Saved Bookmarks
This section includes InterviewSolutions, each offering curated multiple-choice questions to sharpen your knowledge and support exam preparation. Choose a topic below to get started.
| 3751. |
Find the range of 1-|x-2| |
| Answer» | |
| 3752. |
Surds |
|
Answer» Avneet ♥️... Recognized me? ? ?? |
|
| 3753. |
Find the domain and range of a -1÷2-sin3x |
| Answer» | |
| 3754. |
Sintheta•cos^3theta - costheta•sin^3theta = 1/4 |
| Answer» | |
| 3755. |
2sinx + root 3 cosx = 1 + sinx . Find the general solution |
| Answer» | |
| 3756. |
Mod of X - 1 + Mod of X - 2 Greater than equal to 4 |
|
Answer» |x-1|+|x-2|=3/2 which is not greater or equal to then 4 No, not greater than or equal to 4. |
|
| 3757. |
22+2 |
| Answer» 24 | |
| 3758. |
Find the multiplicative inverse of 3+ i |
| Answer» The answer is 3/10 - 1/10 i | |
| 3759. |
Atea of parallelogram whose adjacent sides are -(i+2j^+3k^)and -(3i-2j^+k^) |
| Answer» | |
| 3760. |
If A+B=x and sinA=ksinB show that tanA=ksinx/1+k cosx |
| Answer» | |
| 3761. |
Write domain and range of 1) sinx 2 ) cosecx |
| Answer» Domain of sinx is R and range is [-1,1]Domain of cosecx is R-nπ and range is [-1,0)U(0,1) | |
| 3762. |
find the general solution of the equation :-1) tanA + tanB +tanC = 0 |
| Answer» | |
| 3763. |
f:R-R be such that f(x)=x2.determineRange of f |
| Answer» | |
| 3764. |
Cos4x=1-8sinsquarex cos squarex |
| Answer» | |
| 3765. |
125^x+45^x=2(27)^x How many solutions possible? |
| Answer» | |
| 3766. |
any prescribed book for arts math |
|
Answer» Element maths ? Ml aggarwal |
|
| 3767. |
a(cosC-cosB)= 2(b-c) cos^2A/2 |
| Answer» | |
| 3768. |
√sinx integration |
| Answer» Hiii | |
| 3769. |
Binomial question( yto the power2-3/y)power10 |
| Answer» | |
| 3770. |
Please Ye question bta doCod, |
|
Answer» Which question HMK98KLQ2 Are you ask referral code? |
|
| 3771. |
10power2n-1 + 1 is divisible by 11 |
| Answer» | |
| 3772. |
Find range of function,f(x):x/1+x^2 |
| Answer» The range is all real numbers. | |
| 3773. |
Lcm of 1/2 and 1/3 |
|
Answer» Actually lcm means lowest comment multiple and before 6, 1 is the lowest multiple so 1 is correct Hey shreya how can u say this 6 is the right answer yaar 1is wrong answer All of you are wrong it is 1 6 its 6 6 |
|
| 3774. |
Convert into radian x°y\'z" . |
| Answer» xyz×pie/648000 | |
| 3775. |
?will we have half syllabus in 12th??next year |
|
Answer» Yes it\'s true bt we have the chapter of 12 in class 11....like p block of chemistry yea Is it a true information? Harsh kapoor ????????? |
|
| 3776. |
By pmi,prove that (2n+7) |
| Answer» its too much long method so here it isnot possible | |
| 3777. |
Principal solution |
| Answer» The solution given by the principal | |
| 3778. |
Prove that tan70=tan20+2tan50 |
| Answer» | |
| 3779. |
If A, B, and C are 3vectors and A.B=A.C,A×B=A×C,A not equals to 0 then prove that B=C. |
| Answer» | |
| 3780. |
What do you mean by mathematics |
| Answer» Mathematics is the study of topics such as quantity,structure,space and change. | |
| 3781. |
Find a value of sin75 |
|
Answer» Due to the lack of symbols this seems quite complicated but... This is what I can do though? sin75sin(30+45)sin30cos45+ cos30sin451/2*1/2^1/2 + 3^1/2*1/2^1/2(1+3^1/2)/2*2^1/2Hope it helps? |
|
| 3782. |
Signum function |
| Answer» | |
| 3783. |
How many three digit number which are odd can be formed with no digit number repeated |
| Answer» _ _ _8*8*5 | |
| 3784. |
What is the formula for A n B n C ?? |
| Answer» n(AuBuC) - n(a)-n(b)-n(c)+n(AnB)+n(BnC)+n(AnC) | |
| 3785. |
For what value x the numbers -2/7, x, -2/7 are in gp |
| Answer» 2/7 | |
| 3786. |
What is the value of sin37° |
| Answer» 0.8 | |
| 3787. |
If sin theta = -3/5 and pie |
|
Answer» Hyyy -31/29 Aditi sharma hye u got answer of this q Sorry I repeat my q again if sin theta = -3/5 and theta is grater than pie and smaller than 3pie /2,then find the value of sec theta - cot theta / tan theta - cosec theta. Hye Hy3 |
|
| 3788. |
Find x and y if 3x+y-4i=5+(2x-3y) |
|
Answer» find the value of x and y if 3x +y-4i=5+(2x- 3y) i x=1,y=2 |
|
| 3789. |
Kya aplog v iit ka tayari kar rahe h |
|
Answer» Nope No Yes and i think there should be some preparation for iit in this app then it will be much better what\'s your opinion |
|
| 3790. |
Prove that n(n-1)(n-2).....(n-r+1)=n!/(n-r)! |
| Answer» | |
| 3791. |
What is range of one upon root x minus 5 |
|
Answer» Anyone friend Hey guys Happy frienship day in advance.....???? |
|
| 3792. |
{1,2}=a then wath is a×a×a |
| Answer» A×A= {1,2} × {1,2}A×A= { (1,1),(1,2),(2,1),(2,2) }A×A×A= { (1,1),(1,2),(2,1),(2,2) } × {1,2}A×A×A= { (1,1,1),(1,1,2),(1,2,1),(1,2,2),(2,1,1),(2,1,2),(2,2,1),(2,2,2) } | |
| 3793. |
Cos²x+cos²(x+π/3)+cos²(x-π/3) |
| Answer» | |
| 3794. |
hlo everyone anyone know about hacking because i want help |
|
Answer» ara mera account hack hua hai isliya bol rahi hu Hacking ke chakkar me mat pad jail Jaane ki naubat aa sakti Hai. Tu marne Tak jail me rahega.Marne ke baad bhi kisiko pata nahi chalega. Wahi pe decompose ho jayega aur vahi pe gaadh Diya jaayega. Ok |
|
| 3795. |
Proof : cos 3 theta = 4 cos cube theta - 3 cos theta |
| Answer» Use formula of cos(A+B+C) | |
| 3796. |
A crocodile is known to have 68 teeths the total no. Of crocodiles with different sets of teeth are |
| Answer» 1 | |
| 3797. |
(1-SinA-cosA)^2=2(1-sinA)(1-cosA) |
|
Answer» yrr yahan per sab whatsup no. aur fb id hi kyu maangte h Who is this What\'app no. Do to answer send karta hun |
|
| 3798. |
Prove that Cos6x=2cos²3x-1 |
|
Answer» Cos6x=cos2(3x)(Cos2x=2cos²x-1)Similarly cos2(3x)=2cos²3x-1 hence prove abee oyee adarsh gali hame bhi aati h lekin itne mental nahi ki kahin pr bhi bak de Bhai iss Adarsh mein to bilkul bhi ADARSH nahi h iss khate h irony in english Adarsh jwale apni gand m aag lagale Kutte kamine kyu ghussa dila Diya. Trigonometry dekhate hi mujhe bhayankar gussa Aata Hai. Man toh kar Raha Hai Tera murdur kardu. Bhosdi Ka saala Yaha trigonometry nahi aati aur gaandu sawaal puch raaha Hai Saala |
|
| 3799. |
What is the adject value of π |
|
Answer» 180 this is the right 180 Last vala galat hai 21/7 , 3.14 , - 80 Hey |
|
| 3800. |
If sinA=3/5 and π/2 |
| Answer» | |