This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
Distance between the points ( am1² , 2am1 ) , ( am2² ,2am2 ) |
|
Answer» ong>Step-by-step explanation:P> Distance d between two POINTS P(a,b) and Q(c,d) is GIVEN by d=(a−c)2+(b−d)2 Given that : P(am12,2am1) Q(am22,2am2) Now APPLYING the the formula d=(am12−am22)2+(2am1−2am2)2 d=a(m12−m22)2+(2m1−2m2)2 d=a[(m1+m2)(m1−m2)]2+4(m1−m2)
HOPE IT HELPED U THANK U |
|
| 2. |
) Solve For x - a) For x- a) |x-1|+2| |
Answer» ONG>Answer:please MARK this BRAINLIEST please again I follow and like you |
|
| 3. |
24. Answer the following. i) Find the number of permutations of the letters of the word ‘HEBRON’ beginning with H and ending with N. ii) Find the ratio of permutation of ‘Rohit’ and ‘Virat’. |
|
Answer» ONG>Answer: 1)Herbon |
|
| 4. |
Prove that:- (1-sin a) (1/sec a + tan a) = sec a |
|
Answer» ONG>Answer: (1−sinA) (1+sinA)
× (1+sinA) (1+sinA)
= 1−sin A (1+sinA) 2
= 2 A (1+sinA) 2
= cosA 1+sinA
= cosA 1
+ cosA sinA
=secA+tanA Hence proved. |
|
| 5. |
Simplest form of ratio 133 is 76 |
|
Answer» ONG>ANSWER: Thus, 7/4 is the simplified fraction for 133/76 by using the GCD or HCF method. Thus, 7/4 is the simplified fraction for 133/76 by using the prime factorization method. Step-by-step explanation: HOPE it will help u. |
|
| 8. |
Write the coordinate of point whose coordinate is 4 and which lies on y-axis. |
|
Answer» ONG>ANSWER: AnypointwhichlieontheY−axishasthecoordinates (0,y)whenycantakeanyvalue. Herey=+4units. ∴Thecoordinatesofthepointis(0,4). |
|
| 9. |
40% of a class are women. The probability that a woman likes the color blue is 10%. What is the probability that a person chosen from the class likes blue given a woman is chosen? |
|
Answer» ONG>GIVEN : 40% of a class are women. The probability that a woman LIKES the color blue is 10% To Find : probability that a person chosen from the class likes blue given a woman is chosen? Solution: The probability that a woman likes the color blue is 10% probability that a person chosen from the class likes blue given a woman is chosen = 10 % = 0.1 ( as its given that women is chosen and probability that a woman likes the color blue is 10% ) if probability that a person chosen from the class likes blue = (40/100)(10/100) = 0.4 * 0.1 = -0.04 assuming that Men does not like blue color probability that a person chosen from the class likes blue given a woman is chosen = 10 % = 0.1 Learn More: A pair of fair dice is thrown independently four times. The probability ... A pair of dice is thrown together till a SUM of 4 or 8 is obtained. The ... |
|
| 10. |
Each side of a given square tile is 12 cm. How many tiles will be needed for tiling the floor of a room 18 m wide and 24 m long? |
|
Answer» ong>Answer: (12×12)x = 18×24 so, x=3 |
|
| 11. |
Q8) Make a colourful pie chart to represent the following information. Favourite SPORTS of class IV.SPORTSNumber of students.Hockey15Football30Cricket40Badminton5Basketball20 |
|
Answer» Step-by-step EXPLANATION: |
|
| 12. |
Preapre a fact file for the vocation/profession/business you would like to take up in future. 1)Name of the vocation/profession/business. 2)Educational qualifications required 3)Work profile/description. 4) Opportunities for advancement. 5)Your personal skills talents/of the choice. For doctor |
|
Answer» WER<U>: Step-by-step EXPLANATION: \huge\mathfrak\red[hello] |
|
| 13. |
The sum of the two opposite angles of a quadrilateral is 176° . The other two angles of the quadrilateral are equal. Find the equal angles. |
|
Answer» ong>ANSWER: As we know vertically opposite angles are equal Step-by-step EXPLANATION: So, X + x = 176 2x = 176 x = 88. |
|
| 14. |
Change the following into like terms : 90.21,65,29.5,6958 |
|
Answer» ONG>ANSWER: ok Step-by-step EXPLANATION: |
|
| 16. |
If a : b: c then its mean proportion will be |
|
Answer» ONG>Step-by-step EXPLANATION: Three numbers 'a', 'b' and 'c' are SAID to be continued proportion if a, b and c are in proportion. Continued-proportion is also known as mean PROPORTIONAL . If 'b' is a mean proportional between a and c then b 2 = ac. |
|
| 18. |
00:00 Nina buys a small rug that is in the shape of a kite as shown below. The width of the rug is half its height. Drag numbers to identify the width and the area of the rug. Numbers may be used once or not at all. A kite with height shown as the sum of thirty-one inches and nine inches |
|
Answer» ONG>Answer: 75 Step-by-step EXPLANATION: |
|
| 19. |
If ray OC stands on line AB such that angle AOC = angle BOC then show that angle BOC=90° |
| Answer» | |
| 20. |
पट सेतो निश्चित कीपि, किALMN75 m=13, n. 12ALMNसमकोण सिपनही LLM और PMकीअपार क्रमश Zm तयाय hindi me |
|
Answer» ONG>Answer: 10 Step-by-step EXPLANATION: |
|
| 21. |
X(x - 3) + 2, where x = 1 Please answer soon as possibleI will mark as brainlist answer who ywill answer correct answer |
|
Answer» ONG>Answer: 0 Step-by-step EXPLANATION: X(x-3)+2 x^2-3x+2 1^2-3(1)×2 1-3+2 0 |
|
| 22. |
Cos20-cos70/sin70-sin20 |
|
Answer» ONG>Step-by-step EXPLANATION: cos20-cos70/sin70-sin20 COS(90-20)-cos(90-20)/sin70-sin20 sin70-sin20/sin70-sin20 1 |
|
| 23. |
Simplify [7 - 2a + 5b - (a - b)] - (5a + 3b - 7) |
|
Answer» ong>Answer: 7 - 2A + 5B - a + b - 5a - 3b + 7 -3a -5a +6b -3b -8a +3b HOPE it is helpful |
|
| 24. |
(2:3), (5:6) कायौगिक अनुपात |
|
Answer» ONG>Answer: 10;18 Step-by-step EXPLANATION: |
|
| 25. |
Noteslf 2: y = 12:30 , Then what is the value |
|
Answer» ONG>Answer: 17: 14 Step-by-step explanation: |
|
| 26. |
Can anyone solve this and share the pic! 51.630×72.421 |
|
Answer» ong>Answer: see the ATTACHMENT Step-by-step EXPLANATION: HOPE it helps |
|
| 27. |
Find the value of 5. 3-7.-4 |
|
Answer» ONG>ANSWER: COMPLETE THE QUESTION Step-by-step EXPLANATION: |
|
| 28. |
The number of like term in abc,-bca,bac,cab is |
|
Answer» ER: Step-by-step EXPLANATION: |
|
| 29. |
(7a+ab) (7a-ab) what is the answer for this |
| Answer» ONG>Answer: | |
| 30. |
If an angels is one- third of its supplement then the measure of the angel |
|
Answer» ong>Answer: 60 Step-by-step explanation: |
|
| 31. |
Selling price of a toy car is Rs. 540. If the profit made by the shopkeeper is 20%,what is the cost price of this toy? |
|
Answer» ong>ANSWER: Answer , the COST price of toy is ₹450 |
|
| 32. |
Which is the fanasty game of india saloni you answer the wuestion |
|
Answer» ong>ANSWER: dream 11,my dream 11,halapalymy 11 circle,11wickets,MOBILE premier league Step-by-step explanation: I hope it is helpful for U |
|
| 33. |
How to write maths exam fast ? |
|
Answer» ong>Answer: 1.Be in the campus before exam timing: Be in the school/college campus before the exam timing to AVOID unnecessary stress. ... Read the question paper: As FIRST 15 minutes are to read question paper utilize it, read all the question. ... Solve as you PRIORITIZED: ... TIME management: ... Step-by-step explanation: |
|
| 34. |
Please review itout of 5 |
|
Answer» ER: 5 Step-by-step EXPLANATION: |
|
| 35. |
The universal set is the set of all integers. If its subsets A, B and C are given by: A = {x : x ≤ -1} B = {. . . , -3, -1, 1, 3, 5, . . .} C = {x : -5 ≤ x < 4} Find: a) A ∪ B b) A ∩ B c) C', where C' is the complement of C with respect to ε. d) A ∩ B ∩ C |
|
Answer» ONG>ANSWER: djdkckfensnakskckfmfnffn4jdksjsjd Step-by-step EXPLANATION: ccjcjcjfjfdjwoqkqmanxncjcjcnfbsabakxjxncnffnfbs |
|
| 36. |
Find the median class interval frequency0-1000 2501000-2000 1902000-3000 1003000-4000 404000-5000 155000-6000 5 |
|
Answer» we know that
The cumulative frequency just greater than 300 is 440 and the corresponding class is 1000 - 2000 MEDIAN formula : Here,
According to the QUESTION,
so,
By SUBSTITUTING all the given values in the formula, ─━─━─━─━─━─━─━─━─━─━─━─━─ Additional Information :-Mean :-Using Direct Method Using Short Cut Method ASSUMED Mean Method :- |
|
| 38. |
The object below is made up of identical cubes. Each cube has edges that are 5 feet long. • What is the perimeter of the base of the object? Show all your work and explain your reasoning. Be sure to label your answer with the correct units. • What is the volume of the object in cubic feet? Show all your work and explain your reasoning. |
|
Answer» ONG>ANSWER: Step-by-step explanation: 5 |
|
| 41. |
Solve 4610 +15= 5x4-2x2)4 ब्रैकेट |
|
Answer» ONG>Step-by-step EXPLANATION: the ANSWER is 1156.25 this is the answer |
|
| 42. |
Find the H.C.F of the following polynomials: 36x²a⁴c⁵,24xy²a³b⁴ and 60y³a⁶b²c |
|
Answer» ong>ANSWER: hhhhhyyyggyyy you NEED anything ELSE from you soon my LOVE I love you need anything else yyyyy I don't know if |
|
| 43. |
If root 3 tan A then show sin^2A-cos^2A=1/3 |
|
Answer» ong>Answer: please mark this brainliest please again I FOLLOW and like you to OK sir please |
|
| 44. |
The centre of a circle is (2a, a - 7). Using Distance Formula, find the values of a if the circle passes through the point (11,-9) and has diameter 10√2 units . |
|
Answer» ong>Answer: By given " " ...(i)
Length of radius
" " [by FACTORISATION metghod]
|
|
| 45. |
Limitx---->0 |
|
Answer» ong>Step-by-step EXPLANATION: |
|
| 46. |
Que.7 – What is the probability of choosing a vowel from the alphabet ? i. 1/26 ii. 5/26 iii. 21/26 iv. 1 |
|
Answer» /26 PLEASE MARK BRAINLIEST |
|
| 47. |
Three coins are tossed. Find the probability of getting at least one head. |
|
Answer» ong>Answer: 7/8 Step-by-step explanation: favourable outcome = 7 Probablity = total outcome / favourable outcome =7/8 |
|
| 48. |
On what principal at the rate of 10% per annum, the difference betweenthe compound interests for 3 yearsand 2 years is * 121.00 ? |
|
Answer» ong>ANSWER: Let the sum be Rs.100 Computation of compound interest: Prinicpal =Rs.100 R=10% PER ANNUM and n=2 years. Amount=Rs. ⎣ ⎢ ⎡
100×(1+ 100 10
) 2
⎦ ⎥ ⎤
=Rs. ⎣ ⎢ ⎡
100×( 2 11
) 2
⎦ ⎥ ⎤
=Rs.121 Computation of simple interest: Prinicpal =Rs.100 R=10% and TIME =2 years. ∴S.I.=Rs.( 100 100×10×2
)=Rs.20 Thus, difference in C.I. and S.I.=Rs.(21−20)=Re.1 Now, if difference between C.I and S.I. is Re.1, Then Sum =Rs.100 If difference between C.I. and S.I. is Rs.500, Then Sum =Rs.(100×500)=Rs.50000 |
|
| 49. |
Ishita paid Rs. 500.26 for shirt and 380.45 for a jeans. If she gave Rs. 1000 to shopkeeper then find how muchmoney she got as return? |
|
Answer» t=500.26 RS Jeans=380.45 Rs She GAVE to SHOPKEEPER=1000 Rs Shopkeeper Gave him=1000Rs-(500.26+380.45) =1000Rs-880.71 =119.29Rs |
|
| 50. |
Write the number names according international system30073285 |
|
Answer» ong>Answer: 30,073,285: Thirty million seventy THREE thousand two hundred eighty five Step-by-step EXPLANATION: In INTERNATIONAL System of NUMERATION, you have to place the commas for every three digits from right side. |
|