This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
(b) Arrange the following compounds in increasing order of property indicated: FCH2COOH,O2N-CH2-COOH,CH2COOH,HCOOH-acid character.Acione, Accialuehyde, Benzaldehyde, Acctopnenone- reactivity towardsaddition of HCN. |
|
Answer» nch of SCIENCE concerned with the substances of which matter is COMPOSED, the investigation of their PROPERTIES and reactions, and the USE of such reactions to form NEW substances. |
|
| 2. |
Four solutions A,B,C,D have Ph as 13,1 ,6,8 respectively which solution is 1) strongly alkaline2) strongly acidic3) weakly acidic4) weakly alkaline |
| Answer» N ASOLUTION BSolution CSolution D | |
| 3. |
Why water is not burnt while comprising of hydrogen and oxygen atoms |
|
Answer» Hydrogen is flammable, but OXYGEN is not. ... When hydrogen combines with oxygen the result is water, where the atoms of hydrogen and oxygen are linked together to MAKE a molecule with ENTIRELY different PROPERTIES. You can't burn pure water, which is why we use it to put out fires instead of starting them. |
|
| 4. |
An atom a belongs to 3rd a and b belongs to 7tha group the formula formed is |
|
Answer» AlCl3Explanation:the 3RD GROUP has 3 electron in outermost shell while 7TH group has 7 electron in outermost shell....so AlCl3.. |
|
| 5. |
Balanced equation for AgNO₃ + Cu → CuNO₃ + Ag |
|
Answer» TIONCu + AgNO3 → Ag + CuNO3This is an oxidation-reduction (redox) reaction:Cu0 - 1 e- → CuI(oxidation)AgI + e- → Ag0(reduction)Cu is a reducing agent, AgNO3 is an oxidizing agent.Reactants:CuNames: Copper source: wikidata, accessed: 2019-09-07source: ICSC, accessed: 2019-09-04, Copper (dusts and mists, as Cu) source: NIOSH NPG, accessed: 2019-09-02, Cu source: wikidata, accessed: 2019-09-07Appearance: Solid in various forms. turns green on exposure to moist air source: ICSC, accessed: 2019-09-04; Reddish, lustrous, malleable, odorless solid. source: NIOSH NPG, accessed: 2019-09-02AgNO3 – Silver(I) nitrate, Silver nitrate source: wikipedia, accessed: 2019-09-28Other names: Silver nitrate source: wikipedia, accessed: 2019-09-28source: wikidata, accessed: 2019-09-02source: ICSC, accessed: 2019-09-04, Nitric ACID silver(1+) salt source: wikipedia, accessed: 2019-09-28, Lapis infernalis source: wikipedia, accessed: 2019-09-28Nitric acid silver(I) salt source: wikidata, accessed: 2019-09-02, AgNO3 source: wikidata, accessed: 2019-09-02, Silver(I) nitrate source: wikidata, accessed: 2019-09-02Appearance: Colorless solid source: wikipedia, accessed: 2019-09-28; Odourless COLOURLESS or white crystals source: ICSC, accessed: 2019-09-04Products:AgNames: Silver source: wikidata, accessed: 2019-09-07source: ICSC, accessed: 2019-09-04, Ag source: wikidata, accessed: 2019-09-07, Element 47 source: wikidata, accessed: 2019-09-07Appearance: White metal. turns dark on exposure to ozone, HYDROGEN sulfide or sulfur source: ICSC, accessed: 2019-09-04CuNO3 |
|
| 6. |
What has happened two cell a and b explain identify the type of solution into which cell A and B are placed name and explain the process that has taken place in cell A and B |
| Answer» | |
| 7. |
Write name of any two metals with their symbol. |
| Answer» AL= AluminiumW= TungstenExplanation:OKAY MARK ME AS BRAINLIEST | |
| 8. |
At what pH, the precipitate La(OH), will occur when 0.010M La" acidic solution is treated with NaOH? The Ksp of La(OH), is 2×10 2¹(A) 8.7(B) 6,8(C) 7.8(D) 5.8 |
| Answer» | |
| 9. |
मेजो टार्टरिक अम्ल की संरचना बनाइए |
|
Answer» टार्टरिक एसिड एक कार्बनिक यौगिक है जिसका आणविक सूत्र COOH (CHOH) है2COOH। इसके दो कार्बोक्सिल समूह हैं; अर्थात्, यह दो प्रोटॉन (एच) जारी कर सकता है+)। दूसरे शब्दों में, यह एक द्विध्रुवीय अम्ल है। इसके अलावा, इसे एक एल्डरिक एसिड (अम्लीय चीनी) और एक succinic एसिड व्युत्पन्न के रूप में वर्गीकृत किया जा सकता है. |
|
| 11. |
फॉर्मलीन में कौन सा एल्डिहाइड खुला होता है |
|
Answer» डिहाइड (FORMALDEHYDE) प्राकृतिक रूप से पाया जाने वाला एक कार्बनिक यौगिक है जिसका अणुसूत्र CH2O है। यह सबसे सरल एल्डिहाइड है, इसमें एक -CHO ग्रूप पाया जाता है। |
|
| 12. |
(b) Write the product in the following reaction CH3CH2CH=CH-CH2CN--------------> 2h2o under the arrow |
| Answer» CH 3 −CH=CH−CN (B)H 2 O(a)DIBAL−H | |
| 13. |
a) 3d श्रेणी के तत्वों के ऑक्सीकरण अवस्थाओं के स्थायित्व की 4d तथा 5d श्रेणी के तत्वों से तुलना कीजिए। |
|
Answer» ️️️️️️️️️️️️️️️️️️️️️️️ |
|
| 14. |
Derive an expression for energy o an electro in hydrogen atom |
|
Answer» Therefore, En∝1n2. Hence the EXPRESSION for total ENERGY of electron in nth BOHR orbit is −mZ2e48ε02h2n2J.Explanation:Mark me as barilinest.... |
|
| 15. |
Hg of NaCl was dissolved in 227 g of water. What is of NaCl in the solution? |
| Answer» | |
| 16. |
21.2 g of H2SO4 in 0.152 L of H2O (density of water is 1.00g/mol) what is the mole fraction of each compound? |
|
Answer» An expression containing variables, numbers, and OPERATION symbols is called an algebraic expression. is an example of an algebraic expression. Each expression is made up of terms. A term can be a signed number, a variable, or a constant multiplied by a variable or variables.\huge\underline{\underline{Types :)}} Types:) There are three basic types of algebraic expressions. They are; Monomial-Which has only one non-zero term. Binomial-Which has TWO non-zero terms. Polynomial- Which has more than one non-zero terms with non-negative integral exponents.mark me as BRAINLIST |
|
| 17. |
5. What was the concentration of seawater CO2 and air CO2 on (in Gray's reef) a. December 11th 2006? b. December 6th 2018? c. May 18, 2008? d. May 19th 2018? |
|
Answer» a will be the ANSWER MARK me BRAINLIEST FIRST PLEASE |
|
| 18. |
(ii) Give a simple chemical test to distinguish between the following pairs of compounds.C6H5CHO And C6H5-CO-CH |
|
Answer» C 6 H 5 COCH 3 being a METHYL KETONE gives iodoform test while C 6 H 5 COCH 2 CH 3 does not.AcetophenoneC 6 H 5 COCH 3 +3NaOI→C 6 H 5 COONa+ CHI 3 ↓Iodoform(Yellow ppt.) +2NaOH |
|
| 19. |
Q.11 Match the Column: Column I (Position of particles X and Y)Column II (Formula)(A) Y=in cubic close packing(p) XYX= in tetrahedral voidsB) X= in cubic close packing(9) X,Y,Y= equally distributed between octahedraland tetrahedral voids(C) Y = in cubic close packingXYX=in octahedral voids(D) Y=in bexagonal close packing(5)XY,X=in 2/3rd of octahedral voids(a) A-p, B-, C-r, D-s (b) A-4, B-p, C-s, D-r(C)A-, B-, C-, D-4 (d) A-s, B-p, C-, D-4 |
|
Answer» petroleum is USED as a source of energy, being rich in FUEL carbon in ELECTRICITY generation or RUNNING some kinds of heat engines. Raw petroleum (also known as crude oil) is used in THREE main ways: transport, generating electricity, and producing materials. |
|
| 20. |
1.1 An organic compound 'A'of the molecular formula C5H10Cl2, is hydrolysed to compound'B' C5H1oO which gives an oxime with hydroxylamine and yellow precipitate with amixture of iodine and sodium hydroxide. The compound A'should be:(a) CH3CH2CCI2CH2CH5(b)CH3CH2CH2CCI2CH3(c) CH3CH2CH2CH2CHCI3(d) CH3CH2CH2CHCICH2СІ. |
|
Answer» (b)CH3CH2CH2CCI2CH3Explanation:(b)CH3CH2CH2CCI2CH3hope u find THR RI8 1 friend |
|
| 21. |
Identify the acid and basic radicals in the given salt mixture |
|
Answer» tify the acid and basic radicals in GIVEN salt mixture NOTE the smell and colour of salt. The salt colour should be white and there should be no smell.Heat a pinch of salt in a dry test tube. The colour of the salt will GET reddish brown.I HOPE YOU LIKE MY ANSWER AND I AM ASMITA SONAM BARLA. THANK YOU AND GOD BLESS YOU. |
|
| 22. |
Q.2 A Mixture of cinnamaldehyde and crotopaldehyde is treated with concentrated alkali.C6H5CH=CHCO+CH3CH=CHCHO ----->,Which statement is true about the above reaction?Alodol condensation takes place and A-carbonatom of crotonaldehyde provides the carbanion(b) Aldol condensation takes place and B-carbonof crotonaldehyde provides the carbanion(c) Aldol condensation takes place and T-carbon atom ofcrotonaldehyde provides the carbanion(d) Aldol condensation takes place and a-carbon andcinnamicaldehyde provides the carbanion. |
| Answer» OPTION B Is the CORRECT ANSWER | |
| 23. |
Write the molecular formulae for the following 1. Calcium sulphide2.Boron nitride3.Magnesium Phosphate4.Sodium iodide5.Aluminium nitrateCalculate the molar mass of the following 1.CHCl32.NaOH3.K2CO34.KCl5.H2SO4 |
|
Answer» The leaves of certain plants exhibit droplets of WATER along their margins in the morning. This particularly happens in plants growing in warm humid conditions. A humid environment hampers transpiration while the roots continue to absorb water from the soil. This builds up a BIG hydrostatic pressure within the plant and “forces out” the excess water directly from the tips of veins in the leaf. SPECIAL pore-bearing structures called hydathodes are present on the margins of the leaf to allow this EXUDATION. |
|
| 24. |
The electron affinities of boron and aluminum are -27 and -42 kj/mol, respectively. Contrary to the usual periodic trends, the electron affinities of remaining elements in group 13 are between those of B and Al. How do you explain this apparent anomaly? |
| Answer» SORRY don't KNOW ANSWER ✌️✌️✌️✌️ | |
| 25. |
Because the B-N unit is isoelectronic with C-C unit, tend to have similar chemistry, although they exhibit some important difference? 1. Describe the difference in physical property? 2.conductivity 3.Reactivity of these two compounds? |
|
Answer» from which SUBJECT is this |
|
| 26. |
Boron or aluminum which element is metal? a semi metal? and what single property best explains the difference in their reactivity? |
|
Answer» The usual oxidation state of boron and ALUMINUM is +3, WHEREAS the heavier ELEMENTS in group 13 have an INCREASING tendency to form COMPOUNDS in the +1 oxidation state. |
|
| 27. |
ASSERTION: A diver is able to cut through water in a swimming pool. REASON: The particles of water has intermolecular space and has less force of attraction.a) If both ASSERTION and REASON are correct and REASON is the correct explanation for ASSERTIONb) If ASSERTION and REASON are correct but REASON is not the correct explanation for ASSERTIONc) If ASSERTION is correct but REASON is incorrect.d) If ASSERTION and REASON are incorrect. |
| Answer» PLANTS, ANIMALS, and microbes are interdependent. This makes the ECOSYSTEM self-regulating and self-sustaining with all the components of the ecosystem. So, the correct ANSWER is option A. Both ASSERTION and reason are true and reason is the correct explanation of assertion. | |
| 28. |
Boron and aluminum very different chemistry. which element forms complexes with the most ionic character? |
| Answer» TION:Boron FORMS only covalent COMPOUNDS whereas aluminIum and other elements of group 13 FORM even some ionic compounds. | |
| 29. |
What is basic salt Please tell urgent |
|
Answer» Salts which are FORMED by the PARTIAL NEUTRALIZATION of a base by an acid are called BASIC Salt : ) |
|
| 30. |
What is acidic salt Please tell urgent |
|
Answer» lts are a class of salts that produce an acidic SOLUTION after being dissolved in a solvent. Its FORMATION as a substance has a greater electrical conductivity than that of the PURE solvent. An acidic solution formed by acid salt is MADE during partial neutralization of DIPROTIC or polyprotic acids. |
|
| 32. |
What is polarizing power and polarizability? |
| Answer» EXPLANATION:Rgsslffkydmdtnts | |
| 34. |
Why do alkali metals have low density? |
| Answer» SINCE alkali METALS have a large atomic size and low atomic WEIGHT, they have low density | |
| 35. |
give three examples of physical changes. Explain whether each change is slow or fast, reversible or irreversible, and man-made or naturali |
|
Answer» A CHANGE which can happen BACKWARD, that is, can be REVERSED is called a reversible change. If you keep water in the freezer for some time, it transforms into ice. But as soon as you take it out of the freezer, it turns into water again. This is a reversible change. |
|
| 36. |
give three examples of chemical changes. Explain whether each change is slow or fast, reversible or irreversible, and man-made or naturali |
| Answer» RUSTING of IRON .irereversibleburning of wood or charcoal .ireversibblebaking of CAKE .man made | |
| 37. |
Give the hydronium ion and hydroxide ion concentrations of solutions with the following values of pH. Which of the solutions is most acidic? Which is most basic? (a) pH 13.0 (b) pH 3.0 (c) pH 8.0 |
|
Answer» andhmjffggegegehskykdykydkydmsymAnswer:EXPLANATION: |
|
| 38. |
4. Write a balanced equation for the proton-transfer reaction between phosphate ion (PO43-) and water and determine in which direction the equilibrium is favoured. |
|
Answer» tion:Calculate the Kb for the base.PO4^3- + HOH ==> HPO4^2- + OH^-Kb for PO4^3- = (Kw/k3 for H3PO4) = 1E-14/4.2E-13 = about 0.024. Even though 0.024 is a "relatively" large number in Kb terms (and PO4^3- is a STRONG base in terms of pH), it is less than 1 which means the NUMERATOR is SMALL and the denominator is large. That means that the reactants predominate at equilibrium |
|
| 39. |
Which component of air gets used up during the process of photo synthesis |
|
Answer» dioxideCarbon DIOXIDE is the COMPONENT of AIR gets "USED up" during the process of photosynthesis.thanks ☺️✌️❤️ |
|
| 40. |
What current is needed to deposit 0.5 g cr from a solution of cr3+ for 1hour |
|
Answer» From FARADAY's law of electrolysis, m=Fit×zMm= mass of the substance LIBERATED at an ELECTRODE in grams = 1gI= total ELECTRIC current passed through the substance=1.25AF= 96485 C mol−1 is the Faraday constantM= molar mass of the substance=52z= valency number of IONS of the substance (electrons transferred per ion)=3So, thetotal time required will be t=M×imFz=52×1.251×96500×3=4453.84 sec=1.24 hrhope it helps youplease mark me as brainlist |
|
| 41. |
1. Which of the following are Brønsted-Lowry acids? (a) HCO2H (b) H2S (c) SnCl2 |
|
Answer» a, bExplanation:Bronsted-Lowry acids donate proton (H⁺)We have H⁺ in OPTIONS a and bHope it HELPS Please MARK as brainliest |
|
| 42. |
The functions of an ameter |
|
Answer» ter (from ampere meter) is a measuring instrument USED to measure the CURRENT in a circuit. Electric currents are measured in amperes (A), hence the name. The ammeter is USUALLY connected in series with the circuit in which the current is to be measured. An ammeter usually has low resistance so that it does not cause a significant voltage DROP in the circuit being measured.if you want any help ASK ok. |
|
| 43. |
2. Which of the following are Brønsted-Lowry bases? (a)SO32- (b) Ag(c) F- |
|
Answer» a, cExplanation:Bronsted - Lowry bases accepts proton (H⁺)HOPE it HELPS PLEASE MARK as brainliest |
|
| 44. |
Shinchan ka hello ? xD abb main itna bhi kuch khaas nahi xD -,- |
|
Answer» then that's OK...EXPLANATION:i CANT speak at bio SORRY. |
|
| 45. |
Find out the energy and wave length of radiation required for electronic transition in Hex–1, ,3, 5-triene using the concept of particle in 1D box. |
|
Answer» ehehe I DON'T KNOW |
|
| 46. |
Land nitrate garm karne per aayojit hokar land Darkside 1 Nitrogen dioxide Deta Hai is abhikriya Mein oxygen bhi banti hai is prakriya ke liye santulit rasayanik samikaran likhiye |
|
Answer» लेड नाइट्रेट को गर्म करने से जो दो गैसें निकलती हैं, उनके नाम (i) नाइट्रोजन डाइऑक्साइड (NO2)(II) ऑक्सीजन (O2) हैं। मुझे आशा है कि यह आपकी मदद करेगा। |
|
| 47. |
What is stalk effect |
|
Answer» An elevated BLOOD prolactin level (hyperprolactinemia) occurring as a result of tumors or other masses WITHIN or near the PITUITARY gland and stalk that block delivery of DOPAMINE (a neurotransmitter) from the HYPOTHALAMUS to the prolactin secreting cells of the pituitary.Explanation: |
|
| 48. |
What is zeamen effect ,,,,,,,,,,,,,, |
|
Answer» Zeeman EFFECT,, in PHYSICS and astronomy, the splitting of a spectral line into TWO or more components of SLIGHTLY different frequency when the light SOURCE is placed in a magnetic field.Explanation:Hope that helps you |
|
| 49. |
That means I should not answer the question assumption of Dalton's theory |
|
Answer» Dalton's atomic theory was the first complete attempt to DESCRIBE all matter in TERMS of ATOMS and their properties. ... The first part of his theory states that all matter is made of atoms, which are indivisible. The second part of the theory says all atoms of a given ELEMENT are IDENTICAL in mass and properties. |
|
| 50. |
What does TD on glassware mean?TC? |
|
Answer» to containTC or TD abbreviated for “to contain” and “to deliver” respectively. In a 'TC' MARKED pipette, the contained quantity of the LIQUID CORRESPONDS to the CAPACITY printed on the pipette, While in 'TD' marked pipette, the delivered quantity of liquid corresponds to the capacity printed on the pipetteExplanation:HOPE it's being helpful to you |
|