This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
Phala aap muj sa insta, Facebook pa Baat karo yea aapna phn number do plzzz yrr |
| Answer» | |
| 2. |
1- Write postulates of Dalton's atomic theory.2-Write law of conservation of mass. Give three examples.3-Write law of constant proportion. Give three examples.4- What is formula mass?5- Write formula and mass of Calcium Sulphite,Calcium carbonate, Sodium Carbonate6- Calculate mass of oxygen atom in a) 20g of Calcium carbonate b) 71 gm of Sodium SulphatePLS ANSWER IT IN SHORT PLSSS |
|
Answer» Explanation: 1- All matter consists of indivisible particles called atoms. Atoms of the same element are similar in shape and mass, but differ from the atoms of other elements. Atoms cannot be created or destroyed. Atoms of different elements may combine with each other in a fixed, simple, whole number ratios to form compound atoms 2-The law of conservation of mass states that matter cannot be created or destroyed in a chemical reaction. For example, when wood burns, the mass of the soot, ashes, and gases, equals the original mass of the charcoal and the oxygen when it first reacted. 3- The law of constant composition says that, in any particular chemical compound, all samples of that compound will be made up of the same elements in the same proportion or ratio. For example, any water molecule is always made up of two HYDROGEN atoms and one oxygen atom in a 2:1 ratio 4-This quantity is called the formula massThe SUM of the masses of the elements in the formula of an ionic compound.. The formula mass is obtained by adding the masses of each individual atom in the formula of the compound. 5-Calcium sulfite: CaSO3 Calcium carbonate: CaCO3 Sodium carbonate: : Na₂CO 6: Sodium carbonate + Ethanoic acid → Sodium ethanoate + Carbon dioxide + Water 5.3 g + 6 g → 8.2 g + 2.2 g + 0.9 g 11.3 g = 11.3 g (Mass of REACTANT) (Mass of product) This shows, that during a chemical reaction mass of reactact = mass of product. hope it helps |
|
| 3. |
Girls, which do u love in blush and highlighter? me highlighter...what about u? |
|
Answer» Answer: Brainly is a PLATFORM for STUDY purposes not for any other KIND of posting. Please MAKE sure you do not post such content again Explanation: |
|
| 4. |
The relative atomic mass of an element expressed in grams is known as?urgent |
|
Answer» Answer: The relative atomic mass of an element is DEFINED as the weight in grams of the number of ATOMS of the element contained in 12.00 g of carbon-12. To calculate the relative atomic mass of chlorine, the AVERAGE mass of one atom of chlorine is FOUND by considering 100 atoms of chlorine. |
|
| 5. |
The property by which a substrance can be drawn into thin sheets papa se puchna thik. |
Answer» The property by the virtue of which they can be beaten into thin sheets is CALLED malleability and the property by the virtue of which they can be drawn into wires is called ductility.Nice WAY to talk with someone, ur answer will not be reported this way...XD...but we R very smart |
|
| 6. |
Write iupsc nomanclature |
|
Answer» Answer: a method of NAMING ORGANIC chemical compounds as RECOMMENDED by the International Union of PURE and Applied Chemistry. please mark me as the brainliest if it helps you |
|
| 7. |
the number of atoms present in 12 G of carbon 12 6 C is called ..............(Boyle 's number /avogadro 's number) |
|
Answer» Answer: the avogadro's no. ..... plz mark me BRAINLIEST |
|
| 8. |
पैसे की विशेषताओं का उल्लेख कीजिए |
|
Answer» Explanation: |
|
| 9. |
लो बीयर पढ़ो संतोष सिंह और अरविंद को तेलुगू |
|
Answer» mtlbbbbbbbbbbbbbbbbbbbbbbbb Explanation: yessssssssssssss |
|
| 11. |
Li,Na,Mg,N में से कोन सा तत्व अम्लीय ऑक्साइड बनाता है |
| Answer» | |
| 12. |
ions |
|
Answer» SORRY I can't UNDERSTAND |
|
| 13. |
Calculate the volume in litre of CO2 librated at NTP when 45 gram of 90% pure lime stone isheated completely. |
|
Answer» Answer: 2.016................ |
|
| 14. |
Of bonding in covalentIntroductionmolecules, and molecular orbital theory forh hetroatomic Covalent malecutes3g . [Co, alo, Color] |
| Answer» | |
| 15. |
Wavelenght of alpha particle is how many times less than an electron? |
|
Answer» Answer: SINCE electrons have a rest mass, unlike photons, they have a de Broglie wavelength which is REALLY short, around 0.01 nanometers for easily achievable speeds. This MEANS that a microscope using ELECTRON "matter waves" instead of photon light waves can see much smaller things. Explanation: HOPE it helps you dear friend |
|
| 16. |
The nucleus of the atom is positively charged while the atom itself is neutral under regular circumstances. True or False |
|
Answer» Answer: Its True. The nucleus of the atom is positively charged while the atom itself is NEUTRAL under REGULAR CIRCUMSTANCES. Hope it helps you DEAR friend |
|
| 17. |
Write the chemical name of the compound with chemical formula Mg₃N₂. Also write the valency of each ion in Mg₃N₂ |
|
Answer» Explanation: |
|
| 18. |
Acowuc no remains same..cectronico24. What is the reason for the slightly different physical properties of all the isotopes of an element25. Explain why, the atomic masses of many elements are in fractions and not whole numbers.26. Which of the following are isotopes and which are isobars?एक्सप्लेन व्हाय एटॉमिक मास ऑफ मेनी एलिमेंट्स एंड प्राइस एंड नॉट इन होल नंबर |
|
Answer» The ELEMENTS have same atomic number but different atomic MASS . The PHYSICAL properties of isotopes are all most same elements ... only they have more number of neutrons in their aton. Explanation: atomic atomic sem HAI iska matlab hai ki |
|
| 19. |
Why is iron not used in lab preparation of hydrogen |
|
Answer» Answer: To PREPARE hydrogen in the laboratory, metals like Na and K are not used because their REACTIONS with MINERAL acids are too violent (ALTHOUGH hydrogen is produced) |
|
| 20. |
Si unit of speed....... m......m...... |
|
Answer» Explanation: METRE per second Speed has the dimensions of distance divided by time. The SI unit of speed is the metre per second, but the most COMMON unit of speed in everyday usage is the KILOMETRE per HOUR or, in the US and the UK, miles per hour. For air and marine TRAVEL the knot is commonly used. |
|
| 21. |
For an element with atomic number 30 how many unpaired e^- are present in it? |
Answer» Atomic No. = 30E.C = [AR] 3D(10) 4s²No. of UNPAIRED electron = 0Explanation: |
|
| 22. |
claculate the mass of ammonia produced if 2×10^3 n2 reacts with 1.0×10^3 h2 .. which is limiting reagent and which reactent is excess calculate its mass |
| Answer» | |
| 23. |
Give the structure and bonding of silicates |
|
Answer» Answer: The basic building block, the STRUCTURAL UNIT, of silicate minerals is the SiO44- tetrahedron. In the SiO44- tetrahedron each SI atom is covalently bonded to 4 oxygen atoms. ... The TETRAHEDRA can link together by sharing corners resulting in Si-O-Si covalent bonds. A number of DIFFERENT structures are therefore possible. Explanation: hope it's helps you ✌️ |
|
| 24. |
Phosphorus pentachloride is introduced into an empty gas syringe which has amovable, tightly fitting plunger. The gas is allowed to expand until equilibrium is reached at a temperature at which the phosphorus pentachloride partially dissociates.Which statements are correct?1) The equilibrium pressure inside the syringe will be greater than atmospheric pressure.2) When the plunger is pushed in the equilibrium adjusts to produce more PCl5(g).3) The volume of gas in the syringe at equilibrium will be greater than if no dissociation hadoccurred. I don't understand this question, why 2 and 3 are the only ones that are true? |
|
Answer» Can you imagine a world without merchants, where we are left to our own devices to acquire GOODS and services without middlemen? Sounds like a harsh place to be. The sale and trade of goods defines much of the development and HISTORY of the world.
Please mark me as BRAINLIST I WANT only ONE Brainlist answer please. |
|
| 25. |
Separation and identification of ions group 1,2,3,4,5,6 cation analysis and anion analysis |
|
Answer» Answer: To follow a classic analytical scheme to separate and identify the ions in a known mixture of Group I cations To then apply this scheme to identify the ions in an unknown mixture of Group I cations. One common task in analytical chemistry is the identification of the various ions present in a particular sample. For example, if you are an ENVIRONMENTAL chemist your job may be to recover soil or water samples in ORDER to determine the presence of toxic ions such as Pb2+ or Hg2+2 . A common experimental method used to identify ions in a mixture is called qualitative analysis. In qualitative analysis, the ions in a mixture are SEPARATED by selective precipitation. Selective precipitation involves the addition of a carefully selected reagent to an aqueous mixture of ions, resulting in the precipitation of one or more of the ions, while leaving the rest in solution. Once each ion is isolated, its IDENTITY can be CONFIRMED by using a chemical reaction specific to that ion. Cations are typically divided into Groups, where each group shares a common reagent that can be used for selective precipitation. The classic qualitative analysis scheme used to separate various groups of cations Explanation: thank you for your question |
|
| 26. |
Boiling point of water? |
|
Answer» 212 DEGREES FAHRENHEIT (100 degrees CELSIUS), |
|
| 27. |
Number of ___and____from the mass number of an atom |
|
Answer» Answer: PROTONS and neutrons Explanation: |
|
| 28. |
Explain demorgans law |
|
Answer» Answer: De Morgon's Law states that the complement of the union of two sets is the intersection of their COMPLEMENTS and the complement of the intersection of two sets is the union of their complements. These are mentioned after the GREAT MATHEMATICIAN De Morgan. This law can be EXPRESSED as ( A ∪ B) ' = A ' ∩ B '. Explanation: HOPE IT HELPS....... |
|
| 29. |
What type of metal shows on photoelectric effect? |
|
Answer» Answer: Photoelectric EFFECT occurs easily if the metal has LOW ionization potential cesium, the ALKALI metal has low ionization potential, hence it is best suitable for photoelectric effect. Plz mark me as BRAINLIEST ❤️✨ |
|
| 30. |
O calculate the pH of o.ood M6 x H So a solutionk |
|
Answer» Answer: The answer to the question is 6h+2=23 Explanation: |
|
| 31. |
How much volume of carbon dioxide at NTP may be obtained from 1kg of calcium carbonate |
|
Answer» nvxgkfkhfhkfo Explanation: HVOVHIHOVHV HHV |
|
| 32. |
OH-(CH2)3- CH(CH3)-CH(CH3)-CH3 IUPAC name? |
|
Answer» Answer: ANSWER In the longest CARBON chain, −OH group is closest to the left-hand side, THEREFORE we number from the left-hand side. There is 5 carbon in the longest chain, in SECOND and fourth positions methyl group is attached and in second position there is an alcoholic group. Thus IUPAC name is 2,4-Dimethyl pentan-2-ol. Explanation: I hope this will HELP you...please help me by following thanking mark as brainliest If the answer is right..... please I beg I don't have much followers... |
|
| 33. |
आणिवक कसक सिध्दांत के आधार पर N2अणु का ऊजार आरेख बनाई तथा बंधक्रम व चुम्बकीय व्यवहार लिखिए |
|
Answer» ffnjviuv77f6u cstfkbugibihbhkbguiygggggg66u89y8o 6t78f4 |
|
| 34. |
Chemistry ....... plz any can give me right answers |
|
Answer» HI.... H r U???? |
|
| 35. |
Which property is not considered a typical metallic property |
|
Answer» Answer: Brittle, ALSO soft. |
|
| 36. |
Difine limiting reagent |
|
Answer» Explanation: The LIMITING reagent (or limiting REACTANT or limiting agent) in a chemical reaction is a reactant that is totally CONSUMED when the chemical reaction is completed. The amount of product FORMED is LIMITED by this reagent, since the reaction cannot continue without |
|
| 37. |
Identify the types of reactions A to E by matching them with the reactions (i) to (v)A: Displacement reaction B:Thermal dissociation C:Reduction reaction D:Double decomposition reaction E: Photochemical reactioni) Mg + 2HCl (dil) MgCl2 + H2ii) Cu(OH)2 + H2SO4 (dil) CuSO4 + 2H2Oiii) NH4Cl heat NH3 + HCliv) 2FeCl3 + H2S 2FeCl2 +2HCl + Sv) 4AgBr 2AgBr2 + Br2urgent |
|
Answer» Answer: i)-A)Displacement reaction ii)-D)Double decomposition reaction iii)-B)Thermal DISSOCIATION v)-E)PHOTOCHEMICAL reaction Hope it helps you Explanation: |
|
| 38. |
OH-CH2-CH2-CH2-CH(CH3)-CH(CH3)-CH3 |
|
Answer» I don't UNDERSTAND, SORRY |
|
| 39. |
Calculate to molecular mass of compares ethonoic acid ch2, cooh ,c=2,h=1,0=1 |
| Answer» | |
| 40. |
An element contain 17 electrone 18 neutrones ? calculate atomic numbername of elementANS FAST OR ILL DIE |
|
Answer» ATOMIC number-17 Mass number-35.5 Name of the element-Chlorine Electronic configuration-2,8,7 Valency-1 |
|
| 41. |
What is the role of acid in our stomuch |
|
Answer» The hydrochloric acid in the gastric juice breaks down the food and the DIGESTIVE enzymes split up the PROTEINS. The acidic gastric juice also kills bacteria. The mucus covers the stomach wall with a PROTECTIVE coating |
|
| 42. |
What is meant by metal reactivity series? State it's importanance. |
|
Answer» Explanation: METAL REACTIVITY series their power to REACTwith other elements. |
|
| 43. |
Which one has more atoms 10g of Al or 10g of Fe ?proof |
|
Answer» Answer: 1o G has more atom okkkk |
|
| 44. |
Q.5, Differentiate b/w following classification ofProcessesHomogenous and heterogeneous process.Reversible andiscreversible frocessFlow and non flow Process |
|
Answer» Answer: Explanation: PLANT cells ADDITIONALLY possess large, fluid-filled vesicles called vacuoles within their cytoplasm. Vacuoles typically compose about 30 percent of a cell's volume, but they can fill as much as 90 percent of the intracellular space. Plant cells use vacuoles to adjust their size and turgor pressure. Vacuoles usually account for changes in cell size when the cytoplasmic volume stays constant. |
|
| 45. |
What is this plzz tell wt v should circle here |
|
Answer» What is the QUESTION ASK PROPERLY. ..... |
|
| 46. |
Comparision of feddback and feedforward control with help of an industry process |
Answer» Answer :Feedback and feedforward in a control system are different schemes for reacting to changes in the system. Each scheme utilizes sensors to measure important factors and a set of rules to react to changes in those factors. Feedback and feedforward CONTROLS may coexist in the same system, but the two schemes FUNCTION in very different WAYS. |
|
| 47. |
1. Treatment of boiler feed water isdone by A. internal conditioningB. external conditioningC. Both A&BD. None |
|
Answer» D. NONE. .............. |
|
| 48. |
it has two hard sails and a soft body make it be B valve it's stay mostly on the sea floor S quilling water out of shell by rapidly opening and closing them..m..m.mm.m |
|
Answer» gh Explanation: ......,............ THANKS a LOT for FREE POINTS |
|
| 49. |
Joint N-11 Reviews-Must Read Shocking TRUTH! |
|
Answer» Answer: OKAY ☺☺☺...soon.. have an GOOD DAY ahead dude... HAPPY learning |
|
| 50. |
AMPredict whether the followingreaction is still spontaneous at 500°C N2+ 3H2 -> 2 NH3. Assume AH= -92.22 KJ/mol and AS= -198. 75J/K/mol. * |
| Answer» | |