This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
Discuss the nature of bonding in the following coordination entities on the basis of valence bond theory: [Fe(CN6)]4− [FeF6]3− [Co(C2O4)3]3− [CoF6]3− |
|
Answer» Discuss the nature of bonding in the following coordination entities on the basis of valence bond theory: [FeF6]3− [Co(C2O4)3]3− [CoF6]3− |
|
| 2. |
Why is red phosphorus less reactive than white phosphorus? |
| Answer» Why is red phosphorus less reactive than white phosphorus? | |
| 3. |
Which of the following statement(s) is/are correct regarding inter-halogen compounds of ABx types? |
|
Answer» Which of the following statement(s) is/are correct regarding inter-halogen compounds of ABx types? |
|
| 4. |
Graphite cannot be classified as .............. (a) conducting solid (b) network solid (c) covalent solid (d) lonic solid |
|
Answer» Graphite cannot be classified as .............. (a) conducting solid (b) network solid (c) covalent solid (d) lonic solid |
|
| 5. |
Given: N2 (g)+3H2 (g)⇌2NH3 (g); K1 N2 (g)+O2 (g)⇌2NO (g); K2 H2 (g)+12O2 (g)⇌H2O (g); K3 where K1,K2,K3 are equilibrium constants. The equilibrium constant for the reaction, 2NH3 (g)+52O2 (g)⇌2NO (g)+3H2O (g) will be: |
|
Answer» Given: |
|
| 6. |
Arrange the following carbanions in decreasing order of stability. |
|
Answer» Arrange the following carbanions in decreasing order of stability. |
|
| 7. |
Predict the products of electrolysis in each of the following: An aqueous solution of AgNO3 with silver electrodes Predict the products of electrolysis in each of the following: An aqueous solution AgNO3 with platinum electrodes Predict the products of electrolysis in each of the following; A dilute solution of H2SO4 with platinum electrodes. Predict the products of electrolysis in each of the following: An aqeuous solution of CuCl2 with platinum electrodes. |
|
Answer» Predict the products of electrolysis in each of the following: Predict the products of electrolysis in each of the following: Predict the products of electrolysis in each of the following; Predict the products of electrolysis in each of the following: |
|
| 8. |
The mass to charge ratio (m/e) for a univalent cation is 1.5 × 10−8 Kg/c. Find mass of the atom. |
|
Answer» The mass to charge ratio (m/e) for a univalent cation is 1.5 × 10−8 Kg/c. Find mass of the atom. |
|
| 9. |
Give reasons for the following: (a) Red phosphorus is less reactive than white phosphorus. (b) Electron gain enthalpies of halogens are largely negative. (c) N2O5 is more acidic than N2O3 |
|
Answer» Give reasons for the following: (a) Red phosphorus is less reactive than white phosphorus. (b) Electron gain enthalpies of halogens are largely negative. (c) N2O5 is more acidic than N2O3 |
|
| 10. |
The main product of the following reaction C6H5CH2CH(OH)CH(CH3)2Conc. H2SO4−−−−−−−−→? |
|
Answer» The main product of the following reaction C6H5CH2CH(OH)CH(CH3)2Conc. H2SO4−−−−−−−−→? |
|
| 11. |
The correct order of hybridization of the central atoms in the following species XeF2,XeF+3,XeF4,XeF6 |
|
Answer» The correct order of hybridization of the central atoms in the following species XeF2,XeF+3,XeF4,XeF6 |
|
| 12. |
The de-Broglie wavelength of a particle with mass 1gm and velocity 100m/sec is |
|
Answer» The de-Broglie wavelength of a particle with mass 1gm and velocity 100m/sec is |
|
| 13. |
6.85 g of hydrated Sr (OH)2 .XH2O was heated to give anhydrous mass of weight 3.13 g. The value of X is |
| Answer» 6.85 g of hydrated Sr (OH)2 .XH2O was heated to give anhydrous mass of weight 3.13 g. The value of X is | |
| 14. |
Which of the following are iso-electronic and iso-structural? NO−3, CO2−3, ClO−3, SO3 |
|
Answer» Which of the following are iso-electronic and iso-structural? NO−3, CO2−3, ClO−3, SO3 |
|
| 15. |
Explain why reactivity of lithium with water is less vigorous than sodium |
|
Answer» Explain why reactivity of lithium with water is less vigorous than sodium |
|
| 16. |
Q1) Ministry of Water Resources, River Development and Ganga Rejuvenation launched a nationwide water campaign “Jal Kranti Abhiyan”. Consider the following statements: 1) It is to consolidate water conservation and management in the country. 2) The activities under the scheme will be carried out exclusively by central government 3) New funds will be allocated for expenditure on various works proposed under the scheme 4) It will enhance livelihood security through reliable availability of acceptable quantity and quality of water in rural areas Which of the above statements are correct? |
|
Answer» Q1) Ministry of Water Resources, River Development and Ganga Rejuvenation launched a nationwide water campaign “Jal Kranti Abhiyan”. Consider the following statements: 1) It is to consolidate water conservation and management in the country. 2) The activities under the scheme will be carried out exclusively by central government 3) New funds will be allocated for expenditure on various works proposed under the scheme 4) It will enhance livelihood security through reliable availability of acceptable quantity and quality of water in rural areas Which of the above statements are correct? |
|
| 17. |
No. Of orbitals in s, p, d, f, |
| Answer» No. Of orbitals in s, p, d, f, | |
| 18. |
Why splitting of proton into neutron and neutron takes place in nucleus during radioactive decay |
| Answer» Why splitting of proton into neutron and neutron takes place in nucleus during radioactive decay | |
| 19. |
Which of the following sets contain only isoelectronic ions? (i) Zn2+,Ca2+,Ga3+,Al3+ (ii) K+,Ca2+,Sc3+,Cl− (iii) P3−,S2−,Cl−,K+ (iv) Ti4+,Ar,Cr3+,v5+ |
|
Answer» Which of the following sets contain only isoelectronic ions? (ii) K+,Ca2+,Sc3+,Cl− (iii) P3−,S2−,Cl−,K+ (iv) Ti4+,Ar,Cr3+,v5+ |
|
| 20. |
Pick the odd pair out. |
|
Answer» Pick the odd pair out. |
|
| 21. |
The average life of an excited state of hydrogen atom is of the order of 108s. The number of revolutions made by an electron when it is in state n = 2 and before it suffers a transition to state n = 1, are |
|
Answer» The average life of an excited state of hydrogen atom is of the order of 108s. The number of revolutions made by an electron when it is in state n = 2 and before it suffers a transition to state n = 1, are |
|
| 22. |
An unknown compound gives a positive iodoform test and positive Fehling's test. The compound is: |
|
Answer» An unknown compound gives a positive iodoform test and positive Fehling's test. The compound is:
|
|
| 23. |
The alkene which on ozonolysis gives only acetone is: |
|
Answer» The alkene which on ozonolysis gives only acetone is: |
|
| 24. |
IUPAC name of Na3[Co(NO2)6] is: |
|
Answer» IUPAC name of Na3[Co(NO2)6] is: |
|
| 25. |
Which of the following is formed by Finkelstein Reaction? |
|
Answer» Which of the following is formed by Finkelstein Reaction? |
|
| 26. |
n – Propyl bromide reacts with ethanolic KOH to form |
|
Answer» n – Propyl bromide reacts with ethanolic KOH to form |
|
| 27. |
Does propionic acid give iodoform test? |
|
Answer» Does propionic acid give iodoform test? |
|
| 28. |
In the given anions, the strongest Bronsted base is: |
|
Answer» In the given anions, the strongest Bronsted base is: |
|
| 29. |
NiCl2+KCN(excess)→A(cyano complex) NiCl2+conc.HCl(excess)→B(Chloro complex) The hybridisation of A and B are: |
|
Answer» NiCl2+KCN(excess)→A(cyano complex) NiCl2+conc.HCl(excess)→B(Chloro complex) The hybridisation of A and B are: |
|
| 30. |
Partial pressures of A,B,C and D on the basis of gaseous system A + 2B ⇌ C + 3D are A = 0.20;B = 0.10;C = 0.30 and D = 0.50 atm. The numerical value of equilibrium constant is |
|
Answer» Partial pressures of A,B,C and D on the basis of gaseous system A + 2B ⇌ C + 3D are A = 0.20;B = 0.10;C = 0.30 and D = 0.50 atm. The numerical value of equilibrium constant is |
|
| 31. |
Ethanol is prepared industrially by [MP PMT 1989] |
|
Answer» Ethanol is prepared industrially by [MP PMT 1989] |
|
| 32. |
A mixture of C6H5CHO and HCHO is treated with NaOH, then the Cannizzaro’s reaction involves: |
|
Answer» A mixture of C6H5CHO and HCHO is treated with NaOH, then the Cannizzaro’s reaction involves: |
|
| 33. |
What transition in the hydrogen spectrum would have the same wavelength as the Balmer transition n = 4 to n = 2 of He+ spectrum? |
|
Answer» What transition in the hydrogen spectrum would have the same wavelength as the Balmer transition n = 4 to n = 2 of He+ spectrum? |
|
| 34. |
Which of the following pair(s) is/are functional isomer(s)? |
|
Answer» Which of the following pair(s) is/are functional isomer(s)? |
|
| 35. |
The correct order of +I strength for the following groups −CH3,−CH2R,−CD3 is : (Here R is any alkyl group ). |
|
Answer» The correct order of +I strength for the following groups |
|
| 36. |
Three footballs are respectively filled with nitrogen, hydrogen and helium. If the leaking of the gas occurs with time from the filling hole, then the ratio of the rate of leaking of gases (rN2:rH2:rHe) from three footballs (in equal time interval) is: |
|
Answer» Three footballs are respectively filled with nitrogen, hydrogen and helium. If the leaking of the gas occurs with time from the filling hole, then the ratio of the rate of leaking of gases (rN2:rH2:rHe) from three footballs (in equal time interval) is: |
|
| 37. |
The decomposition reaction, 4HNO3(g)⇌4NO2(g)+2H2O(g)+O2(g) is started with pure HNO3(g). If p is the total pressure at equilibrium, then |
|
Answer» The decomposition reaction, |
|
| 38. |
List-IList-II(I)Work function(P)Wavelength of photon usedless than threshold wavelength(II)Threshold frequency(Q)Photo intensity of light(III)Stopping potential(R)number of photons(IV)Photo current(S)Metal(T)Electron(U)Surface of liquid |
|
Answer» List-IList-II(I)Work function(P)Wavelength of photon usedless than threshold wavelength(II)Threshold frequency(Q)Photo intensity of light(III)Stopping potential(R)number of photons(IV)Photo current(S)Metal(T)Electron(U)Surface of liquid |
|
| 39. |
Which of the following is correct order of decreasing SN2 reactivity? |
|
Answer» Which of the following is correct order of decreasing SN2 reactivity? |
|
| 40. |
Welding of magnesium can be done in an atmosphere of- |
|
Answer» Welding of magnesium can be done in an atmosphere of- |
|
| 41. |
Ice is used in a cooler in order to cool its contents. Which of the following will speed up the cooling process? |
|
Answer» Ice is used in a cooler in order to cool its contents. Which of the following will speed up the cooling process? |
|
| 42. |
Is atomicity present in non-metals? |
| Answer» Is atomicity present in non-metals? | |
| 43. |
Which of the substances A, B and C has the lowest heat capacity, if heat is supplied to all of them at equal rates? The temperature versus time graph is shown: |
|
Answer» Which of the substances A, B and C has the lowest heat capacity, if heat is supplied to all of them at equal rates? The temperature versus time graph is shown:
|
|
| 44. |
How much faster would a reaction proceed at 25∘C than at 0∘C if the activation energy is 65 kJ? |
|
Answer» How much faster would a reaction proceed at 25∘C than at 0∘C if the activation energy is 65 kJ? |
|
| 45. |
Vapour pressure of a solution is: |
|
Answer» Vapour pressure of a solution is: |
|
| 46. |
The solubility product of Cr(OH)3 at 298 K is 6×10−31 . The concentration of hydroxide ions in a saturated solution of Cr(OH)3 will be: |
|
Answer» The solubility product of Cr(OH)3 at 298 K is 6×10−31 . The concentration of hydroxide ions in a saturated solution of Cr(OH)3 will be: |
|
| 47. |
Explain the effect of increasing the temperature of a liquid, on intermolecular forces operating between its particles. What will happen to the viscosity of a liquid if its temperature is increased? |
|
Answer» Explain the effect of increasing the temperature of a liquid, on intermolecular forces operating between its particles. What will happen to the viscosity of a liquid if its temperature is increased? |
|
| 48. |
The bond enthalpy of H2(g) is 436 kJ/mol and that of N2(g) is 941.3 kJ/mol. Calculate the average bond enthalpy of an N - H bond in ammonia. ΔH∘f(NH3)=−46 kJ/mol |
|
Answer» The bond enthalpy of H2(g) is 436 kJ/mol and that of N2(g) is 941.3 kJ/mol. Calculate the average bond enthalpy of an N - H bond in ammonia. |
|
| 49. |
The sodium salt of a certain weak monobasic organic acid is hydrolysed to an extent of 3% in its 0.1 M solution at 25∘C given that the ionic product of water is 10−14 at this temperature, what is the dissociation constant of the acid? |
|
Answer» The sodium salt of a certain weak monobasic organic acid is hydrolysed to an extent of 3% in its 0.1 M solution at 25∘C given that the ionic product of water is 10−14 at this temperature, what is the dissociation constant of the acid? |
|
| 50. |
If one mole of a monatomic gas (γ=53) is mixed with one mole of a diatomic gas (γ=75) the value of γ for the mixture is: |
|
Answer» If one mole of a monatomic gas (γ=53) is mixed with one mole of a diatomic gas (γ=75) the value of γ for the mixture is: |
|