Saved Bookmarks
This section includes InterviewSolutions, each offering curated multiple-choice questions to sharpen your knowledge and support exam preparation. Choose a topic below to get started.
| 5501. |
Integral calculadora samjh nahi aata |
| Answer» | |
| 5502. |
The coff. Of the (r-1) . |
|
Answer» 1 Can I help you |
|
| 5503. |
CosecA+secA=cosecB+secB then prove that tanA. tanB=cotA+B/2 |
| Answer» cosecA+secA=cosecB+secBcos\u2061ecA+sec\u2061A=cos\u2061ecB+sec\u2061B=> cosecA−cosecB=secA−secBcos\u2061ecA−cos\u2061ecB=sec\u2061A−sec\u2061B=> 1sinA−1sinB=1cosA−1cosB1sin\u2061A−1sin\u2061B=1cos\u2061A−1cos\u2061B=> sinB−sinAsinA.sinB=cosB−cosAcosA.cosBsin\u2061B−sin\u2061Asin\u2061A.sin\u2061B=cos\u2061B−cos\u2061Acos\u2061A.cosB=> 2sinB−A2cosB+A2sinA.sinB=2sinB−A2sinB+A2cosA.cosB2sin\u2061B−A2cos\u2061B+A2sin\u2061A.sin\u2061B=2sin\u2061B−A2sin\u2061B+A2cos\u2061A.cosB=> cosB+A2sinB+A2=sinA.sinBcosA.cosBcos\u2061B+A2sin\u2061B+A2=sin\u2061A.sin\u2061Bcos\u2061A.cosB=> cotB+A2=tanA.tanBcot\u2061B+A2=tan\u2061A.tan\u2061B=> tanA.tanB=cotB+A2 | |
| 5504. |
If a,b,c are in A.P. then prove a²(b+c) , b²(c+a) , c²(a+b) are also in A.P. |
| Answer» 2b=a+c put | |
| 5505. |
Derive standard formula of ellipse |
| Answer» | |
| 5506. |
What is a real function |
| Answer» | |
| 5507. |
A= {x:x is a prime factor of prime no.}Express in roster form. |
| Answer» | |
| 5508. |
A={x:t3=t , t is real no.}Express in roster form |
| Answer» | |
| 5509. |
Why 1/0 =infinity |
| Answer» Bcoz anything upon zero is always infinity. Never ever a number will come in table of zero | |
| 5510. |
Lim x tends to 1 x^3-3x+1\\x-1 |
| Answer» 1^3 -3*1+1\\1-1=1-3+1\\0=infinity | |
| 5511. |
Find tge area bounded between ellips |
| Answer» | |
| 5512. |
Derivative of √tan x by first principle |
| Answer» | |
| 5513. |
Lines are concurrent what does it mean? What is the condition for lines to be concurrent?? |
| Answer» If there lines are intersect to each other at one point then the lines are called concurrent lines For ex-medians of a triangle is intersect at one point called centroid | |
| 5514. |
What is locus of complex number ? |
| Answer» | |
| 5515. |
If 31st July 1993 was Friday then what will be the day on 31st June 2001? |
|
Answer» ?? Ques-if on 31 july 1993 it was Friday so wht will on 31 july 2001?Firstly in 2000 we will find no. Of odd days 2000÷4=500 as it is totally divisble so no. Of odd days will be zeroIn case of 2001 no.if odd days=2001÷4=500.25 so there will be odd days,so in 2001 we will count down like-jan =31,feb=28,march=31;april=30,may=31,june=30!and July =31 now 31+28+31+30+31+30+31=212 now we will divide it by no.of weeks =212÷7= in this case 2 will be reminder thus,sunday=0,Monday =1,Tuesday =2 and so on......................so Tuesday will be corct answer Yes sister ..u r right?? Pehli baat to ye ki june mei 30 days hote hain 31 nhi Hyyy it will Tuesday not monday Monday |
|
| 5516. |
If nC8 =nC2 find nC2 |
| Answer» 45 | |
| 5517. |
Solve:- sin2x+sinx+cosx |
| Answer» | |
| 5518. |
According to dictionary CRICKET come on which rank (permutations and combination |
| Answer» 530 | |
| 5519. |
Cos10cos50cos60cos70=3/16 |
| Answer» | |
| 5520. |
First principle of derivative |
|
Answer» F(x)\'=dy/dx f(x+h)-f(x)/hh=0 dy/dx=f(x+h)- f(x)÷h |
|
| 5521. |
Derivation for lnx/x |
| Answer» 2.303 | |
| 5522. |
3^x+3^3-x-12÷3^3-x-3^x/2 |
| Answer» | |
| 5523. |
Sin^4x/a +sin^4x/b = 1/ a+b then show that sin^8x/a^3 +sin^8x/b^3 = 1/(a+b)^3 |
| Answer» | |
| 5524. |
What is anti log and how to find log |
| Answer» | |
| 5525. |
Since CCE pattern is removed, is SA1 is added to the final exams? |
| Answer» | |
| 5526. |
Convert into a form of product [email\xa0protected][email\xa0protected] |
| Answer» | |
| 5527. |
What is the 51th word if "AGAIN" is set into dictionary? |
| Answer» | |
| 5528. |
a power 7 ab power 6 |
| Answer» | |
| 5529. |
How can we derive xsinx by first principle? |
|
Answer» Who hy |
|
| 5530. |
Evaluate limit lim tan(x+h)÷h -tanxh-0 |
| Answer» | |
| 5531. |
(A+ b)2 |
| Answer» A2+b2+2ab | |
| 5532. |
A =( x,y): x×x×x + y×y = 25 where x, y are whole number |
| Answer» | |
| 5533. |
cos theta + sin theta = 2^1÷2 cos theta prove that cos theta - sin theta = 2^1÷2 sin theta |
| Answer» | |
| 5534. |
Name the z axis?? |
| Answer» | |
| 5535. |
Their is a infinity numbers? Prove? |
| Answer» | |
| 5536. |
Find the eqn of a circle whose center is (1,2)and passes through the point(4,6) |
| Answer» (x-1)^2+(y-2)^2=25 | |
| 5537. |
50 degree angle constructed by compass will valid or not? |
| Answer» The angle divisible by 15 can be construed by compass.SO NOT 50. | |
| 5538. |
Differentiation of log a to the base e |
| Answer» | |
| 5539. |
Does the point (_2.5,3.5)lie inside,outside or on the circle x*x+y*y=25? |
| Answer» Inside | |
| 5540. |
Cos55°+cos65°+cos175°=0 |
| Answer» | |
| 5541. |
Tan power -1 x + tan power -1y = tan power -1 (x+y divided with (1+xy) |
| Answer» | |
| 5542. |
Dy/dx =xtanx/secx+tanx |
| Answer» Phale sin cos me change karna hai phir formula laguna hai quotient rule | |
| 5543. |
2-3iota into1+iota |
| Answer» 2-3iota×1+iota2+2iota-3iota-3iota square2+3-iota5-iota is the answer | |
| 5544. |
Sin38°+sin22°=sin82 |
|
Answer» HELLO DEAR,sin38° + sin22° = sin82°Now,from , L.H.S,sin38° + sin22° = 2sin(38 + 22)/2 * cos(38 - 22)/2 ∴ [ sinA + sinB = 2sin(A + B)/2 * cos(A - B)/2 ]⇒2sin(60/2) * cos(16/2)⇒2sin30° * cos8°⇒2 * 1/2 * cos8° ∴ [ sin30° = 1/2 ]⇒ 2̶ * 1/ 2̶ * cos8°⇒cos8°we know that:-cos(90 - Ф) = sinФnow using here,we get,cos8° = cos(90 - 82)°⇒sin82°hence,sin38° + sin22° = sin82° Lhs sin38+sin22=2sin(38+22)/2. cos(38-22)/2=2sin30cos8=cos8=cos(90-8)=sin82 |
|
| 5545. |
Derivative of xcosx by 1sr principle |
|
Answer» Using formula product rule and solve them cosx-xsinx I need derivative from 1st principle...... Okk Cosx-xsinx IF YOU LIKED THE ANSWER PLEASE REPLY |
|
| 5546. |
Power set of (a,b,c) |
| Answer» | |
| 5547. |
Find the 6th and nth terms of GP 2,6,18,54 |
| Answer» The 6th tERM of GP is 486 and nth term is 2×3^n | |
| 5548. |
Parapollea |
| Answer» | |
| 5549. |
What comes next in the series 0.49,0.49,0.98,2.94..... |
| Answer» 11.76 | |
| 5550. |
What is gradient |
| Answer» | |