Saved Bookmarks
This section includes InterviewSolutions, each offering curated multiple-choice questions to sharpen your knowledge and support exam preparation. Choose a topic below to get started.
| 4101. |
Solve the equation |Z|=Z+1+2i |
|
Answer» CDs and DVDs and Neha will not return and delete the message to you and I have to bear with me on my way to the one who smokes weed and Shah Ravindra Ji Agarwal MK to the natural world of Warcraft customer because you are coming to an illiterate to the falling asleep on plane and Neha will not join us on Facebook tk aa jao knp to be there for you to the natural world from which date fix it is a dare to dream and the same 2 baje Jfdevv vrss to be cv |
|
| 4102. |
There should be one option for download whole chapters note. |
| Answer» | |
| 4103. |
Is together with good for reference? |
|
Answer» I am asking for maths May be I dont know....for what subject u r asking????Maths-oswaalPhy,chem,bio-all in one.....????? |
|
| 4104. |
What ks interval????and explain about the types of interval????? |
| Answer» | |
| 4105. |
If p^2+q^2=2q then the minimum value of √(p-a)^2+(a+q-4)^2 |
| Answer» | |
| 4106. |
What is the domain and range of the following1.tanx2.cotx3.cosecx4.secx |
|
Answer» DOMAIN:-1.R-{(2n+1)×π/2}. Where n is integer2.R-{(nπ)}. Where n is integer3.all real numbers4.all real numbersRANGE:-1.all real numbers2.all real numbers3.(-infinity,-1]U[1,infinity)4.(same as cosecx) Dgcdy |
|
| 4107. |
Derivation of-cos(A-B)=cosAcosB+sinAsinB |
| Answer» Easy hai ncert book ME dekho | |
| 4108. |
x^x-2^sinx |
| Answer» | |
| 4109. |
quision paper of 4 class |
| Answer» Do yo want it or what? | |
| 4110. |
Plz solve! X^3-6x^2+11x-6=0 |
| Answer» It is a class 10 question. Simply use the formulas for finding 3 zeroes | |
| 4111. |
What is the value of sine 7.5 degree? |
|
Answer» I got 491 but I don\'t know answer to this. I have got 475, but that doesn\'t mean that i am intelligent. Boards can\'t decide futures I got 465 if u got 488 in10th then u can answer it easily |
|
| 4112. |
What is Aunion B complement |
| Answer» First tell is it like (A U B)\' ???If yes then it\'s A\' intersection B\' | |
| 4113. |
If x is small enough show that 1+x/1-x is approximately equal to 1+2x |
| Answer» | |
| 4114. |
If tan (a+b)=p, tan (a-b)=q,then show that tan2a=p+q/1-pq |
| Answer» Which class | |
| 4115. |
Best reference books for pcmb tell me quickly plz i want to purchase it now itself |
|
Answer» Maths- das guptaBio and physics- H.C. vermaChemistry- pradeep Physics ki ie irodov For maths RD SharmaPhysics - pradeep or Sc vermaChemistry - pradeep or abcBio- i don\'t have any idea. |
|
| 4116. |
Hi Nancy |
| Answer» | |
| 4117. |
Which is greatest number |
| Answer» 10000................ and so on | |
| 4118. |
no one can here solve any doubt ? |
|
Answer» ☺ Wlc sis thanks for your help bro Finally solved ur all doubt... okk Wait I m trying to solve it its true Yaaa |
|
| 4119. |
Proof that sin 18 degree |
| Answer» It is very easy... | |
| 4120. |
Sina+sin2a+sin3a=1+cosa+cos2a |
| Answer» This proof is quite long and not easy to be written here soo... | |
| 4121. |
Value of sin 105° |
| Answer» (√2 + √6)/4 | |
| 4122. |
Find the equation of a locus of a point P the sum of whose distance from (0,2)(0,-2) is 6. |
| Answer» | |
| 4123. |
Friends who are perfect in the chapter |
|
Answer» No prblm Oh we are just in 1 chapter motion in a straight line Kinematics / Motion in a plane Which chapter is it Frnds, I have doubt in physic on topic projectile motion.. whenever a object is projected along x-axis and along y-axis we know that velocity along x axis is always constant and along y axis always varies..but when a moves along X and Y axis we say that object has velocity along y axis but not along x axis.. why???? Sets |
|
| 4124. |
Who is on quora? |
|
Answer» I am No one else |
|
| 4125. |
tan2x+tan3x+√3tan2xtan3x=√3 |
| Answer» | |
| 4126. |
Sin(18) |
| Answer» Sin (18°) value is √5-1/4... | |
| 4127. |
cos(A-B)+cos(B-C)+cos(C-B) =-3/2 |
| Answer» | |
| 4128. |
Lim 3x square_ x_ 10X tends to 2 divided by x square _ 4 |
| Answer» | |
| 4129. |
Formula to find modulus in 11th clasa |
| Answer» | |
| 4130. |
If |z−i|≤5 and z1=5+3i (where, i=√-1), the greatest and least values of |iz+z1| are |
| Answer» | |
| 4131. |
Find the distance of the point (3,5)from the line 2x+3y-14=0 measured parallel to the line x-2y=1 |
| Answer» | |
| 4132. |
If root X + Y = 11 and X + root Y = 7 then find the value of X and. Y with solution |
| Answer» 5 | |
| 4133. |
How many of you had given the entrace exam in pratibha for class 11th commerce side |
|
Answer» But i had given the exam in rpvv civil lines my result will come on 25th If you want to join you must apply in sec 5 ...its is new school...so you will get admission here easily....i am in 12th class I am in RPVV sector 10 |
|
| 4134. |
This subject which book is selected to teach |
|
Answer» I suggest rd Modern nd rd |
|
| 4135. |
Using the properties of sets prove that C-B is a subset of C-A , if A is a subset of B |
| Answer» | |
| 4136. |
Sin1500 |
|
Answer» Also say thanks Under root 3 upon 2 |
|
| 4137. |
Prove-Cos²2x -cos²6x =sin4xsin8x |
| Answer» Can\'t be proved here bro | |
| 4138. |
Anyone from mpc please reply friends |
|
Answer» yes Yeah |
|
| 4139. |
Formula of length of wire |
|
Answer» R u mpc What...... what was topic.. |
|
| 4140. |
For any two sets A and B prove that A intersection(A\'UB\')=(A intersection B) |
| Answer» | |
| 4141. |
Find the largest three digit no. Divisible by 12 |
| Answer» 996 | |
| 4142. |
Is class 11th cbse tough or easy |
|
Answer» Easy Okay okay... Easy Easy than 10 |
|
| 4143. |
cos minus thitaa equal to |
|
Answer» Cos(-thita)=Cos(thita) Oh yh cos theta bcoz it observes theta All are wrong ans is cos thita 1 1 1 |
|
| 4144. |
What is a sets? |
| Answer» Sets are the collections of well defined objects | |
| 4145. |
Plz give me some technique to memorise all triginometric ratio needs in class 11 |
|
Answer» Their are no any formulas to memorise anything you do practise of that. practise make man perfect |
|
| 4146. |
If A+B=C. Then what is the value of A -B |
| Answer» C-2B | |
| 4147. |
f(x)={x10-1 x2 |
| Answer» | |
| 4148. |
Evaluate: sin78°cos18°-cos78°sin 18° |
|
Answer» given equation is in the form sin A ×cos B-cosA×sin B=sin(A-B)given A=78B=18=Sin(78-18)=sin(60)=root3/2 We know that,sinA cosB - cosA sinB = sin(A-B).Here,A=78° and B=18°; therefore sin78° cos18°- cos78° sin18° = sin(78°-18°) = sin 60° =√3/2 |
|
| 4149. |
what is limit? Describe it by example |
| Answer» Definition given in the notes of this app and example- lim x+5=1+5=6. x tends to 1 | |
| 4150. |
What is cube roots of unity??? |
|
Answer» The three cube roots of unity are,1,-1/2 + i√3/2 and -1/2 - √3/2 Its very long its too much longer |
|