Saved Bookmarks
This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
Hybridised state of Fe in FeF6 is |
Answer» PLEASE MARK as BRAINLIEST,FOLLOW me... |
|
| 2. |
For the electrolysis of molten lead bromide a. Name the electrolyte; b. Name the cathode ; c. Name the anode d. Give the reactions at anode. e. Give the reactions at cathode |
|
Answer» Explanation: (i) At the ANODE OXIDATION reaction takes place. At anode : Cu−2e − →Cu 2+
At cathode redution reaction occurs. At cathode : Cu 2+ +2e − →Cu Here both copper ELECTRODES are USED. (ii) At anode : Br − −e − →Br Br+Br→Br 2
At cathode : Pb 2+ +2e − →Pb Here both anode and cathode are made up of GRAPHITE as it is unaffected by bromine vapours. |
|
| 3. |
Write 3 point of difference between mixture and compound |
|
Answer» Explanation: The mixture CONTAINS two or more substances mixed, but neither chemically as well as not in inexact QUANTITY while compound includes two or more elements combined chemically and in a fixed ratio. For instance, Seawater, Crude oil, Mineral oils, Alloys (Brass, Bronze), etc., are some of the mixtures, Water (H2O), Hydrogen Peroxide (H2O2), Sodium Chloride (NaCl), BAKING Soda (NaHCO3), etc. are the name of some compounds. Hope it helps you And mark me in brainlist please please |
|
| 4. |
Corrct techique of sepration of solid constituents in a liquid constituents by adsorption ? |
|
Answer» Thin-layer CHROMATOGRAPHY is a “solid-liquid adsorption” chromatography. In this METHOD stationary PHASE is a solid adsorbent substance coated on glass plates. As adsorbent MATERIAL all solid SUBSTANCES used. in column chromatography (alumina, silica gel, cellulose) can be utilized. Please mark me as brainlist...... |
|
| 5. |
Non metals solution of which is used as an antiseptic on wounds. Potassium dichromate, copper sulphate, potassium....Please answer me.. |
| Answer» | |
| 7. |
What are the chemical formulas of sodium stearate and sodium palmitate |
|
Answer» Sodium Stearate, CHEMICAL structure, molecular formula, Reference Standards. Octadecanoic acid,sodium salt. Sodium stearate [822-16-2]. »Sodium Stearate is a mixture of sodium stearate (C18H35NaO2)and sodium palmitate (C16H31NaO2),which together constitute not LESS than 90.0percent of the total content. Explanation: |
|
| 8. |
*3.Which of the following is not trueO. 0.i mol of any gas at NTP occupies 2.24LO. 1 mol of any gas contain Avogadro number of moleculesO. Imol contains mass equal to molar massO. 0.5mol of gas occupies 2.24LO. Other: |
|
Answer» Answer: |
|
| 9. |
Complete and balance the following equations:1. Zn + HCl -----> _________2. 3Fe+ 4H2O ------> _________3. ______ + HCl ---------> MgCl2 + _________4. ________+ Na2SO4 ---------> BaSO4 + NaCl 5. Zn + NaOH ---------> ____________Class 10 cbse |
|
Answer» Answer 1. ZnCl2 and H2 gas .single displacement rxn 2.Fe(OH)2 and H2 gas single displacement rxn 3.Mg and 2 in FRONT of HCl and the other product is H2 gas double displacement rxn 4.BaCl2 and 2 in front of NaCl double displacement rxn 5.Zn(OH)2 and 2Na and 2 in front of 2NaOH single displacement rxn Explanation: |
|
| 10. |
State the type of reaction each of the following represent.4.PbO+ HNO3————-> Pb(NO3)2+ 2H2O |
| Answer» | |
| 11. |
Name the solvent you would use to separate a mixture of sulphur and carbon. |
|
Answer» Carbon disulphide(CS₂) is a solvent. ADD the MIXTURE of carbon and sulphur to CS₂. The sulphur will GET dissolved in the solvent. |
|
| 12. |
Differentiate iron sulphate and copper sulphate solution |
|
Answer» Answer: (i) copper sulphate with ammonium HYDROXIDE will GIVE you a PALE blue precipitate and IRON(II) sulphate when reacts will give a dirty green precipitate. Explanation: hope it HELPS you...!!!... |
|
| 13. |
Differentiate lead nitrate solution and zinc nitrate solution |
|
Answer» Lead nitrate and ZINC nitrate can be distinguished by ADDING ammonium HYDROXIDE to both. - When NH4OH is added to zinc nitrate, double precipitation reaction occurs giving white ppt of ammonium nitrate. - When NH4OH is added to lead nitrate, no change is observed. |
|
| 14. |
What is the hybridisation of CH3- molecule |
|
Answer» The carbanion has THREE BONDING pairs and one lone pair. Thus, VSEPR theory PREDICTS a tetrahedral electron geometry and a trigonal PLANAR electron geometry. A tetrahedral electron geometry corresponds to sp3 hybridization. |
|
| 15. |
State the type of reaction each of the following represent.3.CuO + H2 --------> Cu + H2O |
|
Answer» Answer: oxidation-reduction reactionExplanation: HOPE THIS HELPS YOU BETTERPLZ MARK ME AS BRAINLIESTGIVE THANKS =TAKE THANKS |
|
| 16. |
What is the hybridisation of PCI5 molecule |
|
Answer» <P>Answer: Hybridization – sp3d The MIXING of ONE s ,three p and one d-atomic ORBITALS to form five sp3d hybrid orbitals of equal energy is called sp3d hybridization. |
|
| 17. |
State the type of reaction each of the following represent. 2. PbO + SO2 -------> PbSO3 |
| Answer» | |
| 18. |
What are CFCs? This question is from chemistry subject. |
Answer» Chlorofluorocarbons (CFCs) are NONTOXIC, nonflammable CHEMICALS CONTAINING atoms of carbon, chlorine, and fluorine. They are used in the manufacture of AEROSOL sprays, blowing agents for FOAMS and packing materials, as solvents, and as refrigerants. |
|
| 19. |
What are the functional group present in dopamine and thyroxine and pencillin |
|
Answer» Explanation: One of the catecholamine neurotransmitters in the brain. It is derived from tyrosine and is the precursor to norepinephrine and epinephrine. Dopamine is a major transmitter in the extrapyramidal system of the brain, and important in regulating movement. A family of receptors (receptors, dopamine) mediate its action. Type Small Molecule Groups Approved Weight Average: 153.1784 Monoisotopic: 153.078978601 Chemical Formula C8H11NO2 Thyroxine, also called 3,5,3′,5′-tetraiodothyronine, or T4, one of the two major hormones secreted by the thyroid GLAND (the other is triiodothyronine). Thyroxine’s principal function is to stimulate the consumption of oxygen and thus the METABOLISM of all cells and tissues in the body. The Function of Thyroxine Thyroxine is one of two hormones that together form what's REFERRED to collectively as the thyroid hormone. Thyroxine travels through the blood to the target cells and is then converted to triiodothyronine, shortened to T3; think of T4 as the messenger, and T3 as the worker that carries out the order. T3 is the active form of thyroid hormone and is primarily responsible for your metabolism, which is the process by which your cells break down FOOD and other substances into smaller molecules they can use. Despite having been discovered almost 90 years ago, penicillins and related compounds, called cephalosporins, remain the most widely-used antibiotics in the world, accounting for nearly 60% of all total antibiotic consumption. From 2000 to 2010 global antibiotic use rose by 36%, and research and study into antibiotics and resistant bacteria continues as an essential and evolving science Molecular Weight: 334.4 g/mol |
|
| 20. |
Atomic number of the four elements A,B,C and D are respectively Z -1, Z, Z +1 and Z +2 . If Z =9 , what is type of bonding between B and B? |
|
Answer» Answer: the question should be bonding between B and D here is the answer atomic number of B is 9 i.e.,fluorine atomic number of D is 9+2=11 i.e.,SODIUM(NA) they will FORM ionic bond which is NaF. hope it helps UUUU..... |
|
| 21. |
WHAT IS CODENSATION AND EVAPORATION |
|
Answer» |
|
| 22. |
Clculate no.of moles in .00273kg of electrons |
|
Answer» 3748579625884379934886339 |
|
| 23. |
Why aromatic acid are solid but acid of acetic acid group are mostly liquid |
Answer» ➠ ANSWER :-
|
|
| 24. |
What mass of N2 will be required to produce 34.0 g of NH3 by the reaction N2+3H2->2NH3 |
|
Answer» From the eq., 28g of N2 produces 34g of NH3 And mass of 1 MOLECULE (2 atoms) of N2=2×14=28g mass of 1 moles of NH3=14+3=17g Hence, mass of 2 moles of NH3=17×2=34g therefore mass of N2 =28g Explanation: |
|
| 25. |
Defin dipole moment draw or dipole diagram of of H2O and BF3 give me answer fast |
|
Answer» Answer: The bond dipole moment USES the idea of electric dipole moment to measure the polarity of a CHEMICAL bond within a molecule. It occurs whenever there is a separation of positive and negative charges. The bond dipole μ is given by: .δ- shows an INCREASE in negative charge and δ+ shows an increase in positive charge. Note that the dipole moments drawn in this diagram represent the shift of the valence electrons as the origin of the charge, which is opposite the direction of the actual electric dipole moment. Explanation: hope it helped you FRIEND if it helps you mark it as BRAINLIEST |
|
| 26. |
Freezing of water is irrevisible or reversible |
|
Answer» reversible Explanation: MARK ME AS THE BRAINLIEST |
|
| 27. |
When two liquids do not mix they form two layers wt it is known as |
|
Answer» Answer: When TWO liquids do not MIX they form two SEPARATE layers and it is known as Immiscible liquids.
|
|
| 28. |
Two solutions of 0.1M cr2o2 2- and 0.1M mno4- are used to titrate fe2+ separately |
| Answer» | |
| 29. |
धर्म कि आड़ पाठ लेखक का नाम |
Answer» धर्म कि आड़ (लेखक) - गणेशशंकर विद्यार्थी । |
|
| 31. |
PØ. During an experiment, an ideal gas is found to obeyadditional law p/V2 constant. The gas is initiall-temperature T and volume V. The temperature at whicexpands to a volume 2V, is(1) 2T(2) 8T(3) 4T16 |
|
Answer» We are given an IDEAL gas which is FOLLOWING an additional law, PV 2 = a constant ....................(1) As the gas is ideal, the gas law is PV=nRT Taking the value of P from the above equation, we get P= V nRT
Putting this value in equation (1), we get V nRT(V) 2
= constant As n and R are constant, above equation becomes, TV= a constant .....................(2) Now, the gas is expanding from INITIAL volume V 1
to final volume V 2
by 2 units, it becomes V 2
=2V 1
From equation (2), we get T 1
V 1
=T 2
V 2
T 1
V 1
=T 2
(2V 1
) T 2
= 2 T 1
So the correct answer is 2 T
|
|
| 32. |
3-Ethyl 2,4-dimethylpentaneStructure formula tenth grade will mark u brainliest |
|
Answer» Answer: 3-Ethyl-2,4-dimethylpentane Cite Download Share Tweet PubChem CID: 14040 3-Ethyl-2,4-dimethylpentane_small.png 3-Ethyl-2,4-dimethylpentane_3D_Structure.png Find SIMILAR Structures Molecular Formula: C9H20 Synonyms: 3-Ethyl-2,4-dimethylpentane 2,4-DIMETHYL-3-ETHYLPENTANE 1068-87-7 Pentane, 3-ethyl-2,4-dimethyl- UNII-ZGK90M81DG More... Molecular Weight: 128.25 g/mol Dates: Modify: 2020-08-22 Create: 2005-03-26 Contents 1 Structures Expand this section 2 Names and Identifiers Expand this section 3 Chemical and PHYSICAL Properties Expand this section 4 Spectral INFORMATION Expand this section 5 Related Records Expand this section 6 Chemical Vendors 7 Literature Expand this section 8 Patents Expand this section 9 Classification Expand this section 10 Information Sources 1Structures HelpNew WINDOW 1.12D Structure HelpNew Window |
|
| 33. |
Magnesium ribbon is rubbed before burning because it has a coating of (a) basic magnesium carbonate (b) basic magnesium oxide (c) basic magnesium sulphide (d) basic magnesium chloride |
| Answer» | |
| 34. |
What is the valency of S in SF2,SF4,SF6 |
|
Answer» the VALENCY of S is 3. Explanation: PLEASE MARK it I am BRAINLIEST |
|
| 35. |
Observation when dilute acid is added to sodium carbonate |
|
Answer» NA2CO3 + HCl( Dilute) = NaCl + H2 CO3 Explanation: I HOPE you got it. If Yes then don't forget me to follow & Mark my Answer as BRAINLIST Answer. |
|
| 36. |
Displacement kitne Prakar ke Hote Hain |
|
Answer» यह तीन प्रकार की होती है: उष्मीय वियोजन जो ऊष्मा के द्वारा होती है, विद्युत वियोजन जिसमें ऊष्मा विद्युत के रूप में प्रदान की जाती है, प्रकाशीय वियोजन जिसमें ऊष्मा प्रकाश के द्वारा प्रदान की जाती हैं. |
|
| 37. |
Calculate the molarity of 450gms of NAOH dissolved in 1 litre of solution? |
|
Answer» MOLARITY = no of MOLES / VOLUME = 450/45 = 10M |
|
| 38. |
9. Fill in the chart with information from the text:EffectCause(a) The cat has many enemies.The cat stretches himself a few times(b)(c) The cat knows his friends andevery landmark60 |
|
Answer» |
|
| 39. |
Plz tell the detailed explanation of "functional groups". (No irrelevant answers!!) |
|
Answer» functional groups are groups of one or more ATOMS with DISTINCTIVE CHEMICAL properties |
|
| 40. |
observation for when sodium hydroxide is added in little and then in excess with zinc sulphate solution |
|
Answer» Little: |
|
| 41. |
8. Which quantam number is wrong in this set of quantam numbersn=3,L=3.m=-3, s=+1/2N=3O 1=3Om=3O D=+ 1/2 |
|
Answer» L Explanation: |
|
| 42. |
Direct current should be used during electroplating. give reason |
|
Answer» Why is DC preferred over AC in ELECTROPLATING? Plating requires ions to flow through an electrolyte in an ELECTRIC FIELD. ... With AC, there will be no net ION flow and no plating will happen because the electric field direction will keep alternating and ions will oscillate back and forth within the electrolyte |
|
| 43. |
An acid with only one replaceable hydrogen ion per molecule |
|
Answer» Answer: An acid with only one replaceable HYDROGEN ION PER molecule is HCL / HNO₃/H₂PO₂ |
|
| 44. |
Acid which is strong dehydrating agent |
|
Answer» <STRONG>Answer: SULPHURIC ACID IS A STRONG DEHYDRATING AGENT. |
|
| 45. |
What are the two concepts of vbt that are applied to structure determinatiin of covalent compounds with examples? In detail |
|
Answer» Explanation: |
|
| 46. |
Calculate the amount of co2 produced by the combustion of 60 gram of ethane |
|
Answer» Answer: 89.6 L Explanation: 2C2H6 + 7 O2- 4CO2 + 3H2O C2H6 = 30amu moles = 2 moles So moles of CO2 = 4 At STP Vol of CO2 = 4 X 22.4 = 89.6L |
|
| 47. |
1. Write down the formulae of(i) sodium oxide(iialuminium chloride(ii) sodium suphide(iv) magnesium hydroxide |
|
Answer» Na2O AlCl₃ Na2S Mg(OH)2 |
|
| 48. |
5. An electron is in a 4F orbital what possible value for quantam m can ithavea. 0,1O b. -2,0,+2c. 0,1,2O d. -3,-2,-1,0,+1, +2, +3 |
|
Answer» Answer: The values of the magnetic QUANTUM(m) are -1 to +1 including zero. Explanation: SINCE the ELECTRON is in a 4f orbital, the VALUE of the PRINCIPAL quantum no.,n=4. For the f orbital, the secondary quantum number, 1=3. |
|
| 49. |
Q.10 What is the Chemical formula ofwashing soda? *Na2(CO3).10H20OK2(CO3)ONaHCO3O Naci11 Which of the following non-metalis a |
|
Answer» NA2CO3 this is the answer hope it HELPS |
|
| 50. |
3. A sample of a salt has the percentage composition : Fe = 36.76: S = 21.11 and 0 = 42.14Calculate the empirical formula of the compound. |
|
Answer» FE= 36.76/56= 0.65/0.65= 1 S= 21.11/32= 0.65/0.65=1 O= 42.14/16= 4.04= 4 |
|