Saved Bookmarks
This section includes InterviewSolutions, each offering curated multiple-choice questions to sharpen your knowledge and support exam preparation. Choose a topic below to get started.
| 42951. |
Akshu pls jaldi bol na |
| Answer» | |
| 42952. |
Akshu pls bol do |
| Answer» | |
| 42953. |
Eva congo congo????✨?????? |
| Answer» | |
| 42954. |
Akshu pls |
| Answer» | |
| 42955. |
Akshu pls pls |
| Answer» | |
| 42956. |
Akshu can u do me a favor |
| Answer» | |
| 42957. |
Akshu kaha so gai kya |
| Answer» | |
| 42958. |
Can i call u akshu Akshita |
| Answer» | |
| 42959. |
Eva kya hua |
| Answer» | |
| 42960. |
Akshita kisi ko bataya |
| Answer» | |
| 42961. |
Akshita kal ka kisi freind ko bataya |
| Answer» | |
| 42962. |
Akshita talk to mee |
| Answer» | |
| 42963. |
Dj Akshita kha hai |
| Answer» | |
| 42964. |
write merits and demerits of doberiener\'s classification of elements. |
| Answer» | |
| 42965. |
Akshita gussa hai kya |
| Answer» | |
| 42966. |
Hii dj |
| Answer» | |
| 42967. |
Esterification |
|
Answer» Reaction of alcohal with ethanoic acid in presente of H2SO4 Mixing of ethanoic acid with alcohol makes ester |
|
| 42968. |
Give an example of a flower which contains both stamens and carpels |
|
Answer» No , recognise ?? DJ Hibiscus /Mustard Papaya Mustard , rose , hibiscus |
|
| 42969. |
Dare for u all.open ur internal feelings here below |
| Answer» | |
| 42970. |
What do u mean by or understand by aquaregia? |
|
Answer» Aqua Regis is a Latin word means royal drink it is use for dissolving noble metals like gold.... It is form with the mixing of HCl and hno3 in 3:1 ratio Aqua regia is a liquid which is prepare by mixing hydrochloric acid and nitric acid in ratio 3:1 |
|
| 42971. |
Hlo .can i give u a task.if u r strong to complete it |
| Answer» | |
| 42972. |
What is flux?? |
| Answer» | |
| 42973. |
Proof of snell\'s law? |
| Answer» The ratio of sin I of angle of incidence to the sin r of angle of refraction is a constant, for a light of given colour and a given pair of media Sin I ÷ sin r=constant | |
| 42974. |
How is mendleve |
| Answer» | |
| 42975. |
How to make a physics modal in any topic to get good marks |
| Answer» | |
| 42976. |
Found in free State and native state means ? |
|
Answer» And native state It means that it is lower reactive/less reactive and do not have any action with various agents like air,water,etc.. |
|
| 42977. |
Hello friends? |
| Answer» | |
| 42978. |
Hor to make a modal of physics in many topic to get good mark |
| Answer» | |
| 42979. |
Hlo dear friends .how r u all.i m making bore |
| Answer» | |
| 42980. |
What is the importance of reproduction |
| Answer» to maintane our generation | |
| 42981. |
What do u mean by hymen |
| Answer» Hymen means - - A fold of tissue that partly covers the entrance to the ****** of a Virgin. | |
| 42982. |
State State the law of Newton |
| Answer» | |
| 42983. |
What is the shape of Earth\'s imaginary magnet |
| Answer» Bar magnet | |
| 42984. |
Akshita dj eva akansha where are you ???? |
| Answer» | |
| 42985. |
What is difference between magnetic pole and geographical pole |
| Answer» Magnetic pole of magnet whereas geographical pole is the earth\'s four pole that is east west north and south | |
| 42986. |
Hi Akshita |
| Answer» | |
| 42987. |
Corrosion is Sometimes Benificial .HOW ? |
|
Answer» Thnx ishan It is only in the case of al and cu bcoz due to corrosion a oxide layer is formed which prevent further weakening. Due to corrosion the shine of al and cu do not get tarnished |
|
| 42988. |
Explain power ?? |
| Answer» VI | |
| 42989. |
What is the akalis |
|
Answer» Yes Those bases with r soluble in wther. Eg naoh and koh . More tge 1st group of modern periodic table has all alkalis Bases which dissolves in water |
|
| 42990. |
Why a food chain has only a few trophic level? |
| Answer» Due to 10 percent law | |
| 42991. |
Mechanism of breathing |
| Answer» | |
| 42992. |
Preparation of bleaching powder |
|
Answer» Slaked lime CA(oh)2+cl2----Caocl2+H2O Dre calcium hydroxide + cl2 will give bleaching powder and h2o |
|
| 42993. |
What is life proces |
|
Answer» These e the systems and process that sustains life The basic function perform by living organisms to live their life on the earth is called life processEX~nutrition and respiration The processes which maintain our life is called life process |
|
| 42994. |
Why iron pillar not get rust yet ????? |
|
Answer» Because it was painted with different salts Iron oxide protect iron from rusting Iron pillar got covered with iron oxide. So it is not getting rust |
|
| 42995. |
State whether a voltmeter has a high resistance or a low resistance. Give reason for your answer |
|
Answer» Because................................................... In......... Of...... .......... ...............that\'s why voltmeter has medium resistance Medium resistance Low resistence High resistance |
|
| 42996. |
Demonstrate an activity to show that chlorophyll is necessary for photosynthesis |
| Answer» | |
| 42997. |
What is the ore of iron called |
| Answer» | |
| 42998. |
Why we donot make isomers of methane , ethane, propane. |
|
Answer» Yes u r right pragya Because... Methane, Ethane,Propane do not have sufficient member to be branched..... No functional group can be attached to it in branch... |
|
| 42999. |
which compound is an ingredient of antacids? |
|
Answer» Sodium Hydrogencarbonate Nahco3 Eno |
|
| 43000. |
What is the pH value of salt |
|
Answer» 7 . Because it is made from strong acid and strong base so its pH is 7 7 |
|