This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
1) (i) Which one of the following will not produce an acid when made to react with water? (a) Carbon monoxide (b) Carbon dioxide (c) Nitrogen dioxide (d) Sulphur trioxide (ii) When Dilute Sulphuric acid reacts with iron sulphide, the gas evolved is (a) Hydrogen sulphide (b) Sulphur dioxide (c) Sulphur trioxide (d) Vapours of sulphuric acid 2) Give balanced equations for the following reactions -: (i) Silver nitrate solution and sodium chloride solution (ii) Zinc sulphide and dilute sulphuric acid PLEASE ANSWER CORRECTLY |
|
Answer» Answer: 1.i. a. CARBON monoxide ii. a. HYDROGEN sulphide 2. i. AgNO3+NaCl--------) AgCl+NaNO3 it's a double displacement REACTION... ii. ZnS + 4H2SO4 → ZnSO4 + 4SO2 + 4H2O here's your answer I hope it HELPS you Mark me as brainliest and follow me pls |
|
| 2. |
Which of the following true about gases state(A) thermal energy >molecular attraction (C) molecular forces |
|
Answer» thermel ENERGY ATTRACTION A OPTION |
|
| 3. |
Predict the total number of atoms in each case.(1) Calcium phosphate (i) Hydrogen sulphide(iii) Magnesium bromide (iv) Sodium oxide(V) Aluminium hydroxideI need the answer quickly please |
|
Answer» Question: Predict the total number of ATOMS in each case. (i) Calcium phosphate (II) Hydrogen sulphide (III) Magnesium bromide (iv) SODIUM oxide (v) Aluminium hydroxide __________________________________________________________ Answer: (i) Calcium phosphate = Ca₃(PO₄)₂ Total atoms = 3 + 2(1+4) = 13 atoms (ii) Hydrogen Sulphide =H₂S Total atoms = 2 + 1 = 3 atoms (iii) Magnesium bromide = MgBr₂ Total atoms = 1 + 2 = 3 atoms (iv) Sodium oxide = Na₂O Total atoms = 2 + 1 = 3 atoms (v) ALUMINUM hydroxide = Al(OH)₃ Total atoms = 1 + 3(1 + 1) = 7 atoms ¯\_(ツ)_/¯Please mark me brainliest( ̄︶ ̄)↗ |
|
| 4. |
Molar mass of ch3ch2oh |
|
Answer» ANSWER: Here you go Explanation: The molar MASS of ethanol with this chemical formula is 46.07 grams. Hope this HELPS you and PLEASE mark me brainliest........... |
|
| 6. |
give reason energy is released during the conversion of F to F- but absorbed during the conversion of O to O2- |
| Answer» | |
| 7. |
इंटरनल पार्ट पार्टिकल्स स्पेस इन मैक्सिमम इन |
|
Answer» Answer: solids The PARTICLES in the SOLID are touching with very little space between them. The particles in a liquid USUALLY are still touching but there are some spaces between them. The GAS particles have BIG distances between them. |
|
| 8. |
148. Number of possible resonating structure of carbonate ions is…(a) 9 (b)6 (c)3 (d)2with explanation |
|
Answer» Answer: 3 is the answer Explanation: LIKE ozone, the ELECTRONIC structure of the carbonate ion cannot be described by a SINGLE Lewis ELECTRON structure. Unlike O3, though, the actual structure of CO32− is an average of three resonance structures. |
|
| 9. |
While playing in a park. A child stung up by a wasp |
|
Answer» PLEASE explain the QUESTION more CLEARLY please MARK me as brainliest. please |
|
| 10. |
Give five example of oxidation reactions |
|
Answer» Answer: H2O is the oxidizing AGENT; it gives oxygen to carbon, which is oxidized to CO. Chlorine is the oxidant, it REMOVES hydrogen from H2S, THEREBY oxidizing it to sulphur. Fluorine removes hydrogen from the water, therefore, fluorine is the oxidant. The water is oxidized to oxygen. mark me as brainliest and please follow me and SUBSCRIBE to my youtube channel abiraj 718 |
|
| 11. |
I. Express the following in scientific notation.(i) 143478.22 |
|
Answer» Answer: 1.437822 * 10 ^5 Explanation: |
|
| 12. |
What is scientific name of grass |
|
Answer» Poeceae is the SCIENTIFIC NAME of GRASS. |
|
| 13. |
A freshly prepared aqueous (Pt(NH3)2Cl2) does not conduct current?why |
|
Answer» Answer: BEACUSE the RESISTIVITY LEVEL of these Compound is LOW |
|
| 14. |
Which of the following exhibits the weakest inter molecule forces(A) NH3(B) HCL(C) He(D) H20 |
|
Answer» Answer: (C) He Explanation: all other molecules will have intermolecular hydrogen bondings which are strong. |
|
| 15. |
Complete and balance the following equations1.Ca+O22.Mg+Cl23.Al2O3+Hcl4.Zn+H2o5.Li+h2 |
|
Answer» Explanation: 2Ca+O2 = 2Cao Mg+Cl2=mgcl2 al2o3+ 3hcl= 2alcl3 + 3H2O + co2 zn + H2O= zno + H2 2li+H2= 2lih HOPE IT HELPS |
|
| 16. |
Calculate the molarity of 20% of ethonalin water and density of the solution is 0.960 |
|
Answer» MOLARITY = 3.48 M MOLALITY = 4.35 m |
|
| 17. |
1degrees c rise in temperature is equal to rise of(A)1deggree f(B)9/5degree f(C)5/9degree f (D)33degrees f |
| Answer» | |
| 18. |
An element X has valency 2 while element Y has valency 2. Write formula of compound formed by X and Y |
| Answer» | |
| 19. |
Express this in scientific notation 5567.28 |
|
Answer» Answer: 5.56728*10^3 Explanation: |
|
| 20. |
146. which of the following possesses ionic and covalent bond?(a)CO2 (b)H2SO4 (c)NH4Cl (d) Nal |
| Answer» | |
| 21. |
Which of the following is not 13and 15 compounds |
| Answer» | |
| 22. |
A solution has pH value of 9. To increase its pH value, we should adda) Dilute acidb) Salt solutionc) Distilled water6 Sodium hydroxide solution |
Answer» a. DILUTE ACID............. |
|
| 23. |
I. Express the following in scientific notation.(i) 5567.28(ii) 143478.22(iii) 0.000025(iv) 0.00030402(v) 7.003II. How many significant figures are present in the following?(i) 200(ii) 2004(iii) 0.200(iv) 0.00456(v) 1.0008 × 106(vi) 2.3206 × 10−5(vii) 23.483(viii) 23.123123(ix) 3.0(x) 12.60III. 1) Convert 100℃ into ℉.2) Convert 27℃ into K. |
|
Answer» Answer: please FIND my attached resume and LET me know if you have any other questions or concerns please SEND me your ADDRESS and I will send the clear to close on the house phone when you GET here I will see if I can find a way you and I will see what you can do to make it to class today I will not have the clear to close my account and it is not the same to you and yours also have a couple of questions for you about it |
|
| 24. |
Pure water does not conduct electricity. However, when a small amount of acid, base or salt is added, it starts conducting. Why? |
|
Answer» Answer: pure water or FRESH water or DISTILLED water does not contain impurities.. So therefore it doesn't conduct ELECTRICITY.Any impurities, LIKE salts, in the water enable it to conduct electricity. |
|
| 25. |
What is added to remove hydrogen sulphide in laboratory preparation of hydrogen |
|
Answer» Hi the answer is below Explanation: A number of processes have been designed to remove hydrogen SULFIDE from drinking water. For levels up to 75 mg/L chlorine is used in the purification PROCESS as an oxidizing chemical to react with hydrogen sulfide. This reaction yields insoluble solid sulfur. Hope this helps you And please follow me and I will follow you BACK plzzzzz... |
|
| 26. |
In Bohr's model of hydrogen atom, if atomic radiusof the first orbit is x, then the radius of the 3rd orbitwill be(1)x/3(2) 3x(3) 9x(4) 6x |
Answer» OPTION 2 is CORRECT 3X..... |
|
| 27. |
element X and Y combine to form two compound XY and X2Y find the weight of Xand Y ,IF THE WEIGHT OF .1 MOLE of XY is 10g and .05 mole of X2Y is 9g?? |
|
Answer» Answer Let X and y be the ATOMIC weights of X and Y Given 0.1 mole of XY 2
weighs 10g ⇒x+2y= 0.1 10
=100⟶(1) 0.05 mole of X 3
Y 2
weighs 9g ⇒3x+2y= 0.05 9
=180⟶(2) (1)⇒x=100−2y Substituting for x in Equation (2) ⇒3(100−2y)+2y=180 ⇒300−6y+2y=180 ⇒y=30 Hence x=100−2(30)=40 |
|
| 28. |
Q:1) Define functional group? Enlist all the functional groups. Write their names,chemical formula and general formula |
| Answer» | |
| 29. |
A metallic carbonate stable towards heat is? a)CuCO3 b)ZnCO3 c)Na2CO3 d)CaCO3 |
|
Answer» and mgco3 ----- mgo+ co2 my friend hope it will HELP you but there is no option in ur option BOX |
|
| 30. |
Class 11 chemistry. Chapter 2 structure of atom |
|
Answer» the ethnic composition of the SINHALA speakers are BUDDHIST most of the Sinhala speakers are Buddhist most of the Tamils are either of the Tamils there is liye main unko |
|
| 32. |
What kind of thermometer is used to measure the minimum and maximum temperature? |
|
Answer» Answer: Explanation: Liquid thermometers often include both Celsius and Fahrenheit temperature SCALES, which are DISPLAYED on either side of the tube. A MAXIMUM thermometer is a FAMILIAR type of liquid thermometer.J |
|
| 33. |
Which of the following moleculepossess polar and nonpolar covalentbond ?a) ammonium chlorideb) carbontetrachloridec) hydrogen peroxided) HCN |
|
Answer» HYDROGEN peroxide Explanation: |
|
| 34. |
Will the following equations occur? if so, complete the equation1.cu+AgNo32.Mg+CuO3.Al+ZnSo44.Zn+CuSo45.MgCl2+Al |
|
Answer» Answer: Cu + 2AgNO3 ---------> Cu(NO3)2 + 2Ag Mg + CUO ----------->MgO + Cu 2Al + 3ZnSO4 ----------> Al2(SO4)3 + 3Zn Zn + CuSo4 -------> ZnSO4 + Cu MgCl2 + Al -------------> No REACTION |
|
| 35. |
Dravana meaning in English |
|
Answer» scary Explanation: PLZ MARK as BRAINLIEST |
|
| 37. |
Enlist all the functional groups. |
| Answer» | |
| 38. |
What are solution and discus its types |
|
Answer» Answer: On the basis of physical STATES of solvent and SOLUTE can be CATEGORIZED as solid, liquid and gaseous solutions. ... In liquid solutions, solid, GAS or liquid is mixed in a liquid state. Gaseous solutions are usually homogenous mixtures of gases LIKE air. |
|
| 39. |
Explain the following condition by which we can convert all physical state into each otherby change in pressure |
|
Answer» uyetyestjttsytwjjhtwywththtwyhwy |
|
| 40. |
What is meant by assay.....?? |
|
Answer» Answer: As a noun, assay means a test or appraisal to determine the components of a substance or object. As a VERB, it refers to the act of analyzing, or of conducting that test. It is USUALLY USED in chemistry-related fields LIKE metallurgy and PHARMACEUTICALS, but you can also assay a poem. |
|
| 41. |
The most powerful nucliophile |
|
Answer» Answer: When we considered the EFFECTS of protic solvents, REMEMBER that the IODIDE ANION was the strongest NUCLEOPHILE. |
|
| 42. |
Conductivity of 0.2M solution of kcl at 298k is 0.025 S.cm^-1.calculate its molar conductivity |
|
Answer» Answer:
The MOLAR CONDUCTIVITY is 124 S CM ^2 mol ^−1 |
|
| 43. |
Energy required to convert magnesium to magnesium ions present in 24 mg of magnesium vapours |
|
Answer» Answer: 2.188 KJ .................................... |
|
| 44. |
Two or more form of elements having different physical properties but rising to identical chemical properties are |
|
Answer» .................................... |
|
| 45. |
Volume occupied by 10 2 molecules of water (density: 1 kg/L) is: |
|
Answer» Volume occupied by 10^2 molecules of water is cm³ Explanation: Molecular weight of water = 18 We KNOW that 1 mole of water contains = molecules Therefore, 100 molecules of water = = moles = gram = gram = kg Given density of water = 1 kg/L Therefore, the volume occupied by kg of water cm³ Hope this answer is helpful. |
|
| 46. |
Can carrosion of metals be an advantage explain with an explain |
|
Answer» Answer: here is ur anss.. HOPE it HELPS.. :) Yes, corrosion can be advantageous ti us. Fkr examole: Advantages of corrosion - Protection : Surface corrosion forms an oxide layer which further protects the inner metal form corrosion. Corrosion prevents corrosion : Some metals like zinc are used as sacrificial anodes to prevent corrosion to other metal. Galvanic corrosion : The principle on which primary batteries work. In which one metal corrodes preferentially to ANOTHER when both metals are in electrical contact, in the PRESENCE of an electrolyte. |
|
| 47. |
draw a structure of the atom and show the position of valence shell, penultimate shell ,Electron,proton and neutron |
| Answer» | |
| 48. |
A 0.1 M basic solution is required |
|
Answer» to be titrated with 0.1 M ACIDIC SOLUTION to get NEUTRAL soln |
|
| 49. |
C(po4)2++sio2=p4o10++casio3 |
|
Answer» Explanation: 2Ca3(PO4)2 + 6SiO2 → P4O10 + 6CaSiO3 Tricalcium Phosphate + Quartz = Tetraphosphorus Decaoxide + Wollastonite Reaction Type Double Displacement (Metathesis) Reactants
2. Quartz - SiO2
Products
2. Wollastonite - CaSiO3
hope this helps you! |
|
| 50. |
What is thermal decomposition? |
|
Answer» Thermal decomposition, or thermolysis, is a chemical decomposition caused by heat. The decomposition temperature of a SUBSTANCE is the temperature at which the substance CHEMICALLY decomposes. The reaction is usually endothermic as heat is REQUIRED to break chemical bonds in the COMPOUND undergoing decomposition. Explanation: HOPE IT HELPS YOU !! |
|