This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
Shape of the molecule having dsp2 and d2sp3 hybridisation is respectively: |
|
Answer» Shape of the molecule having dsp2 and d2sp3 hybridisation is respectively: |
|
| 2. |
In the following reaction sequence, the correct structures of E, F and G are: |
|
Answer» In the following reaction sequence, the correct structures of E, F and G are: |
|
| 3. |
Which is the correct IUPAC name for (a) 1-bromo-2-ethylpropane (b) 1-bromo-2-ethyl-2-methylethane (c) 1-bromo-2-methylbutane (d) 2-methyl-1-bromobutane |
|
Answer» Which is the correct IUPAC name for (a) 1-bromo-2-ethylpropane (b) 1-bromo-2-ethyl-2-methylethane (c) 1-bromo-2-methylbutane (d) 2-methyl-1-bromobutane |
|
| 4. |
The most stable carbocation among the following is: |
|
Answer» The most stable carbocation among the following is: |
|
| 5. |
The van der Waal gas constant 'a' is given by which of the following relations? |
|
Answer» The van der Waal gas constant 'a' is given by which of the following relations? |
|
| 6. |
Question 11 In comparison to a 0.01 M solution of glucose, the depression in freezing point of a 0.01MMgCl2 solution is ........... . (a) the same (b) about twice (c) about three times (d) about six times |
|
Answer» Question 11 |
|
| 7. |
Name the following compounds according to IUPAC system of nomenclature : CH3CH(CH3)CH2CH2CHO CH3CH2COCH(C2H5)CH2CH2Cl CH3CH=CHCHO CH3COCH2COCH3 CH3CH(CH3)CH2C(CH3)2COCH3 (CH3)3CCH2COOH OHCC6H4CHO−p |
|
Answer» Name the following compounds according to IUPAC system of nomenclature : CH3CH(CH3)CH2CH2CHO CH3CH2COCH(C2H5)CH2CH2Cl CH3CH=CHCHO CH3COCH2COCH3 CH3CH(CH3)CH2C(CH3)2COCH3 (CH3)3CCH2COOH OHCC6H4CHO−p |
|
| 8. |
In a H atom, if 'x' is the radius of the first Bohr orbit, the de Broglie wavelength of an electron in the third Bohr orbit is |
|
Answer» In a H atom, if 'x' is the radius of the first Bohr orbit, the de Broglie wavelength of an electron in the third Bohr orbit is |
|
| 9. |
Which nomenclature is not according to IUPAC system? |
|
Answer» Which nomenclature is not according to IUPAC system? |
|
| 10. |
Gases X, Y, Z, P and Q have their van der Waals' constants ′a′ and ′b′ (in CGS units) as shown below: XYZPQa66200.0530b0.0250.150.10.020.2 The gas with the highest critical temperature is: |
|
Answer» Gases X, Y, Z, P and Q have their van der Waals' constants ′a′ and ′b′ (in CGS units) as shown below: |
|
| 11. |
Smoking addiction is harmful because it produces polycyclic aromatic hydrocarbons, which cause |
|
Answer» Smoking addiction is harmful because it produces polycyclic aromatic hydrocarbons, which cause |
|
| 12. |
The correct order of IP1 is |
|
Answer» The correct order of IP1 is |
|
| 13. |
Among the compounds I-IV, the compound having the lowest boiling point is |
|
Answer» Among the compounds I-IV, the compound having the lowest boiling point is
|
|
| 14. |
What were the names used to denote the existance of undiscovered elements such as gallium and germanium respectively? |
|
Answer» What were the names used to denote the existance of undiscovered elements such as gallium and germanium respectively? |
|
| 15. |
Number of bases stronger than C6H5O− among the following is: (a) p-Nitrophenolate, (b) CO2−3,(c) HCO−3, (d) H−(e) CH3O− |
|
Answer» Number of bases stronger than C6H5O− among the following is: |
|
| 16. |
Convert the following condensed structure into Bond-line structure. (CH3)2CHCH(CH3)2 |
|
Answer» Convert the following condensed structure into Bond-line structure. |
|
| 17. |
Which of the following species has the electronic configuration [Ar]3d5? |
|
Answer» Which of the following species has the electronic configuration [Ar]3d5? |
|
| 18. |
Acetic acid CH3COOH can form a dimer (CH3COOH)2 in the gas phase. The dimer is held together by two H - bonds with a total strength of 77.43 kJ per mol of dimer. If at 27∘C, the equilibrium constant for the dimerization is 1.096×103, then calculate the magnitude of ΔS∘ (in kJ) for the reaction: 2CH3COOH(g)⇌(CH3COOH)2(g) (Round upto 2 digits after decimal and ln(1.096×103)≈7 and R=8.3 JK−1mol−1) |
Answer» Acetic acid CH3COOH can form a dimer (CH3COOH)2 in the gas phase. The dimer is held together by two H - bonds with a total strength of 77.43 kJ per mol of dimer. If at 27∘C, the equilibrium constant for the dimerization is 1.096×103, then calculate the magnitude of ΔS∘ (in kJ) for the reaction:2CH3COOH(g)⇌(CH3COOH)2(g) (Round upto 2 digits after decimal and ln(1.096×103)≈7 and R=8.3 JK−1mol−1) |
|
| 19. |
State the drawbacks of Rutherford model of an atom. |
|
Answer» State the drawbacks of Rutherford model of an atom. |
|
| 20. |
In the following reactions, the product S is |
|
Answer» In the following reactions, the product S is |
|
| 21. |
Why carbon -12 isotope was chosen as a standard unit to measure atomic weight ? |
| Answer» Why carbon -12 isotope was chosen as a standard unit to measure atomic weight ? | |
| 22. |
Sort the following complexes according to their crystal field stabilization energy (CFSE) |
|
Answer» Sort the following complexes according to their crystal field stabilization energy (CFSE) |
|
| 23. |
At high pressure, van der Waal's equation for one mole of the gas becomes: |
|
Answer» At high pressure, van der Waal's equation for one mole of the gas becomes: |
|
| 24. |
2BF3(g)+6NaH180 oC−−−−→P(g)+Q(s) Find out maximum number of atom(s) that can lie in a plane of covalent molecule 'P'. |
|
Answer» 2BF3(g)+6NaH180 oC−−−−→P(g)+Q(s) Find out maximum number of atom(s) that can lie in a plane of covalent molecule 'P'. |
|
| 25. |
Which one of the following carbocation violates Bredt's rule? |
|
Answer» Which one of the following carbocation violates Bredt's rule? |
|
| 26. |
Which of the following compounds produce 1,5-cyclooctanedione on ozonolysis? |
|
Answer» Which of the following compounds produce 1,5-cyclooctanedione on ozonolysis? |
|
| 27. |
Jahn-Teller effect is not observed spin complexes of: |
|
Answer» Jahn-Teller effect is not observed spin complexes of: |
|
| 28. |
Gasoline is obtained from crude petroleum oil by |
|
Answer» Gasoline is obtained from crude petroleum oil by |
|
| 29. |
What is the difference between static and dynamic equilibrium? |
| Answer» What is the difference between static and dynamic equilibrium? | |
| 30. |
Azulene is isomer of Napthalene. It has 2 fused rings. It has aromatic nature due to ___ |
|
Answer» Azulene is isomer of Napthalene. It has 2 fused rings. It has aromatic nature due to |
|
| 31. |
LIST-ILIST-II(P) PCl3F2,PCl2F3(1)Hybridisation of central atom same, shape of molecule same, dipole moment same(Q) BF3,BCl3(2)Hybridisation of Central atom same, shape ofmolecule same, dipole moment same,isoelectronic species, used in fertiliserpreparation(R) CO2CN−22(3) Hybridisation of central atom same, shape ofmolecule same, dipole moment same,isoelectronic species, aromatic(S) C6H6,B3N3H6(4) Hybridisation of central atom same, shape ofmolecule same, but dipole moment different |
|
Answer» LIST-ILIST-II(P) PCl3F2,PCl2F3(1)Hybridisation of central atom same, shape of molecule same, dipole moment same(Q) BF3,BCl3(2)Hybridisation of Central atom same, shape ofmolecule same, dipole moment same,isoelectronic species, used in fertiliserpreparation(R) CO2CN−22(3) Hybridisation of central atom same, shape ofmolecule same, dipole moment same,isoelectronic species, aromatic(S) C6H6,B3N3H6(4) Hybridisation of central atom same, shape ofmolecule same, but dipole moment different |
|
| 32. |
Why alkyl iodide have higher boiling point than other alkyl group? |
|
Answer» Why alkyl iodide have higher boiling point than other alkyl group? |
|
| 33. |
The X -X bond length is 1.5 ∘A and Y - Y bond length is 2.54 ∘A. If electronegativities of 'X' and 'Y' are 3.5 and 2.0 respectively, the X - Y bond length is likely to be |
|
Answer» The X -X bond length is 1.5 ∘A and Y - Y bond length is 2.54 ∘A. If electronegativities of 'X' and 'Y' are 3.5 and 2.0 respectively, the X - Y bond length is likely to be |
|
| 34. |
During the corrosion of metals, oxygen absorbed at |
|
Answer» During the corrosion of metals, oxygen absorbed at |
|
| 35. |
A large value of equilibrium constant K shows that |
|
Answer» A large value of equilibrium constant K shows that |
|
| 36. |
In which pair, the stronger bond is formed in the first species~ I .O2, O2−1 II. N2,N2+ III.NO+, NO−1 |
|
Answer» In which pair, the stronger bond is formed in the first species~ I .O2, O2−1 II. N2,N2+ III.NO+, NO−1
|
|
| 37. |
The Lewis acid character of halides of boron are as follows: |
|
Answer» The Lewis acid character of halides of boron are as follows: |
|
| 38. |
How to memorize or guess colour of any compound? |
|
Answer» How to memorize or guess colour of any compound? |
|
| 39. |
Naturally occurring substance in the alkaloids of Papaver somniferum |
|
Answer» Naturally occurring substance in the alkaloids of Papaver somniferum |
|
| 40. |
The electronic configuration of chromium is: |
|
Answer» The electronic configuration of chromium is: |
|
| 41. |
The sketch shows the plot of Z vs P for 1 mole of a hypothetical gas at three distinct temperatures: Boyle's temperature is the temperature at which a gas shows ideal behaviour over a pressure range in the low pressure region. Boyle's temperature (Tb)=aRb. If a plot is obtained at temperatures well below Boyle's temperature, then the curve will show a negative deviation in the low pressure region and a positive deviation in the high pressure region. Which of the following is correct? |
|
Answer» The sketch shows the plot of Z vs P for 1 mole of a hypothetical gas at three distinct |
|
| 42. |
The stable conformer of cis-3-fluorocyclohexanol is: |
|
Answer» The stable conformer of cis-3-fluorocyclohexanol is: |
|
| 43. |
2× 108 atoms of carbon are arranged side by side. Calculate the radius of carbon atom if the length of this arrangement is 2.4 cm. |
|
Answer» 2× 108 atoms of carbon are arranged side by side. Calculate the radius of carbon atom if the length of this arrangement is 2.4 cm. |
|
| 44. |
Column -I Column-II A. 2s (P) n=4,l=2,m=0 B. 2pz (Q)n=4,l=2,m=−2 or +2 C. 4dx2−y2 (R) n=2,l=1,m=0 D. 4d2z (S) n=2,l=0,m=0 Match the column -I with column -II |
||||||||||
Answer»
|
|||||||||||
| 45. |
Example of electron deficient hydride is: |
|
Answer» Example of electron deficient hydride is: |
|
| 46. |
The order of the increasing acidity is as follows: |
|
Answer» The order of the increasing acidity is as follows: |
|
| 47. |
Consider the following equilibrium in a closed container: N2O4 (g) ⇋ 2NO2 (g) At a fixed temperature, the volume of the reaction container is halved. For this change, which of the following statements holds true regarding the equilibrium constant Kp and degree of dissociation α? |
|
Answer» Consider the following equilibrium in a closed container: N2O4 (g) ⇋ 2NO2 (g) At a fixed temperature, the volume of the reaction container is halved. For this change, which of the following statements holds true regarding the equilibrium constant Kp and degree of dissociation α? |
|
| 48. |
Why the law of triads not applicable in C,N,O? |
|
Answer» Why the law of triads not applicable in C,N,O? |
|
| 49. |
The diplo moment values of CO2 and BF3 is 0. Explain why |
|
Answer» The diplo moment values of CO2 and BF3 is 0. Explain why |
|
| 50. |
A fruit grower can use two types of fertilizer in his garden, brand P and brand Q. The amounts (in kg) of nitrogen, phosphoric acid, potash and chlorine in a bag of each brand are given in the table. Tests indicate that the garden needs atleast 240 kg of phosphoric acid, atleast 270 kg of potash and atmost 310 kg of chlorine. If the grower wants to maximize the amount of nitrogen added to the garden, how many bags of each brand should be added? What is the maximum amount of nitrogen added? Brand PBrand QNitrogen33.5Phosphoric acid12Potash31.5Chlorine1.52 |
|
Answer» A fruit grower can use two types of fertilizer in his garden, brand P and brand Q. The amounts (in kg) of nitrogen, phosphoric acid, potash and chlorine in a bag of each brand are given in the table. Tests indicate that the garden needs atleast 240 kg of phosphoric acid, atleast 270 kg of potash and atmost 310 kg of chlorine. If the grower wants to maximize the amount of nitrogen added to the garden, how many bags of each brand should be added? What is the maximum amount of nitrogen added? Brand PBrand QNitrogen33.5Phosphoric acid12Potash31.5Chlorine1.52 |
|