This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
International place value definition |
|
Answer» ong>Answer: In the International system of numeration, starting from RIGHT, the first PERIOD is ones, consisting of three place values (ones, tens, and HUNDREDS). The next period is thousands, consisting of three place values (ONE thousand, ten thousands, and hundred thousands) and then millions and after that billions. |
|
| 3. |
PQRST is a regular pentagon.Find the measures of angle a, angle b, angle c. |
|
Answer» ONG>ANSWER: gocxgixfifxifhvchcufuuvcuuv |
|
| 4. |
What is the predecessor and successor of 1000 |
|
Answer» ONG>ANSWER: PREDECESSOR is 999 successor is 1001 |
|
| 5. |
Can anyone please share the pic of monika capoor class 9th maths chapter 1 mcq |
|
Answer» ong>Answer: |
|
| 6. |
15 added to 3 times a number is equal to 3 added to 5 times the number. What is the number |
|
Answer» ONG>ANSWER:
|
|
| 7. |
Find : 125 rays to the power minus 1 upon 3 |
|
Answer» ONG>Answer: 1/5 is the CORRECT answer of this QUESTION. hope this will help you out |
|
| 8. |
(sin^3 θ+cos^3 θ)/(sinθ+cosθ) =? * |
|
Answer» ong>Answer: HEY mate!! Step-by-step EXPLANATION: here is UR answer Step By step... I hope it HELPS you... |
|
| 10. |
54 + ( - 3 ) + ( - 66 ) + 17 |
|
Answer» ONG>Answer: ANS... = 2 Step-by-step explanation: → = 54 – 3 – 66 + 17 = 51 – 66 + 17 = – 15 + 17 → = 2 |
|
| 11. |
Express each if the following s a fraction in tha simplest form.:0.55% |
|
Answer» ONG>Answer: 11/2000 Step-by-step EXPLANATION: .55% .55/100 55/100*100 11/2000 |
|
| 12. |
8 2 points1. Which one of these haslowest value ? *ग15339/-12949/-0026521/-12499/-Fridge0 Washing machineL.E.DAC |
| Answer» ONG>ANSWER: | |
| 13. |
A man bought an article for Rs 40 and sold it for 50 what is the profit percent |
|
Answer» ONG>Answer: 25% profit=SP -CP 50-40=10 10/40*100 25% |
|
| 14. |
Sum of 5th and 9th term is 30. if 25th term is 3 time of 18th term, find the sum of 20 term |
|
Answer» ong>Answer: |
|
| 15. |
If the C.P is 80 and the S.P is 120 than gain or loss persent |
|
Answer» ONG>ANSWER: Profit = SP-CP 120-80=40 profit percent =profit /CP*100 40/80*100=50 ANS=50% |
|
| 16. |
Is maths a happy number word ? Give reasons :- |
|
Answer» ong>ANSWER: are you SAYING world? Step-by-step explanation: ? |
|
| 17. |
On selling a book for Rs 810, Susilo gains 8%. For how much did he purchase it |
|
Answer» ONG>Answer: 750 LOOK in the piccccc |
|
| 18. |
Mark the point on XY-plane for different crops taking their products as its x-co-ordinate and yield as it's your co-ordinate |
Answer» ONG>ANSWER:please explain step by step explanationStep-by-step explanation: please my brain list tik please my brain list tik please my brain list tik |
|
| 20. |
Insert 10 rational number between 0 and -1 |
|
Answer» , -1/3, - 1/4, -1/5, - 2/5, -3/5, - 1/6, - 1/7, - 2/7, -3/7 |
|
| 21. |
If x = - 2 and x^2 + 2xy = - 5, then find the value of y |
| Answer» ONG>Step-by-step EXPLANATION: | |
| 22. |
If AB//CD Find x 4x and 5x. |
|
Answer» ONG>ANSWER: where is TRANSVERSAL LINE |
|
| 23. |
If the distance between the points (x,-1) and(3,2) is 5 then the value of x is -7 or -1 |
| Answer» ONG>ANSWER: | |
| 24. |
Is 294 and 256 are co Prime |
|
Answer» ong>ANSWER: yes 294 and 256 are co prime Step-by-step EXPLANATION: |
|
| 25. |
Two bus services A and B arrive at a station. Service A arrives at the station every 15 minutes; service B arrives at the station every 20 minutes. The first bus arrives at the station at 8:00 a.m. When will both buses arrive at the station again? * |
|
Answer» ONG>Answer: 30 mins Step-by-step EXPLANATION: |
|
| 27. |
The difference between the compound interest and the simple interest accrued on an amount of RS. 18000 in2 years was RS. 405. What was the rate of interest? |
|
Answer» ong>Step-by-step explanation: The difference between the compound INTEREST and the simple interest ACCRUED on an amount of RS. 18,000 in 2 YEARS was Rs. 405. ... The difference between the compound interest (compounding annually) and simple interest on a sum at the RATE of 12% per annum for 2 years is Rs 360. |
|
| 28. |
3. Find the missing angles of the following polygons. |
| Answer» ONG>Answer: | |
| 29. |
Evaluate :-2 tan sq. 45°+ cos²30° - sin² 60 ° |
|
Answer» ong>ANSWER: |
|
| 31. |
if one zero of the quadratic polynomial 2x2-3x+p is 3, find its other zero also find the value of p. |
|
Answer» ONG>Answer: 2(3)^2-3(3)+p=0 18-9+p=0 p=-9 |
|
| 32. |
Is 1/a²- 1/b² divisible by (a-b)??? |
|
Answer» align="absmiddle" ALT="\frac{\Big( \frac{1}{a^{2} }- \frac{1}{b^{2}}\Big) }{ (a-b) }" class="latex-formula" id="TexFormula1" src="https://tex.z-dn.net/?F=%20%5Cfrac%7B%5CBig%28%20%5Cfrac%7B1%7D%7Ba%5E%7B2%7D%20%7D-%20%5Cfrac%7B1%7D%7Bb%5E%7B2%7D%7D%5CBig%29%20%7D%7B%20%28a-b%29%20%7D%20" title="\frac{\Big( \frac{1}{a^{2} }- \frac{1}{b^{2}}\Big) }{ (a-b) }"> THEREFORE ., •••♪ |
|
| 33. |
If sec theta = 37/35 find sin theta [ theta is an acute angle] |
|
Answer» ONG>Step-by-step EXPLANATION: secA=37/35. cosA=35/37. sin²A+cos²=1. sinA=√1-cos²A => √1-(35/37)² => √1-1225/1369. => √1369-1225/1369 => √144/1369 sinA=12/37. |
|
| 34. |
The rate at which heat is conducted is called |
|
Answer» ong>Answer: The rate of heat flow is the amount of heat that is transferred per unit of time in some MATERIAL, usually measured in watt.Heat is the flow of thermal energy driven by thermal non-equilibrium, so that 'heat flow' is a redundancy.The total heat output of a reactor core is called the heat generation rate. The heat generation rate divided by the volume of FUEL will give the average volumetric thermal source strength.So the rate of heat transfer to an object is equal to the thermal conductivity of the material the object is made from, multiplied by the SURFACE area in contact, multiplied by the difference in temperature between the two objects, divided by the THICKNESS of the material. |
|
| 35. |
The difference of two integers is 15 . If one integer is -16, find the other integer |
| Answer» ONG>Answer: | |
| 36. |
Add 20 to the product of 7 and 5. |
|
Answer» ONG>ANSWER: so easy Step-by-step explanation: 20+35 55 answer |
|
| 37. |
Factor tree for 1740 |
|
Answer» er: Positive Integer factors of 1740 = 2, 4, 3, 12, 5, 60, 29, 1740 divided by 2, 2, 3, 5, 29, gives no remainder. They are integers and prime NUMBERS of 1740, they are also called composite number. Step-by-step EXPLANATION: ➡️plz follow me and THANK my answers dude❤ |
|
| 38. |
Prove that cos 55 degrees sin 35 degrees+sin 55 degrees cos 35 degrees=1 |
|
Answer» ONG>ANSWER: cos55°sin35°+sin55°cos35°=1 LHS cos55sin(90-55)+sin55cos(90-55) cos²55°+sin²55° 1 |
|
| 39. |
The area of a trapezium is 248 sq. m. If it's height 3m, find the sum of its parallel sides |
|
Answer» align="absmiddle" alt="\small \purple {\sf{quєѕtíσn !}}" class="latex-formula" ID="TexFormula1" src="https://tex.z-dn.net/?f=%5Csmall%20%5Cpurple%20%20%7B%5Csf%7Bqu%D1%94%D1%95t%C3%AD%CF%83n%20%21%7D%7D" title="\small \purple {\sf{quєѕtíσn !}}"> The area of a trapezium is 248 sq. m. If it's height 3m, find the sum of its parallel sides Area of a trapezium = 1/2 ( a + B) (h) where a and b are the length of the parallel sides and h, the height. Given area = 248 m², height = 8m and the LENGTHS of the parallel sides differ by 4 cm. |
|
| 40. |
-) If the price of an article which is 15,000 is reduced by 3%,then the new price is |
|
Answer» ong>ANSWER: $14,550 Step-by-step explanation: 15,000*0.03=450 15,000-450= 14,550 or 15,000*0.97=14,550
|
|
| 41. |
Hi guys ✌️❤️send me .. MCQ questions from traingle chapter |
|
Answer» ONG>ANSWER: if you want more I can GIVE you if you find this helpful than follow me dude and mark as BRAINLIST... |
|
| 42. |
Value of under root 3 to the power minus 2 |
| Answer» ONG>Step-by-step explanation: | |
| 43. |
Sin(O+30) + cos(O+60)= cos 0 |
|
Answer» 0 + 30 + cos 0 + 60 EQUAL to cos 0 MINS SIN 0 + 30 + 10 + 60 equal to cos 0 sin 0 + 30 + 50 + 60 equal to 90 cos 90 + 0 = 20 90 degree sin 90 equal to cos 9119 equal to 1 |
|
| 44. |
The complementary of an angle is thrice of it. find its angle |
|
Answer» ong>Answer: you MEAN compliment then it's compliment (90-x) according to the question : 90-3x=X then solve it your answer will COME |
|
| 45. |
Isosceles triangles ABC and A'B'C' are congruent with base BC and B'C' respectively. If C is represented by (2x + 10) and C' is represented by x + 30, then measure of C is a) 40b) 50c) 70d) 90... |
|
Answer» ong>ANSWER: #Red official Follow me for 50 POINT questions. There is 2x - 10 not 2x + 10 2x - 10 = x + 30 x = 40 |
|
| 46. |
INTEGRAL ZEROES OF THEPOLYNOMIAL (x+3) (x+7) IS |
|
Answer» ong>Answer: -3&-7 are the zeros of p(X). l hope this answer is HELPFUL for you ☺️ |
|
| 48. |
X2+x+1=0কে দুটি পূর্ণ বর্গ সংখ্যার অন্তররূপে প্রকাশ করো |
|
Answer» ong>Answer: mark as BRAINLIEST. CHECK image |
|
| 49. |
2010. ./=1 + f2.1-z1 + t2[Hint : Put 1 = tane). |
|
Answer» ong>Answer: |
|
| 50. |
. If - 15mn^p? is divided by = m*n*p. The _90n p4(b)quotient is-5(a)3m?-90(c)3т3(d) -90m3m т |
|
Answer» ONG>ANSWER: I am not UNDERSTANDING |
|