This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
The functional groups which are arranged randomly are called |
|
Answer» ong>Answer: Hydrocarbons are a class of molecule that is defined by functional groups called hydrocarbyls that CONTAIN only carbon and hydrogen, but vary in the number and order of double bonds. ... pl,z make me has BRAINLEST |
|
| 2. |
3325CS GS260०००07280072800हत्यmunडाफमेन साक्लो रकेनचक्रीयकरण संश्लेषणविधिपर टिप्पणी |
| Answer» ONG>Answer: | |
| 4. |
विमीय विश्लेषण क्या होता है |
|
Answer» ONG>Answer: 1 Explanation: |
|
| 5. |
Scanner resolution measured in *InchesResolutiondpiNone |
|
Answer» NER RESOLUTION MEASURED in * Inches Resolution None dpi |
|
| 6. |
What is the electronic configuration of sodium and chlorine? Why do Sodium and chlorine form ions and can they combine? |
|
Answer» ong>ANSWER: Sodium has only one electron in its outermost shell. So, sodium atom will DONATE one electron to chlorine atom and forms a sodium ION i.e. Na+. On the other side chlorine atomic NUMBER is 17, its electronic configuration is 2,8,7. |
|
| 7. |
The functional groups which are arranged same side are called |
|
Answer» ong>Explanation: The functional GROUPS which are ARRANGED same side are called ORGANICS molicules |
|
| 8. |
• Observe the the followingreactionH HC(Benzaldehyde)(1-Phenylethanone)(acetophenonelCH(1. -Diphenylprop 2 money(Benzaletophenonewill this reaction give a mixture ofproducts like a cross aldol reaction? |
| Answer» | |
| 9. |
How is hydrogen chloride gas collected in the laboratory? |
|
Answer» ong>Hydrogen is collected by DOWNWARD displacement of water as it is less denser than water. Hence it comes out at the SURFACE of water . It is insoluble in water so it does not DISSOLVE in water. In CASE of displacement with air, it is not possible EVEN if hydrogen is lighter than air (14.5 times lighter than air). |
|
| 10. |
Which technique will you apply if two proteins have the same molecular weights |
|
Answer» ong>ANSWER: For example, if two MOLECULES have the same mass and shape, the one with the greater net CHARGE will move FASTER toward an electrode. The separation of SMALL molecules, such as amino acids and nucleotides, is one of the many uses of electrophoresis. Explanation: hope it helps |
|
| 11. |
the average atomic mass of element carbon is 12.001 . what are the percentage of Isotopes c 6 12 and c 6 14 |
|
Answer» ong>ANSWER: what are himalyas? showing INTERESTING here xxe-wngx-hod Explanation: |
|
| 12. |
In the laboratory preparation and collection of hydrogen chloride, concentrated sulphuric acid is used as twice- once before the gas is prepared. State the role of conc.suphuric acid in each case. |
|
Answer» > (i) HYDROGEN CHLORIDE gas is prepared by treating SODIUM chloride with concentrated sulphuric acid. The HCl gas is passed through a drying agent to remove moisture where concentrated sulphuric acid plays the ROLE of dehydrating agent as well. (ii) NaCl+H
SO 4
→NaHSO 4
+HCl(g)
|
|
| 13. |
CH,COOⓇK® Electrolysis HOCH-CHIn the above reaction pH of solution with respect to time :-(1) Remain constant(2) Decreases(3) Increases(4) None |
|
Answer» ong>Answer: 1) Remain CONSTANT Explanation: because during ELECTROLYSIS none of the IONS are lost they get collected at terminals |
|
| 14. |
Name this bond [ complex naming ] and explain step by step. [ if you don't know then dont spam let others answer this :) ] |
|
Answer» BIS(METHYL tert-butyl) pentane maybe CORRECT. |
|
| 15. |
I.U.P.A.C name of compound is : CH-CH-CH-CH=CH-C-OHIICHO(1) 4-Formylhex-2-enoic acid(2) 4-oxohex-2-enoic acid(3) 4-Carboxy butenal(4) 4-Ethyl-5-oxopent-2-enoic acid |
|
Answer» ong>ANSWER: Explanation: there are 4 CH and OH is the functional grp |
|
| 16. |
What is the basic theme of organization in the periodic table? |
|
Answer» ONG>Answer:
The basic theme of ORGANIZING of element in the periodic table is to classify the ELEMENTS in periods and groups according to their properties. This arrangement makes the study of elements and their COMPOUND simple and systematic.
|
|
| 17. |
Objective or aim of studying the importance of chemical in our daily life for project work |
|
Answer» ong>Explanation: Explanation: Answer: Answer: Answer: Answer: Width of rectangle is 25 cm. Step-by-step explanation: Given :- A wire bend in form of SQUARE of side 30 cm. Then wire is again bend in form of rectangle of length 35 cm. To find :- Width of the rectangle. Solution :- Here, Concept is : If we are BENDING wire in form of square than again bending it in rectangle. Than, perimeter of square will equal to perimeter of rectangle because we are not increasing length of wire by one MEASURE we are bending it in square and rectangular shape. So, Perimeter of square = 4 × side ⟶ Perimeter = 4 × 30 ⟶ Perimeter = 120 Thus, Perimeter of square is 120 cm. According to concept, Perimeter of square and perimeter of rectangle are equal. So, Perimeter of rectangle is 120 cm. Let, BREADTH or width or rectangle be x cm. We know, Perimeter of rectangle = 2(Length + Breadth) ⟶ 120 = 2×(35 + x) ⟶ 120 = 70 + 2x \⟶ 120 - 70 = 2x ⟶ 50 = 2x ⟶ 50/2 = x ⟶ x = 25 We take, Width of rectangle be x. Therefore, Width of rectangle is 25 cm. |
|
| 18. |
H Pd-BaSO,> ACH, C=C CH->BNaLiq NHWhich statement is correct :-(1) A & B : -cis-2-Butene(2) A & B :- n butane(3) A & B are geometrical isomer of each other(4) A is more stable than B |
|
Answer» ong>ANSWER: what are HIMALYAS? SHOWING INTERESTING here fci frdt kvq Explanation: |
|
| 19. |
You discovered a novel bacterium that glyceraldehyde 3-phosphate is phosphorylated and oxidized by ATP in the following reaction: ATP + H2O + NAD+ + glyceraldehyde 3-phosphate --> ADP + NADH +H+ + 1,3-bisphosphoglycerate a) How is this different from the reaction that occurs in most species? b)Do you think the AG for this reaction is going to be more negative or less negative than the reactionthat occurs in most species? Why or why not? |
|
Answer» ONG>Explanation: By USING the numbers 22,9,7,13 you have to USE these numbers once and by adding ,subtracting ,multiplying and DIVIDING you have to make the answer as 24. |
|
| 20. |
Which of the following does not represents bond dissociation energy (1) H2(e) → 2H)(2) Cl2) 2016)(3) H2O → 2Hg) + O2)(4) 0218) ► 20% |
| Answer» ONG>ANSWER: | |
| 22. |
For oxidation of iron, 4Fe(s) + 302(g) 2Fc,0,(s) entropy change is - 549.4 JK'mol at 298K.A.Hº for this reaction is - 1648 10' JmolAbove reaction is :-(1) Spontancous(2) Non-spontaneous(3) At equilibrium(4) Can't predict |
|
Answer» on 1 SPONTANEOUS REACTION |
|
| 23. |
PH of saturated solution of a metal hydroxide M(OH), is 10. The solubility product (Ksp) of M(OH), will be :(1) 2 x 10-20(2) 4 x 10-30(3) 1 x 10-10(4) 5 * 10-1 |
|
Answer» ong>Answer: The solubility product of a sparingly SOLUBLE metal HYDROXIDE M(OH)2 at 298 K is 5 × 10^-16 mol^3 dm^-9 . The pH value of its aqueous and SATURATED ... Top answer · 2 votes M(OH)2 M^2 + + 2OH^- Ksp = (s)(2s)^2 = 4s^3 = 5 × 10^-16 s = √( 5 × 10^-164) = √( 500 × 10^-184) = 5 × 10^-6 Conc. of OH^- = 2s = 2 × 5 × ... |
|
| 24. |
PH of saturated solution of a metal hydroxide M(OH)2 is 10. The solubility product (K52) of M(OH), will be:(1) 2 x 10-20(2) 4 x 10-30(3) 1* 10-10(4) 5 x 10-13 |
| Answer» ONG>Answer: | |
| 25. |
Thermoplastic is prepared by ____ |
|
Answer» ONG>Answer: Thermoplastics are a class of POLYMERS that can be softened and melted by the application of heat, and can be PROCESSED either in the heat-softened state (e.g. by thermoforming) or in the liquid state (e.g. by extrusion and INJECTION molding) |
|
| 27. |
No of lonepairs inCr+2 |
|
Answer» ong>Explanation: pairs if two electrons are paired but are not USED in chemical BONDING. Thus, the NUMBER of ... |
|
| 28. |
Define isotope for correct answer |
| Answer» | |
| 29. |
SREE VIVEKANANDA MATRIC HIGHER SECONDARY SCHOOL KOOTTUMANGALAM, MONDAIKADU(P.O) MODEL EXAMINATION 2021 MATHEMATICSTIME: 1.30hrsMARKS: 505x1=5(4) 12STD:XI. Choose the correct answer1. If (5,7(3,P) and (6,6) are collinear then the value of P is(1)3(2) 6(3) 92. The equation of a line passing through the origin and perpendicular to the line 7x-3y+4-0 is(1) 7x-3y+4-0(2)3x-7y+4=0(3) 3x+7y=03. The area of triangle formed by pts (-5,00,-5) and (5,0) is(1) 0 sq.units (2) 25 sq.units (3) 5 sq.units4. The scope of the line joining (12,3) (4,a) is 1/8. The value of a is(1) 1(2) 4(3) (-5)(4) 7x-3y=0(4) None of these5. (2,1) is the pt of intersection of two lines (1) x-y-3-0,3x-y-7-0 (2) xty 3, 3x+y=7 (3) 3x+y=3, x+y=7 (4)x+3y-3-0. x-y-7-0(4) 2II. Answer the following questions (Any Six) Question No:13 is compulsory 6 x 2= 12 6. Solve 2m +19m+30-0 by factorization method.7. Solve 2x-5x+2-0 by formula method. 8. If the difference between a number and its reciprocal is Find the number9. Determine x-x-1=0 is the nature of roots of quadratic equation 10. If the pts P(-1.5,3) Q(6.-2) R(-3,4) are collinear or not?11. The line r pusses through the pis (-2,2) and (5,8) and the line S passes through the pts (-8,7) and (-2,0). Is the line are perpendicular to S?12. Find the equation of a straight line passing through (5,-3) and (7,-4).13 13. If a, B are the roots of 7x+ax+2=0 and if B-a = Find value of 'a"III. Answer the following questions (Any Five) Question No.20 is compulsory 14. Solve 9x-12x+4 0 by completing the square method.5x5 2515. A passenger train takes 1hr more than an express train to travel a distance of 240km fromChennai to Virudhachalam. The speed of passenger train is less than that of an express train by20km per hour. Find the average speed of both the trains?16. If the roots of equation (c-ab)x-2(a-bc)x+b-ac=0 are real and equal. Prove that either a-0 (or) a'+b+c=3abe.17. If a, B are the roots of equation 2x-x-1=0 then form a equation whose roots are18. Find the value of k if area of a quadrilateral is 28 sq.units, whose vertices are (-4,-2) (-3,k) (3,-2) and (2,3)19. Using the concept of slope, show that the pts (-2,5) (6,-1) and (2,2) are collinear. 20. A line makes positive intercepts on co-ordinate axes whose sum is 7 and its passes through(-3,8). Find its equation.IV. Answer the following questions1x8-821. Construct a APQR which PQ=&em. R = 60° and the median RG from R to PQ is 5.8cm. |
|
Answer» Explanation: 5.8 CM. |
|
| 30. |
A man ate food with low protein, high carbohydrate produces 6.2 g urea per day. The same man excreted 26.2 g urea per day after three days. Explain the data with logical reasoning. |
|
Answer» ONG>Explanation: The amount of grams of each energy source (fat, carbohydrate, and PROTEIN) and the amount of energy per gram of each energy source is GIVEN on the LABEL. Multiply the grams by the Energy per gram to obtain the Energy. |
|
| 31. |
आधिक कवक सिध्दान्त के प्रमुख अभिसहित क्या है। लिरिवर |
|
Answer» ONG>ANSWER: can we MEET once Explanation: meet.goo /qqv-ibqk-kjd |
|
| 32. |
Explain sp3d Hybridisation using one example? |
|
Answer» ONG>Explanation: Explanation:Example: PF5. In PF5, one of the electrons in 3s ORBITAL is promoted to the higher 3d orbital so that it has FIVE UNPAIRED electrons. These five orbitals hybridize to form five sp3d hybrid orbitals, which adopt trigonal bipyramidal arrangement. |
|
| 33. |
Cation that does not form a precipitate with ammonium hydroxide but forms one with NaOH |
|
Answer» ong>Explanation: jejejej to be a great weekend and I will work with you on the FOLLOWING link is below youhdjdjeu the following link unsubscribe me my NUMBER ONE is NAOH to the email address to the best of luck in your family and friends and family yytyyyy are not the intended ADDRESSEE the contents of this email and any other questions to ask if |
|
| 34. |
*Law of gravitation explains the gravitational force between____* 1️⃣ the earth and a point mass only2️⃣ the earth and sun only3️⃣ any two bodies having some mass4️⃣ two charged bodies onlyanswer me |
|
Answer» ong>Answer: option 3 Explanation: Any TWO bodies having some mass Mark BRAINLIEST PLEASE:) |
|
| 35. |
Assertion: The chemical properties of an isotope are similar Reason Each isotope of an element is a pure substance |
|
Answer» ong>ANSWER: yes Explanation: isotope of some element can be separated by CHEMICAL METHOD such as electrolysis. each isotope of element is a pure SUBSTANCE |
|
| 36. |
Define democracy ? bye EVERYONE meet u on Monday..Hapiee holi..Take care..byeee |
|
Answer» ONG>ANSWER: DEMOCRACY is of the PEOPLE, for the people, and by the people.. |
|
| 37. |
Write the molecular orbital configuration of O2 molecule?Calculate the bond order ? |
|
Answer» ong>Explanation: There are 10 bonding and 5 non-bonding electrons in the orbitals according to the MOLECULAR ORBITAL configuration. THUS, the BOND order of is 2.5. Hope it will help you ❤️ |
|
| 38. |
Resin which is responsible for the removal of anions from water is _____ |
|
Answer» ong>Answer: RESIN is a NATURAL plant EXTRACT it is positively charged please mark me as the brainliest friend |
|
| 39. |
ASSIGNMENT 7 1. Consider three hypothetical ionic solids: AX,AX2, and AX3 (each X forms X-). Each of these solids has the same Ksp value, 5.5 x10-7. You place 0.25 mol of each compound in a separate container and add enough water to bring the volume to 1.0 dm3 in each case. a. Write the chemical equation for each of the solids dissolving in water. b. Would you expect the concentration of each solution to be 0.25M in the compound? Explain, in some detail, why or why not. c. Would you expect the concentrations of the A cations (A+, A2+, and A3+) in the three solutions to be the same? Does just knowing the stoichiometry of each reaction help you determine the answer, or do you need something else? Explain your answer in detail, but without doing any arithmetic calculations. d. Of the three solids, which one would you expect to have the greatest molar solubility? Explain in detail, but without doing any arithmetic calculations. e. Calculate the molar solubility of each compound. |
|
Answer» ONG>ANSWER: I don't know sry TRY to UNDERSTAND |
|
| 40. |
Which reagent are not source of carbanion1 RX2RLi3R2culi4Rmgx |
|
Answer» ong>EXPLANATION: which REAGENT are not SOURCE of carbanion 1 RX 2RLi 3R2culi 4Rmgx |
|
| 41. |
WRITE THE REACTION OF SO2 WITH H2S AND FECL |
|
Answer» ONG>Answer: SO 2 + 2 FeCl 3 + 2 H 2O → 2 FeCl 2 + H 2SO 4 + 2 HCl. SO 2 is a REDUCING agent, FeCl 3 is an oxidizing agent. ; Colorless gas with a characteristic, irritating, pungent odor. |
|
| 42. |
SHORT What do you observe when you are visiting a nearbyList the steps involved in the preparation of fabric. |
| Answer» ONG>EXPLANATION: | |
| 43. |
हाइड्रोजन बंध टिपडी |
|
Answer» ONG>ANSWER: Here's Your Answer हायड्रोजन हे रासायनिक घटक असून एच आणि अणु क्रमांक १ हे चिन्ह आहे. प्रमाणित अणु 1.008 वजनासह, हायड्रोजन नियतकालिक सारणीमधील सर्वात हलके घटक आहे. हायड्रोजन हा विश्वातील सर्वात विपुल रासायनिक पदार्थ आहे आणि हे सर्व बॅरॉनिक द्रव्यमानांपैकी अंदाजे 75% घटक आहे. |
|
| 44. |
Which of the following does not form carbanion with base |
|
Answer» ong>Answer: Cannizaro reaction involves ATTACK of OH- on carbonyl CARBON and H- SHIFT on another carbonyl carbon, no carbanion intermediate. Step by step solution by experts to help you in doubt clearance & scoring excellent marks in exams. |
|
| 45. |
♡Tera Saath hai Toh kya kami hai ♡ ♡Teri har muskan se mili mujhe khushi♡♡Muskuraate Rehna isi tarah humesha♡♡Kyuki teri iss muskan mein meri jaan basi hai..♡#for u my lil..siso#Dhoklu..#love u bhena..❣ |
|
Answer» ONG>Answer: hayeee so sweet THANKS ÇØÇKRØÀÇH xD!! you are the best brother ✌️ |
|
| 46. |
0-27). (a) Arrange the following species in increasing order of their ionic sizes N-NaF 0²-(b) How does atomic radius vary in a period and in a group? How do you explainvariation? |
|
Answer» er: Explanation: B ) In a period, from left to right, with increase in the ATOMIC NUMBER, the atomic radius decreases due to increase in the nuclear charge which increases the attraction of the nucleus for the VALENCE electrons. In a group, on moving from top to BOTTOM, the ionic |
|
| 47. |
Define democracy?' ♡Aankho Me Rahen Walo Ko Yaad Nahi Karte,♡♡Dil Me Rehne Walo Ki Baat Nahi Karte:♡♡Humari To Rooh Me Bus Gaye Hai Woh,♡♡Tabhi To Hum Milne Ki Fariyad Nahi Karte.♡ |
|
Answer» cracy is a FORM of constitution where PEOPLE can ELECT or what their own REPRESENTATIVES. #always keep smiling^_^ |
|
| 48. |
Solve it "If you know" otherwise leave it., |
|
Answer» ONG>Answer: Radioactivity Explanation: Option B ẞ , alpha and gamma . In ẞ reaction it loses 1 electron so Z decreases by 1 In Alpha reaction Atmoic decreases by 1 and mass decreases by 4 and in gamma no change occurs so the same only . |
|
| 49. |
Why are items held together in chemical compound |
|
Answer» ONG>EXPLANATION: please mark as brainilist p please |
|
| 50. |
Ca(HCO3)2M.complete and balance the chemical reaction |
|
Answer» ONG>Explanation: Calcium bicarbonate, also CALLED calcium HYDROGEN carbonate, has a chemical formula Ca(HCO3)2. The term does not refer to a known solid compound; it exists only in aqueous solution containing the calcium (CA2+), bicarbonate (HCO− 3), and carbonate (CO2− 3) ions, together with dissolved carbon dioxide (CO2). The relative concentrations of these carbon-containing species depend on the pH; bicarbonate predominates within the range 6.36–10.25 in fresh water. |
|