This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
Pick out the odd one and give reasons for the following. Calcium oxide, Calcium chloride, Phosphorus pentoxide, Potassium hydroxide. |
| Answer» ONG>ANSWER: | |
| 2. |
Which has the maximum number of molecules among the following? (a) 44g of CO2(b) 44g of O2(c) 8g of H2(d) 64g of SO2iska answer (b) h but plz koi bta do kese iska answer b h?? |
| Answer» ONG>ANSWER: | |
| 3. |
Which of the following is used as nuclear moderator :-O D20О Н2,0O H202O D2 |
|
Answer» ong>Explanation: Heavy water is basically used as a moderator in nuclear REACTORS to slow down the neutrons so that they are captured and BECOME effective to bring about the fission reaction. The main reason why heavy water is used as a moderator is because it CAPTURES LESS neutrons than the normal water. |
|
| 4. |
. Name the molecule in which a triple bond is formed? Which type of bonds they are? |
|
Answer» >
Triple bond, in CHEMISTRY, a covalent linkage in which TWO atoms share three pairs of electrons, as in the nitrogen molecule, N2, or acetylene, C2H2. ❥ the above is the answer of your question❥ hope that's helps you |
|
| 5. |
Giveone of the factorwhich influence the electromagnetienergy |
|
Answer» ONG>Answer: electric current is the FACTOR |
|
| 6. |
The chemical formula of sodium zincate isA) Na2 Zn2 O2B) Na Zn0C) NaZnO2D) Na ZnO2 |
|
Answer» ONG>ANSWER: H4Na2O4Z Explanation: |
|
| 7. |
Consider the following reaction: FeCl3(aq) + NaOH(aq) → Fe(OH)3(s) + NaCl(aq) a- Balance this equation.b- 20 g of FeCl3 were added to 12 g of NaOH. Calculate the obtained mass of each of the products. |
|
Answer» ong>ANSWER: fecl3+3Naoh$$$$ fe(oh)3 + 3 NACL Explanation: 20 gm if fe(oh)3 and 12 gm of nacl |
|
| 8. |
What are the products formed when an aqueous solution of Calcium bicarbonate is boiled. O CaCO3 + H2O + CO2O Ca(HCO3)2 + H2OO Ca(OH)2 +H2OO Ca + CO2 + H2O |
|
Answer» aCO3 + H2O + CO2 Explanation: |
|
| 10. |
Consider the following reaction: 2Fe2O3 + 3C → 4Fe + 3CO2120 g of were added to 7.2 g of carbon.a- Tell whether if the mixture is stoichiometric or not. If the mixture is not stoichiometric, specify the limiting reagent and that in excess.b- Calculate the mass of Fe formed.c- Calculate the number of mol of CO2 obtained.d- Determine the remaining mass of the reagent in excess. |
|
Answer» ONG>EXPLANATION: ejeueyrydydhdjdjdjdndbdvdvd |
|
| 11. |
What is the sign convension when work is done on the system by the surroundings |
|
Answer» ONG>ANSWER: If work is done on the system, its SIGN is positive. If work is done by the system, its sign is NEGATIVE |
|
| 12. |
The ______ of a compound is the symbolic representation of its composition . |
|
Answer» CHEMICAL FORMULAE of different COMPOUNDS can be WRITTEN easily. Hope this will HELP you |
|
| 13. |
(vi) Write the mathematical expression for ionicc product of water. |
|
Answer» ONG>ANSWER: rjdjcjcp iiynxuyoviovrifjrbghfjh |
|
| 14. |
Which of following has highest melting point :-О КСІO RbC1O LiciO NaCl |
|
Answer» ong>ANSWER: The melting point of a compound depends on Vander walls force of attraction which increases as molecular size increases, in given compounds Sr atom has the LARGEST size, so vanderwalls force of attraction will be GREATER in SRF2 and it will have the highest melting point. |
|
| 15. |
Why molecular weight of a compound is fixed but equivalent weight is different? |
|
Answer» ong>Answer: Equivalent weight unlike molecular weight is proportional MASS of chemical entities which combine or displace other chemical entities. It is defined as the mass of an element/compound/ion which COMBINES or DISPLACES 1 part of hydrogen or 8 parts of oxygen or 35.5 parts of chlorine by mass. |
|
| 16. |
(vii) Calculate the quantity of electricity required to deposit 0.2 mol of sodium metal during electrolysis of fused sodium chloride. |
|
Answer» ONG>Explanation: The QUANTITY of electricity required to deposit 1.15 g of sodium from molten NaCl (NA = 23, Cl = 35.5) is : Top answer · 1 vote Mass of Na is divided with its atomic mass to obtain number of moles.Number of moles of Na = 1.1523 = 0.05 moles. Na^ + + e^ - → Na THUS, |
|
| 17. |
The products obtained by the reaction between acid and base are A) saltB) waterC) sulphur |
| Answer» ONG>Answer: | |
| 18. |
Varterprises Town Hall Conde Tumkur Mob: 9741894963 PART-By Seves of the following questions. Each question carries 10 marie710Deline jonization energy. How does it vary along a period and dethe group? ExplainCalculate the bond order of the following: 02, 0; and 05State Pajan's rules. |
|
Answer» ONG>ANSWER: ysisgskbskavsidvejsgeowbekevistsisuakdgeubsvskvsusse |
|
| 19. |
What is super glue ? |
|
Answer» ong>EXPLANATION:STRONG> Cyanoacrylates are a family of strong fast-acting adhesives with industrial, medical, and household uses. They are derives from ethyl cyanoacrylate and related esters. The cyanoacrylate GROUP in the monomer RAPIDLY polymerize in the presence of water to FORM long, strong chains. They have some minor toxicity. |
|
| 20. |
What is ment by carossion |
|
Answer» Corrosion is when a refined METAL is naturally converted to a more stable FORM such as its oxide, hydroxide or sulphide STATE this leads to deterioration of the material. |
|
| 21. |
In N3H, oxidation number of N atoms are :- O -1,0,0O -1/3,-1/3,-1/3O -3, -3, -3O -1,-1,0 |
|
Answer» ong>ANSWER: oxidation number of H ATOM = +1 oxidation number of N atom = x sum of oxidation number of all ATOMS = 0 oxidation number of H + 3 × oxidation number of N = 0 1 + 3x = 0 x = - 1/3 |
|
| 23. |
Oyeee Mere Dost Andhere Ke GhostDouble Ande Ke ToastBujhe Hue LamppostFlop Show Ke HostI Miss uh The Most |
|
Answer» ong>Answer: pls MAKE me brainleast Explanation: pls FOLLOW mohdmansoorali2666 join |
|
| 24. |
Is This Green Ape CBD Gummies Solution Reliable To Use? |
|
Answer» ong>Answer: Unquestionably indeed, as Green Ape CBD GUMMIES is DELIVERED utilizing the local plant called hemp. It is 100% SHIELDED and LIBERATED from RUINOUS manifestations. The makers have guaranteed that this great formula doesn't contain such a body harming constituents. |
|
| 25. |
The reaction intermediate isa) CIb) CO2c) C103d) CIO. |
|
Answer» ONG>ANSWER: the reaction intermediate is (b) CO2 please MARK me as BRAINLIAST |
|
| 26. |
Define octet rule. Using this rule, show the formation of carbon dioxide molecule with dot and cross model. |
|
Answer» ong>Answer: The octet rule is a chemical rule of THUMB that reflects the theory that main group elements TEND to bond in such a way that each atom has eight electrons in its valence shell, giving it the same electronic configuration as a noble GAS. The rule is especially applicable to carbon, nitrogen, oxygen, and the halogens, but also to metals such as sodium or MAGNESIUM.
The valence electrons can be counted using a Lewis electron DOT diagram as shown at the right for carbon dioxide. The electrons shared by the two atoms in a covalent bond are counted twice, once for each atom. In carbon dioxide each oxygen shares four electrons with the central carbon, two (shown in red) from the oxygen itself and two (shown in black) from the carbon. All four of these electrons are counted in both the carbon octet and the oxygen octet, so that both atoms are considered to obey the octet rule. Explanation: |
|
| 27. |
For the azimuthal quantum number ( l) = 2 , number of maximum electrons is________ |
|
Answer» mate!!! for azimuthal quantum (l) = 2 , m = ( 2 × 2 + 1 ) = 5 THUS the number of maximum ELECTRON is ( 5×2) = 10 Hope it HELPS :-) |
|
| 29. |
प्रतिरोध और रोगाणु नाशक के बीच क्या अंतर है |
|
Answer» ONG>ANSWER:
❣❣❣❣ REPORT MY ALL QUESTION I GIVE 10 THANKS ❤
AND FREEE 25 POINTS |
|
| 30. |
Experiments used to know the chemical properties of a drug |
|
Answer» ong>Answer: MITOCHONDRIA are membrane-bound CELL organelles (mitochondrion, SINGULAR) that GENERATE most of the chemical energy needed to power the cell's biochemical REACTIONS. Chemical energy produced by the mitochondria is stored in a small molecule called adenosine triphosphate (ATP).
|
|
| 31. |
Why do element in the same group have similar physical and chemical properties? |
|
Answer» ong>Answer: elements in a group have the same PHYSICAL and chemical properties because their ATOMS have the same number of valence electrons or same valence shell ELECTRONIC CONFIGURATION. |
|
| 32. |
6.022 ×10²³× 6.643×10–²³ is equals to ? please answer it with steps . |
|
Answer» 2 × 10²³ × 6.643 × 10 ^ - 23 6.022 × 6.643 40.004146 hope HELPFUL for you |
|
| 33. |
Which catalyst used in fedel craft acylation and alkylation |
|
Answer» ONG>Answer: Alcohols are OFTEN used as substrates in Friedel-Crafts ALKYLATION reactions. Sulfuric acid is used as a catalyst with alcohols, forming an alkyl sulfate that reacts with the AROMATIC substrate. |
|
| 34. |
2. Identify A, B, C in the following: CH3-CH=CH2 Bry/CC14 AR.TZnСB dil AlkaliKMnO4What ro S |
|
Answer» ONG>ANSWER: मैं खेतों में काम करता हूं तभी मेरे परिवारों को खाना मिलता है फसल अच्छी हो तो कोई चिंता नहीं होती मगर जब किसी आपदा के कारण मेरी फसल निष्फल हो जाती है तब मेरे साथ साथ मेरा परिवार भी मुश्किलों में पड़ जाता है मुझे बहुत ही भारी नुकसान का सामना करना पड़ता है जिसमें मेरा परिवार भी शामिल होता है वह मेरे हर सुख-दुख में हर ...so pls respect kisaan agar kisaan HEIN to ham hein mark me as brainliest ONE |
|
| 35. |
Which element is more metallic among brelium or calcium? Give reason. |
|
Answer» ong>ANSWER: These metals are less reactive than the neighboring ALKALI metal. MAGNESIUM is less active than sodium; calcium is less active than potassium; and so on. These metals become more active as we go down the COLUMN. Magnesium is more active than BERYLLIUM; calcium is more active than magnesium; and so on. |
|
| 36. |
Write down the steps of making sub-total of salary depending on post. |
|
Answer» ong>ANSWER: |
|
| 37. |
What is cell constant? Write its SI unit |
|
Answer» ONG>Answer: The quantity l/A is called cell CONSTANT denoted by the symbol, G*. if we know l and A. Its UNIT are cm–1 ohm–1. The molar conductivity of 0.025 mol L–1 methanoic acid is 46.1 S cm2 mol–1. |
|
| 38. |
As compared to nitrogen o2 is |
|
Answer» ong>ANSWER: Each oxygen atom has 8 protons in its nucleus, while each nitrogen atom has only 7 protons in its nucleus. ... O2 "permeates" approximately 3-4 times faster than does N2 through a typical RUBBER, as is used in tires, PRIMARILY because O2 has a slightly smaller effective molecular size than does N2. |
|
| 39. |
1 G of Ammonium Chloride is added to a test tube containing 2G of Barium Hydroxide what happens when you touch the bottoms of the test tube |
|
Answer» ONG>Answer: Explanation: Ba(OH)2+NH4cl=bacl2+NH4OH
As the BOTTOM of the test tube becomes cool hence we conclude that the reaction is endothermic as it ABSORBS heat from its ENVIRONMENT to complete the reaction
Please mark it as BRAINLIEST
|
|
| 40. |
H2 li2 b2 c2 calculate their bond order and predict their magnetic behaviour |
|
Answer» ong>Explanation: Among H2 , He2^+ , Li2 , Be2 , B2 , C2 , N2 , O2^- , and F2 , the number of diamagnetic species is (Atomic numbers: H = 1 , He = 2 , Li = 3 , Be = 4 , B ... Six species are diamagentic as all electrons are paired. These are H2 (σ 1s)^2 , Li2 KK (σ 2S)^2 , Be2 KK (σ 2s)^2 (σ ^* 2s)^2 , C2 KK (σ 2s)^2 ... |
|
| 41. |
Mention the number of periods and group in long form of periodic table |
|
Answer» ong>ANSWER: Number of PERIODS= 7 Number of GROUPS= 18 |
|
| 42. |
Diamond is very hard due to its ____________ structure. a) Hexagonal layered b) Tetragonal three dimensional c) Tetragonal layered d) Hexagonal two dimensional |
|
Answer» ong>ANSWER: b) TETRAGONAL THREE dimensional Explanation: |
|
| 43. |
ODD ONE OUT(2) DIAMOND,GRAPHITE,COAL,IRON. |
| Answer» ONG>Answer: | |
| 44. |
In with of the fowving sesias all the element are ratio Activ in nature |
|
Answer» ong>ANSWER: The basic natural radioactive ELEMENTS are INCLUDED into four radioactive series as shown in Table I. These are: thorium series, neptunium series, URANIUM series and uranium-actinium series. All of radioactive series articles are bond by irreversible reciprocal transformations. |
|
| 45. |
What is action of semi carbazide on acetone |
|
Answer» ong>ANSWER: Aldehydes, KETONES and CARBOXYLIC Acids Zigya App. Give the reaction of ACETONE with SEMICARBAZIDE. When acetone react with semicarbazide, it forms semicarbazone. |
|
| 46. |
What is photosynthesis? ------------------------------------------I'm getting bored -_- |
|
Answer» WER:-} Photosynthesis, the process by which green plants and certain other organisms TRANSFORM light energy into chemical energy. During photosynthesis in green plants, light energy is captured and USED to convert WATER, carbon dioxide, and minerals into oxygen and energy-rich ORGANIC compounds. hσpє ít'ѕ hєlp. чσu |
|
| 47. |
Why is volume a partial molar quantity but not temperature and pressure |
|
Answer» ONG>ANSWER: Partial molar volumes help to assess the influence of pressure on phase equilibria or REACTION equilibria. The prediction of partial molar volumes or EXCESS volumes is a sharp test for theories of the FLUID state. On the other hand, the interpretation of partial molar volumes or excess volumes is usually difficult, if not impossible. Many mixtures exhibit positive and negative excess volumes, depending on composition, temperature, and pressure. Speculations why some mixture exhibits positive or negative excess volumina are futile, particularly if they are based on measurements at ambient pressure and temperature only. |
|
| 48. |
Karva dhatvik yogik aur sakul ke madhya antar |
|
Answer» ONG>EXPLANATION: कार्बधात्विक यौगिक किसे कहते ... कार्बधात्विक यौगिको मे धात्विक शब्द का ... |
|
| 49. |
Which of the following titration is not performed practically (a) NH4OH versus HCI(b) NaOH wexsus HCl(c)NH4OH versus CH3COOH (d)NaOH versus CH3COOH |
|
Answer» ong>Answer: Follow i n s t a g R a m = niral161 Explanation: → MARK as BRAINLIEST answer. → (c)NH4OH versus CH3COOH → Because it is to DANGEROUS. |
|