This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
If cottheta+tantheta=2cosectheta, then find the general value of theta. |
|
Answer» |
|
| 2. |
Write T before each true statement and write F before each false statement. Then give the truth value of the conditionalexpressed. Water is dry implies snow is hot . |
|
Answer» |
|
| 3. |
Write T before each true statement and write F before each false statement. Then give the truth value of the continent, expressed. If monkeys climb trees, then 6 is divisible by 2 |
|
Answer» |
|
| 4. |
Write T before each true statement and write F before each false statement. Then give the truth value of the conditional expressed. If oxygen is a gas, then gold is a compound. |
|
Answer» |
|
| 5. |
Write T before each true statement and write F before each false statement. Then give the truth value of the continent, expressed. If Asia is a continent, then Delhi is in Japan. |
|
Answer» |
|
| 6. |
Find the equation of the circle passing through the points (4,1) and (6,5) and whose centre is on the line 4x+y=16 |
|
Answer» |
|
| 7. |
A,B,C,D are 4 complanar points and A:B:C:D are their projectioins on any plane. If alpha is the angle between plane of ABCD and plane of projections then ("Volume of tetrahedron AB'C'D' ")/("Volume of tetrahedronA'BCD")= |
| Answer» ANSWER :a | |
| 8. |
If A(1,0), B(0,1) and P(x,y) are points such that xygt0 and x+ylt1, then |
|
Answer» p LIES EITHER inside the triangle OAB or in the third quadrant |
|
| 9. |
AB is a vertical pole with B at the ground level and and A at the top .A man finds that the angle of elevation of the point A from a certain point C on the ground is 60^(@) . He moves away from the pole along the line BC to a point D such that CD = 7 m .From D . the angle of elevation of the point A is 45^(@) .Find the height of the pole . |
|
Answer» |
|
| 10. |
Find the mean deviation about the median for the data in 13, 17, 16, 14, 11, 13, 10, 16, 11, 18, 12, 17 |
|
Answer» |
|
| 11. |
If the pair of lines 6x^(2)-5xy-6y^(2)=0, 6x^(2)-5xy-6y^(2)+x+5y-1=0 form a square then area of square is |
|
Answer» `(1)/(3)` |
|
| 12. |
If sin^(-1)(3/x)+sin^(-1)(4/x)=(pi)/2 then x= |
|
Answer» 6 |
|
| 13. |
The value of 'c' by Rolle's Theorem for which f(x) =1-root(3)(x^(4)in [-1,1] is |
|
Answer» 0 |
|
| 14. |
Which of the following sentences are statement? Give reason for your answer: What is your name? |
|
Answer» |
|
| 15. |
If y=|cosx|+|sinx|, then (dy)/(dx)at x = (2pi)/3 is |
|
Answer» `(1-sqrt3)/2` |
|
| 16. |
Let A (5,2), B (3,-3) and C (-4,3) be the vertices of a Delta ABC Find the length of the altitude from A to BC |
| Answer» SOLUTION :`47/sqrt 85` | |
| 17. |
If [sin x] + [ sqrt(2)cos x] = -3, x in [ 0, 2pi]( [*] denotes the greatest integer function), then x belongs to |
|
Answer» `(PI, (5 pi)/(4))` |
|
| 18. |
sin((pi)/(16))sin((3pi)/(16))sin((5pi)/(16))sin((7pi)/(16))= ……….. |
|
Answer» `(1)/(16)` |
|
| 19. |
Find the centroid of the triangle whose vertices are (5,4,6),(1,-1,3) and (4, 3, 2). |
|
Answer» |
|
| 20. |
sin ""(pi)/(14).sin""(3pi)/(14).sin""(5pi)/(14).sin""(7pi)/(14).sin""(9pi)/(14).sin""(11pi)/(14).sin""(13pi)/(14)= |
|
Answer» `1//64` |
|
| 21. |
If alt0 the function e^(ax)+e^(-ax) is a monotonically decreasing function for values of 'x' given by |
| Answer» ANSWER :B | |
| 22. |
If 0 lt a lt b lt ( pi )/(2) and f(a,b) = ( tan b - tan a )/( b-a), then which of the following are not correct . |
|
Answer» `F(a,B) ge 2` |
|
| 23. |
If A(a,0), B(-a,0) and angleAPB=45^(@), then the locus of P is |
|
Answer» `X^(2)+y^(2)+2ax+a^(2)=0` |
|
| 24. |
f(x)= sin alpha + cos alpha -1, where alpha= sin^(-1) sqrt({x}), {.} is the fractional part of x, then f(x) is |
|
Answer» an EVEN function |
|
| 25. |
If the distance between the points (x,-2,-3) and (3,1,-9) is 7 units, find the values of x |
| Answer» SOLUTION :x=5 or a] | |
| 26. |
If tan^(-1)x+tan^(-1)y+tan^(-1)z=pi then x+y+z= |
|
Answer» `xy+yz+zx=1` |
|
| 27. |
The roots of the quadratic equation 4x^(2)-(5a+1)x+5a=0, are p and q. if q=1+p, calculate the possible values of a,p and q. |
|
Answer» (ii) (a) `6,-2,` (B) `p lt -2 or p GT 6,` (C) `p lt -3`. |
|
| 28. |
If Tan theta + Cot theta = 3 then Tan^(4)theta+Cot^(4)theta = |
|
Answer» 24 |
|
| 29. |
The point (4,1) undergoes the following transformations successively I. Reflection about the line y =x II. Translation through a distance 2 units in the direction of positive X-axis. III. Rotation through an angle pi/4 about origin in the anticlock wise direction. Then, the final position of the point is |
|
Answer» `(- SQRT(18), sqrt(18))` |
|
| 30. |
Write T before each true statement and write F before each false statement. Then give the truth value of the conditional expressed. Ifsqrt(5) is an integer, then 3 is an integer. |
|
Answer» |
|
| 31. |
Write T before each true statement and write F before each false statement. Then give the truth value of the conditional expressed. If a triangle is a rectangle, then a circle is a rhombus. |
|
Answer» |
|
| 32. |
Write T before each true statement and write F before each false statement. Then give the truth value of the conditional expressed. If 51 is theproduct of 17 and -3, then lions can fly in the air. |
|
Answer» |
|
| 33. |
Write T before each true statement and write F before each false statement. Then give the truth value of the conditional expressed. If 3=5, then 7 is a prime number : |
|
Answer» |
|
| 34. |
Write T before each true statement and write F before each false statement. Then give the truth value of the conditional expressed. 5x6-4=21 implies 2 (5 -: 15+3)=20/3 |
|
Answer» |
|
| 35. |
Write T before each true statement and write F before each false statement. Then give the truth value of the conditionalexpressed. Snow is cold implies water is wet |
|
Answer» |
|
| 37. |
If cos(alpha - beta) + cos(beta - gamma)+ cos(gamma-alpha)=-3/2, then |
|
Answer» `SUM COS ALPHA =0` |
|
| 39. |
Find the mean and variance for the following frequency distributions in |
|
Answer» |
|
| 40. |
Find the slope of a line perpendicular to the line whose slope is -5/(6) |
|
Answer» |
|
| 41. |
If f(x)=int_(0)^(x)e^(t^(2))(t-2)(t-3)dt for all x in(0,oo), then |
|
Answer» F has a local maximum at x=2 |
|
| 42. |
Let f(x)= x^(2)+ (1)/(x^(2)) and g(x)= x- (1)/(x), x in R -{-1, 0,1}. If h(x)= (f(x))/(g(x)) then the minimum local value of h(x) is……. |
| Answer» ANSWER :D | |
| 43. |
Assertion (A) :The value of "tan"^(-1)+"tan"^(-1)3=(3pi)/(4) Reason (R) : If x gt 0, y gt , 0, xy gt 1 then tan^(-1)x+tan^(-1)y=pi +tan^(-1)((x+y)/(1-xy)) |
|
Answer» Both A and R are TRUE and R is CORRECT EXPLANATION of A |
|
| 44. |
For all natural numbers n, statementp(n)= 1+2+3+ 4....+n = (n(n+1))/2 is truefind p(n+1) |
|
Answer» `(N(n+1))/2` `=1/2 n(n+1)` For n=1 `L.H.S =1` `R.H.S =1/2 .1 (1+1) =1/2 .1.2=1` `L.H.S. =R.H.S` Therefore p (n) is TRUE for n=1 Let P (n) is true for n=K `:. P (K) :1+2+3+….+K =1/2 K(k+1)` Adding(k+1) on both sides `1+2+3+.....+K+(K+1)` `=1/2 K(k+1) +(K+1)` `=1/2 (K+1) (K+2)` `=1/2 (K+1){(K+1)+1}` `rArr ""P (n)" is also true for" n=K +1 ` Hence by the principle of mathematical induction, GIVEN STATEMENT is true for all natural NUMBER 'n' |
|
| 45. |
The ratio between the sum of n terms of two A.P.'s is (7n + 1) : (4n+27). Find the ratio of their 11 th terms. |
|
Answer» |
|
| 46. |
If non zero numers a,b,c are in harmonic progression, the show that the equation x/a+y/b+1/c=0 represents a family of concurrent lines and find the point of concurrency. |
|
Answer» |
|
| 48. |
A ray makes angles pi//3, pi//3 with bar(OX) and bar(OY) respectively. Find the angle made by it with bar(OZ) |
|
Answer» |
|
| 49. |
If fifth term of a G.P. is 2, then the product of its first 9 terms is |
|
Answer» 256 |
|