This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
Name /give examplesa. Petroleum productb. Cosmeticsc. Buliding materialsd. Explosives |
| Answer» | |
| 2. |
साधारणतया हैलोजनों का सामान्य इलेक्ट्रॉनिक विन्यास........होता है। |
|
Answer» NS2 np5 Explanation: n= 1-7 it having OXIDATION state of -1. |
|
| 3. |
Explain in detail about classification of solution on the basis of amount of solute |
|
Answer» Answer: Plz mark as BRAINLIEST....I BEG u plz........ Explanation: On the Basis of the Amount of Solute Added Based on the amount of solute present in the solution, we can classify them into the following TYPES. Unsaturated Solution: An unsaturated is one that can dissolve more solute at a definite temperature. It MEANS that we can still add more solute to the SOLVENT. |
|
| 4. |
An element X belongs to 3rd period and 17 group state number of valence electrons in it |
|
Answer» As all the elements which BELONG to 17th group have a valency 1 and valence ELECTRONS as 7. |
|
| 5. |
What happens when a base is exposed to air |
|
Answer» NOTHING HAPPENS EG:SOPE Explanation:I HOPE IT IS ENOUGH
|
|
| 6. |
How many moles are there in 28g of Nitride ion? |
|
Answer» 12.04 ×10²³ ATOMS are present in 28 g of nitride ion . hope it helps you mate. please thank and MARK my answer as BRAINLIEST. @ ANUSHA ❤✌ |
|
| 7. |
Three vectors satisfy the relation a.b=0 and a.c=0then how is a parallel to b×c |
|
Answer» dflifpipfpcupgij0bob. vbdydoiv NSN ansba s s d. |
|
| 8. |
Jal ke jamne par uske anu ke bich ki duri badhti h ya ghahti h |
|
Answer» Answer: Duri ghati KYU ki sabi particles paas AANE par wo solid ho JATA hai |
|
| 9. |
1.Tetrachloromethane and water can be separated using a separating funnel. What can bededuced from this statement?A They do not mix together.B They have different boiling points.с They have different colours.D They have different densities.2.What method would you use to obtain pure water from a mixture of water and ink? State, withreasons, what happens to the colour of the mixture during the process.3.A student was given some statements about simple distillation and fractional distillation. Shewas asked to consider whether each of the statements is true or false. Her answers are shownbelow. State, with reasons, whether her answers are correct.StatementTrue/FalseTrue(a) Both simple distillation and fractional distillation require acondenser and a distillation flask.False(b) Simple distillation is used to separate a solute from a solvent.(c) Fractional distillation can only be used when the boiling points ofthe liquids in the mixture are far apart.FalseTrue(d) During fractional distillation, the liquid with the highest boilingpoint distils over first. |
|
Answer» Answer: 1-A , 2 - Chromatography Explanation: A seperating funnel is USED for IMMISCIBLE liquids such as OIL and water , THUS STATEMENT A is correct. |
|
| 10. |
3 nitro heptane structure.....answer with attachment plzzzzz |
|
Answer» RESULT for 3 nitro heptane structure 3-Methylheptane is a BRANCHED ALKANE isomeric to octane. Its structural formula is CH3CH2CH(CH3)CH2CH2CH2CH3. It has one stereocenter. Its refractive index is 1.398 (20 °C, D). |
|
| 11. |
Which one of the following will turn red litmus blue? *1 point |
|
Answer» where are the OPTIONS??? |
|
| 12. |
why do some bridges have weight limits that depend on how many wheels or axles the crossing vehicle has? |
|
Answer» Answer: Because it can HOLD the weight of CERTAIN VEHICLES of certain wheels |
|
| 13. |
Can nonsoluble bases be ionized? |
Answer» ⟿An acid in a BASE SOLUTION will ionize; a base in an acid will ionize. LIKE solutions do not ionize. When pKa is less than pH, around 99 percent to 100 percent of the DRUG will ionize. |
|
| 14. |
What is it's answer. |
|
Answer» The OXYGEN CARRYING PIGMENT of BLOOD is HEMOGLOBIN |
|
| 15. |
EmptedQ: 12Lanthanide contraction can explain ?ion ListN34AAtomic number of the series678101112BIonic radius of series4151681920С22324Density of the series527283132DNumber of extra nuclear electrons3536O39404344< Prev. QuestionNext Question >Finish the ExamMark for Review Clear Responsee S |
|
Answer» Answer: ATOMIC RADIUS can explain the lanthoid CONTRACTION Explanation: DUE to lanthanoid contraction atomic radius of lanthanoid are same |
|
| 16. |
Write Chemical reaction of iron (fe),magnesium (mg) and calcium (ca) with hydrochloric acid (Hcl) and sulphuric acid (H2so4) . Plzz send me a only reaction means equation type anwer jse books me hota h and aaj raat me hi dena mera question ka answer plzzz!!!! |
| Answer» | |
| 17. |
For n=4, Which one of the following value of I is not possible? |
| Answer» | |
| 18. |
Cu crystallizes in fcc unit cell with edge length of 495pm. What is the radius of Cu atom ? |
|
Answer» a = (2√2)*r r = a/(2√2) = 495/(2√2) = 175 pm Hope it will be HELPFUL ✌️ |
|
| 19. |
what method would you use to obtain pure water from a mixture of water and ink? state with reasons , what happens to the colour of the mixture during the process. answer in detail plz with example . ans fast |
|
Answer» FILTRATION is the TECHNIQUE USED to PURIFY |
|
| 20. |
The units of viscosity is |
|
Answer» The SI unit of DYNAMIC viscosity is the newton-second per square meter ( N·s / m2). The SI unit of viscosity is the PASCAL second [Pa s], which has no SPECIAL name. hope it HELPS you mate. please thank and Mark my ANSWER as brainliest. @ ANUSHA ❤✌ |
|
| 21. |
Accretion: at normal pressure the boiling point of water is 100 Celsius for 3 70 3.15 k .Reason: as the pressure increases boiling point of water also increases.A. both association a and reason or true and reason are is the correct explanation of the assertion aB. Both assertion and reason our true but reason our is not the correct explanation of assertion aC. Assertion is true but recent are is false.D. Assertion a is false but reason r is true |
|
Answer» Answer: D. ASSERTION a is false but REASON R is TRUE |
|
| 22. |
Why phenol is less polar than ethenol? Give proper reason. |
Answer» Phenols are more ACIDIC than phenols because delocalization of ELECTRONS takes place in phenols by resonance . |
|
| 23. |
(iii)निम्न में से कौन-सा ऑक्साइड प्रबलतम अम्लीय है--(अ) H20(ब) Al203(स) CO2(द) SO2 |
Answer» सबसे प्रबलतम अम्लीय ऑक्साइड |
|
| 24. |
Mno2+4hcl=Mncl2 +2h2o+cl2 yogik kaa naam or upchyan apchyan |
|
Answer» Answer: PLZ TRANSLATE THE QUESTION SO THAT MANY CAN ANSWER THIS QUESTION PLZZ DO THAT FIRST |
|
| 25. |
What are the constituent elements of Potassium permanganate |
|
Answer» Answer: PLZ SUPPORT EMATE Explanation: Chemical COMPONENTS of the Formula Given the formula for potassium permanganate, KMnO4, its constituent elements are potassium (K), manganese (Mn), and OXYGEN (O). The formula indicates that there is 1 mole K, 1 mole Mn, and 4 moles O per mole of KMnO4. |
|
| 26. |
Elementmeaning examples etc |
|
Answer» Answer: A chemical element refers to the PURE SUBSTANCE of one type of atom. ... For example, CARBON is an element comprised of atoms having the same number of protons, i.e. 6. Common EXAMPLES of elements are iron, copper, silver, gold, hydrogen, carbon, nitrogen, and oxygen.ʜᴏᴘᴇ ɪᴛ ʜᴇʟᴘs ᴜ ᴍᴀᴛᴇ |
|
| 28. |
3inheritance of traits. State the visible characters of Fjand F2 progenies.21. Explain giving reasons the bending of the shoot tip of a plant towards light source coming from ongside of the plant22. It is desired to obtain an erect image of an object, using concave mirror of focal length of 12 cm.(i) What should be the range of the object distance in the above case?(ii) Will the image be smaller or larger than the object? Draw a ray diagram to show the formation ofimage in this case.(iii) Where will the image of this object be, if it is placed 24 cm in front of the mirror?23. Suppose your parents have constructedom there |
|
Answer» The RECESSIVE characters appear in the F2 generation. Law of SEGREGATION. Laws of Inheritance. Image source: wikipedia. This law STATES ... |
|
| 29. |
How to find ionic or co - valent compounds |
|
Answer» Ionic COMPOUNDS is made from a METAL and a non metal and co-valent compound is made from only non METALS. |
|
| 31. |
o no me ye kha ki thum boli na ki tum 1st class ho tho me write kya ki me 2 nd class hu ok so rupsa puchi ki kya 2nd bro tho me bola ki sindhu 2nd class ka matlab janti ha ki me 2nd class hu ok |
|
Answer» I hope so you have understand...what I told you in RUPSA's question... you will think I an negative with you so...it's. true cuz you SAID bad about my Tavish. but don't behave again ...IM positive with you now.... reply me if any QUERY..or any other... |
|
| 32. |
What happens when , hydrochloric acid is completely reacts with sodiumhydroxide solution , give word as well as symbolic reaction |
|
Answer» Answer: Hydrochloric acid reacts with sodium hydroxide to FORM sodium chloride (the salt) and WATER. Sodium chloride is made up of Na+ cations from the base (NaOH) and Cl- anions from the acid (HCl). HCl+NaOH→H2O+NaCl. Hydrogen bromide reacts with POTASSIUM hydroxide to form potassium bromide (the salt) and water... Explanation: hope it helps you |
|
| 33. |
Group number of elements with z=104 |
|
Answer» Answer: RutherfordiumRutherfordium (RF), an artificially PRODUCED radioactive transuranium ELEMENT in Group IVb of the periodic table, atomic NUMBER 104.
|
|
| 34. |
Which of the alkali metal is having least melting point1 sodium2 potassium3 rubidium4 caesium |
|
Answer» OPTION 4 Explanation: |
|
| 35. |
Initial concentration ofthe reactant is 1.0M. The concentration becomes 0.9M, 0.8M and 0.7M in2 hours, 4hours and 6hours respectively, then the order of reaction is |
|
Answer» Explanation: Here INITIAL concentration is 0.1M=A 1 Other time and CORRESPONDING concentration are given as Time Cocentration- t 1 =0H A 1 =1.0M t 2 =2HA 2 =0.9M |
|
| 36. |
write the observation when Dilute acid is added to a solution of metal carbonate or metal hydrogen carbonate. |
|
Answer» Explanation: When dilute acid reacts with metal carbonate SALT,water and carbon dioxide are PRODUCED. Please mark me as Brainliest!!! |
|
| 37. |
Write the observation Crystals of hydrated copper sulphate are heated. |
|
Answer» PLZ,if it is correct plz rate ⭐me,like me and follow me and mark me as brainlist Explanation: The copper sulphate crystals CuSO4. 5H2O contain 5 water molecules which are known as water of crystallization. When we heat the crystals, these water molecules are removed and the salt TURNS WHITE. If we moisten the crystals again with water, the blue colour of the crystals reappear. |
|
| 38. |
6. The de Broglie wave length of Img grain of sand blown by a 20m s-1 wind is. |
|
Answer» Answer: the de-broglie WAVELENGTH of 1 MG grain of SAND BLOWN by a 20m/s wind is- a) 3.3 *10^29.ʜᴏᴘᴇ ɪᴛ ʜᴇʟᴘs ᴜ ᴍᴀᴛᴇʙᴇ ʙʀᴀɪɴʟʏ |
|
| 39. |
Mnemonic in English for spectrochemical series |
|
Answer» Answer: too tough for me PLZ ASK question of mine level thank U |
|
| 41. |
3How will you create an artificial aquatic ecosystem, which is se9. Explain the processes of aerobic respiration in mitochondria of a cell and anaerobic respiration in yeastand muscle with the help of word equations.In a pea plant, the trait of flowers bearing purple colour (PP) is dominant over white colour (pp).Cand generations with the help of a cross following the rules of |
| Answer» | |
| 42. |
Sodium chloride is a neutral salt whereas sodium carbonate is basic. Explain on the basis of the acid and base that reacted to form these salts. |
|
Answer» Answer: sodium carbonate (NA2CO3) 2Na^+ is CAME from sodium hydroxide (NaOH), a strong base and (CO3)²- is came from carbonic acid (H2CO3), a weak acid it is CLEAR that, Na2CO3 is formed by strong base and weak acid. so, Na2CO3 is BASIC in nature or it is a basic salt. Read more on Brainly.in - brainly.in/question/120394#readmore |
|
| 43. |
Write the observation when Active metal is added to dilute hydrochloric acid. |
|
Answer» Answer: the metal STATS reacting with the acid it get combined with the negative ion and HENCE the HYDROGEN bubbles will come out of the solution . THANK you hope it helps ❤️ |
|
| 44. |
For class 8..... answer it quick guys |
|
Answer» 1. HAND picking, Winnowing. 2. Evaporation. 3.distillation. 4. filtration.. 5. chromatography. 6.by using magnet. Explanation: Hope it helps you. |
|
| 45. |
Write the step in deducing the chemical formulae of the following compounds- 1-Sodium sulphate 2-Potassium nitrate 3-ferric phosphate 4-calcium oxide 5-aluminium hydroxide- |
|
Answer» kkkok Explanation: okkkkkkkokokokokokokookol |
|
| 46. |
What is sublime ..? |
|
Answer» Answer: sublimer; sublimest. DEFINITION of sublime (Entry 2 of 2) 1a : lofty, grand, or exalted in thought, expression, or MANNER. b : of outstanding spiritual, intellectual, or moral worth. c : TENDING to INSPIRE awe usually because of elevated quality (as of beauty, nobility, or GRANDEUR) or transcendent excellence. |
|
| 47. |
Find the answer plz |
|
Answer» Answer: 4. (c) Explanation: Hope it HELPS you if so, |
|
| 48. |
When an acid reacts with metal carbonate or a metal carbonate or a metal hydrogen carbonate, it gives the corresponding salt, gas and one more product .name the gas and product name the gas and product. 1. carbon dioxide 2.hydrogen ,salt 3.carbon dioxide, salt 4.all of the above |
|
Answer» Acids give carbon DIOXIDE GAS, respective salt and water when they react with METAL HYDROGEN carbonate. Acid + Metal hydrogen carbonate → Salt + Carbon dioxide + Water. |
|
| 50. |
How is sri chaitanya |
|
Answer» LOOK above some INFORMATION about SRI chaiyanya thanks...... |
|