This section includes 7 InterviewSolutions, each offering curated multiple-choice questions to sharpen your Current Affairs knowledge and support exam preparation. Choose a topic below to get started.
| 1. |
find the h c f of (865,255) using Euclid division lemma |
| Answer» | |
| 2. |
Find the HCF of 60 and 100 by using Euclid division lemma. |
|
Answer» Using Euclid's division lemma - 100 = (60× 1) + 40 60 = (40 × 1) + 20 40 = (20 × 2) + 0 Now, the remainder is 0. So, the HCF of 60 and 100 is 20 |
|
| 3. |
se Euclid division lemma to show that any positive odd integer is of the form 63or 6q +5, where q is some integers. |
|
Answer» Use Euclid's division lemma to show that any positive odd integer is of the form 6q+1,6q+3,6q+5 where q is a certain integer. Answer:-Let a be a positive odd integer a=bq+rb=6 a=6q+r, 0≤r<6. So,the possible values of r are 0,1,2,3,4,5 Set of positive odd integers are {1,3,5,7,9......}put a=1,3,5,7,9......a=bq+r1=6(0)+1=6q+1 [r=1]3=6(0)+3=6q+3 [r=3]5=6(0)+5=6q+5 [r=5]7=6(1)+1=6q+1 [r=1]9=6(1)+3=6q+3 [r=3] So,any positive integer is of the form 6q+1,6q+3,6q+5 where q is certain integer. tq |
|
| 4. |
lheseandshowthattheycanberewritten in the form 3m or 3mise Euclid' s division lemma to show that the cube of any positive integer is of th |
|
Answer» Like my answer if you find it useful |
|
| 5. |
11. Diagram of the ádjacent picthre frame has outer dimensions 24 cmx 28cmand inner dimensions 16 cm x20 cm. Find the area of each section ofthe frame, if the width of each section is same. |
| Answer» | |
| 6. |
Diagram of the adjacent picture frame has outer dimensions =24cm×28㎝and innei dimensions 16 cm× 20 cm Find the area of each section of11.the frame, if the width of each section is same |
|
Answer» thank you Didi very helpful to me |
|
| 7. |
Diagram of the adjacent picture frame has outeand inner dimensions 16 cm × 20 cm. Find the area of each section ofthe frame, if the width of each section is same. |
|
Answer» solution diagram |
|
| 8. |
4h Diagram of the adjacent picture frame has outer dimensions24 emx 28 cttand inner dimensions 16 cm x 20 cm. Find the area of each section ofthe frame, if the width of each section is same |
| Answer» | |
| 9. |
EXERCISE - 10.1the later surface area and total surface area of the following right prisms.5 cm.4 cm.6 cm.8 cm.4 cm. |
|
Answer» csa of cube=4×4×4=64cm2tsa of cube=6×(4^2)=96cm2csa of cuboid=2(lh+bh)2×(40+30)140cm2tsa of cuboid=2(lh+bh+lb)2(118)236cm2 236 cm*2 is the best answer 236 CM 2 is best answer 1) LSA of a cube: 4a^2 4*4*4 64cmTSA of a cube: 6a^2 6*4*4 96cm2) TSA of a cubiod: 2(lb+bh+hl) 2(8*6+6*5+5*8) 2(48+30+40) 2*118 236cmLSA of a cubiod: 2h(l+b) 2*5(8+6) 10*14 140cm |
|
| 10. |
2.Calculate the electric energy consumed by a 1200Wtoaster in 20 minutes.[CBSE 2009] |
|
Answer» Power P= 120 Watt Time t= 20 minutes= 20× 60 s= 1200 seconds We know that, Power P = Work W ( or Energy E)/ Time taken t Then, Energy E= Power P × Time t So, Energy E= 120 W× 1200= 144000 J or 144 KJ. |
|
| 11. |
I. The sum of any two digit number ab and the number ba by reversing its digits, is completelydivisible by: |
| Answer» | |
| 12. |
r The number of two digit numbers divisible by theproduct of the digit is1) 52) 83) 144) 33 |
| Answer» | |
| 13. |
3. Difference of two perfect cubes is 189. If the cube root of the smaller of the two numfind the cube root of the larger number.INCERT |
|
Answer» 6 is the cuberoot of larger number. 6 is the cuberoot of larger number 6 is the cube root of largest number Let, the first find the cube root of 3. I:e 27Now add 27+189=216hence the cube root of 216 is 6 6 will be the cube root of the largest no. |
|
| 14. |
The perfect cube in that case is = 10648.Example 4: Is 1188 a perfect cube? If not, by which smallest natural number should1188 be divided so that the quotient is a perfect cube? |
|
Answer» smallest natural number is 44 then it will become 1188/44 =27 and 27 is perfect cube of 3 smallest number is 44 then it will become 1188/44 = 27 and 27 is perfect cube of 3 regard |
|
| 15. |
4. What is the smallest number by which 4116 must be multiplied so that the productis a perfect cube? Find the cube root of the perfect cube so obtained. |
| Answer» | |
| 16. |
in a game there are 100 coins labelled with of the filling coin picked randomly a) the coin to be a perfect cube number b) the coin to be a two digit number divisible by 4 |
|
Answer» perfect cubes are 1,8,27,64 so probability=4/100=1/252 digit divisible by 4 12,16,..,96 so 22probability=22/100=11/50 |
|
| 17. |
Is 68600 a perfect cube? If not, find thesmallest number by which it must bemultiplied to get a perfect cube. |
|
Answer» 68600=2*2*2*5*5*7*7*7 So68600isnotaperfectcube Sowehavetomultiple5togetgetperfectcubethenwewillget343000 68600 is the correct answer 68600 is the correct ans 68600 is the correct answer of the given question 68600 is the correct answer 68600 is the right answer |
|
| 18. |
5. What is the smallest number by which 3584 must be divided so that the quotientso obtained is a perfect cube? Find the cube root of the perfect cube so obtained. |
| Answer» | |
| 19. |
Is 1188 a perfect cube? If not by which simallest rational number should 1188 bedivided so that qoutient is a perfect cube? |
| Answer» | |
| 20. |
Find the smallest number by which 16384 be divided so that the quotient may beT ake it a perfect cube?a perfect cube. |
|
Answer» The only non-perfect cube in question number 20 is 243. a On factorising 243 into prime factors, we get:243=3×3×3×3×3 On grouping the factors in triples of equal factors, we get:243={3×3×3}×3×3 It is evident that the prime factors of 243 cannot be grouped into triples of equal factors such that no factor is left over. Therefore, 243 is not a perfect cube. However, if the number is multiplied by 3, the factors can be grouped into triples of equal factors such that no factor is left over. Thus, 243 should be multiplied by 3 to make it a perfect cube. b On factorising 243 into prime factors, we get:243=3×3×3×3×3 On grouping the factors in triples of equal factors, we get:243={3×3×3}×3×3 It is evident that the prime factors of 243 cannot be grouped into triples of equal factors such that no factor is left over. Therefore, 243 is not a perfect cube. However, if the number is divided by (3×3=9), the factors can be grouped into triples of equal factors such that no factor is left over. Thus, 243 should be divided by 9 to make it a perfect cube. 16384÷4=40964096 is the cube of 16 |
|
| 21. |
Is 1863400 a perfect cube ? If not , find at least number by which it has to be divided so that the resulting number is a perfect cube |
|
Answer» prime factorization of 1863400 is (2^3×5^2×7×11^3) so to make this no a perfect cube we have to divide it by 5×5 and 7 as now 10648 will come which is cube of 22 |
|
| 22. |
Prove the trigonometric identity \frac{1}{1+\sin \theta}+\frac{1}{1-\sin \theta}=2 \sec ^{2} \theta |
|
Answer» bhai ji thanks.Scholar ho yaar ap |
|
| 23. |
Vegetative propagation |
|
Answer» Vegetative reproduction is any form of asexual reproduction occurring in plants in which a new plant grows from a fragment of the parent plant or grows from a specialized reproductive structure. Plant Propagation is the process of plant reproduction of a species or cultivar, and it can be sexual or asexual. |
|
| 24. |
Write the degree of the polynomial4z3 3z5 2z4 z + 14z3 3z5 224 z +1 |
|
Answer» The degree of a polynomial is the highest degree of its monomials with non-zero coefficients. Therefore, for polynomial-3z^5 + 2z^4 + 4z^3 + z +1Degree is 5 |
|
| 25. |
parallelogram difination |
|
Answer» In Euclidean geometry, a parallelogram is a simple quadrilateral with two pairs of parallel sides. The opposite or facing sides of a parallelogram are of equal length and the opposite angles of a parallelogram are of equal measure. Area:base × height |
|
| 26. |
Express the trigonometric ratio of sec A and tanA in terms of sin A. |
|
Answer» secA/tanA = (1/cosA)/(sinA/cosA) = 1/sinA |
|
| 27. |
trigonometric identity |
|
Answer» In mathematics, an "identity" is an equation which is always true. These can be "trivially" true, like "x=x" or usefully true, such as the Pythagorean Theorem's "a2+b2=c2" for right triangles. There are loads of trigonometric identities, but the following are the ones you're most likely to see and use. Basic and Pythagorean Identities \csc(x) = \dfrac{1}{\sin(x)}csc(x)=sin(x)1 \sin(x) = \dfrac{1}{\csc(x)}sin(x)=csc(x)1 \sec(x) = \dfrac{1}{\cos(x)}sec(x)=cos(x)1 \cos(x) = \dfrac{1}{\sec(x)}cos(x)=sec(x)1 \cot(x) = \dfrac{1}{\tan(x)} = \dfrac{\cos(x)}{\sin(x)}cot(x)=tan(x)1=sin(x)cos(x) \tan(x) = \dfrac{1}{\cot(x)} = \dfrac{\sin(x)}{\cos(x)}tan(x)=cot(x)1=cos(x)sin(x) Notice how a "co-(something)" trig ratio is always the reciprocal of some "non-co" ratio. You can use this fact to help you keep straight that cosecant goes with sine and secant goes with cosine. The following (particularly the first of the three below) are called "Pythagorean" identities. sin2(t) + cos2(t) = 1 tan2(t) + 1 = sec2(t) 1 + cot2(t) = csc2(t) Note that the three identities above all involve squaring and the number1. You can see the Pythagorean-Thereom relationship clearly if you considerthe unit circle, where the angle ist, the "opposite" side issin(t) =y,the "adjacent" side iscos(t) =x, and the hypotenuse is1. |
|
| 28. |
trigonometric function |
| Answer» | |
| 29. |
(c) Write z- i in trigonometric form. |
| Answer» | |
| 30. |
9. Find the number whose 13% is 65 |
| Answer» | |
| 31. |
polynomial of degree 3 in x has at most(a) 5 terms(c) 4 terms(b) 3 terms(d) 1 ternm |
|
Answer» 4 termsax^3+bx^3+cx+d |
|
| 32. |
(iii) xy -x-y+1 0(iv) xy-y -x+y04. At what point the origin be shifted so that the equation ? +xy-3x -y+2-0 dosnot contain any first degree term and constant terms. |
| Answer» | |
| 33. |
2.A polynomial of degree 3 in x has at most(a) 5 terms(c) 4 terms(b) 3 terms(d) 1 term |
|
Answer» b...Themean value theoremstates that p/(x) will have 3 roots. However p/(x) will have degree 2 and therefore will have at most 2 roots. So we get a contra- diction, which means p(x) cannot exist. Thus a polynomial of degree 3 has at most three real roots |
|
| 34. |
1, then let us determine the value of sn 0-2osecors express cosec θ and tan θ in t |
|
Answer» hit like if you find it useful what is the 2nd step? I can't understand I have replaced them with π/4 |
|
| 35. |
i) First degree polynorfial with pl)- I and (2)3,ig |
|
Answer» polynomial 2x-1to prove let polynomial be ax+bnowwhenx=1ax+b=1 that is a+b=1....1and when X=2ax+b=3 that is ,2a+b=3....2hence subtracting both the equation-a=-2 hence a =2put in equation 1hence b=-1hence polynomial will be 2x-1 |
|
| 36. |
Write the number of atmost terms in a polynomial of degree 6 in x. |
|
Answer» The no. of terms in a polynomial of degree 6. is 6+1 = 7 |
|
| 37. |
eXpress cot85 +cos75in terms of trigonometric ratio of angle between 0 and 45 degree |
|
Answer» cot (85°) + cos(75°) Cot 85°+Cos75° Use formula cot(90°- A)=tan(A) cos(90°- A)= sin(A) cot(90°-5°)+cos(90°-15°) tan 5° + sin 15° |
|
| 38. |
what is cyclic quadrilateral?Give short difination |
| Answer» | |
| 39. |
3*BAE.10.(i) In the given figure, wehave "I-22 and 23以4. Show that <DAC(ii) State any two axioms of Euclid |
|
Answer» Euclid axiomsonly one line can be drawn through a point parallel to another linea straight line can be drawn between any two points angle DAC = angle I + 3 and angle Bac = 2+4 . here I = 2 and 3 = 4 So give a Common name for 1 and 2 is x and for 3 and 4 is y. So I + 3 = X + Y. and 2 + 4 = X+\So both is Same |
|
| 40. |
0.20. Two equal circles of radius 10 cm each intersect each otherand the length of their common chord is 12 cm. Let us determinethe distance between the two centres of the two circles |
| Answer» | |
| 41. |
Ifthe ratio of the curved surface areas of a solid cone and a solid right circular cylinderhaving same base radii and same height is 5:8, then let us determine the ratio of their baseradii and heights. |
| Answer» | |
| 42. |
A solid right circular cylinder is made by melting a solid right circular cone. The radii ofboth are equal. If the height of the cone is 15 cm.,then let us determine the height ofthe solid cylinder |
| Answer» | |
| 43. |
- IUULUUPUU.8. Mannan Miyan observed, after 6 years of taking a loan of some money, that the interest tobe paid had become th of its principal. Let us determine the rate of simple interest inpercent per annum. |
| Answer» | |
| 44. |
State the fifth postulate of Euclid. What is the name given to it |
| Answer» | |
| 45. |
2 State the fifth postulate of Euclid. What is the name given to it |
|
Answer» Fifth postulate of Euclidgeometry: If a straight line falling on two straight lines makes the interior angles on the same side of it taken together less than two right angles, then the two straight lines, if produced indefinitely, meet on that side on which the sum of angles is less than two right angles |
|
| 46. |
four point p,q,r,and s are such that PR=QS.IS PQ=RS? justify it and also state the Euclid postulate or axiom used here |
| Answer» | |
| 47. |
4) The hydrostatic pressure 'P' of a liquid columndepends upon the density 'd', height 'h' of liquidcolumn and also an accleration 'g' due to gravity.Using dimensional analysis, derive formula forpressure P. [Ans : Phdgl. |
| Answer» | |
| 48. |
An electric heater is rated 500W how much energy does it uses in 10 hrs |
|
Answer» energy consumed= 1500*101500015kw-h |
|
| 49. |
4.On the portion of the straight line x +2y 4 intercepted between the axes, a square is construthe side of the line away from the origin. Then the point of intersection of its diagonals hasco-ordinates:3, 3(4) none |
| Answer» | |
| 50. |
Why is plaster of Paris stored in airtight container? |
|
Answer» because air contains moisture this moisture can cause the setting of plaster of Paris into hard mass gypsum. |
|