Answer»

As atomic orbitals are filled according to the Aufbau principle, the 6s orbitals are filled immediately after which of the following orbitals?


44.

If the equilibrium constant of the reaction 2HI ⇌ H2 + I2 is 0.25, then the equilibrium constant of the reaction H2 + I2 ⇌ 2HI would be

Answer»

If the equilibrium constant of the reaction 2HI H2 + I2 is 0.25, then the

equilibrium constant of the reaction H2 + I2 2HI would be


45.

If P0 and P are the vapour pressure of a solvent and its solution respectively and N1 and N2 are the mole fractions of the solvent and solute respectively, then correct relation is

Answer»

If P0 and P are the vapour pressure of a solvent and its solution respectively and N1 and N2 are the mole fractions of the solvent and solute respectively, then correct relation is


46.

Which of the following is a stable free radical?

Answer»

Which of the following is a stable free radical?


47.

Ford elementary reaction M ------&gt; N (M gives N), the rate of disappearance of M is increased by factor of 8 upon doubling the concentration of M. the order of the reaction with respect to M is: A) 4 B)3 C)2 D)1 [ Doubt: what does order of reaction mean. ]

Answer»

Ford elementary reaction M ------> N (M gives N), the rate of disappearance of M is increased by factor of 8 upon doubling the concentration of M. the order of the reaction with respect to M is:

A) 4

B)3

C)2

D)1

[ Doubt: what does order of reaction mean. ]

48.

What is the concentration of NO3- ions when equal volume of 0.1M AgNO3 and 0.1M NaCl are mixed together?

Answer»

What is the concentration of NO3- ions when equal volume of 0.1M AgNO3 and 0.1M NaCl are mixed together?

49.

What is the chief product obtained when n-butane is treated with bromine in the presence of light at 130∘C

Answer»

What is the chief product obtained when n-butane is treated with bromine in the presence of light at 130C


50.

Which of the following reactions will give optically inactive alcohol(s)?

Answer»

Which of the following reactions will give optically inactive alcohol(s)?