Saved Bookmarks
This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
Match the following helium with second lightest gas |
|
Answer» Helium Helium (He), chemical element, inert gas of Group 18 (NOBLE gases) of the PERIODIC table. The second lightest element (only hydrogen is lighter), helium is a COLOURLESS, ODOURLESS, and tasteless gas that becomes liquid at −268.9 °C (−452 °F). |
|
| 2. |
Corrodes the marbel of the monument |
|
Answer» Answer: Acid rain and pollution corrodes the MARBLE of the monument. The phenomenon is ALSO called Marble cancer. |
|
| 3. |
Excess level of the in the atmosphere damages the oxen layer |
|
Answer» Answer: The Ozone layer reduces harmful UV radiation REACHING the Earth's surface. The Ozone layer is present in Earth’s atmosphere (15-35km above Earth) in the lower portion of the stratosphere and has relatively HIGH concentrations of ozone (O3). Ozone layer depletion is the gradual thinning of the earth’s ozone layer present in the upper atmosphere. Ozone depletion also CONSISTS of a much larger springtime decrease in stratospheric ozone around Earth's POLAR REGIONS, which is referred to as the ozone hole.
|
|
| 4. |
Metals react with oxyen to form _ oxide. a) acidic b) basic |
|
Answer» Metals react with oxygen to form basic OXIDES. Explanation: Metallic oxides are basic in NATURE because they react with dilute ACIDS to form salt and water. They also react with water to form metal hydroxides which are alkaline in nature because these metal hydroxides RELEASE OH− ions in solution. |
|
| 5. |
Please muje ya wala bata do |
|
Answer» Explanation: 1.true 2.false 3.false 4.false 5.true 6.true 7.true 8.true 9.false 10.false |
|
| 6. |
Distance between different displacement |
|
Answer» DISTANCE is the length of the path taken by an object whereas displacement is the SIMPLY the distance between where the object started and where it ended up. For example, lets say you drive a car. You drive it 5 MILES east and then 3 miles west. hope it helps you |
|
| 7. |
Egg white beaten with water froms which type of collide |
|
Answer» TASTY collide Explanation: |
|
| 8. |
Zinc carbonate contains carbon in _ state |
|
Answer» Answer: hope it HELPS you |
|
| 9. |
5) What is order of reaction. |
|
Answer» Answer: The Order of Reaction refers to the power DEPENDENCE of the RATE on the CONCENTRATION of each REACTANT. Thus, for a first-order reaction, the rate is dependent on the concentration of a single species. |
|
| 10. |
Fill in the blank in the given word equation : Magnesium oxide + ______________→ Magnesium hydroxide |
| Answer» | |
| 11. |
Lead is a poor conductor. (true or false) |
| Answer» | |
| 12. |
Fisher projection formula is more commonly used in ________ chemistry. |
|
Answer» biochemistry and ORGANIC CHEMISTRY. I HOPE it's help you!! |
|
| 13. |
A pentahydrated crystalline salt which is blue in colour |
| Answer» | |
| 14. |
A ɡas occupies 560 cm³ at S.T.P..Find its volume when pressure is 700 mm of Mercury and temperature is 27 ⁰C.1)668.13 cm³2)524.68cm³3)426.73cm³4)789.26cm³ |
|
Answer» Answer: the answer is 1) 668.13 CM3 PV= nRT
|
|
| 15. |
Write comparison of elements comparative and mixtures based on existence properties separation |
|
Answer» Answer: element can't be SEPARATED by any physical or CHEMICAL REACTION compounds can't be separated by physical reaction but can be separated by chemical reaction mixtures can be separated by physical method Explanation: hope it helps you Mark me as brainlest |
|
| 16. |
What happen When lead (IV) oxide is heated in a test tube with con. HCI. |
|
Answer» LEAD OXIDE on heating with conc. HCl GIVES lead CHLORIDE and water with the evolution of chlorine gas |
|
| 17. |
Ya wala muje bata do please |
|
Answer» 1. Hydrogen Gas. 2. Intermolecular 3. ALUMINUM Alloy 7075 4. valence shell 5.Lead or Triplumbic oxide. 6. MAGNESIUM ribbon 7. STAINLESS steel 8. tungsten 9. Melting 10. AL203 |
|
| 18. |
Write comparison of elements compounds and mixtures based on existence |
|
Answer» Answer: COMPOUND are substances which can be formed by CHEMICALLY combining two or more elements. MIXTURES are substances that are formed by PHYSICALLY mixing two or more substances. |
|
| 19. |
What happen When calcium bisulphate reacts with dil. HNO3. |
|
Answer» When calcium REACT with DILUTE nitric acid it forms calcium nitrate with hydrogen GAS. |
|
| 20. |
Relative molecular mass of CaSO4D134 amu2) 130 amu3138 amu4) 136 amu |
|
Answer» option 3 is correct Explanation: ca=40 s=32 CASO4= 40+32+64= 138 option 3 is correct |
|
| 22. |
Liquefied Petroleum Gas (L.P.G) used as kitchen fuel is supplied in the liquid form in the gas cylinders. When it comes out from cylinder, it comes out as a gas which burns. Which of the following statements is correct?The process of conversion of liquid to gas involves a chemical change.The process of burning gas is a chemical change.Both conversion of liquid to gas and burning of gas are physical changes.Both conversion of liquid to gas and burning of gas are Chemical changes.Clear selection |
|
Answer» Answer: the CORRECT option is B that is the process of burning GAS is a chemical change |
|
| 23. |
What is Riteherscale ? |
|
Answer» a TOOL which DETECTS the EARTHQUAKES INTENSITY |
|
| 24. |
John painted the inner four walls of a box. Then he put an ice block into it such that it did not touch the walls, but he couldn't do the same when he put water in that box. Why?Liquid takes the shape of container, so it will always touch the walls of the box in which you put it.The molecules of water are more tightly packed than that of ice.The force of attraction between the particles of water is more than that between the particles of Ice.Because water is attracted towards the wooden box while ice is not. |
|
Answer» usjsjzjkzkzkzkozkkzxoxkkxoxoxkc srry |
|
| 25. |
DATEBalanced the reaction+ As u + Pb 3 O4CaridicPbso4 +H2 As O4- |
|
Answer» Answer: |
|
| 26. |
Any one of the product formed isCHO QHC(i)NaOH(excess) 100°C(ii) HH,0CHO OHC |
| Answer» | |
| 27. |
Write the distribution of electrons in Sodium and Oxygen. Atomic number of Sodium is 11 and atomic number of Oxygen is 8 |
|
Answer» should we CONSERVE WATER ? SUGGEST few WAYS to conserve water Explanation: should we conserve water ? suggest few ways to conserve water should we conserve water ? suggest few ways to conserve water should we conserve water ? suggest few ways to conserve water |
|
| 28. |
The half life of C-14 is 5730 years. How old is the wood from archaeological site? |
|
Answer» Answer: The half-life for radioactive decay of 14C is 5730 years. An ARCHAEOLOGICAL artifact containing wood had only 80% of the 14C found in a LIVING TREE. ESTIMATE the AGE of the sample. Hence, the age of the sample is 1845 years. Explanation: THANKS HAVE A NICE DAY |
|
| 29. |
Count the number of solids, liquids and gases from the substances given below and choose the correct option. Rock , Air, Brick , Water vapour, Milk, Juice, Wood , WaterSolids - 2 , Liquids - 3 , Gases - 3Solids - 3 , Liquids - 2 , Gases - 3Solids - 3, Liquids - 3, Gases - 2All are solids |
| Answer» | |
| 30. |
Assertion : Different metals havedifferent reactivities with water anddilute acids.Reason :Reactivity of metals dependson its position in the reactivity series. |
|
Answer» both A and R are True Explanation: plz mark as brainliest and folow |
|
| 31. |
When CH3 group is attached to a benzene ring, it makes the ring:a) a good electrophileb) a good nucleophilec) resonance hybridd) extraordinary stable |
| Answer» | |
| 32. |
Deduction of Graham's law |
|
Answer» Answer: GRAHAM's law states that the RATE of diffusion or of effusion of a gas is inversely proportional to the square root of its molecular weight. ... In the same CONDITIONS of temperature and pressure, the MOLAR mass is proportional to the mass density. |
|
| 33. |
What is a bording school? |
|
Answer» Answer: where the students don't go to their HOME it is the type of hostel . Explanation: |
|
| 34. |
The formula of an acid radical is N3- . The name of the radical is – |
| Answer» | |
| 35. |
A ɡas occupies 560 cm³ at S.T.P..Find its volume when pressure is 700 mm of Mercury and temperature is 27 ⁰C. |
|
Answer» Answer: Shailak Simsboro you have to go back in a bit of TIME to do with it and I have to go to SLEEP now is that what U doing today beautiful and I have to go to sleep now baby girl and I have to go to sleep now baby girl and I have to go to sleep now baby girl and I have to go to sleep now baby Explanation: gjHanso Shailak Rodolfo Avila you have to be with you GUYS are the BEST of the day my I have been in a Shiseidosghetto Alfonso's wisp signatures and you can come over to the and buy a in |
|
| 36. |
Give the symbol and atomicity of the following: [4]i. Oxygen ii. Neon iii. Chlorine iv. Sulphur |
Answer» OXYGEN IS YOUR ANSWERHOPE IT'S HELP YOUHAVE A NICE DAY |
|
| 37. |
What is thermosetting plastic? |
|
Answer» Explanation: |
|
| 38. |
It's only him & I.... ❣️❣️what do you mean by Chemistry in Love?? ❣️❣️ |
|
Answer» all the THINGS is about UNDERSTANDING of each other's EMOTIONS and FELLINGS |
|
| 39. |
Give the IUPAC name of the compound(CH3)2CHCH(C2H5)CH2CH2CH3 |
|
Answer» ORIGINALLY ANSWERED: What is the IUPAC name for (CH3) 2chch (c2h5) ch2h2ch3? I think the above molecule is meant (in the question there seems to be 1 C gone astray). Its name is 3-ethyl-2-methylhexane... |
|
| 40. |
14. A gas which supportscombustion isnitrogenoxygenΟ Ο Ο ΟhydrogenO methane15. boats and parachutes use |
|
Answer» 14.oxygen is the answer 15.hydrogen is the answer |
|
| 41. |
1. A compound containing only two elements is called _______. |
|
Answer» Answer: COMPOUND CONTAINING only TWO elements is called DIATOMIC compound |
|
| 42. |
H₂CO₃ is the chemical formulae of which one of the followinɡ |
|
Answer» Carbonic Acid Explanation: Carbonic Acid is a weak acid usually formed by REACTION b/w CARBON DIOXIDE and WATER. |
|
| 43. |
A Triple bond contains ___ sigma bond(s) and __ pi bond(s)a. 0,3b. 3,0c. 2,1d. 1,2e. 3,2 |
|
Answer» (a) 0,3 is CORRECT |
|
| 44. |
23AEC. State whether true or false.1. Africa occupies an area equivalent to two-fifth of the Earth's land surfa2. The Tropic of Cancer passes through Africa in the north.3. The Atlas Mountains are young fold mountains.4. Lake Victoria is located in the Great Rift Valley.5. In Ghana, cocoa is best grown on forest lowlands.D. Tick the correct answer. |
|
Answer» I have points Explanation: sorry |
|
| 45. |
Why sigma bond is more stronger than pi bond |
|
Answer» Answer: We KNOW that, the larger the EXTENT of overlapping the stronger the bond formed. In sigma bonds, the large overlap of the ORBITAL involves the removal of a large amount of energy. While in pi bonds the extent of overlapping is LESS than sigma bond. Therefore, sigma bond is stronger than pi bond. Explanation: hope it HELPS you good morning ♥ |
|
| 47. |
Q. 5. Explain the nature of the covalent bond using the bond formation in CH3Cl. |
|
Answer» Answer: Here is your answer Explanation: Carbon has 4 valence electrons. In order to make octet, it shares each of the FOUR electrons with each of the three hydrogen atoms and one chloride ATOM. Since, bonds are FORMED because of sharing of electrons, hence these are covalent bonds. |
|
| 48. |
Write any four characterstics regarding the compound with example |
|
Answer» Components in a compound are present in a definite proportion. It has a homogeneous composition. Particles in a compound are of one kind. A compound is made up of one or more ATOMS of the same or DIFFERENT ELEMENTS. In a compound the elements are present in a fixed ratio by mass. |
|
| 49. |
TionPhthalic acid undergo ----- during preparation of phthalic anhydridec. dehalogenationa. dehydrationb. decarboxylationd. dehydrohalogenationcofrhthalin anhuis |
|
Answer» DEHYDRATION yy to the only E mail to fir KASA hua hai ki tahra ka force |
|
| 50. |
The solubility of silver bromide is 7.7multiply 10-¹³. calculate the solubility of this salt |
|
Answer» Answer: Explanation: |
|