332354 + Interview Questions in Secondary School in Math

1.	Maths syllabus high c
Answer» HEY MATE, what are you MEAN by??

Discussion

2.	From the simple word problem for the given question 80-15=?
Answer» The ANSWER is 80-15 = 65

Discussion

3.	12=6,6=3,10=???? (10 is not equal to 5)
Answer» HII.... the answer to your question is 3 because 12 has 6 LETTERS, 6 has 3 letters and 10 also has 3 letters.... hope it is correct and will HELP you..

Discussion

4.	When walking, right turns take 3 minutes and left turns take 4 minutes. When driving, right and left turns taking 1 minute each. How long did it take for the hiker to reach his destination?
Answer» 0minutes because HIKER MEANS the PERSON who CLIMB mountains and while climbing you cannot take TURNS

Discussion

5.	50÷{3-(2-1)} -25 = answrrto croct number
Answer» The ANSWER is 0 only

Discussion

6.	Find value of k for which the given equation has real and equal roots x^2-2x (1+3k)+7 (3+2k)=0
Answer» x²-2x(1+3k)+7(3+2k)=0 x²-x(2+6k)+7(3+2k)=0 here a = 1, b= -(2+6k) and C = 7(3+2k) Now, D= b²-4ac (6k+2)²-4(1)x7(3+2k) 36k²+4+24k-84-56k 36k²-32k-80 Now, for equal roots D = 0 36k²-32k-80 = 0 9K²-8K-20=0 9K²-18K+10K-20=0 9K(K-2)+10(K-2)=0 (9K+10)(K-2)=0 K= -10/9 or k = 2

6.

Find value of k for which the given equation has real and equal roots x^2-2x (1+3k)+7 (3+2k)=0

Answer»

x²-2x(1+3k)+7(3+2k)=0

x²-x(2+6k)+7(3+2k)=0

here a = 1, b= -(2+6k) and C = 7(3+2k)

Now, D= b²-4ac

(6k+2)²-4(1)x7(3+2k)

36k²+4+24k-84-56k

36k²-32k-80

Now, for equal roots D = 0

36k²-32k-80 = 0

9K²-8K-20=0

9K²-18K+10K-20=0

9K(K-2)+10(K-2)=0

(9K+10)(K-2)=0

K= -10/9 or k = 2

Discussion

7.	1/3 of a number exceeds 1/6 of the number by 4.Find the number.
Answer» $\frac{1}{3} \times x - \frac{1}{6} \times x = 4 \\ 2x - x = 24 \\ x = 24$

Discussion

8.	Tell me the solution of first question
Answer» I don't KNOW SORRY...

Discussion

9.	Cos(45-a)cos(45-b)-sin(45-a)sin(45-b)=
Answer» COS (45-a)cos(45-b)-SIN(45-a)sin(45-b) Cos(45-a+45-b) Cos(90-(a+b)) Sin(a+b)

Discussion

10.	The technique or skill of map pmaking is called__________
Answer» HELLO dear Your answer Cartography is the study and PRACTICE of MAKING MAPS. ✅✅ If it HELPS you mark me as a brainlist Thanks ❤️❤️

Discussion

11.	Factorise the following using splitting the middle term method. Minimum one pls.
Answer» X² + 4√2 X + 6 => x² + ( 3√2 + √2 )x + 6 => x² + 3√2x + √2x + 6 => x( x + 3√2 ) + √2( x + 3√2 ) => ( x + 3√2 ) ( x + √2 ) ( II ) : x² - 3√5x - 20 => x² - ( 4√5 - √5 )x - 20 => x² - 4√5x + √5x - 20 => x( x - 4√5 ) + √5( x - 4√5 ) => ( x - 4√5 ) ( x + √5 ) $.$

Discussion

12.	Evaluate. the following products algabric expressions class 8 and how to solve these sums
Answer» This MAY be the ANSWER CHECK it out

Discussion

13.	a number consists of two digits whose sum is 9 if 27 is subtracted from the number its digits are reversed find the number
Answer» 63 is the ANSWER 63-27=36 it is REVERSED 63=36 and the SUM of DIGITS =3+6=9

Discussion

14.	the lengths of the sides of a triangle are in a ratio 3:4:5 and it's perimeter is 144cm. find the length of each side of the triangle, area of the triangle and the height of the triangle
Answer» Hey MATE<3<3 your answer is in the ATTACHMENT given below

Discussion

15.	Find it is a perfect cube 3645
Answer» The CUBED ROOT of three THOUSAND, SIX hundred and forty-five ∛3645 = 15.3897835201

Discussion

16.	Why vector division is not possible
Answer» HIII a vector space only SUPPORTS additional and scaler MULTIPLICATION so the answer would be no.

Discussion

17.	Give me time table of 13 -20
Answer» REFER to the 2 ATTACHMENT HOPE it HELPS ☺☺

Discussion

18.	Two supplementry angles differ by 12 degree find the angle
Answer» Let the two SUPPLEMENTARY ANGLES be x and y X+y=180....1 X=y+12...2 Using substitution, Y+12+y=180 2y=180-12=168 Y=168/2=84 X=84+12=96 So one angle is 84 and it's supplementary angle is 96 degrees Hope this helps. Please MARK as brainliest

Discussion

19.	work in a fort 300 men had provisions for 90 days after 20 days 50 men left the fort. how long would the food last at the same rate?
Answer» 84 DAYS FOOD WIIL be RANING

Discussion

20.	Find the smallest number to multiply with 150 to make it a perfect square
Answer» $\textbf{Explaination :}$ _________________ “LOOK at the number 150. It is not a perfect square because it has a single zero in it's unit digit.” “According to the QUESTION, as the number 150 is not a perfect square. Inorder to make it a perfect square we need to multiply it with a certain number to convert it into a perfect square” $\textbf{Solution :}$ _________________ $\textbf{Note :}$ We are doing it by prime factorisation method. “So, we need to FIND the prime factors of 150” Prime Factors of 150 = 5 × 5 × 2 × 3 “Have a look at the factors, we need to pair them out. So, only 5 is in pair but 2 and 3 are not in pair. So, we will take them in the next step.” Smallest number to be multiplied = 2 × 3 = 6 Perfect Sq. $= \sqrt{ 150 \times 6 }= \sqrt{5 \times 5 \times 2 \times 3 \times 6} \\ \\ = \sqrt{900} \: \: \: \: \: \: \: \: = \sqrt{5 \times 5 \times 6 \times 6} \\ \\ \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: = 5 \times 6 \\ \\ \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: \: = 30$ •°• The perfect sq. is 900 $\sqrt{900} = 30$ ____________________ $\boxed{Hope\:it\:helps\:you!}$ ____________________ ★ Be Brainly ★

Discussion

21.	Find the standard equation of a circle having the given center and radius
Answer» The standard equation is (x-h)^2+(y-k)^2=r^2 With the CENTRE being at the POINT (h,k) and radius being r. Hope this HELPS . PLEASE mark as brainliest

Discussion

22.	Which is a segment inthis circle?
Answer» SEGMENT CB and The segment DE segment CB is a DIAMETER and SegmentDE is a CHORD

Discussion

23.	What is a square of 999.9
Answer» The square root of 999.9 is 31.621195423323. Or, √999.9 = 31.621195423323 Step 1: Divide the number (999.9) by 2 to get the first guess for the square root . First guess = 999.9/2 = 499.95.Step 2: Divide 999.9 by the previous result. d = 999.9/499.95 = 2. Average this value (d) with that of step 1: (2 + 499.95)/2 = 250.975 (new guess). Error = new guess - previous value = 499.95 - 250.975 = 248.975. 248.975 > 0.001. As error > accuracy, we REPEAT this step again.Step 3: Divide 999.9 by the previous result. d = 999.9/250.975 = 3.9840621576. Average this value (d) with that of step 2: (3.9840621576 + 250.975)/2 = 127.4795310788 (new guess). Error = new guess - previous value = 250.975 - 127.4795310788 = 123.4954689212. 123.4954689212 > 0.001. As error > accuracy, we repeat this step again.Step 4: Divide 999.9 by the previous result. d = 999.9/127.4795310788 = 7.8436121591. Average this value (d) with that of step 3: (7.8436121591 + 127.4795310788)/2 = 67.6615716189(new guess). Error = new guess - previous value = 127.4795310788 - 67.6615716189 = 59.8179594599. 59.8179594599 > 0.001. As error > accuracy, we repeat this step again.Step 5: Divide 999.9 by the previous result. d = 999.9/67.6615716189 = 14.7779600159. Average this value (d) with that of step 4: (14.7779600159 + 67.6615716189)/2 = 41.2197658174(new guess). Error = new guess - previous value = 67.6615716189 - 41.2197658174 = 26.4418058015. 26.4418058015 > 0.001. As error > accuracy, we repeat this step again.Step 6: Divide 999.9 by the previous result. d = 999.9/41.2197658174 = 24.2577797368. Average this value (d) with that of step 5: (24.2577797368 + 41.2197658174)/2 = 32.7387727771(new guess). Error = new guess - previous value = 41.2197658174 - 32.7387727771 = 8.4809930403. 8.4809930403 > 0.001. As error > accuracy, we repeat this step again.Step 7: Divide 999.9 by the previous result. d = 999.9/32.7387727771 = 30.5417679156. Average this value (d) with that of step 6: (30.5417679156 + 32.7387727771)/2 = 31.6402703464(new guess). Error = new guess - previous value = 32.7387727771 - 31.6402703464 = 1.0985024307. 1.0985024307 > 0.001. As error > accuracy, we repeat this step again.Step 8: Divide 999.9 by the previous result. d = 999.9/31.6402703464 = 31.6021319999. Average this value (d) with that of step 7: (31.6021319999 + 31.6402703464)/2 = 31.6212011732(new guess). Error = new guess - previous value = 31.6402703464 - 31.6212011732 = 0.0190691732. 0.0190691732 > 0.001. As error > accuracy, we repeat this step again.Step 9: Divide 999.9 by the previous result. d = 999.9/31.6212011732 = 31.6211896734. Average this value (d) with that of step 8: (31.6211896734 + 31.6212011732)/2 = 31.6211954233(new guess). Error = new guess - previous value = 31.6212011732 - 31.6211954233 = 0.0000057499. 0.0000057499 <= 0.001. As error <= accuracy, we stop the iterations and use 31.6211954233 as the square root. So, we can say that the square root of 999.9 is 31.62119 with an error smaller than 0.001 (in fact the error is 0.0000057499). this means that the first 5 decimal PLACES are correct. Just to compare, the RETURNED value by USING the javascript function 'Math.sqrt(999.9)' is 31.62119542332326.

Discussion

24.	In a calendar,a square of four numbers is marked. The sum of the numbers is 80 .what are the numbers?
Answer» let the smallest number=x next number=x+1 as it is a square 3rd no.=x+7 4th no.=x+8 x+x+1+x+7+x+8=80 4x+16=80 4x=64 x=16 ∴the NOS. are 16, 17, 23, 24

24.

In a calendar,a square of four numbers is marked. The sum of the numbers is 80 .what are the numbers?

Answer»

let the smallest number=x

next number=x+1

as it is a square 3rd no.=x+7

4th no.=x+8

x+x+1+x+7+x+8=80

4x+16=80

4x=64

x=16

∴the NOS. are 16, 17, 23, 24

Discussion

25.	Find seven rational numbers between 7 and 8 ? in esy way
Answer» 7.1, 7.2, 7.3, 7.4, 7.5, 7.6, 7.7

Discussion

26.	Hlo everyonei had taken nonmedical means pcmfurther in which field i can goand jobs i can do
Answer» ENGINEERING Architecture MERCHANT navy Commercial PILOT BACHELOR of SCIENCE

Discussion

27.	Find the value of a and b if i) √2+√3/3√2-2√3 = a+b√6
Answer» Hi ! Identity USED : $(x + y)(x - y) = {x}^{2} - {y}^{2}$ $\frac{ \sqrt{2} + \sqrt{3} }{3 \sqrt{2} - 2 \sqrt{3} } = a + b \sqrt{6} \\$ L.H.S On RATIONALIZING the denominator we get, $= \frac{ \sqrt{2} + \sqrt{3} }{3 \sqrt{2} - 2 \sqrt{3} } \times \frac{3 \sqrt{2} + 2 \sqrt{3} }{3 \sqrt{2} + 2 \sqrt{3} } \\ \\ = \frac{ \sqrt{2} (3 \sqrt{2} + 2 \sqrt{3} ) + \sqrt{3} (3 \sqrt{2} + 2 \sqrt{3} )}{ {(3 \sqrt{2}) }^{2} - {(2 \sqrt{3}) }^{2} } \\ \\ = \frac{6 + 2 \sqrt{6} + 3 \sqrt{6} + 6}{18 - 12} \\ \\ = \frac{12 + 5 \sqrt{6} }{6} \\ \\ = 2 + \frac{5 \sqrt{6} }{6}$ On COMPARING we get, $2 + \frac{5 \sqrt{6} }{6} = a + b \sqrt{6} \\ \\ a = 2 \: : \: b = \frac{5}{6}$

Discussion

28.	Simplifypleaseeeeeeguys
Answer» 6/35 ,4/15 and 3/1o is your ANSWER.

Discussion

29.	101-200 prime numbers
Answer» 101, 103, 107, 109, 113, 127, 131, 137, 139, 149, 151, 157, 163 ,167, 173, 179, 181, 191, 193, 197, 199

Discussion

30.	Solve the following systems of equations 'ELIMINATION BY SUBSTITUTION' method and find the value of 2x + y; , y # 0Content Quality Solution Required ❎ Don't Spamming ❎
Answer» $\mathbf{hence \: \: } \\ \\ \\ \mathbf{ \fcolorbox{blue}{lime}{ (2x + y) = <klux>2</klux>(3) + 2 }} \\ \\ \\$ => 6 + 2 => 8

Discussion

31.	Hlo 10 rupye ki aise cheez lani hai jo apke ghar ko bhar deIAS QUES
Answer» Hello dear!!!! vese to 10 rupees me bahut saari zeese aa jati h but....KOI ESI jis JO AAPKE ghar ko bhar de wo hai..... agarbatti....hai....wo hamare ghar ko fragnance se bhar degi aur. sath sath spirituality bhi HOGI... hopes help.. plzzzzz mark as brainliest

Discussion

32.	Explain matrices and its type with example?
Answer» in order to range numerous numbers, mathematics provides a simple solution: matrices. A matrix can be defined as a rectangular grid of numbers, symbols, and EXPRESSIONS arranged in rows and columns. These grids are usually charted by brackets around them. The dimensions of a matrix are represented as R X C, where R is the number of rows and C is the number of columns. This R X C notation is also called the order of the matrix. Types of Matrices There are various types of matrices, depending on their structure. Let's EXPLORE the most common types: Null Matrix A matrix that has all 0 elements is called a null matrix. It can be of any order. For example, we could have a null matrix of the order 2 X 3. It's also a singular matrix, since it does not have an inverse and its determinant is 0. Null Matrix Any matrix that does have an inverse can be called a regular matrix. Row Matrix A row matrix is a matrix with only one row. Its order would be 1 X C, where C is the number of columns. For example, here's a row matrix of the order 1 X 5: Row Matrix Column Matrix A column matrix is a matrix with only one column. It is represented by an order of R X 1, where R is the number of rows. Here's a column matrix of the order 3 X 1: Column Matrix Square Matrix A matrix where the number of rows is EQUAL to the number of columns is called a square matrix. Here's a square matrix of the order 2 X 2: Square Matrix Diagonal Matrix A diagonal matrix is a square matrix where all the elements are 0 except for those in the diagonal from the top left corner to the bottom right corner. Let's take a look at a diagonal matrix of order 4 X 4: Diagonal Matrix A special type of diagonal matrix, where all the diagonal elements are equal is called a scalar matrix. We can see a 3 X 3 scalar matrix here: Scalar Matrix A scalar matrix whose diagonal elements are all 1 is called a unit matrix, or identity matrix. Unit Matrix Upper TRIANGULAR Matrix A square matrix where all the elements below the left-right diagonal are 0 is called an upper triangular matrix. Here's an upper triangular matrix of order 3 X 3: Upper Triangular Matrix Lower Triangular Matrix A square matrix where all the elements above the left-right diagonal are 0 is called a lower triangular matrix. Here's what a lower triangular matrix of order 3 X 3 could look like: Lower Triangular Matrix Symmetric Matrix A matrix whose transpose is the same as the original matrix is called a symmetric matrix. Only a square matrix can be a symmetric matrix. The transpose of a matrix is another matrix that is formed by switching the rows and columns of a given matrix. The given matrix A is a 3 X 3 symmetric matrix, since it's the same as its transpose AT. Symmetric MATRIXA matrix whose transpose is the same as the original matrix is called a symmetric matrix. Only a square matrix can be a symmetric matrix. The transpose of a matrix is another matrix that is formed by switching the rows and columns of a given matrix. The given matrix A is a 3 X 3 symmetric matrix, since it's the same as its transpose AT.

32.

Explain matrices and its type with example?

Answer»

in order to range numerous numbers, mathematics provides a simple solution: matrices. A matrix can be defined as a rectangular grid of numbers, symbols, and EXPRESSIONS arranged in rows and columns. These grids are usually charted by brackets around them.

The dimensions of a matrix are represented as R X C, where R is the number of rows and C is the number of columns. This R X C notation is also called the order of the matrix.

Types of Matrices

There are various types of matrices, depending on their structure. Let's EXPLORE the most common types:

Null Matrix

A matrix that has all 0 elements is called a null matrix. It can be of any order. For example, we could have a null matrix of the order 2 X 3. It's also a singular matrix, since it does not have an inverse and its determinant is 0.

Null Matrix

Any matrix that does have an inverse can be called a regular matrix.

Row Matrix

A row matrix is a matrix with only one row. Its order would be 1 X C, where C is the number of columns. For example, here's a row matrix of the order 1 X 5:

Row Matrix

Column Matrix

A column matrix is a matrix with only one column. It is represented by an order of R X 1, where R is the number of rows. Here's a column matrix of the order 3 X 1:

Column Matrix

Square Matrix

A matrix where the number of rows is EQUAL to the number of columns is called a square matrix. Here's a square matrix of the order 2 X 2:

Square Matrix

Diagonal Matrix

A diagonal matrix is a square matrix where all the elements are 0 except for those in the diagonal from the top left corner to the bottom right corner. Let's take a look at a diagonal matrix of order 4 X 4:

Diagonal Matrix

A special type of diagonal matrix, where all the diagonal elements are equal is called a scalar matrix. We can see a 3 X 3 scalar matrix here:

Scalar Matrix

A scalar matrix whose diagonal elements are all 1 is called a unit matrix, or identity matrix.

Unit Matrix

Upper TRIANGULAR Matrix

A square matrix where all the elements below the left-right diagonal are 0 is called an upper triangular matrix. Here's an upper triangular matrix of order 3 X 3:

Upper Triangular Matrix

Lower Triangular Matrix

A square matrix where all the elements above the left-right diagonal are 0 is called a lower triangular matrix. Here's what a lower triangular matrix of order 3 X 3 could look like:

Lower Triangular Matrix

Symmetric Matrix

A matrix whose transpose is the same as the original matrix is called a symmetric matrix. Only a square matrix can be a symmetric matrix. The transpose of a matrix is another matrix that is formed by switching the rows and columns of a given matrix. The given matrix A is a 3 X 3 symmetric matrix, since it's the same as its transpose AT.

Symmetric MATRIXA matrix whose transpose is the same as the original matrix is called a symmetric matrix. Only a square matrix can be a symmetric matrix. The transpose of a matrix is another matrix that is formed by switching the rows and columns of a given matrix. The given matrix A is a 3 X 3 symmetric matrix, since it's the same as its transpose AT.

Discussion

33.	What are five digit numbers which divisible by 36
Answer» 1) 36000 2) 72000 3) 18000 4) 14400 5) 10800

Discussion

34.	Now let’s try to figure out how long it’d take to move from left to right. If each right turn takes 1 minute and each left turn takes 3 minutes, how long would you spend turning?
Answer» 0 MINUTES or 4 minutes

Discussion

35.	Find the odd man out. 1. 3, 5, 11, 14, 17, 21a. 21b. 17c. 14d. 3
Answer» (C) CUZ it is EVEN and REST are ODD

Discussion

36.	Find the missing number in the series: 2, 3, 5, 16, 231, ‘?'
Answer» 53105 2^2 - 1^2 =3 3^2 - 2^2 =5 5^2 - 3^2 =16 16^2-5^2 =231 231^2-16^2=53105

Discussion

37.	Find the least value of * for which 7*5462 is divisible by 9 indiabix
Answer» 3 should be PLACE on VALUE of *

Discussion

38.	the sum of the disease of the two digit number is 12 if the new number formed by reversing the digit is greater than the original number by 7 find original number check in solution
Answer» Given sum of the digits is 12 Let the digits in ones place be x Hence the digit in tens place is (12 – x) The original number = 10(12 – x) + x = 120 – 9x Number formed by reversing the digits = 10x + (12 – x) = 9x + 12 Given that number formed by reversing the digits is 54 greater than the original number. ⇒ 9x + 12 = (120 – 9x) + 54 = 174 – 9x ⇒ 18X = 174 – 12 = 162 ∴ x = 9 The original number = 120 – 9x = 120 – 9(9) = 39 i hope it helps U.. mark as brainliest if you like my answer .

Discussion

39.	The area of trapezium is 220cm2. its parallel sides are 20cm and 35cm respectively .find the height of the trapezium
Answer» HIEGHT of TRAPEZIUM is 16

Discussion

40.	If 3.45 × 5613 = 19 364.85, what is the product of 3450 and 5613
Answer» SINCE it is given that 3.45x5613=19364.85 Then 3450x5613 will be , There is a change of THREE decimal places to arrive at 3450 from 3.45, therefore on the PRODUCT SIDE you will need to ADD zero/move 3 decimal places Therefore the product will be 19364850 Hope this helps

Discussion

41.	Ravi takes 6 days to complete a job Shyam takes 12 days to complete the same job if Ram and Shyam work together how many days they will take to complete the job
Answer» 4 DAYS TAKE to COMPLETE JOB

Discussion

42.	If x+y+z=0,show that x^3
Answer» $x + y + z = 0 \\ \\ x = - y - z \\ \\ x^3 = (- y - z)^3 = - y^3 - 3y^2z - 3yz^2 - z^3$

Discussion

43.	to dig a pond 15 people take 50 days some people reported sick and to finish the work it took 75 days how many people reported sick
Answer» 15 people take 50 days therefore 7.5 people will take 100 days there for )(15+7.5)/2 people will do it in 75 days 11 people do it in 75 days therefore 4 people REPORTED sick.

Discussion

44.	2/3 of a year, find the answer
Answer» 2/3 of a YEAR is 2/3 * 12 = 8 the 2/3 of year is 8 MONTHS

Discussion

45.	-2/3 - ( -3/2) - 3/4 = ?In Fraction not decimal.
Answer» $\frac{ - 2}{3} - ( \frac{ - 3}{2} ) - \frac{3}{4} \\ = \frac{ - 2}{3} + \frac{3}{2} - \frac{3}{4} \\ = \frac{ - 8 + 18 - 9}{12} \\ = \frac{1}{12}$ your ANSWER is here ✌✌✌✌

Discussion

46.	a man travel 10km by walk and certain distance by train and then bus as far as twice the wohle is 70km find distance travell by train
Answer» The man TRAVELS by train and BUS DISTANCE = 70 - 10 = 60 kms. This distance of 60 kms is travelled in the ratio 1 : 2 by train and bus respectively. Hence distance travelled by train = (1/3)x60 = 20 kms and hence distance travelled by bus = 40 kms

46.

a man travel 10km by walk and certain distance by train and then bus as far as twice the wohle is 70km find distance travell by train

Answer»

The man TRAVELS by train and BUS DISTANCE = 70 - 10 = 60 kms.

This distance of 60 kms is travelled in the ratio 1 : 2 by train and bus respectively.

Hence distance travelled by train = (1/3)x60 = 20 kms and hence distance travelled by bus = 40 kms

Discussion

47.	Ravi can type 45 words per minute and he completes typing a letters in 20 m he is a boss asked him to complete the job in 15 minutes what should be the typing speed of Ravi
Answer» WORDS typed in 20 minutes = 45×20 =900 Speed REQUIRED = 900÷15= 60 words PER min

Discussion

48.	What is a dimension? Does point have any direction? If it has why? if it doesn't have why?
Answer» DIMENSION MEANS AREA

Discussion

49.	The median and mode of a data are 14 and 12 respectively. What is the mean
Answer» HEYA!! -------- 3 Median = Mode + 2 MEAN 3 (14 ) = 12 + 2 Mean 42 -12 = 2 Mean 30 = 2 Mean Mean = 15 ---------------------------------------------------------------------------------------------------- ----------------------------------------------------------------------------------------------------

Discussion

50.	The total cost of 3 tables and 2 chairs is Rs 1850. If a table costs rs 75 more than a chair, find the price of each.
Answer» Suppose one CHAIR COSTS - $x$ therefore, COST of one table- $(x + 75)$ cost of 2 chairs- $2x$ & cost of 3 tables- $3 \times (x + 75) \\ \\ = 3x + 225$ a/q $2x + 3x + 225 = 1850$ solve this and put the value of x HOPE this will help you.. plz mark me as a brainliest

Discussion

Explore topic-wise InterviewSolutions in Current Affairs.

Maths syllabus high c

From the simple word problem for the given question 80-15=?

12=6,6=3,10=???? (10 is not equal to 5)

When walking, right turns take 3 minutes and left turns take 4 minutes. When driving, right and left turns taking 1 minute each. How long did it take for the hiker to reach his destination?

50÷{3-(2-1)} -25 = answrrto croct number

Find value of k for which the given equation has real and equal roots x^2-2x (1+3k)+7 (3+2k)=0

1/3 of a number exceeds 1/6 of the number by 4.Find the number.

Tell me the solution of first question

Cos(45-a)cos(45-b)-sin(45-a)sin(45-b)=

The technique or skill of map pmaking is called__________

Factorise the following using splitting the middle term method. Minimum one pls.

Evaluate. the following products algabric expressions class 8 and how to solve these sums

a number consists of two digits whose sum is 9 if 27 is subtracted from the number its digits are reversed find the number

the lengths of the sides of a triangle are in a ratio 3:4:5 and it's perimeter is 144cm. find the length of each side of the triangle, area of the triangle and the height of the triangle

Find it is a perfect cube 3645

Why vector division is not possible

Give me time table of 13 -20

Two supplementry angles differ by 12 degree find the angle

work in a fort 300 men had provisions for 90 days after 20 days 50 men left the fort. how long would the food last at the same rate?

Find the smallest number to multiply with 150 to make it a perfect square

Find the standard equation of a circle having the given center and radius

Which is a segment inthis circle?

What is a square of 999.9

In a calendar,a square of four numbers is marked. The sum of the numbers is 80 .what are the numbers?

Find seven rational numbers between 7 and 8 ? in esy way

Hlo everyonei had taken nonmedical means pcmfurther in which field i can goand jobs i can do

Find the value of a and b if i) √2+√3/3√2-2√3 = a+b√6

Simplifypleaseeeeeeguys

101-200 prime numbers

Solve the following systems of equations 'ELIMINATION BY SUBSTITUTION' method and find the value of 2x + y; , y # 0Content Quality Solution Required ❎ Don't Spamming ❎

Hlo 10 rupye ki aise cheez lani hai jo apke ghar ko bhar deIAS QUES

Explain matrices and its type with example?

What are five digit numbers which divisible by 36

Now let’s try to figure out how long it’d take to move from left to right. If each right turn takes 1 minute and each left turn takes 3 minutes, how long would you spend turning?

Find the odd man out. 1. 3, 5, 11, 14, 17, 21a. 21b. 17c. 14d. 3

Find the missing number in the series: 2, 3, 5, 16, 231, ‘?'

Find the least value of * for which 7*5462 is divisible by 9 indiabix

the sum of the disease of the two digit number is 12 if the new number formed by reversing the digit is greater than the original number by 7 find original number check in solution

The area of trapezium is 220cm2. its parallel sides are 20cm and 35cm respectively .find the height of the trapezium

If 3.45 × 5613 = 19 364.85, what is the product of 3450 and 5613

Ravi takes 6 days to complete a job Shyam takes 12 days to complete the same job if Ram and Shyam work together how many days they will take to complete the job

If x+y+z=0,show that x^3

to dig a pond 15 people take 50 days some people reported sick and to finish the work it took 75 days how many people reported sick

2/3 of a year, find the answer

-2/3 - ( -3/2) - 3/4 = ?In Fraction not decimal.

a man travel 10km by walk and certain distance by train and then bus as far as twice the wohle is 70km find distance travell by train

Ravi can type 45 words per minute and he completes typing a letters in 20 m he is a boss asked him to complete the job in 15 minutes what should be the typing speed of Ravi

What is a dimension? Does point have any direction? If it has why? if it doesn't have why?

The median and mode of a data are 14 and 12 respectively. What is the mean

The total cost of 3 tables and 2 chairs is Rs 1850. If a table costs rs 75 more than a chair, find the price of each.