This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
Which of the following is not a molecular solid bromine sulphurphosphoruscarbon dioxide |
| Answer» NG to me,here all are MOLECULAR SOLID. | |
| 2. |
A) The number of electrons, protons and neutrons in a species are equal to 18, 16 and 16 respectively. Assign the proper symbol to the species. (1)b) The Balmer series of lines in the hydrogen spectrum appear in the visible region of the electromagnetic spectrum. Calculate the wave number of the second line in the Balmer series. (Rydberg constant for Hydrogen is 109677 cm-1) |
|
Answer» tion:ATOMIC number of the ELEMENT is 16 OK hope it helps MARK as brainlliest pls |
|
| 3. |
When 5 mole of N2 and 15 mole of H2 react how many moles of NH3 get? |
|
Answer» No. of moles of NH3 =10 molesExplanation:Here, N2 + 3H2 = 2NH3 1 mole 3 moles 2 moles On the basis of balanced chemical equation, it is clear that—1 mole of N2 COMBINES with 3 moles of H2 to produce 2moles ofNH3So, 5 moles of N2 COMBINE with 15 moles of H2 to produce 10 moles of NH3 |
|
| 4. |
Define unit cell in chemistry |
|
Answer» tion:UNIT cell is the most basic and least volume consuming repeating structure of any solid. It is used to visually SIMPLIFY the crystalline patterns solids ARRANGE themselves in. When the unit cell repeats itself, the network is CALLED a lattice. |
|
| 5. |
Drive an expression for the phase rule for reactive and non reactive system |
| Answer» | |
| 6. |
Propanel and pentan -3-one are ozonolysis product of alkenes |
|
Answer» Ozonolysis is an organic reaction where the unsaturated bonds of alkenes, ALKYNES, or AZO compounds are CLEAVED with OZONE. Alkenes and alkynes form organic compounds in which the multiple carbon–carbon bond has been REPLACED by a carbonyl group while azo compounds form nitrosamines. |
|
| 7. |
Explain thomsmodel of atom |
|
Answer» son's model, the atom is composed of electrons surrounded by a soup of positive charge to BALANCE the electrons' negative charges, like negatively CHARGED “PLUMS” surrounded by positively charged “pudding”. The 1904 Thomson model was disproved by Hans Geiger's and Ernest Marsden's 1909 GOLD FOIL experiment. |
|
| 8. |
What are the bonds formed between metals and non metals. |
| Answer» TION:Ionic bonds form when a NONMETAL and a metal EXCHANGE electrons, while covalent bonds form when electrons are SHARED between TWO nonmetals. An ionic bond is a type of chemical bond formed through an electrostatic attraction between two oppositely charged ions. | |
| 9. |
They are computer designed to provide services to clent machines in a computer network |
|
Answer» e :They are computers designed to provide services to CLIENT machines in a computer network. They have LARGER storage capacities and powerful PROCESSORS. Running on them are programs that SERVE client requests and allocate resources like memory and time to client machines. HOPE it helps. |
|
| 10. |
How to calculate the percentage of ionic character of carbon dioxide bond in ccl4 |
|
Answer» ting point of a substance is the temperature at which it TRANSFORMS from a SOLID to a liquid state. Metals show a high melting point as they exist in a CRYSTALLINE solid form. High melting point metals have STRONG INTERMOLECULAR forces between atoms. |
|
| 11. |
Uses of hydrogen trioxocarbonate iv |
|
Answer» is a CHEMICAL COMPOUND with the chemical formula CH₄. It is a group-14 hydride and the SIMPLEST alkane, and is the MAIN constituent of NATURAL gas. |
|
| 12. |
1. In ______ substances molecules exist very close |
| Answer» | |
| 13. |
What is atomic mass? |
|
Answer» The atomic mass is the mass of an atom. ALTHOUGH the SI unit of mass is kilogram, the atomic mass is often expressed in the non-SI unit dalton where 1 dalton is DEFINED as ¹⁄₁₂ of the mass of a single carbon-12 atom, at rest or the mass of an atom of a particular CHEMICAL substance. |
|
| 14. |
............is the symbol for the concentration unit of molarity. |
| Answer» | |
| 15. |
Vi chitro koi? Ar ai khane to porishrobon and kelason poddhotti hobe !! |
| Answer» WELL NA hobena UNFORTUNATELY | |
| 16. |
Write the properties of the following. i)Solids ii)Gasses |
| Answer» SOLIDS...HardGasses....GAS FORM | |
| 17. |
Define morderen periodic law |
|
Answer» pinesExplanation: |
|
| 18. |
Achchhe sawasth ke liye mul sharnte kya hai |
|
Answer» अच्छे स्वास्थ्य की मूल शर्तें निम्न है :- 1 ) अच्छे स्वास्थ्य के लिए अच्छा भोजन करें । 2) आयु के अनुसार सामान्य वजन, ऊंचाई और शरीर का निर्माण और विकास के सामान्य स्थिति होना।3) पर्याप्त भूख लगना।4) स्वस्थ त्वचा ।5) सक्रिय और सतर्क ।6) नींद का सामान्य पैटर्न ।7) मित्र और मल निष्कासन का स्वास्थ्य पैटर्न ।8) समान्य हीमोग्लोबिन ( HB ) और सिरम प्रोटीन का स्तर ।9) सीधे हाथ और पैरों के साथ सीधी मुद्रा में खड़े होना ।10) अपने दैनिक कार्य को सामान्य रूप से पूर्ण करना ।11) स्वास्थ्य दांतों और मसूड़ों का सामान्य रूप से कार्य करना ।please MARK my answer is BRANLIST....please |
|
| 19. |
Answer choice please |
| Answer» LIKE my ANSWEREXPLANATION:FOLLOW me DP taehyungu follow I follow U | |
| 21. |
Choose a character that is exclusive to mammals Oly, from the following a) internal fertilisationb) homeothermyc) four chambered heatd) muscular diaphragm |
| Answer» | |
| 22. |
2. A substance made up of two or more elements combined in a definite proportion by weight, is called(a) element(b) compound(c) mixture |
|
Answer» (b) CompoundsExplanation:Compounds are those substances formed as a result of the combination between various ELEMENTS, always in definite proportions.There are TWO types of them based on the BONDS formed-- COVALENT and ionic bonds |
|
| 23. |
What are polar and non polar molecules ? write short answer type plz |
|
Answer» Summary. NON polar molecules are symmetric with no unshared electrons. Polar molecules are asymmetric, either containing lone pairs of electrons on a central atom or having atoms with DIFFERENT ELECTRONEGATIVITIES BONDED. |
|
| 24. |
No spamming irrelevant answers will be reported and deleted |
| Answer» OPTION 2Explanation:HOPE this HELPS | |
| 25. |
57. What is the total number of sigma bonds and pi-bonds in the following molecules? © C.H.(0) CHO |
| Answer» REPLY USING the MEANING INTENDED | |
| 26. |
Ch3-ch(OH)-ch(NH2)-ch2ch3 IUPAC name |
|
Answer» e the answer for your question is 1-amino-2-methoxypropane.PLEASE MARK me as BRAINLIEST answer and please do SAY THANKS |
|
| 28. |
A porikkay khun khun podotti bebohar kora hoyese? |
|
Answer» is a CHEMICAL compound with the chemical FORMULA CH₄. It is a group-14 hydride and the simplest alkane, and is the main CONSTITUENT of NATURAL gas. |
|
| 29. |
Difference between ionation and dissocation |
|
Answer» Ionization Dissociation1) Formation of positively 1)Separation of ionsor negatively charged IONS. which are ALREADY from MOLECULES which are. present in an IONIC not initially in the ionic state. compound |
|
| 30. |
What is action of following on chlorobenzene a. h2so4 b. ch3cl in anhydrous alcl3 |
| Answer» C6H5CL + H2SO4 = C6H5SO3HC6H5Cl +CH3CL +anhy.AlCl3 = 4-Methylchlorobenzene | |
| 31. |
Can anyone explain the screening effect ?? |
|
Answer» The phenomenon which occurs when the nucleus REDUCES its force of attraction on the valence electrons due to the PRESENCE of electrons in the inner-shell. This is known as a SCREENING EFFECT. ... As the attraction between the nucleus decreases, the repulsion increases between the inner electrons and OUTER electrons. |
|
| 32. |
EAN of Na3[Cr(C2O4) 3] |
|
Answer» is a chemical COMPOUND with the chemical FORMULA CH₄. It is a group-14 hydride and the simplest ALKANE, and is the main constituent of NATURAL gas. |
|
| 33. |
Write the symbol along with the charges of the following ions: Sulphate, Nitride, Carbonate, Ammonium urgent |
|
Answer» hlhlhofizluutsityorutoor6r66p66r96or66r66py6p7p66yyyydyoyyoyyyoyoyypyyyoytkkgtktktkttkdggdkgjjjfjfkkgdgktykkyykyooyiytiyyiyiiotitititIi6o6oitittititititiiysisisitittitttittktittit |
|
| 34. |
What is the concentration of dissolved oxygen at 50°C under pressure of of 1 atm if the partial pressureof oxygen at 50°C is 0.14 atm (Henry's law constant foroxygen = 1.3 ×10-3 mol dm-³ atm-1) |
|
Answer» is a chemical COMPOUND with the chemical FORMULA CH₄. It is a group-14 hydride and the simplest alkane, and is the main CONSTITUENT of natural GAS. |
|
| 35. |
What is the % by mass (m/m) of copper in an alloy when 10 g of Cu is mixed with 250 g of Zn? |
|
Answer» is a chemical compound with the chemical FORMULA CH₄. It is a group-14 hydride and the SIMPLEST ALKANE, and is the main CONSTITUENT of natural GAS. |
|
| 36. |
SHOW COVALENT BONDING USING e dot structures in – CH3Cl, H2 S, F2, S8, CYCLOPENTANE |
|
Answer» er of soil which is just below the top-soil is called B-horizon. It is ALSO KNOWN as sub-soil. The sub-soil is made up of slightly bigger rock particles than that of top-soil. ... The sub-soil has very little humus (decayed organic MATTER). |
|
| 38. |
Explain the hybridization of following molecular ions ( SO 4^2- , PO4^3- ) write short answer type . |
| Answer» TION:(−1)×(−1)×(−1)×(−1)×(−1) | |
| 39. |
The reactions for the production of Na2SO4 from salt and sulphuric acid are as follows: NaCl + H2SO4 → NaHSO4+HCl (low temperature reaction) NaCl+ NaHSO4 → Na2SO4+HCl (high temperature reaction) The sulphuric acid solution contains 75 % H2SO4. The salt which is used is dry and pure. During heating, HCl and H2O vapours are formed and removed from the system. The final product has the following analysis weight composition: Compound Composition Molecular Weight Na2SO4 91.48% 142.06 H2O 1.35% 18.02 NaHSO4 4.79%. 120.07 HCl 0.40 % 36.46 NaCl 1.98 % 58.45 H2SO4 0.00% 98.08 Using 1000 kg of the final product (P) as a basis: 1.1. Calculate the extent of reaction 1 and reaction 2? (7) 1.2. Using the extent of reactions in 1.1, calculate the mass of sulphuric solution (F1) and sodium chloride (F2) in the feed? (9) 1.3. By analysing the final product stream (P) which reactant is limiting between H2SO4 and NaCl? Why? (2) 1.4. What is the mass of HCl and NaCl vapours thar were formed and removed from the system in stream C? (6) |
|
Answer» omgnacl PLUS 2bcl oisbnsvfkdhzh |
|
| 40. |
What is CH3COCH3. what we say it in chemistry? |
|
Answer» e answer for the question asked by you is :-IUPAC name of CH3COCH3 is acetone also KNOWN as propanone or dimethyl ketone . it is a colourless flammable LIQUID . it is the main INGREDIENT in polish REMOVER and it is also use to make fibers , drugs , plastics and other chemicalPlease mark me as the brainliest and please do say thanks |
|
| 41. |
Find out the ions involved in the formation of the following compounds along with their charges and write the formulae of the compounds: [2] a. Zinc carbonate b. Silver nitrate c. Copper (II) chloride d. Potassium bro 24 gm of magnesium burns with 16 gm of oxygen to form 40 gm of magnesium oxide. How much magnesium oxide would be formed when 96 gm of magnesium reacts with 100 gm of oxygen? Explain. |
|
Answer» a. ZN+ and CO3-b. AG+ and NO2-c. CU2+ and Cl-d. K+ and Br-Mark me the BRAINLIEST. |
|
| 42. |
Calculate the volume in litres of 49.8g of HCL gas at STP (molar mass of HCL = 36.5g mol') |
| Answer» TION:Not now..................... FOLLOW me as a BRO.... | |
| 43. |
Na2S2O3 + I2 gives Na2S4O6 + NaI |
|
Answer» +I2 = Na2S4O6+NaI BALANCE the equation by ion electron method. here we see iodine , I2 is REDUCED (as OXIDATION number changes from 0 to -1) and SULPHUR is oxidised. ( as oxidation number of s changes from +2 to +2.5).plzzzz mark as brainlist... |
|
| 44. |
Tell me IUPAC name of the compound |
|
Answer» can you PLEASE POST the QUESTION correctlyExplanation:The PIC is blured |
|
| 45. |
(1)acid rain occurs due to atmospheric pollution of 1. so22. NH3 3.CO2 4.N2O |
|
Answer» 1Explanation:ACID RAIN is DANGEROUS for ENVIRNMENT |
|
| 46. |
State and explain laws of mass action with proper derivation...!! NO SPAMS :-( |
|
Answer» thanks for free pointsExplanation:please MAKE my answer as BRAINLIST answer |
|
| 47. |
How do chemists use the mole |
|
Answer» e is the unit of amount in chemistry. It provides a bridge between the ATOM and the macroscopic amounts of MATERIAL that we work with in the laboratory. It allows the chemist to WEIGH out amounts of two substances, say iron and SULFUR, such that equal numbers of atoms of iron and sulfur are obtained. |
|
| 48. |
Convert ethyl bromide to ethene |
|
Answer» In ethyl ALCOHAL, the attacking species is the ethoxide anion, which is a much stronger base than the hydroxide anion, so it directly EXTRACTS the beta hydrogen from ethyl BROMIDE, followed by elimination of the bromide anion from the adjacent carbon atom to form ETHENE. |
|
| 49. |
1 mole of acidified K2Cr2O7 can oxidise how many moles of H2O2 |
| Answer» PLS MARK as BRAINLIEST and FOLLOW me | |