Saved Bookmarks
This section includes InterviewSolutions, each offering curated multiple-choice questions to sharpen your knowledge and support exam preparation. Choose a topic below to get started.
| 36151. |
Explain the factor affecting the rate of reaction. |
| Answer» Temperature and use of catalyst . | |
| 36152. |
Mention two points of difference between pepsin and trypsin. |
|
Answer» Pepsin covert protein into peptones where as tripsin convert peptones into poly peptidesPepsin produce in gastic juice where as tripsin is from Pancreas Pepsin convert protein into poly peptides *acidic Pepdin works on acdic medium while trypsin works on basic medium? Pepsin is produced by gastric gland n trypsin is produced by pancreas? |
|
| 36153. |
How we can that Electric current is the flow of electron. |
|
Answer» Only electron flows Scientists really have not find that is there any other thing that also flow with the electrons but the only answer is this that electeon e |
|
| 36154. |
Give an example of a flower which contains both stamen and carpels |
|
Answer» Hibiscus and mustard Pea plant China rose Sunflower papaya I think |
|
| 36155. |
What is charg |
| Answer» | |
| 36156. |
Project for science |
| Answer» | |
| 36157. |
hlw everyone??? |
| Answer» | |
| 36158. |
Chemical equation for slaked lime |
|
Answer» Cao + h2o=ca+(oh)2 Ca(OH)2 |
|
| 36159. |
What is heteroatom |
| Answer» | |
| 36160. |
What happen when blue litmus solution is mixed with cooking oil |
|
Answer» It turn into red Red Turn into red |
|
| 36161. |
What colour does the sky appear to an astronaut? ?? |
| Answer» Black | |
| 36162. |
pal pal dil ke paas tm rhti ho....jeevan meethi pyaas ye kehti ho...?? |
| Answer» | |
| 36163. |
What is a turbine |
|
Answer» Book thikk se padhoo tab kisiko duffer bolna okk Wind se bhi hota hai ranjan The big blades like structure which produces electricity on turning by wind ...... Then convert mechanical to electrical energy |
|
| 36164. |
Condensation is endothermic or exothermic |
| Answer» Exothermic | |
| 36165. |
What is source of energy |
|
Answer» Any resource which we use to get energy. eg. Solar energy we use many different energy sources to do work . energy sources are classified as renewable or non renewable |
|
| 36166. |
an organic compound burns with a sooty flame . is it saturated or unsaturated hydrocarbon |
| Answer» | |
| 36167. |
What is reflecting |
| Answer» | |
| 36168. |
how can sodium be obtained from sodium chloride? |
| Answer» By electrolytic refining | |
| 36169. |
Why the size of an anion is bigger than the atom from which it is formed |
| Answer» Because no. of electrons are loses by atom in formation of anion. | |
| 36170. |
why aqueous solution of an acid conducts electricity |
|
Answer» Bcz in aq solution it breaks into ions and ions conduct electricity so aq of acid conducts electricity Sry galti se isme likh di 100 days employment guaranteed |
|
| 36171. |
What would be colour of litmus in a solution of sodium carbonate |
| Answer» Blue bcz it\'s basic | |
| 36172. |
AL+NAOH=? |
|
Answer» Sodium alumunate + hydrogen gas Na2Al2O3 + H2 |
|
| 36173. |
Kya Math me puri book ke chapter ayenge ? |
|
Answer» Nhi is bar maths nahi ayega??.... Sry just kidding... Ha full syllabus Nahi nursery class ke bhi aayenge ...wo bhi pdh lena ? |
|
| 36174. |
Name the compound responsible for the depletion of Ozone layer |
|
Answer» CFCs(chlorofluorocarbons) Methane |
|
| 36175. |
An organic compound burn with sooty flame it is saturated or unsaturated compound justify |
| Answer» it is an unsaturated compound | |
| 36176. |
What is breading system |
| Answer» | |
| 36177. |
An organic compound burns with the safety flame it is saturated or unsaturated compound justify |
| Answer» it is saturated because unsaturated compound contains non burnt carbon which gives sooty flame | |
| 36178. |
Describe how baking soda is produced on a large scale? |
| Answer» It is prepared by reaction of cold and concentrated solution of sodium chloride with ammonia and carbon dioxide .NaCl + H2O + CO2 + NH3\xa0→ NH4Cl + NaHCO3 (Baking soda)It is mild alkali. | |
| 36179. |
why an iron grill should be painted frequently . give reason . |
|
Answer» Iron reacts with moisture and oxygen present in atmosphere .This leads to corrosion.So iron should be painted frequently to prevent it from rusting. It prevents iron from direct contact to moisture etc.and prevent corrosion. To prevent from rusting |
|
| 36180. |
Why all metals not react with water? |
| Answer» | |
| 36181. |
Benzene is alkene or alkyne?what is its molecular formula? |
|
Answer» Benzene is neither a!Kane nor alkyne as benzene is aromatic hydrocarbon whereas alkene and alkyne are aliphatic hydrocarbons. Benzene is not an open chained hydrocarbon.C6H6. It\'s an alkene.Molecular formula isC6H6 |
|
| 36182. |
Bye everyone I am leaving this app ???? |
| Answer» | |
| 36183. |
Example of flower contains both stamens and carples? |
|
Answer» Hibiscus ,rose,Lily, sunflower,tulip etc China rose(hibiscus),mustard. |
|
| 36184. |
What is atom and structure |
| Answer» | |
| 36185. |
Limination of solr energy |
|
Answer» Cannot be used for frying purpose Limitation of solar energy is it can only be obtained during bthe day and it cannot be used for longer period like electrical energy.? |
|
| 36186. |
How many times was Belgium constitution amended |
|
Answer» 4times four times....between 1970 & 1993 |
|
| 36187. |
Name the compound of a solar cooker that produces a green house effect inside it. |
|
Answer» Glass sheet Doesn\'t allow to go rays outside so I also don\'t know answer but I think glass sheet so what will be the correct answer......according to u......any guess avisha I say that a compound of solar cooker No I think the infra red rays o sunlight......i think |
|
| 36188. |
What is the next homologue of C3H7OH called? |
|
Answer» C4H9OH called butanol C4H9OH called butanol C4H8OH |
|
| 36189. |
Anomalies of mendleev periodic table.Which were renamed by modern periodic law |
| Answer» 1) POSITION OF ISOTOPES :since the isotopes of the same elements have the same atomic number, they are given the same place in the table.2) POSITION OF RARE EARTHS:These elements are separately placed at the bottom of table . similarly Acton elements ( which were discovered after Mendeleev ) are also placed at the bottom of the periodic table.3) ANOMALOUS PAIRS.the arrangement according to the atomic number show that their placements are correct. | |
| 36190. |
Experiment to study esterification process of ethanol and acetic acid |
|
Answer» It is not important that you only use hydrochloric acid you use any acid catalyst. react acetic acid and ethanol in the the presence of concentrated hydrochloric solution.....ethyl ethanoate and water will be produced and ethyl ethanoate is the ester |
|
| 36191. |
What do you mean by diffusion? Plz answer me as fast as you can... |
|
Answer» The process of movement of particles form high concentration to low concentration , is knpwn as diffusion Idiot the movement of any material from higher concentration to the lower concentration is called the diffusion |
|
| 36192. |
Did Dobereiner\'s traids also exist in the column of newlands octaves? Compare and find out. |
|
Answer» Yes doberniers triads also exist in the columns of Newlands octaves. e. g. Lithium,sodium and potassium constitute a doberniers triads. Now if we consider Li as the first element then the eighth element form it is Na and if we consider Na as the first element then the eighth element form it is K. So we can say that Doberniers triad are included in the Newlands law of octaves. Yes |
|
| 36193. |
Why the trait acquired during lifetime not inherited? |
| Answer» This is because the acquired trait not present in our DNA and hence it is not inherited | |
| 36194. |
What is used for white washing...? CaO or Ca(OH)2....? |
|
Answer» As it is said "a SOLUTION of soaked lime" so maybe the ans is CaO Cao |
|
| 36195. |
Good morning gyss |
| Answer» | |
| 36196. |
Good morning ☺☺☺☺ |
| Answer» | |
| 36197. |
Exlplain the way of excreatory system. |
| Answer» | |
| 36198. |
How cam we take sample question |
| Answer» | |
| 36199. |
What is the range of human.eye |
|
Answer» Near 25cm and far point is onfinity 25 cm |
|
| 36200. |
What is angular velocity |
| Answer» Angular velocity of an object is the rate of change of its angular displacement with respect to time. The SI unit of angular velocity is radians per second. | |